DEF0012795MA - - Google Patents
Info
- Publication number
- DEF0012795MA DEF0012795MA DEF0012795MA DE F0012795M A DEF0012795M A DE F0012795MA DE F0012795M A DEF0012795M A DE F0012795MA
- Authority
- DE
- Germany
- Prior art keywords
- cultures
- culture
- flask
- ecm
- steroid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000003431 steroids Chemical class 0.000 claims description 16
- 241000235546 Rhizopus stolonifer Species 0.000 claims description 9
- 240000008042 Zea mays Species 0.000 claims description 9
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims description 9
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 9
- 235000005822 corn Nutrition 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000000284 extract Substances 0.000 claims description 7
- 235000015097 nutrients Nutrition 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 238000011534 incubation Methods 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 239000003415 peat Substances 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 238000007865 diluting Methods 0.000 claims description 3
- 238000010790 dilution Methods 0.000 claims description 3
- 239000012895 dilution Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 2
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims 1
- 239000001569 carbon dioxide Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 8
- 238000000855 fermentation Methods 0.000 description 6
- 230000004151 fermentation Effects 0.000 description 6
- 229960003387 progesterone Drugs 0.000 description 6
- 239000000186 progesterone Substances 0.000 description 6
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 4
- 235000019796 monopotassium phosphate Nutrition 0.000 description 4
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 239000001888 Peptone Substances 0.000 description 2
- 108010080698 Peptones Proteins 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000003463 adsorbent Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000012531 culture fluid Substances 0.000 description 2
- 239000008121 dextrose Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 235000019319 peptone Nutrition 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WHBHBVVOGNECLV-OBQKJFGGSA-N 11-deoxycortisol Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 WHBHBVVOGNECLV-OBQKJFGGSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000000944 Soxhlet extraction Methods 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 235000021049 nutrient content Nutrition 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2757826C2 (de) | Verfahren zur Durchführung von biochemischen Reaktionen mit Hilfe von Mikroorganismen | |
| DE1768215B2 (de) | Verfahren zur Herstellung von 1,4-Androstadien-3,17-dion und 4-Androsten-3,17-dfon durch mikrobiologischem Abbau | |
| DE2446638B2 (de) | Biologisches Verfahren zur Entfernung von Chromaten und Bichromaten aus Industrieabwässern | |
| CH341493A (de) | Verfahren zur Racematspaltung | |
| DE956953C (de) | Verfahren zur biologischen Oxydation von Steroiden | |
| DEF0012795MA (enrdf_load_stackoverflow) | ||
| EP0014991A1 (de) | Mikrobiologisches Verfahren zur Herstellung 7-alpha-hydroxylierter Steroide | |
| DE1593035C3 (de) | Verfahren zur Herstellung von aliphatischen Aldehyden oder aliphatischen Carbonsäuren durch enzymatische Oxydation | |
| DE1070176B (de) | Verfahren zur Herstellung neuer Steroidverbindungen der 1, 4 - Pregnadienreihe | |
| CH385204A (de) | Verfahren zur Herstellung von Steroidverbindungen | |
| DE936207C (de) | Verfahren zur Herstellung von oxydierten Steroiden | |
| AT248630B (de) | Verfahren zur Herstellung von Hydrocortison | |
| AT206389B (de) | Verfahren zur Herstellung von Azotobakterpräparaten zur Bodenbakterisierung bzw. als Futtermittel | |
| AT212498B (de) | Verfahren zur mikrobiologischen Oxydation von Steroiden | |
| DE1568932C (de) | Verfahren zur Herstellung von 1,4-Androstadien-3,17-dion und 4-Androsten-3,17dion durch mikrobiologischen Abbau | |
| DE1107225B (de) | Verfahren zur Herstellung von 1, 4, 17(20)-Pregnatrienen | |
| DE1593035B2 (de) | Verfahren zur Herstellung von aliphatischen Aldehyden oder aliphatischen Carbonsäuren durch enzymatische Oxydation | |
| DE1092906B (de) | Verfahren zur Herstellung von 12a-Hydroxylverbindungen der Tetracyclinreihe | |
| DE1036254B (de) | Verfahren zur Racematspaltung | |
| DE1062699B (de) | Verfahren zur 11-Hydroxylierung von Steroidverbindungen | |
| DE1124945B (de) | Verfahren zur Herstellung von 9ª‡-Oxysteroiden der Pregnanreihe | |
| DE1188594B (de) | Verfahren zur Herstellung von Hydrocortison und/oder Prednisolon | |
| CH364504A (de) | Verfahren zur Aufspaltung von d,l-Steroiden | |
| DE1081457B (de) | Verfahren zur Herstellung von 11ª‰-Hydroxysteroiden der Pregnanreihe | |
| EP0014971A1 (de) | Verfahren zur Herstellung von 1-alpha-Hydroxydehydroepiandrosteron |