DE899615C - Ammoniumnitratsprengstoff - Google Patents
AmmoniumnitratsprengstoffInfo
- Publication number
- DE899615C DE899615C DEI3953A DEI0003953A DE899615C DE 899615 C DE899615 C DE 899615C DE I3953 A DEI3953 A DE I3953A DE I0003953 A DEI0003953 A DE I0003953A DE 899615 C DE899615 C DE 899615C
- Authority
- DE
- Germany
- Prior art keywords
- water
- parts
- ammonium nitrate
- soluble
- explosive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002360 explosive Substances 0.000 title claims description 41
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 title claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 20
- 229920001282 polysaccharide Polymers 0.000 claims description 10
- 239000005017 polysaccharide Substances 0.000 claims description 10
- 229920002472 Starch Polymers 0.000 claims description 7
- 150000004676 glycans Chemical class 0.000 claims description 7
- 239000008107 starch Substances 0.000 claims description 7
- 235000019698 starch Nutrition 0.000 claims description 7
- 229920003086 cellulose ether Polymers 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 27
- 229920000159 gelatin Polymers 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 10
- 239000008273 gelatin Substances 0.000 description 10
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 10
- 108010010803 Gelatin Proteins 0.000 description 8
- 235000013312 flour Nutrition 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 235000011852 gelatine desserts Nutrition 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 8
- 239000002023 wood Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 4
- 235000010344 sodium nitrate Nutrition 0.000 description 4
- 239000004317 sodium nitrate Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 3
- 239000000020 Nitrocellulose Substances 0.000 description 3
- 238000005474 detonation Methods 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- 229920001220 nitrocellulos Polymers 0.000 description 3
- -1 polysaccharide ethers Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000015 trinitrotoluene Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 2
- 239000000006 Nitroglycerin Substances 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229960003711 glyceryl trinitrate Drugs 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- DYSXLQBUUOPLBB-UHFFFAOYSA-N 2,3-dinitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O DYSXLQBUUOPLBB-UHFFFAOYSA-N 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical compound CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- RHZUVFJBSILHOK-UHFFFAOYSA-N anthracen-1-ylmethanolate Chemical compound C1=CC=C2C=C3C(C[O-])=CC=CC3=CC2=C1 RHZUVFJBSILHOK-UHFFFAOYSA-N 0.000 description 1
- 239000003830 anthracite Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- YMBNBZFZTXCWDV-UHFFFAOYSA-N ethane-1,2-diol;propane-1,2,3-triol Chemical compound OCCO.OCC(O)CO YMBNBZFZTXCWDV-UHFFFAOYSA-N 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Substances OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010903 husk Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920003087 methylethyl cellulose Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B31/00—Compositions containing an inorganic nitrogen-oxygen salt
- C06B31/28—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate
- C06B31/30—Compositions containing an inorganic nitrogen-oxygen salt the salt being ammonium nitrate with vegetable matter; with resin; with rubber
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB12067/48A GB645039A (en) | 1948-05-03 | 1948-05-03 | Improvements in or relating to ammonium nitrate blasting explosives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE899615C true DE899615C (de) | 1953-12-14 |
Family
ID=9997833
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI3953A Expired DE899615C (de) | 1948-05-03 | 1951-03-28 | Ammoniumnitratsprengstoff |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2680068A (forum.php) |
| BE (1) | BE488705A (forum.php) |
| DE (1) | DE899615C (forum.php) |
| FR (1) | FR984674A (forum.php) |
