DEC0004975MA - - Google Patents
Info
- Publication number
- DEC0004975MA DEC0004975MA DEC0004975MA DE C0004975M A DEC0004975M A DE C0004975MA DE C0004975M A DEC0004975M A DE C0004975MA
- Authority
- DE
- Germany
- Prior art keywords
- acrylonitrile
- percent
- weight
- polymers
- vinylimidazole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920000642 polymer Polymers 0.000 claims description 20
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 239000000178 monomer Substances 0.000 claims description 12
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 7
- 239000000835 fiber Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 12
- 229920002239 polyacrylonitrile Polymers 0.000 description 8
- -1 alkyl methacrylates Chemical class 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 229920002006 poly(N-vinylimidazole) polymer Polymers 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 description 2
- 239000000980 acid dye Substances 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 125000005250 alkyl acrylate group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical class O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- DZLUPKIRNOCKJB-UHFFFAOYSA-N 2-methoxy-n,n-dimethylacetamide Chemical compound COCC(=O)N(C)C DZLUPKIRNOCKJB-UHFFFAOYSA-N 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 238000000578 dry spinning Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical class ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920001567 vinyl ester resin Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000002166 wet spinning Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE965527C (de) | Spinnbare Masse fuer die Herstellung anfaerbbarer Fasern | |
| DE920206C (de) | Verfahren zur Herstellung von formbaren Massen auf der Grundlage von Acrylsaeurenitrilpolymerisaten | |
| DE873746C (de) | Verfahren zur Herstellung von Kunstharzen aus Vinylchlorid | |
| DE1066022B (de) | Verfahren zur Herstellung von Acryl nitrilmischporymeren | |
| EP0590460B1 (de) | Hochkonzentrierte wässrige Poly(acrylnitril)-Emulsionen und Verfahren zu ihrer Herstellung | |
| DE1469821A1 (de) | Homogen optisch aufgehellte makromolekulare organische Stoffe und Verfahren zur Herstellung optischer Aufheller | |
| DE1279889B (de) | Verfahren zur Herstellung von Fasern oder Faeden auf der Grundlage von ueberwiegend Acrylnitrilpolymerisate enthaltenden Massen | |
| DEC0004975MA (enExample) | ||
| DE1569153A1 (de) | Acrylnitrilvinylidenchlorid-Mischpolymerisate | |
| DE1221009B (de) | Thermoplastisch verarbeitbare Formmasse | |
| DE1494668A1 (de) | Verfahren zur Herstellung von anfaerbbaren Acrylnitrilpolymerisatfasern oder -faeden | |
| DE2624081A1 (de) | Verfahren zur herstellung flammfester acrylharzfasern | |
| DE1544873C2 (de) | Thermoplatische Polymerisatmischung | |
| DE1569147A1 (de) | Form-,Press- oder UEberzugsmassen auf der Basis von Acrylnitrilpolymerisaten | |
| DE1017785B (de) | Kunststoffmassen fuer Formkoerper auf der Grundlage von Polyvinylchlorid | |
| DE2260993C3 (de) | Farbbare Massen auf der Grundlage von Polyolefinen | |
| DE1213613B (de) | Verfahren zur Herstellung von Acrylnitrilpfropfpolymerisaten | |
| DE914306C (de) | Gemisch zur Herstellung anfaerbbarer Faeden oder Fasern | |
| DE1254286B (de) | Verfahren zum Herstellen von Fasern oder Faeden aus modifiziertem Polypropylen | |
| DE1234028B (de) | Verfahren zur Herstellung von direkt verspinn-baren Polyacrylnitrilmischpolymerisatloesungen | |
| DE2402957A1 (de) | Stabilisierung halogenhaltiger acrylnitrilpolymerer | |
| DE2043402C3 (de) | Fasern und Fäden aus chlorhaltigen Modacrylpolymerisaten mit verbesserter Flammfestigkeit | |
| DE1770754A1 (de) | Herstellung von Polyamiden mit besonderen Eigenschaften | |
| DE1218733B (de) | Verfahren zur Herstellung von Acrylnitrilmischpolymerisaten | |
| CH364111A (de) | Verfahren zur Herstellung von Lösungen von Acrylnitril-Vinylpyridin-Kopolymeren in organischen Lösungsmitteln |