DE854951C - Verfahren zur Herstellung von Dialkyldihalogensilanen - Google Patents
Verfahren zur Herstellung von DialkyldihalogensilanenInfo
- Publication number
- DE854951C DE854951C DEI2080A DEI0002080A DE854951C DE 854951 C DE854951 C DE 854951C DE I2080 A DEI2080 A DE I2080A DE I0002080 A DEI0002080 A DE I0002080A DE 854951 C DE854951 C DE 854951C
- Authority
- DE
- Germany
- Prior art keywords
- zinc
- copper
- silicon
- weight
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000010949 copper Substances 0.000 claims description 83
- 229910052710 silicon Inorganic materials 0.000 claims description 74
- 229910052802 copper Inorganic materials 0.000 claims description 70
- 239000011701 zinc Substances 0.000 claims description 70
- 229910052725 zinc Inorganic materials 0.000 claims description 61
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 59
- 239000010703 silicon Substances 0.000 claims description 58
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 40
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 39
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 239000000203 mixture Substances 0.000 claims description 34
- 239000003054 catalyst Substances 0.000 claims description 33
- -1 copper halides Chemical class 0.000 claims description 31
- 150000001350 alkyl halides Chemical class 0.000 claims description 12
- 229910045601 alloy Inorganic materials 0.000 claims description 8
- 239000000956 alloy Substances 0.000 claims description 8
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical class [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 5
- 238000010298 pulverizing process Methods 0.000 claims 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 26
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 20
- 239000007795 chemical reaction product Substances 0.000 description 13
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 13
- 239000011592 zinc chloride Substances 0.000 description 13
- 235000005074 zinc chloride Nutrition 0.000 description 13
- 229940050176 methyl chloride Drugs 0.000 description 10
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 7
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 229960003280 cupric chloride Drugs 0.000 description 4
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 4
- 239000005751 Copper oxide Substances 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229910000431 copper oxide Inorganic materials 0.000 description 3
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000530268 Lycaena heteronea Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000005055 methyl trichlorosilane Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000005871 repellent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 229940102001 zinc bromide Drugs 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- YGZSVWMBUCGDCV-UHFFFAOYSA-N chloro(methyl)silane Chemical class C[SiH2]Cl YGZSVWMBUCGDCV-UHFFFAOYSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000005048 methyldichlorosilane Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000011856 silicon-based particle Substances 0.000 description 1
- 239000011863 silicon-based powder Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/12—Organo silicon halides
- C07F7/16—Preparation thereof from silicon and halogenated hydrocarbons direct synthesis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/12—Organo silicon halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US731417A US2464033A (en) | 1947-02-27 | 1947-02-27 | Preparation of dialkyl-substituted dihalogenosilanes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE854951C true DE854951C (de) | 1952-11-10 |
Family
ID=24939413
