DE97863A - - Google Patents
Info
- Publication number
- DE97863A DE97863A DE97863A DE 97863 A DE97863 A DE 97863A DE 97863 A DE97863 A DE 97863A
- Authority
- DE
- Germany
- Prior art keywords
- incandescent
- impregnation
- silicon
- incandescent body
- bodies
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 16
- 238000005470 impregnation Methods 0.000 claims description 8
- 239000000377 silicon dioxide Substances 0.000 claims description 8
- 150000003377 silicon compounds Chemical class 0.000 claims description 7
- 235000012239 silicon dioxide Nutrition 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims 1
- 239000002956 ash Substances 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 2
- -1 alkyl compounds Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 235000002918 Fraxinus excelsior Nutrition 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- RTCGUJFWSLMVSH-UHFFFAOYSA-N chloroform;silicon Chemical compound [Si].ClC(Cl)Cl RTCGUJFWSLMVSH-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Family
ID=
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE913401C (de) * | 1953-04-10 | 1954-06-14 | Fritz Graetz | Verfahren zum Vergueten von Gluehkoerpern |
| DE950723C (de) * | 1953-06-23 | 1956-10-18 | Wolfhard Graetz | Verfahren zur Verguetung von Gluehkoerpern fuer Leuchtgeraete |
| DE962421C (de) * | 1953-04-17 | 1957-04-25 | Wolfhard Graetz | Verfahren zur Herstellung vergueteter Gluehkoerper fuer mit Gas oder fluessigem Brennstoff betriebene Leuchten |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE913401C (de) * | 1953-04-10 | 1954-06-14 | Fritz Graetz | Verfahren zum Vergueten von Gluehkoerpern |
| DE962421C (de) * | 1953-04-17 | 1957-04-25 | Wolfhard Graetz | Verfahren zur Herstellung vergueteter Gluehkoerper fuer mit Gas oder fluessigem Brennstoff betriebene Leuchten |
| DE950723C (de) * | 1953-06-23 | 1956-10-18 | Wolfhard Graetz | Verfahren zur Verguetung von Gluehkoerpern fuer Leuchtgeraete |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE97863A (enExample) | ||
| DE158928C (enExample) | ||
| DE579885C (de) | Fuellmaterial fuer Tuerme, Gaswaescher, Kolonnen o. dgl. | |
| DE148177C (enExample) | ||
| DE327864C (de) | Verfahren zur Herstellung von Feueranzuendern aus brennbaren Stoffen unter Zusatz eines leicht brennbaren Fuellstoffes und von Schwefel | |
| DE405749C (de) | Brandmasse fuer Druckgaserzeugung | |
| DE134222C (enExample) | ||
| DE477660C (de) | Verfahren zur Entwicklung schwefliger Saeure behufs Bekaempfung von Schaedlingen | |
| DE158258C (enExample) | ||
| DE297884C (enExample) | ||
| DE69030C (de) | Verfahren zur Herstellung von krystallinischer Thonerde | |
| AT130648B (de) | Verfahren zur Herstellung eines Zusatzes für Mörtel oder Beton. | |
| AT159122B (de) | Zündstab zum wiederholten Entzünden und Auslöschen. | |
| DE422672C (de) | Verfahren zur Herstellung von Siegellackkerzen | |
| DE3205594A1 (de) | Verfahren zur herstellung eines zusatzstoffes zur verbesserung fluessiger kraftstoffe oder als heizmittelersatz | |
| DE525284C (de) | Herstellung von Wasserstoff aus Kohlenoxyd oder kohlenoxydhaltigen Gasen | |
| DE2235426C3 (de) | Verfahren zur Behandlung von Stickoxiden enthaltenden Abgasen | |
| DE919426C (de) | Verfahren zur Nassbehandlung von Verbrennungsrueckstaenden aus Dampfkesselanlagen | |
| DE606067C (de) | Verfahren zur Herstellung poroeser Koerper, wie Ziegel o. dgl. | |
| DE358514C (de) | Fester Gluehkoerper und Verfahren zu seiner Herstellung | |
| DE962146C (de) | Verfahren zum Brennen von Dolomit zur Herstellung von Sorelzement od. dgl. | |
| AT106604B (de) | Leuchtsatz, insbesondere für photographische Zwecke. | |
| DE444861C (de) | Verarbeitung der Sulfate des Bariums und Strontiums | |
| DE577996C (de) | Verfahren zur Herstellung von Zuendhoelzern | |
| DE920008C (de) | Heizmittel |