NL156189B - Werkwijze ter bereiding van het antibioticum lincomycine. - Google Patents
Werkwijze ter bereiding van het antibioticum lincomycine.Info
- Publication number
- NL156189B NL156189B NL7110981.A NL156189DA NL156189B NL 156189 B NL156189 B NL 156189B NL 156189D A NL156189D A NL 156189DA NL 156189 B NL156189 B NL 156189B
- Authority
- NL
- Netherlands
- Prior art keywords
- preparing
- antibiotic lincomycin
- lincomycin
- antibiotic
- Prior art date
Links
- OJMMVQQUTAEWLP-UHFFFAOYSA-N Lincomycin Natural products CN1CC(CCC)CC1C(=O)NC(C(C)O)C1C(O)C(O)C(O)C(SC)O1 OJMMVQQUTAEWLP-UHFFFAOYSA-N 0.000 title 1
- 230000003115 biocidal effect Effects 0.000 title 1
- OJMMVQQUTAEWLP-KIDUDLJLSA-N lincomycin Chemical compound CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@@H](C)O)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 OJMMVQQUTAEWLP-KIDUDLJLSA-N 0.000 title 1
- 229960005287 lincomycin Drugs 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N11/00—Colour television systems
- H04N11/06—Transmission systems characterised by the manner in which the individual colour picture signal components are combined
- H04N11/12—Transmission systems characterised by the manner in which the individual colour picture signal components are combined using simultaneous signals only
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Processing Of Color Television Signals (AREA)
- Studio Circuits (AREA)
- Color Television Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US117618A US2677721A (en) | 1949-09-24 | 1949-09-24 | Color television system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL156189B true NL156189B (nl) |
Family
ID=22373897
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7110981.A NL156189B (nl) | 1949-09-24 | Werkwijze ter bereiding van het antibioticum lincomycine. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2677721A (enExample) |
| BE (1) | BE498279A (enExample) |
| CH (1) | CH288289A (enExample) |
| DE (1) | DE904778C (enExample) |
| ES (1) | ES194684A1 (enExample) |
| FR (1) | FR1025634A (enExample) |
| GB (1) | GB685662A (enExample) |
| NL (1) | NL156189B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU30728A1 (enExample) * | 1950-05-01 | |||
| US2833852A (en) * | 1951-03-10 | 1958-05-06 | Philco Corp | Color signal control system for color television receivers |
| US2742525A (en) * | 1951-04-27 | 1956-04-17 | Rca Corp | Color test pattern generator |
| US2862998A (en) * | 1951-09-14 | 1958-12-02 | Philco Corp | Color television system |
| NL106695C (enExample) * | 1953-05-13 | |||
| US2841640A (en) * | 1953-08-13 | 1958-07-01 | Gen Precision Lab Inc | Color television system |
| BE532304A (enExample) * | 1953-10-05 | |||
| BE538058A (enExample) * | 1954-05-10 | |||
| US2921121A (en) * | 1955-04-01 | 1960-01-12 | Rca Corp | Notch filter in brightness channel of color television transmitter |
| US2978544A (en) * | 1955-05-20 | 1961-04-04 | Siemens Ag | Apparatus for simultaneously transmitting a plurality of messages |
| US2910527A (en) * | 1955-06-07 | 1959-10-27 | Zenith Radio Corp | System for translating a d. c. component |
| US2946851A (en) * | 1956-03-21 | 1960-07-26 | Bell Telephone Labor Inc | Television system having reduced transmission bandwidth |
| US3004460A (en) * | 1956-12-31 | 1961-10-17 | Baldwin Piano Co | Audio modulation system |
| DE1053311B (de) * | 1958-02-11 | 1959-03-19 | Hell Rudolf Dr Ing Fa | Verfahren und Vorrichtung zur elektronischen Farbkorrektur |
| US3562421A (en) * | 1967-08-03 | 1971-02-09 | Ward Electronic Ind | Television time multiplexing system |
