DEF0011665MA - - Google Patents
Info
- Publication number
- DEF0011665MA DEF0011665MA DEF0011665MA DE F0011665M A DEF0011665M A DE F0011665MA DE F0011665M A DEF0011665M A DE F0011665MA
- Authority
- DE
- Germany
- Prior art keywords
- glycols
- polyester
- groups
- linear
- glycol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002334 glycols Chemical class 0.000 claims description 19
- 229920000728 polyester Polymers 0.000 claims description 15
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 10
- 125000005442 diisocyanate group Chemical group 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- -1 aliphatic dicarboxylic acids Chemical class 0.000 claims description 7
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- 239000004033 plastic Substances 0.000 claims description 4
- 229920003023 plastic Polymers 0.000 claims description 4
- 238000004132 cross linking Methods 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000007493 shaping process Methods 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 239000007859 condensation product Substances 0.000 claims 1
- 125000001302 tertiary amino group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 12
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 8
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 239000001361 adipic acid Substances 0.000 description 4
- 235000011037 adipic acid Nutrition 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 230000000979 retarding effect Effects 0.000 description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000009293 tertiary effect Effects 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1114632B (de) | Verfahren zur Herstellung von Kunststoff-Formkoerpern oder Schaumstoffen auf Grundlage von Polyesterurethanen | |
| DE1966923A1 (de) | Verfahren zur herstellung von polyurethanen | |
| DE1668811A1 (de) | Laktonadditionsprodukte | |
| EP0022452A1 (de) | Anstrichmittel auf Basis eines Polyurethan-Prepolymers und eines Polyesterharzes, Verfahren zu seiner Herstellung und seine Verwendung zum Ăberziehen von metallischen Oberflächen | |
| DE3782076T2 (de) | Verwendung von polymerpolyaminen fuer die herstellung von polyurethan/polyharnstoffen oder polyharnstoffen. | |
| DE1932832B2 (de) | 2,4-bis(4-aminocyclohexylmethyl) cyclohexylamin, 2,4-bis(4-isocyanatcyclohexylmethyl)cyclohexylisocyanat und dessen verwendung zur herstellung von polyurethanen | |
| DE2604657A1 (de) | Haerter fuer polyurethan-reaktionsgemische | |
| DE2359613A1 (de) | Fluessige, loesungsmittelfreie, aromatische carboxyl- und/oder carboxylatgruppen aufweisende polyisocyanate | |
| DE962112C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe aus linearen oder vorwiegend linearen, groesstenteils aus aliphatischen Dicarbonsaeuren und Glykolen aufgebauten Polyestern, organischen Diisocyanaten und Glykolen | |
| DE2521841B1 (de) | Verfahren zum Abdichten und Ausfuellen von Fugen und zum Beschichten von Oberflaechen | |
| DE1595012A1 (de) | OElloesliche Diisocyanataddukte | |
| DE965359C (de) | Verfahren zur Herstellung vernetzter kautschukartiger Polykondensate aus diisocyanatmodifizierten Polyestern | |
| DEF0011665MA (cg-RX-API-DMAC7.html) | ||
| DE963104C (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe im wesentlichen aus linearen oder vorwiegend linearen, ueberwiegend Hydroxyl-Endgruppen enthaltenden Polyestern und organischen Diisocyanaten | |
| DE955995C (de) | Verfahren zur Herstellung von hochmolekularen, fuer Vernetzungsreaktionen geeigneten linearen Polyadditionsprodukten | |
| DE961572C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe | |
| DE1067209B (de) | Verfahren zur Herstellung von Urethangruppen enthaltenden Schaumstoffen | |
| DE1518464A1 (de) | Verfahren zur Herstellung von Polyisocyanatmassen | |
| DE1151113B (de) | Verfahren zur Herstellung von, gegebenenfalls verschaeumten, Polyurethan-Kunststoffen | |
| DE2107678A1 (de) | Verfahren zur Herstellung von vernetzten hochelastischen Kunststoffen | |
| DE959679C (de) | Verfahren zur Herstellung lagerfaehiger, mit Diisocyanaten zu kautschukelastischen Formkoerpern verarbeitbarer Kunststoffe aus Polyestern, Glykolen und Diisocyanaten | |
| DE951887C (de) | Verfahren zur Herstellung vernetzter hochelastischer Produkte aus im wesentlichen linearen hydroxylgruppenhaltigen Polyestern und Diisocyanaten | |
| DEF0017426MA (cg-RX-API-DMAC7.html) | ||
| DE962935C (de) | Verfahren zur Herstellung von hochporoesen Leichtstoffen | |
| DE933783C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe |