DE929350C - Verfahren zur Herstellung halbleitenden Materials - Google Patents
Verfahren zur Herstellung halbleitenden MaterialsInfo
- Publication number
- DE929350C DE929350C DEN5546A DEN0005546A DE929350C DE 929350 C DE929350 C DE 929350C DE N5546 A DEN5546 A DE N5546A DE N0005546 A DEN0005546 A DE N0005546A DE 929350 C DE929350 C DE 929350C
- Authority
- DE
- Germany
- Prior art keywords
- tio
- bao
- air
- starting material
- percent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 8
- 239000004065 semiconductor Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 239000000203 mixture Substances 0.000 claims description 12
- 239000007858 starting material Substances 0.000 claims description 11
- 238000005245 sintering Methods 0.000 claims description 8
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 5
- 150000002910 rare earth metals Chemical class 0.000 claims description 5
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 claims description 4
- 229910002113 barium titanate Inorganic materials 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- 229910052727 yttrium Inorganic materials 0.000 claims description 3
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004327 boric acid Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 2
- 238000007493 shaping process Methods 0.000 claims description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- 229910052726 zirconium Inorganic materials 0.000 claims 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 37
- 229910004298 SiO 2 Inorganic materials 0.000 description 7
- 239000000654 additive Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000000996 additive effect Effects 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910006404 SnO 2 Inorganic materials 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910052691 Erbium Inorganic materials 0.000 description 1
- 229910052688 Gadolinium Inorganic materials 0.000 description 1
- 229910005793 GeO 2 Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- 150000001622 bismuth compounds Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/01—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics
- C04B35/46—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on titanium oxides or titanates
- C04B35/462—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on titanium oxides or titanates based on titanates
- C04B35/465—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on titanium oxides or titanates based on titanates based on alkaline earth metal titanates
- C04B35/468—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on titanium oxides or titanates based on titanates based on alkaline earth metal titanates based on barium titanates
- C04B35/4682—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products based on oxide ceramics based on titanium oxides or titanates based on titanates based on alkaline earth metal titanates based on barium titanates based on BaTiO3 perovskite phase
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/022—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient mainly consisting of non-metallic substances
- H01C7/023—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient mainly consisting of non-metallic substances containing oxides or oxidic compounds, e.g. ferrites
- H01C7/025—Perovskites, e.g. titanates
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Ceramic Engineering (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Manufacturing & Machinery (AREA)
- Structural Engineering (AREA)
- Organic Chemistry (AREA)
- Compositions Of Oxide Ceramics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL319001X | 1951-05-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE929350C true DE929350C (de) | 1955-06-23 |
Family
ID=19783910
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN5546A Expired DE929350C (de) | 1951-05-23 | 1952-05-21 | Verfahren zur Herstellung halbleitenden Materials |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE511613A (enExample) |