| GB (1) | GB645039A (forum.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117014B (de) * | 1958-11-12 | 1961-11-09 | Fernand Lebrun | Sicherheitssprengstoff |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2680067A (en) * | 1950-08-31 | 1954-06-01 | Ici Ltd | Blasting explosive containing a water-soluble polysaccharide ether |
| US2768073A (en) * | 1952-04-21 | 1956-10-23 | Ici Ltd | Explosive compositions |
| US2829036A (en) * | 1953-03-07 | 1958-04-01 | Dynamit Ag Vormals Alfred Nobe | Fire damp proof explosive compositions |
| US2860041A (en) * | 1955-11-17 | 1958-11-11 | Trojan Powder Co | Blasting explosives |
| US2847291A (en) * | 1956-05-09 | 1958-08-12 | Sakurai Takehisa | Gelatin dynamite explosives containing water |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2570827A (en) * | 1951-10-09 | Composition fok waterproofing | ||
| GB359163A (en) * | 1930-09-26 | 1931-10-22 | Ig Farbenindustrie Ag | Improvements in the storage of fertilisers which are hygroscopic or have a tendency to cake |
| US1992217A (en) * | 1932-05-19 | 1935-02-26 | Du Pont | Ammonium nitrate explosive |
| BE461725A (forum.php) * | 1939-08-03 | |||
| US2345582A (en) * | 1940-08-03 | 1944-04-04 | Atlas Powder Co | Explosive composition |
| US2314832A (en) * | 1940-11-13 | 1943-03-23 | Du Pont | Explosive composition |
| US2314809A (en) * | 1941-01-07 | 1943-03-23 | Du Pont | Explosive composition |
| US2333367A (en) * | 1941-01-29 | 1943-11-02 | American Zinc Lead & Smelting | Method of conditioning paints |
| US2358384A (en) * | 1941-01-31 | 1944-09-19 | Du Pont | Detonating explosive |
| US2389771A (en) * | 1941-02-15 | 1945-11-27 | Komel Corp | Explosive composition |
| US2358385A (en) * | 1941-04-10 | 1944-09-19 | Du Pont | Explosive |
-
0
- BE BE488705D patent/BE488705A/xx unknown
-
1948
- 1948-05-03 GB GB12067/48A patent/GB645039A/en not_active Expired
-
1949
- 1949-04-12 US US87108A patent/US2680068A/en not_active Expired - Lifetime
- 1949-04-13 FR FR984674D patent/FR984674A/fr not_active Expired
-
1951
- 1951-03-28 DE DEI3953A patent/DE899615C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117014B (de) * | 1958-11-12 | 1961-11-09 | Fernand Lebrun | Sicherheitssprengstoff |
Also Published As
| Publication number | Publication date |
|---|---|
| BE488705A (forum.php) | |
| US2680068A (en) | 1954-06-01 |
| GB645039A (en) | 1950-10-25 |
| FR984674A (fr) | 1951-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69015784T2 (de) | Sprengstoff- und treibstoffzusammensetzung. | |
| DE2245510B2 (de) | Explosive Treibmasse | |
| CH636588A5 (de) | Breifoermige sprengstoffmasse. | |
| DE899615C (de) | Ammoniumnitratsprengstoff | |
| DE1571213A1 (de) | Explosivstoffe | |
| DE863615C (de) | Wettersprengstoff | |
| DE1950580B2 (de) | Sprengstoffzusammensetzung vom slurry-typ | |
| DE1906776A1 (de) | Zusammensetzungen fuer Sprengstoffmaterialien und Verfahren zu deren Herstellung | |
| DE1009990B (de) | Plastischer Sicherheitssprengstoff mit ausgeglichener Sauerstoffbilanz | |
| DE2159382A1 (de) | Gel für Explosivaufschlämmungen und Verfahren zu dessen Herstellung | |
| DE2212278C3 (forum.php) | ||
| DE717873C (de) | Verfahren zur Herstellung von detonationsempfindlichem Ammonnitrat | |
| DE1232506B (de) | Stabilisierte Sprengstoffzusammensetzung vom Slurry-Typ | |
| DE2019968C3 (de) | Sprengstoffmischung hoher Brisanz und hoher Gesamtenergie und Verfahren zu deren Herstellung | |
| DE903319C (de) | Verfahren zur Verminderung des Setzens von Ammonnitratsprengstoffen | |
| DE2213454B2 (de) | Gekörntes Treibmittelpulver auf der Basis von Ammoniumnitrat und Nitrocellulose | |
| US2055403A (en) | Explosive | |
| DE1117014B (de) | Sicherheitssprengstoff | |
| DE1915456C3 (de) | Schlammförmige, chromhaltige Lignin-Explosivstoffe | |
| DE915196C (de) | Ammonnitrat-Wettersprengstoff | |
| US1828788A (en) | Explosive | |
| US3475238A (en) | Method for preparing gelled slurry explosive compositions containing distinct liquid and solid phases | |
| DE2116353B2 (de) | Pulverförmiger, von flüssigen Salpetersäureestern freier, Ammoniumnitratsprengstoff hoher Wasserfestigkeit und Dichte | |
| DE1646299C (de) | Sprengstoff auf der Basis von Nitro glyzenn in plastischer Form und als Auf schlammung | |
| DE857318C (de) | Gelatinesprengstoff |