DEL0017318MA - - Google Patents
Info
- Publication number
- DEL0017318MA DEL0017318MA DEL0017318MA DE L0017318M A DEL0017318M A DE L0017318MA DE L0017318M A DEL0017318M A DE L0017318MA
- Authority
- DE
- Germany
- Prior art keywords
- hydrofluoric acid
- diazonium
- boiling
- fluoronitrobenzenes
- nitroaniline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 22
- 239000012954 diazonium Substances 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 150000004812 organic fluorine compounds Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- 238000009835 boiling Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 2
- ICMFHHGKLRTCBM-UHFFFAOYSA-N 4-nitrobenzenediazonium Chemical compound [O-][N+](=O)C1=CC=C([N+]#N)C=C1 ICMFHHGKLRTCBM-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- KMRSVJOEUGWWBX-UHFFFAOYSA-M 2-nitrobenzenediazonium;chloride Chemical compound [Cl-].[O-][N+](=O)C1=CC=CC=C1[N+]#N KMRSVJOEUGWWBX-UHFFFAOYSA-M 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEL0017318MA (cg-RX-API-DMAC7.html) | ||
| DE69803252T2 (de) | Verfahren zur Herstellung eines polyhydrischen Alkohols | |
| DE960456C (de) | Verfahren zur Herstellung von Fluornitrobenzolen | |
| DE69707825T2 (de) | Verfahren zur Herstellung von alicyclischen Hydrazin-derivaten. | |
| DE1965782A1 (de) | Verbessertes Verfahren zur Herstellung von aromatischen Trifluormethylverbindungen der Benzolreihe | |
| DE3836917A1 (de) | Verfahren zur herstellung von cyclopropylamin | |
| DE711709C (de) | Verfahren zur Herstellung von Tetrahydrofuran | |
| DE665792C (de) | Verfahren zur Herstellung von Diaethylaminoaethanol | |
| DE69104782T2 (de) | Verfahren zur Herstellung von ungesättigten Bromiden. | |
| DE3105446A1 (de) | Verfahren zur herstellung von araliphatischen aldehyden und/oder aminen | |
| DE69600519T2 (de) | Verfahren zur Herstellung von tertiär Butyl-Hydrozin-Halogenid | |
| DE650380C (de) | Verfahren zur Darstellung von Morpholin bzw. 2, 6-Dimethylmorpholin | |
| DE247271C (cg-RX-API-DMAC7.html) | ||
| DE268340C (cg-RX-API-DMAC7.html) | ||
| DE2306335C3 (de) | Verfahren zur Herstellung von Dichloracetaldehyd | |
| DE590432C (de) | Verfahren zur Herstellung von Additionsverbindungen der unterchlorigen oder unterbroigen Saeure mit organischen Verbindungen | |
| DE949569C (de) | Verfahren zur Herstellung von Aminoalkoholen | |
| DE501178C (de) | Verfahren zur Herstellung von Kaliummagnesiumkarbonat (Engelschem Salz) unter Druck | |
| DE1194839B (de) | Verfahren zur Herstellung von p-Nitroacetophenonoxim | |
| DE922167C (de) | Verfahren zur Herstellung von Cyclohexylidencyclohexanonen | |
| DE209418C (cg-RX-API-DMAC7.html) | ||
| DE1808389C3 (de) | Verfahren zur Herstellung von Resorcin durch Säurehydrolyse von m-Phenylendiamin | |
| DE1240087B (de) | Verfahren zur Herstellung von omega-Aminododecansaeure | |
| DE848649C (de) | Verfahren zur Herstellung von Acetalen aliphatischer ª,ª-acetylenischer Aldehyde | |
| DEF0017351MA (cg-RX-API-DMAC7.html) |