| CH (1) | CH319001A (enExample) |
| DE (1) | DE929350C (enExample) |
| FR (1) | FR1066126A (enExample) |
| GB (1) | GB714965A (enExample) |
| NL (1) | NL84015C (enExample) |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1140628B (de) * | 1957-07-15 | 1962-12-06 | Siemens Ag | Halbleiterwiderstand mit positivem Temperaturkoeffizienten und Verfahren zu seiner Herstellung |
| DE1147699B (de) * | 1955-06-15 | 1963-04-25 | Dr Carl Schusterius | Heizelement fuer Waermegeraete |
| DE1149648B (de) * | 1961-06-16 | 1963-05-30 | Bosch Gmbh Robert | Impulsgeber fuer elektrische Signalanlagen, wie Blinklichtanlagen, insbesondere zur Fahrtrichtungsanzeige von Kraftfahrzeugen |
| DE1182131B (de) * | 1962-05-09 | 1964-11-19 | Matsushita Electric Ind Co Ltd | Ferroelektrischer keramischer Halbleiter |
| DE1261602B (de) * | 1959-04-24 | 1968-02-22 | Int Standard Electric Corp | Verfahren zum Herstellen von elektrischen Kondensatoren oder Gleichrichtern oder aehnlichen elektrischen Bauelementen mit einem Koerper aus keramischem Material hoher DK |
| DE1286242B (de) * | 1958-07-22 | 1969-01-02 | Siemens Ag | Elektrisch beheiztes Geraet, das zur selbsttaetigen Temperaturregelung mit einem elektrischen Widerstandselement mit positivem Temperaturkoeffizienten versehen ist |
| DE1288686B (de) * | 1964-01-31 | 1969-02-06 | Int Standard Electric Corp | Verfahren zur Erstellung eines keramischen Kondensators |
| US3444101A (en) * | 1964-08-19 | 1969-05-13 | Telefunken Patent | Barium titanate compositions containing cerium and bismuth |
| DE1415406B1 (de) * | 1958-04-30 | 1970-08-20 | Siemens Ag | Keramischer Widerstand mit hohem positiven Temperaturkoeffizienten seines Gesamtwiderstandswertes |
| DE2349485A1 (de) * | 1972-10-10 | 1974-04-25 | Texas Instruments Inc | Heizvorrichtung |
| DE2510322A1 (de) * | 1975-02-11 | 1976-08-19 | Bbc Brown Boveri & Cie | Kaltleiter-bauelement |
| DE2552127A1 (de) * | 1975-08-08 | 1977-02-10 | Tdk Electronics Co Ltd | Keramikhalbleiter |
| DE2809449A1 (de) * | 1977-03-07 | 1978-09-14 | Tdk Electronics Co Ltd | Heizelement |
| DE3917570A1 (de) * | 1989-05-30 | 1990-12-06 | Siemens Ag | Elektrisches keramisches bauelement, insbesondere kaltleiter, mit hoher elektrischer ueberschlagsfestigkeit im elektrodenfreien bereich und verfahren zu seiner herstellung |
| US5837164A (en) * | 1996-10-08 | 1998-11-17 | Therm-O-Disc, Incorporated | High temperature PTC device comprising a conductive polymer composition |
| US5985182A (en) * | 1996-10-08 | 1999-11-16 | Therm-O-Disc, Incorporated | High temperature PTC device and conductive polymer composition |
| US6074576A (en) * | 1998-03-24 | 2000-06-13 | Therm-O-Disc, Incorporated | Conductive polymer materials for high voltage PTC devices |
| DE102008036835A1 (de) * | 2008-08-07 | 2010-02-18 | Epcos Ag | Heizungsvorrichtung und Verfahren zur Herstellung der Heizungsvorrichtung |
| US9321689B2 (en) | 2008-08-07 | 2016-04-26 | Epcos Ag | Molded object, heating device and method for producing a molded object |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2976505A (en) * | 1958-02-24 | 1961-03-21 | Westinghouse Electric Corp | Thermistors |
| US3044968A (en) * | 1958-05-13 | 1962-07-17 | Westinghouse Electric Corp | Positive temperature coefficient thermistor materials |
| US3211595A (en) * | 1959-11-02 | 1965-10-12 | Hughes Aircraft Co | P-type alloy bonding of semiconductors using a boron-gold alloy |
| US2981699A (en) * | 1959-12-28 | 1961-04-25 | Westinghouse Electric Corp | Positive temperature coefficient thermistor materials |
| DE1239416B (de) * | 1960-04-26 | 1967-04-27 | Siemens Electrogeraete Ges Mit | Elektrischer Durchlauferhitzer mit Heizwiderstand aus Keramik |
| US3116262A (en) * | 1961-05-19 | 1963-12-31 | Gen Electric | Ceramic composition |