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI2080A Expired DE854951C (de) | 1947-02-27 | 1950-09-21 | Verfahren zur Herstellung von Dialkyldihalogensilanen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2464033A (esLanguage) |
| BE (1) | BE481523A (esLanguage) |
| CH (1) | CH268528A (esLanguage) |
| DE (1) | DE854951C (esLanguage) |
| FR (1) | FR961856A (esLanguage) |
| GB (1) | GB637941A (esLanguage) |
| NL (1) | NL65956C (esLanguage) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3231156A (en) * | 1962-10-10 | 1966-01-25 | American Can Co | Container with snap-in plastic nozzle |
| DE1279676B (de) * | 1965-01-27 | 1968-10-10 | Unilever Nv | Verfahren zur Herstellung von Organohalogensilanen |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE921566C (de) * | 1949-05-05 | 1954-12-20 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Alkyl- bzw. Arylhalogensilanen |
| US2657114A (en) * | 1949-06-21 | 1953-10-27 | Union Carbide & Carbon Corp | Chlorosilanes |
| DE970341C (de) * | 1950-11-29 | 1958-09-11 | Goldschmidt Ag Th | Verfahren zur Herstellung von Alkylhalogensilanen |
| US2903473A (en) * | 1954-03-19 | 1959-09-08 | Takami Yasuo | Process for the production of phenylchlorosilanes |
| US2887502A (en) * | 1957-06-13 | 1959-05-19 | Gen Electric | Preparation of alkyl chlorosilanes |
| US3069452A (en) * | 1959-01-26 | 1962-12-18 | Goldschmidt Ag Th | Process for the production of a silane mixture |
| US3072700A (en) * | 1959-08-07 | 1963-01-08 | Union Carbide Corp | Process for producing silanes |
| JPS5110238B2 (esLanguage) * | 1972-02-23 | 1976-04-02 | ||
| DE2750556A1 (de) * | 1977-11-11 | 1979-05-17 | Bayer Ag | Verfahren zur herstellung von katalyt-kupfer |
| US4281149A (en) * | 1980-03-24 | 1981-07-28 | General Electric Company | Process for treating silicon particles within a silicone reactor system |
| US4450282A (en) * | 1981-07-29 | 1984-05-22 | General Electric Company | Catalyst for a process for producing silicones |
| US4487950A (en) * | 1982-04-16 | 1984-12-11 | General Electric Company | Method for making methylchlorosilanes |
| DE3425424C3 (de) | 1983-07-28 | 1995-05-18 | Gen Electric | Verfahren zur Herstellung von Alkylhalogensilanen |
| USRE33452E (en) * | 1983-07-28 | 1990-11-20 | General Electric Company | Method for making alkylhalosilanes |
| US4500724A (en) * | 1983-07-28 | 1985-02-19 | General Electric Company | Method for making alkylhalosilanes |
| US4864044A (en) * | 1985-02-15 | 1989-09-05 | Union Carbide Corporation | Tin containing activated silicon for the direct reaction |
| US4762940A (en) * | 1987-12-11 | 1988-08-09 | Dow Corning Corporation | Method for preparation of alkylhalosilanes |
| US5061672A (en) * | 1990-01-30 | 1991-10-29 | Elkem Metals Company | Active mass for making organohalosilanes |
| DE4408113A1 (de) * | 1994-03-10 | 1995-09-14 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Methylchlorsilanen |
| US6077487A (en) * | 1997-11-05 | 2000-06-20 | Millipore Corporation | Process and apparatus of removing metal carbonyls and moisture from a gas |
| DE19752261C1 (de) * | 1997-11-14 | 1999-01-28 | H & G Hegmanns Ingenieurgesell | Verfahren zur Herstellung von Organohologensilanen |
| US6425850B1 (en) | 2000-04-20 | 2002-07-30 | General Electric Company | Method for determining eta phase copper |
| US6528674B1 (en) | 2000-04-20 | 2003-03-04 | General Electric Company | Method for preparing a contact mass |
| US6407276B1 (en) | 2001-03-29 | 2002-06-18 | General Electric Company | Method for improving selectivity for dialkyldichlorosilane |
| US7265235B2 (en) * | 2002-04-17 | 2007-09-04 | Wacker Chemie Ag | Method for producing halosilanes by impinging microwave energy |
| BRPI0510452A (pt) * | 2004-05-04 | 2007-10-30 | Dow Corning | contêiner para formação de eletrodos auto-cozidos |
