DEC0007863MA - - Google Patents
Info
- Publication number
- DEC0007863MA DEC0007863MA DEC0007863MA DE C0007863M A DEC0007863M A DE C0007863MA DE C0007863M A DEC0007863M A DE C0007863MA
- Authority
- DE
- Germany
- Prior art keywords
- water
- compounds
- ecm
- theobromine
- salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000003839 salts Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229940030600 antihypertensive agent Drugs 0.000 claims description 3
- 239000002220 antihypertensive agent Substances 0.000 claims description 3
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- YAPQBXQYLJRXSA-UHFFFAOYSA-N theobromine Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- NHAXKHSVJBVINX-UHFFFAOYSA-N 3,7-dimethylpurine-2,6-dione;sodium Chemical compound [Na].CN1C(=O)NC(=O)C2=C1N=CN2C NHAXKHSVJBVINX-UHFFFAOYSA-N 0.000 description 2
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229960004559 theobromine Drugs 0.000 description 2
- LDYNUEHTWBORQU-UHFFFAOYSA-N (1-hydrazinylpyrido[3,4-d]pyridazin-4-yl)hydrazine Chemical compound N1=CC=C2C(NN)=NN=C(NN)C2=C1 LDYNUEHTWBORQU-UHFFFAOYSA-N 0.000 description 1
- XYMXHHBGFSPUSJ-UHFFFAOYSA-N (5-hydrazinylpyrido[2,3-d]pyridazin-8-yl)hydrazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=N1 XYMXHHBGFSPUSJ-UHFFFAOYSA-N 0.000 description 1
- IHJVDPWMLXFQAI-UHFFFAOYSA-N 1,3-dimethyl-7h-purine-2,6-dione;sodium Chemical compound [Na].O=C1N(C)C(=O)N(C)C2=C1NC=N2 IHJVDPWMLXFQAI-UHFFFAOYSA-N 0.000 description 1
- GEPVMDINFCTKRV-UHFFFAOYSA-N 8,8-dimethyl-3H-purine-2,6-dione Chemical class CC1(N=C2NC(NC(C2=N1)=O)=O)C GEPVMDINFCTKRV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229960002877 dihydralazine Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- -1 theobromine dihydrazinophthalazine compound Chemical class 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1162841B (de) | Verfahren zur Herstellung von Dihydro-1, 3, 5-dithiazinverbindungen | |
| DE1240846B (de) | Verfahren zur Herstellung von Sulfamiden | |
| DEC0007863MA (en)) | ||
| DE1795344A1 (de) | 3-Amino-isothiazole | |
| DE2534962B2 (de) | cis-3,4-Ureylenthiophan-l,1-dioxid und Verfahren zu seiner Herstellung | |
| DE1032258B (de) | Verfahren zur Herstellung von in 5-Stellung mono- und disubstituierten 1-Aryl-hydantoinen | |
| DE2310334A1 (de) | Verfahren zur herstellung von teilweise neuen 4,6-dichlorpyrazolo-(3,4-d)-pyrimidinderivaten | |
| CH513180A (de) | Verfahren zur Herstellung antidiabetisch wirksamer Sulfonamide | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| DE948976C (de) | Verfahren zur Herstellung von blutdrucksenkenden Mitteln | |
| EP0006151B1 (de) | Verfahren zur Herstellung von 17-Hydroxyspartein | |
| AT323154B (de) | Verfahren zur herstellung von neuen 5-methoxy-2-methylindol-3-essigsäurederivaten sowie von deren salzen | |
| DE1249260B (de) | Verfahren zur Herstellung von N'-sübstituierten N-(Amidosulfonyl)-sulfonsäureamiden | |
| DE864555C (de) | Verfahren zur Herstellung von 2, 4-Diamino-5-aryloxypyrimidinen | |
| DE2218248C3 (de) | Picolinsäure-dithiocarbamate | |
| DE1670598C3 (de) | Neue Cephalosporine und Verfahren zu ihrer Herstellung | |
| AT265286B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| DEF0017332MA (en)) | ||
| AT216671B (de) | Verfahren zur Herstellung von Verbindungen verschiedener Penicilline mit Sulfonamiden | |
| DE2125544C3 (de) | 2H, 4H-U.4 Tnazin-33-dione | |
| DE1067030B (de) | Verfahren zur Her stellung von 4,6 disubsütuierten 1-Pyra zolo (3 4-d) pynmidmen | |
| DE1695402C3 (de) | Verfahren zur Herstellung von Bis- eckige Klammer auf 3-hydroxy-4hydroxymethyl-2-methyl-pyridyl-(5)methyl eckige Klammer zu -disulfid | |
| DE1067028B (en)) | ||
| DE1206914B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1224316B (de) | Verfahren zur Herstellung von 2-Methyl-3-(o-aethylphenyl)-4-oxo-3, 4-dihydrochinazolin und dessen Salzen |