DEF0011677MA - - Google Patents
Info
- Publication number
- DEF0011677MA DEF0011677MA DEF0011677MA DE F0011677M A DEF0011677M A DE F0011677MA DE F0011677M A DEF0011677M A DE F0011677MA
- Authority
- DE
- Germany
- Prior art keywords
- groups
- glycols
- linear
- aliphatic
- polyester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920000728 polyester Polymers 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 150000002334 glycols Chemical class 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000005442 diisocyanate group Chemical group 0.000 claims description 9
- 150000007824 aliphatic compounds Chemical class 0.000 claims description 7
- -1 aliphatic dicarboxylic acids Chemical class 0.000 claims description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 5
- 239000012948 isocyanate Substances 0.000 claims description 5
- 229920003023 plastic Polymers 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 5
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 4
- 150000002513 isocyanates Chemical class 0.000 claims description 4
- 239000000155 melt Substances 0.000 claims description 4
- 125000005521 carbonamide group Chemical group 0.000 claims description 3
- 238000004132 cross linking Methods 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 2
- 239000001361 adipic acid Substances 0.000 claims description 2
- 235000011037 adipic acid Nutrition 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 239000007859 condensation product Substances 0.000 claims 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims 1
- 230000000630 rising effect Effects 0.000 claims 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 11
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- YTXSTJBFRDSIPJ-UHFFFAOYSA-N ethyl carbamate tetradecane-1,14-diol Chemical compound NC(=O)OCC.NC(=O)OCC.C(CCCCCCCCCCCCCO)O YTXSTJBFRDSIPJ-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69722500T2 (de) | Carbodiimide enthaltende Polyurethanharze | |
| DE2019432B2 (de) | Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen | |
| DE1174759B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur | |
| DE1069379B (de) | Verfahren zur Herstellung homogener Kunststoffe auf Grundlage Urethangrup'pen und gegebenenfalls auch Thioärhergruppen aufweisender Polyglykoläther | |
| DE1932832B2 (de) | 2,4-bis(4-aminocyclohexylmethyl) cyclohexylamin, 2,4-bis(4-isocyanatcyclohexylmethyl)cyclohexylisocyanat und dessen verwendung zur herstellung von polyurethanen | |
| DE3782076T2 (de) | Verwendung von polymerpolyaminen fuer die herstellung von polyurethan/polyharnstoffen oder polyharnstoffen. | |
| DE1114318B (de) | Verfahren zur Herstellung von vernetzten homogenen Elastomeren | |
| DD236539A5 (de) | Verwendung und herstellung von substituierten p,p'-methylen-bis-anilinen | |
| DE2604657A1 (de) | Haerter fuer polyurethan-reaktionsgemische | |
| DE1057334B (de) | Verfahren zur Herstellung von stickstoffhaltigen polymeren Verbindungen | |
| DE1122254B (de) | Verfahren zur Herstellung von primaere Amino- und Harnstoffgruppen aufweisenden hoehermolekularen Verbindungen | |
| DE1028772B (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe | |
| DE961572C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe | |
| DE2436017C2 (de) | Verfahren zur Herstellung von Polyharnstoffen | |
| DEF0011677MA (enExample) | ||
| DE1114633B (de) | Verfahren zur Herstellung hochmolekularer, elastischer, vernetzter Kunststoffe auf Grundlage von Polyesterurethanen | |
| DE933783C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe | |
| EP0452775B1 (de) | Thermoplastische Polyurethan-Polyharnstoff-Elastomere mit erhöhtem Wärmestand | |
| DE2107678A1 (de) | Verfahren zur Herstellung von vernetzten hochelastischen Kunststoffen | |
| DE1694169A1 (de) | Verfahren zur Herstellung von vernetzten Polyurethanelastomeren | |
| DE962112C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe aus linearen oder vorwiegend linearen, groesstenteils aus aliphatischen Dicarbonsaeuren und Glykolen aufgebauten Polyestern, organischen Diisocyanaten und Glykolen | |
| DE1570599C3 (de) | Verfahren zur Herstellung hochmolekularer elastischer Polyurethane unter Formgebung. An9: Bayer AG, 5090 Leverkusen | |
| DE1147034B (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe auf Polyurethanbasis | |
| DE953116C (de) | Verfahren zur Herstellung von Formkoerpern durch Umsetzung von linearen, vorwiegend aus aliphatischen Komponenten aufgebauten Polyestern | |
| DE1769869C3 (de) | Verfahren zur Herstellung von hochmolekularen vernetzten Polyurethanen |