| FR2887551B1 (fr) * | 2005-06-22 | 2008-02-15 | Rhodia Chimie Sa | Procede de synthese directe d'alkylhalogenosilanes |
| US7645894B2 (en) * | 2006-04-22 | 2010-01-12 | Bernard Kanner | Direct process for making cyclic dimethylsiloxane oligomers |
| US8957237B2 (en) | 2011-12-19 | 2015-02-17 | Bluestar Silicones France Sas | Method for the direct synthesis of alkylhalogenosilanes |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2383818A (en) * | 1943-07-26 | 1945-08-28 | Gen Electric | Preparation of organosilicon halides |
| US2427605A (en) * | 1945-03-15 | 1947-09-16 | Gen Electric | Preparation of alkylhalogenosilanes |
-
0
- BE BE481523D patent/BE481523A/xx unknown
- FR FR961856D patent/FR961856A/fr not_active Expired
- NL NL65956D patent/NL65956C/xx active
-
1947
- 1947-02-27 US US731417A patent/US2464033A/en not_active Expired - Lifetime
-
1948
- 1948-02-25 GB GB5642/48A patent/GB637941A/en not_active Expired
- 1948-02-26 CH CH268528D patent/CH268528A/de unknown
-
1950
- 1950-09-21 DE DEI2080A patent/DE854951C/de not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3231156A (en) * | 1962-10-10 | 1966-01-25 | American Can Co | Container with snap-in plastic nozzle |
| DE1279676B (de) * | 1965-01-27 | 1968-10-10 | Unilever Nv | Verfahren zur Herstellung von Organohalogensilanen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR961856A (esLanguage) | 1950-05-24 |
| GB637941A (en) | 1950-05-31 |
| US2464033A (en) | 1949-03-08 |
| BE481523A (esLanguage) | |
| NL65956C (esLanguage) | |
| CH268528A (de) | 1950-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE854951C (de) | Verfahren zur Herstellung von Dialkyldihalogensilanen | |
| DE842059C (de) | Verfahren zur Herstellung von Organosiliziumhalogeniden | |
| DE3851692T2 (de) | Verfahren zur Herstellung von Aklylhalosilanen. | |
| DD232278A5 (de) | Verfahren zur herstellung von alkylhalogensilanen | |
| DE844902C (de) | Verfahren zur Herstellung von Dialkyldihalogensilanen | |
| DE69909208T2 (de) | Verfahren zur Herstellung von Alkylhalogensilanen | |
| DE69631944T2 (de) | Verfahren zur Überwachung der Verteilung der Reaktionsprodukte bei der Alkylhalogensilanherstellung | |
| DE69402201T2 (de) | Phosphorhaltiges, metallurgisches silizium zur herstellung von organohalosilanen | |
| DE69813402T2 (de) | Herstellung von Alkylhalogensilanen | |
| DE69013482T2 (de) | Verfahren zur Herstellung von Organohalosilanen. | |
| DE1019306B (de) | Verfahren zur Herstellung von Phenylchlorsilanen | |
| EP0671402B1 (de) | Verfahren zur Herstellung von Methylchlorsilanen | |
| DE102013209604A1 (de) | Verfahren zur Herstellung von Methylchlorsilanen | |
| DE1922017C3 (de) | Verfahren zur Herstellung von 2-Methylenglutarnitril durch Dimerisierung von Acrylnitril | |
| DE1279676B (de) | Verfahren zur Herstellung von Organohalogensilanen | |
| DE602004013179T2 (de) | Direktes verfahren zur synthese von alkylhalogensilanen | |
| DE69802350T2 (de) | Verfahren zur Herstellung aktiven Siliziumpulvers für die Herstellung von Alkyl- oder Aryl-Halogensilanen | |
| DE2948883C3 (de) | Manganzusatz zu Magnesiumschmelzen | |
| EP0759438B1 (de) | Verfahren zur Herstellung von Dimethyldichlorsilan | |
| DE1134671B (de) | Verfahren zur Herstellung von Methyl- bzw. AEthylchlorsilanen mit hohem Gehalt an Methyl- bzw. AEthyldichlorsilan | |
| DE19937908C1 (de) | Verfahren zur Herstellung von Organochlorsilanen | |
| DE3425424A1 (de) | Verfahren zur herstellung von alkylhalogensilanen | |
| DE60315345T2 (de) | Verfahren und katalysatorsystem für die direktsynthese von alkylhalogensilanen | |
| EP0810228A2 (de) | Verfahren zur Herstellung von Alkylhalogensilanen | |
| DE1088051B (de) | Verfahren zur Herstellung von Alkylhalogensilanen |