| US3299332A (en) * | 1961-07-10 | 1967-01-17 | Murata Manufacturing Co | Semiconductive capacitor and the method of manufacturing the same |
| US3458363A (en) * | 1962-09-11 | 1969-07-29 | Teledyne Inc | Thermoelectric device comprising an oxide base thermoelectric element |
| US3231522A (en) * | 1963-09-26 | 1966-01-25 | American Radiator & Standard | Thermistor |
| US3277020A (en) * | 1963-12-19 | 1966-10-04 | Int Resistance Co | Glass composition and electrical resistance material made therefrom |
| US3359133A (en) * | 1964-04-06 | 1967-12-19 | American Lava Corp | Ceramic dielectrics |
| US3351568A (en) * | 1964-04-13 | 1967-11-07 | Texas Instruments Inc | Production of solid state ptc sensors |
| US3292062A (en) * | 1964-06-01 | 1966-12-13 | Bell Telephone Labor Inc | Method for preparing stabilized barium titanate, and capacitor |
| DE1490659B2 (de) * | 1964-09-17 | 1972-01-13 | Siemens AG, 1000 Berlin u. 8000 München | Gesinterter elektrischer kaltleiterwiderstandskoerper und verfahren zu seiner herstellung |
| US3373120A (en) * | 1965-12-02 | 1968-03-12 | Matsushita Electric Industrial Co Ltd | Semiconductive ceramic compositions with positive temperature coefficient of resistance |
| US3426250A (en) * | 1966-08-01 | 1969-02-04 | Sprague Electric Co | Controlled reduction and reoxidation of batio3 capacitors and resulting capacitor |
| JPS5410110B2 (enExample) * | 1974-03-20 | 1979-05-01 | ||
| JPS551684B2 (enExample) * | 1974-09-25 | 1980-01-16 | ||
| JP5099011B2 (ja) * | 2006-09-28 | 2012-12-12 | 株式会社村田製作所 | チタン酸バリウム系半導体磁器組成物とそれを用いたptc素子 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB579868A (en) * | 1944-03-15 | 1946-08-19 | Taylor Tunnicliff And Company | An improved dielectric composition |
| GB625516A (en) * | 1947-08-06 | 1949-06-29 | Jack Woodcock | Improvements in or relating to ceramic dielectrics comprising essentially titania |
-
0
- BE BE511613D patent/BE511613A/xx unknown
- NL NL84015D patent/NL84015C/xx active
-
1952
- 1952-05-20 GB GB12720/52A patent/GB714965A/en not_active Expired
- 1952-05-21 FR FR1066126D patent/FR1066126A/fr not_active Expired
- 1952-05-21 DE DEN5546A patent/DE929350C/de not_active Expired
- 1952-05-21 CH CH319001D patent/CH319001A/de unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB579868A (en) * | 1944-03-15 | 1946-08-19 | Taylor Tunnicliff And Company | An improved dielectric composition |
| GB625516A (en) * | 1947-08-06 | 1949-06-29 | Jack Woodcock | Improvements in or relating to ceramic dielectrics comprising essentially titania |
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1147699B (de) * | 1955-06-15 | 1963-04-25 | Dr Carl Schusterius | Heizelement fuer Waermegeraete |
| DE1140628B (de) * | 1957-07-15 | 1962-12-06 | Siemens Ag | Halbleiterwiderstand mit positivem Temperaturkoeffizienten und Verfahren zu seiner Herstellung |
| DE1415406B1 (de) * | 1958-04-30 | 1970-08-20 | Siemens Ag | Keramischer Widerstand mit hohem positiven Temperaturkoeffizienten seines Gesamtwiderstandswertes |
| DE1286242B (de) * | 1958-07-22 | 1969-01-02 | Siemens Ag | Elektrisch beheiztes Geraet, das zur selbsttaetigen Temperaturregelung mit einem elektrischen Widerstandselement mit positivem Temperaturkoeffizienten versehen ist |
| DE1261602B (de) * | 1959-04-24 | 1968-02-22 | Int Standard Electric Corp | Verfahren zum Herstellen von elektrischen Kondensatoren oder Gleichrichtern oder aehnlichen elektrischen Bauelementen mit einem Koerper aus keramischem Material hoher DK |
| DE1149648B (de) * | 1961-06-16 | 1963-05-30 | Bosch Gmbh Robert | Impulsgeber fuer elektrische Signalanlagen, wie Blinklichtanlagen, insbesondere zur Fahrtrichtungsanzeige von Kraftfahrzeugen |
| DE1182131B (de) * | 1962-05-09 | 1964-11-19 | Matsushita Electric Ind Co Ltd | Ferroelektrischer keramischer Halbleiter |
| DE1288686B (de) * | 1964-01-31 | 1969-02-06 | Int Standard Electric Corp | Verfahren zur Erstellung eines keramischen Kondensators |
