DEC0009869MA - - Google Patents
Info
- Publication number
- DEC0009869MA DEC0009869MA DEC0009869MA DE C0009869M A DEC0009869M A DE C0009869MA DE C0009869M A DEC0009869M A DE C0009869MA
- Authority
- DE
- Germany
- Prior art keywords
- vol
- group
- dihydrazino
- pyrimidines
- hydrazine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 4
- QCAWOHUJKPKOMD-UHFFFAOYSA-N 4,6-diamino-1h-pyrimidine-2-thione Chemical class NC1=CC(N)=NC(S)=N1 QCAWOHUJKPKOMD-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- UXXJXQUBPSPZKL-UHFFFAOYSA-N 2,6-dihydrazinylpyrimidin-4-amine Chemical compound NNC1=CC(N)=NC(NN)=N1 UXXJXQUBPSPZKL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- JTTIOYHBNXDJOD-UHFFFAOYSA-N 2,4,6-triaminopyrimidine Chemical compound NC1=CC(N)=NC(N)=N1 JTTIOYHBNXDJOD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KRHMEUCUJPZUHD-UHFFFAOYSA-N (2,6-dihydrazinylpyrimidin-4-yl)hydrazine Chemical compound NNC1=CC(NN)=NC(NN)=N1 KRHMEUCUJPZUHD-UHFFFAOYSA-N 0.000 description 1
- HMURPXRHBUNCNW-UHFFFAOYSA-N (2-hydrazinyl-6-methylpyrimidin-4-yl)hydrazine Chemical compound CC1=CC(NN)=NC(NN)=N1 HMURPXRHBUNCNW-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- -1 alkyl mercaptopyrimidine compounds Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940125717 barbiturate Drugs 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- QDGHXQFTWKRQTG-UHFFFAOYSA-N pyrimidin-2-ylhydrazine Chemical class NNC1=NC=CC=N1 QDGHXQFTWKRQTG-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 230000008673 vomiting Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2139526A1 (enExample) | ||
| DE2029707A1 (de) | Anti-Viruspräparate und deren Verwendung | |
| CH625252A5 (enExample) | ||
| CH380734A (de) | Verfahren zur Herstellung von neuen s-Triazinderivaten | |
| DE1445186B2 (de) | 3,3'-Di-2-imidazolin-2-yl-carbanilid | |
| DEC0009869MA (enExample) | ||
| DE962165C (de) | Verfahren zur Herstellung von Dihydrazino-amino-pyrimidinen | |
| DE3323316A1 (de) | Bis-(2,2-dimethyl-1-aziridinyl)-phosphinsaeure -amide, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2505703A1 (de) | Verfahren zur substitution von chloratomen des cyanurchlorids (b) | |
| DE2738498B2 (de) | l-(2-Chloräthyl)-l-nitroso-3-<2- acetamido-2desoxy- ß -D-glucopyranosyl)- harnstoffe, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1139494B (de) | Verfahren zur Herstellung von phosphorhaltigen Thioharnstoffen | |
| DE1642334A1 (de) | Herbicide Mittel | |
| DE3041812A1 (de) | Basisch substituierte 5-phenyltetrazole, verfahren zu ihrer herstellung und ihre verwendung als heilmittel | |
| DE833959C (de) | Verfahren zur Herstellung von chemotherapeutisch wertvollen Biguanidderivaten | |
| DD142653A5 (de) | Herstellungsmethode eines szintillographischen mittels | |
| DE2511022C3 (de) | N-(3,3-Diphenylpropyl)-N' -benzylpiperazine | |
| DE1233406B (de) | Verfahren zur Herstellung von 4, 6, 7-Triaminopteridinen | |
| AT265308B (de) | Verfahren zur Herstellung von N-Benzyl-N',N"-dimethylguanidin oder seinen Säureadditionssalzen | |
| DD290189A5 (de) | Verbessertes verfahren zur herstellung von 2-benzimidazol-carbaminsaeuremethylester | |
| DE1693036C3 (de) | Biguanide, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE1100637B (de) | Verfahren zur Herstellung von Alkyleniminoalkylguanidinen, deren Acylverbindungen, Salzen und quaternaeren Ammoniumverbindungen | |
| AT212330B (de) | Verfahren zur Herstellung von neuen, antidiabetisch wirksamen Biguanidderivaten | |
| DD146595A1 (de) | Verfahren zur herstellung von 1.3-di-acylamino-2-imino-4-aryl-delta hoch 4-imidazolinen | |
| DE1153758B (de) | Verfahren zur Herstellung von Tetrahydroisochinolinderivaten | |
| DE1545844A1 (de) | Verfahren zur Herstellung von N-substituierten 3-Aminobenzisothiazolen |