DE904778C - Fernsehempfaenger fuer die UEbertragung farbiger Bilder - Google Patents
Fernsehempfaenger fuer die UEbertragung farbiger BilderInfo
- Publication number
- DE904778C DE904778C DER3721A DER0003721A DE904778C DE 904778 C DE904778 C DE 904778C DE R3721 A DER3721 A DE R3721A DE R0003721 A DER0003721 A DE R0003721A DE 904778 C DE904778 C DE 904778C
- Authority
- DE
- Germany
- Prior art keywords
- frequency
- distributor
- image
- signal
- green
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005540 biological transmission Effects 0.000 title claims description 8
- 239000002131 composite material Substances 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 2
- 239000003086 colorant Substances 0.000 claims 2
- 239000003292 glue Substances 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 230000000694 effects Effects 0.000 description 8
- 238000000034 method Methods 0.000 description 6
- 230000008859 change Effects 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000005070 sampling Methods 0.000 description 3
- 238000010079 rubber tapping Methods 0.000 description 2
- 230000001360 synchronised effect Effects 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- CVRALZAYCYJELZ-UHFFFAOYSA-N O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate Chemical compound C=1C=CC=CC=1P(=S)(OC)OC1=CC(Cl)=C(Br)C=C1Cl CVRALZAYCYJELZ-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 108700002782 erythrocyte membrane band 4.2 Proteins 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000009191 jumping Effects 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000008447 perception Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N11/00—Colour television systems
- H04N11/06—Transmission systems characterised by the manner in which the individual colour picture signal components are combined
- H04N11/12—Transmission systems characterised by the manner in which the individual colour picture signal components are combined using simultaneous signals only
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Processing Of Color Television Signals (AREA)
- Studio Circuits (AREA)
- Color Television Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US117618A US2677721A (en) | 1949-09-24 | 1949-09-24 | Color television system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE904778C true DE904778C (de) | 1954-02-22 |
Family
ID=22373897
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER3721A Expired DE904778C (de) | 1949-09-24 | 1950-09-23 | Fernsehempfaenger fuer die UEbertragung farbiger Bilder |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2677721A (enExample) |
| BE (1) | BE498279A (enExample) |
| CH (1) | CH288289A (enExample) |
| DE (1) | DE904778C (enExample) |
| ES (1) | ES194684A1 (enExample) |
| FR (1) | FR1025634A (enExample) |
| GB (1) | GB685662A (enExample) |
| NL (1) | NL156189B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE502934A (enExample) * | 1950-05-01 | |||
| US2833852A (en) * | 1951-03-10 | 1958-05-06 | Philco Corp | Color signal control system for color television receivers |
| US2742525A (en) * | 1951-04-27 | 1956-04-17 | Rca Corp | Color test pattern generator |
| US2862998A (en) * | 1951-09-14 | 1958-12-02 | Philco Corp | Color television system |
| NL106695C (enExample) * | 1953-05-13 | |||
| US2841640A (en) * | 1953-08-13 | 1958-07-01 | Gen Precision Lab Inc | Color television system |
| NL113804C (enExample) * | 1953-10-05 | |||
| NL197082A (enExample) * | 1954-05-10 | |||
| US2921121A (en) * | 1955-04-01 | 1960-01-12 | Rca Corp | Notch filter in brightness channel of color television transmitter |
| US2978544A (en) * | 1955-05-20 | 1961-04-04 | Siemens Ag | Apparatus for simultaneously transmitting a plurality of messages |
| US2910527A (en) * | 1955-06-07 | 1959-10-27 | Zenith Radio Corp | System for translating a d. c. component |
| US2946851A (en) * | 1956-03-21 | 1960-07-26 | Bell Telephone Labor Inc | Television system having reduced transmission bandwidth |