| US3582542A (en) * | 1970-04-15 | 1971-06-01 | Itt | Multiplexed, sequential dot interlaced television system |
| JP5033628B2 (ja) * | 2006-02-17 | 2012-09-26 | パナソニック株式会社 | 撮像装置 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2058686A (en) * | 1932-10-25 | 1936-10-27 | Radio Res Lab Inc | Wave signaling method and apparatus |
| US2048081A (en) * | 1933-04-29 | 1936-07-21 | Alger S Riggs | Communication system |
| US2193722A (en) * | 1936-09-04 | 1940-03-12 | Interchem Corp | Method of color reproduction |
| US2235180A (en) * | 1938-10-06 | 1941-03-18 | Condenser Dev Corp | Stator mounting for variable condensers |
| US2333969A (en) * | 1941-05-27 | 1943-11-09 | Gen Electric | Television system and method of operation |
| US2359637A (en) * | 1942-10-31 | 1944-10-03 | Alfred N Goldsmith | Television system |
| US2461515A (en) * | 1945-07-16 | 1949-02-15 | Arthur B Bronwell | Color television system |
| NL84373C (enExample) * | 1946-12-07 | |||
| US2558489A (en) * | 1949-06-06 | 1951-06-26 | Meguer V Kalfaian | Color television system |
-
0
- BE BE498279D patent/BE498279A/xx unknown
- NL NL7110981.A patent/NL156189B/xx unknown
-
1949
- 1949-09-24 US US117618A patent/US2677721A/en not_active Expired - Lifetime
-
1950
- 1950-09-21 GB GB23205/50A patent/GB685662A/en not_active Expired
- 1950-09-22 CH CH288289D patent/CH288289A/de unknown
- 1950-09-22 FR FR1025634D patent/FR1025634A/fr not_active Expired
- 1950-09-23 DE DER3721A patent/DE904778C/de not_active Expired
- 1950-09-23 ES ES0194684A patent/ES194684A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1025634A (fr) | 1953-04-17 |
| ES194684A1 (es) | 1952-04-01 |
| DE904778C (de) | 1954-02-22 |
| GB685662A (en) | 1953-01-07 |
| US2677721A (en) | 1954-05-04 |
| CH288289A (de) | 1953-01-15 |
| BE498279A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL156189B (nl) | Werkwijze ter bereiding van het antibioticum lincomycine. | |
| NL143273B (nl) | Werkwijze voor het bereiden van een antibioticum. | |
| CH285325A (fr) | Véhicule. | |
| BE507597A (fr) | Procede de preparation de piperidines substituees. | |
| NL186003B (nl) | Werkwijze voor het bereiden van n,n-diallyldichlooraceetamide. | |
| NL153237B (nl) | Werkwijze ter bereiding van siloxan-polyoxyalkyleenblokcopolymeren met schuimstabiliserende eigenschappen. | |
| NL162932B (nl) | Werkwijze voor het bereiden van entcopolymeren. | |
| NL173642B (nl) | Werkwijze ter bereiding van tricyclische isochromanen. | |
| NL153527B (nl) | Werkwijze ter bereiding van 3-gesubstitueerde fenylpyrroolverbindingen. | |
| NL154404B (nl) | Werkwijze voor het bereiden van met aceetaldehyde gearomatiseerde saccharose. | |
| CH286867A (de) | Epilamisierungsverfahren. | |
| NL163486B (nl) | Werkwijze voor het bereiden van fosgeen. | |
| NL160247C (nl) | Werkwijze ter bereiding van aryl-alfa-oximinoalkylketonen. | |
| NL151708B (nl) | Werkwijze voor het bereiden van 1-(5-nitro-2-thiazolyl)-2-oxo-tetrahydroimidazool. | |
| NL156209B (nl) | Deurvasthoudinrichting. | |
| NL151986B (nl) | Werkwijze voor het bereiden van acrylonitril. | |
| NL139534B (nl) | Werkwijze ter bereiding van cefaloridine. | |
| CA461040A (en) | System for sintering | |
| CA460126A (en) | Pipe rack | |
| NL148062B (nl) | Werkwijze voor het bereiden van hydroxypropylcellusose. | |
| CA458951A (en) | Heating system | |
| NL153895B (nl) | Werkwijze ter bereiding van acrylonitrileentpolymeren. | |
| BE496834A (nl) | Werkwijze voor het bereiden van carbazol. | |
| NL147749B (nl) | Werkwijze ter bereiding van grootmoleculige amorfe copolymeren. | |
| AU140610B2 (en) | Improved supporting-stand for eggbeaters andthe like |