DE764896A - - Google Patents
Info
- Publication number
- DE764896A DE764896A DE764896A DE 764896 A DE764896 A DE 764896A DE 764896 A DE764896 A DE 764896A
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- pyrazolone
- diazo
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000008049 diazo compounds Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1132540B (de) | Verfahren zur Herstellung von Loesungen von Kupplungskomponenten der Eisfarbenreihe | |
| DE764896A (enExample) | ||
| DE607870C (de) | Verfahren zur Herstellung von Diazopraeparaten | |
| DE844148C (de) | Verfahren zur Herstellung von Acylacetylaminen | |
| DE595680C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE949104C (de) | Verfahren zur Herstellung fester, haltbarer Diazonium-Verbindungen | |
| DE131537C (enExample) | ||
| DE1493919C (de) | Verfahren zur Herstellung von Sulfo derivaten des Hydrochinons | |
| DE943408C (de) | Verfahren zur Darstellung von Bisguanylhydrazonen | |
| DE655047C (de) | Verfahren zur Herstellung von Aryldiazoniumsalzen | |
| CH240316A (de) | Verfahren zur Herstellung einer zur Injektion geeigneten Lösung eines Derivates des 3-Benzol-azo-2,6-diamino-pyridins. | |
| DE2524927B2 (de) | Organische Verbindungen, deren Herstellung und Verwendung | |
| DE615846C (de) | Verfahren zur Herstellung von Diazoaminoverbindungen | |
| AT114529B (de) | Verfahren zur Darstellung organischer Arsenverbindungen. | |
| DE854802C (de) | Verfahren zur Herstellung von 4, 4'-Diaminodiphenylsulfoxyd | |
| CH86691A (de) | Verfahren zur Herstellung eines chromhaltigen sauren Farbstoffs. | |
| CH200909A (de) | Verfahren zur Herstellung eines stickstoffhaltigen aromatischen Aldehyds. | |
| CH176029A (de) | Verfahren zur Darstellung des 4-Amino-3-methoxydiphenylamins. | |
| CH178405A (de) | Verfahren zur Darstellung des 4-Amino-3-äthoxy-2'-chlor-diphenylamins. | |
| DE2947468A1 (de) | Disazofarbstoff, verfahren zu seiner herstellung sowie seine verwendung | |
| CH200061A (de) | Verfahren zur Herstellung eines Hydrazins der Diphenylreihe. | |
| CH218521A (de) | Verfahren zur Herstellung eines Diphenylsulfonabkömmlings. | |
| CH217973A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| CH210964A (de) | Verfahren zur Darstellung eines Harnstoffderivates. | |
| CH128638A (de) | Verfahren zur Darstellung eines 1-Derivates des Anthrachinons. |