| US3004460A (en) * | 1956-12-31 | 1961-10-17 | Baldwin Piano Co | Audio modulation system |
| DE1053311B (de) * | 1958-02-11 | 1959-03-19 | Hell Rudolf Dr Ing Fa | Verfahren und Vorrichtung zur elektronischen Farbkorrektur |
| US3562421A (en) * | 1967-08-03 | 1971-02-09 | Ward Electronic Ind | Television time multiplexing system |
| US3582542A (en) * | 1970-04-15 | 1971-06-01 | Itt | Multiplexed, sequential dot interlaced television system |
| WO2007094403A1 (ja) * | 2006-02-17 | 2007-08-23 | Matsushita Electric Industrial Co., Ltd. | 撮像装置 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2058686A (en) * | 1932-10-25 | 1936-10-27 | Radio Res Lab Inc | Wave signaling method and apparatus |
| US2048081A (en) * | 1933-04-29 | 1936-07-21 | Alger S Riggs | Communication system |
| US2193722A (en) * | 1936-09-04 | 1940-03-12 | Interchem Corp | Method of color reproduction |
| US2235180A (en) * | 1938-10-06 | 1941-03-18 | Condenser Dev Corp | Stator mounting for variable condensers |
| US2333969A (en) * | 1941-05-27 | 1943-11-09 | Gen Electric | Television system and method of operation |
| US2359637A (en) * | 1942-10-31 | 1944-10-03 | Alfred N Goldsmith | Television system |
| US2461515A (en) * | 1945-07-16 | 1949-02-15 | Arthur B Bronwell | Color television system |
| FR955951A (enExample) * | 1946-12-07 | 1950-01-23 | ||
| US2558489A (en) * | 1949-06-06 | 1951-06-26 | Meguer V Kalfaian | Color television system |
-
0
- NL NL7110981.A patent/NL156189B/xx unknown
- BE BE498279D patent/BE498279A/xx unknown
-
1949
- 1949-09-24 US US117618A patent/US2677721A/en not_active Expired - Lifetime
-
1950
- 1950-09-21 GB GB23205/50A patent/GB685662A/en not_active Expired
- 1950-09-22 FR FR1025634D patent/FR1025634A/fr not_active Expired
- 1950-09-22 CH CH288289D patent/CH288289A/de unknown
- 1950-09-23 ES ES0194684A patent/ES194684A1/es not_active Expired
- 1950-09-23 DE DER3721A patent/DE904778C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES194684A1 (es) | 1952-04-01 |
| BE498279A (enExample) | |
| FR1025634A (fr) | 1953-04-17 |
| NL156189B (nl) | |
| GB685662A (en) | 1953-01-07 |
| CH288289A (de) | 1953-01-15 |
| US2677721A (en) | 1954-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE904778C (de) | Fernsehempfaenger fuer die UEbertragung farbiger Bilder | |
| DE3888169T2 (de) | Datenübertragung in aktiver bildperiode. | |
| DE905144C (de) | Einrichtung zur absatzweisen Mehrfachuebertragung fuer das Farbfernsehen | |
| DE3435264C2 (enExample) | ||
| DE951152C (de) | Farbfernsehsystem | |
| WO1990013210A1 (de) | Farbfernsehsystem mit einrichtungen zur codierung und decodierung von farbfernsehsignalen | |
| DE1512320A1 (de) | Dropout-Kompensator | |
| DE973497C (de) | Fernsehsystem | |
| DE868612C (de) | Farbfernsehsender | |
| DE2617423A1 (de) | Signalverarbeitungsschaltung fuer farbfernsehsignale | |
| DE947620C (de) | Mehrfachuebertragungssystem fuer Fernsehbilder | |
| DE921950C (de) | Fernsehsystem zur Zerlegung, UEbertragung oder Wiedergabe farbiger Bilder | |
| DE3141257C2 (de) | Farbsignalverarbeitungsschaltung | |
| DE1208335B (de) | UEbertragungseinrichtung fuer ein Analogsignal, insbesondere fuer ein Fernseh- oder Faksimile-Bilduebertragungssystem | |
| DE1024561B (de) | Farbfernsehempfaenger | |
| DE1081919B (de) | Mehrfachuebertragungssystem zum UEbertragen von drei Fernsehsignalen, insbesondere fuer Farbfernsehen | |
| DE936340C (de) | Mehrfach-UEbertragungssystem zum UEbertragen von drei Signalen, die sich je auf ein Fernsehbild beziehen | |
| DE864268C (de) | Farbfernseheinrichtung | |
| DE1195802B (de) | Farbfernsehsender | |
| DE910782C (de) | Mehrfach-Nachrichten-UEbertragungssystem | |
| DE1005118B (de) | Farbfernseheinrichtung | |
| DE3789498T2 (de) | Mac-format mit alternierenden gleichstrompegel- und taktwiedergewinnungssignalen. | |
| DE1018455B (de) | Multiplexuebertragungssystem fuer Fernsehsignale | |
| DE914262C (de) | Einseitenband-Traegerfrequenz-Fernsprechsystem | |
| DE1148256B (de) | Farbfernsehsystem |