DEB0026574MA - - Google Patents
Info
- Publication number
- DEB0026574MA DEB0026574MA DEB0026574MA DE B0026574M A DEB0026574M A DE B0026574MA DE B0026574M A DEB0026574M A DE B0026574MA
- Authority
- DE
- Germany
- Prior art keywords
- aqueous
- cobalt
- olefins
- cobalt salt
- synthesis gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000001336 alkenes Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 11
- 239000000243 solution Substances 0.000 claims description 11
- 230000015572 biosynthetic process Effects 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 10
- 239000007789 gas Substances 0.000 claims description 10
- 238000003786 synthesis reaction Methods 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 150000001868 cobalt Chemical class 0.000 claims description 9
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 7
- 239000012266 salt solution Substances 0.000 claims description 6
- 239000008346 aqueous phase Substances 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims 1
- 229910002091 carbon monoxide Inorganic materials 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000010941 cobalt Substances 0.000 description 11
- 229910017052 cobalt Inorganic materials 0.000 description 11
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229940011182 cobalt acetate Drugs 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- FXHGMKSSBGDXIY-UHFFFAOYSA-N heptanal Chemical compound CCCCCCC=O FXHGMKSSBGDXIY-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- GYHFUZHODSMOHU-UHFFFAOYSA-N nonanal Chemical compound CCCCCCCCC=O GYHFUZHODSMOHU-UHFFFAOYSA-N 0.000 description 2
- -1 olefin hydrocarbons Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1204624B1 (de) | Kontinuierliches verfahren zur hydroformylierung von olefinen mit 6 bis 20 kohlenstoffatomen | |
| DE2139630C3 (de) | Verfahren zur Herstellung von vorwiegend geradkettigen Aldehyden | |
| EP2220017B1 (de) | Mehrstufiges kontinuierliches verfahren zur hydroformylierung von höheren olefinen oder olefingemischen | |
| DE19957522A1 (de) | Verfahren zur katalytischen Durchführung von Aldolkondensationen mittels Mehrphasenreaktion | |
| EP1231198B1 (de) | Hydroformylierung | |
| DE102009027978A1 (de) | Verfahren zur Herstellung von Decancarbonsäuren | |
| DE102008007080A1 (de) | Verfahren zur Herstellung von C9-Alkohol aus C8-Olefinen | |
| DE69936137T2 (de) | Verfahren zur herstellung von essigsäure | |
| DE3035404C2 (de) | Verfahren zur Herstellung ungesättigter Kohlenwasserstoffe | |
| EP0017051A1 (de) | Verfahren zur Herstellung von Alkylestern gesättigter aliphatischer Carbonsäuren | |
| EP2925714A1 (de) | Verfahren zur katalytischen aldolkondensation von aldehyden | |
| DE849548C (de) | Verfahren zur Herstellung von sauerstoffhaltigen Verbindungen | |
| EP3301084B1 (de) | Kontinuierliches herstellungsverfahren für 2-methylenalkanale | |
| DEB0026574MA (enExample) | ||
| DE3022025A1 (de) | Verfahren zur hydroformylierung von olefinen | |
| DE946621C (de) | Verfahren zur Herstellung sauerstoffhaltiger organischer Verbindungen | |
| EP3077358B1 (de) | Verfahren zur herstellung von 2-methylbutanal aus den bei der herstellung von gemischen isomerer a, -ungesättigter decenale anfallenden nebenströmen | |
| DE975064C (de) | Verfahren zur Herstellung von Alkoholen | |
| EP3077357B1 (de) | Verfahren zur herstellung von 2-methylbuttersäure mit einem vermindertem gehalt an 3-methylbuttersäure aus den bei der herstellung von pentansäuren anfallenden nebenströmen | |
| DE102013020323B3 (de) | Verfahren zur Herstellung von isomeren Hexansäuren aus den bei der Herstellung von Pentanalen anfallenden Nebenströmen | |
| DE949737C (de) | Verfahren zur kontinuierlichen Ausfuehrung der Oxosynthese | |
| DE974482C (de) | Verfahren zur Herstellung von Alkoholen | |
| DE975040C (de) | Verfahren zur Regulierung der Reaktionstemperatur bei der kontinuierlichen Herstellung sauerstoffhaltiger organischer Verbindungen | |
| DE10045056A1 (de) | Verfahren zur kontinuierlichen Hydroformylierung von Polyalkenen mit 30 bis 700 Kohlenstoffatomen | |
| DE975189C (de) | Verfahren zur Herstellung sauerstoffhaltiger organischer Verbindungen durch die Oxo-Synthese |