| US3444101A (en) * | 1964-08-19 | 1969-05-13 | Telefunken Patent | Barium titanate compositions containing cerium and bismuth |
| DE2349485A1 (de) * | 1972-10-10 | 1974-04-25 | Texas Instruments Inc | Heizvorrichtung |
| DE2510322A1 (de) * | 1975-02-11 | 1976-08-19 | Bbc Brown Boveri & Cie | Kaltleiter-bauelement |
| DE2552127A1 (de) * | 1975-08-08 | 1977-02-10 | Tdk Electronics Co Ltd | Keramikhalbleiter |
| DE2809449A1 (de) * | 1977-03-07 | 1978-09-14 | Tdk Electronics Co Ltd | Heizelement |
| US4245146A (en) * | 1977-03-07 | 1981-01-13 | Tdk Electronics Company Limited | Heating element made of PTC ceramic material |
| DE3917570A1 (de) * | 1989-05-30 | 1990-12-06 | Siemens Ag | Elektrisches keramisches bauelement, insbesondere kaltleiter, mit hoher elektrischer ueberschlagsfestigkeit im elektrodenfreien bereich und verfahren zu seiner herstellung |
| US5837164A (en) * | 1996-10-08 | 1998-11-17 | Therm-O-Disc, Incorporated | High temperature PTC device comprising a conductive polymer composition |
| US5985182A (en) * | 1996-10-08 | 1999-11-16 | Therm-O-Disc, Incorporated | High temperature PTC device and conductive polymer composition |
| US6074576A (en) * | 1998-03-24 | 2000-06-13 | Therm-O-Disc, Incorporated | Conductive polymer materials for high voltage PTC devices |
| DE102008036835A1 (de) * | 2008-08-07 | 2010-02-18 | Epcos Ag | Heizungsvorrichtung und Verfahren zur Herstellung der Heizungsvorrichtung |
| US9321689B2 (en) | 2008-08-07 | 2016-04-26 | Epcos Ag | Molded object, heating device and method for producing a molded object |
| US9363851B2 (en) | 2008-08-07 | 2016-06-07 | Epcos Ag | Heating device and method for manufacturing the heating device |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1066126A (fr) | 1954-06-02 |
| CH319001A (de) | 1957-01-31 |
| BE511613A (enExample) | |
| NL84015C (enExample) | |
| GB714965A (en) | 1954-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE929350C (de) | Verfahren zur Herstellung halbleitenden Materials | |
| DE2904276C3 (de) | Keramische Materialien aus Bariumtitanat-Homologen | |
| DE2800495A1 (de) | Nichtlinearer widerstand | |
| DE2932914C2 (de) | Hochfeste Tonerdeporzellanmasse für elektrische Isolatoren | |
| DE2631035B2 (de) | Feinteiliges Pulver aus einer Bleititanat/Blei Magnesium-Wolframat-Zusammensetzung und seine Verwendung | |
| DE2849293C2 (enExample) | ||
| DE1080465B (de) | Metall-keramischer Koerper | |
| DE3011977C2 (enExample) | ||
| DE112012000207B4 (de) | Piezokeramische Zusammensetzung | |
| DE4127829A1 (de) | Niedrig sinternde pzt-versaetze | |
| DE1113407B (de) | Verfahren zur Herstellung eines keramischen, dielektrischen Materials | |
| DE69613928T2 (de) | Piezoelektrische Keramik und Verfahren zu ihrer Herstellung | |
| DE3730821C2 (de) | Keramische Zusammensetzung mit hoher Dielektrizitätskonstante | |
| DE3106136A1 (de) | Verfahren zur herstellung polykristalliner keramischer kaltleiterkoerper | |
| DE1280121B (de) | Verfahren zur wahlweisen Herstellung eines keramischen Dielektriums oder eines Halbleiterwiderstandes mit positivem Temperaturkoeffizienten | |
| DE112023002813T5 (de) | Temperatursensorelement und Temperatursensor | |
| DE1244038B (de) | Verfahren zur Herstellung von halbkristallinen keramischen Koerpern mit hoher Dielektrizitaetskonstante | |
| DE2225731A1 (de) | Pulverzusammensetzung und ihre An Wendung | |
| DE1182131B (de) | Ferroelektrischer keramischer Halbleiter | |
| DE1300860B (de) | Verfahren zur Verminderung der Verluste eines ferromagnetischen Mangan-Zink-Ferrits | |
| CH318037A (de) | Elektrischer Widerstandskörper und Verfahren zu dessen Herstellung | |
| US2705204A (en) | Ceramic dielectric materials | |
| DE1646750C3 (de) | Halbleitende Keramikmassen mit positi vem Temperaturkoefftzienten des Widerstan | |
| DE980100C (de) | Keramische Koerper mit hoher Dielektrizitaetskonstante und Verfahren zur Herstellung dieser Koerper | |
| DE2037348B2 (de) | Dielektrisches keramikmaterial |