DE69708004T2 - Substituiertes Carboxanilid-Derivat und dieses als aktiven Bestandteil enthaltendes Mittel zur Bekämpfung von Pflanzenkrankheiten - Google Patents
Substituiertes Carboxanilid-Derivat und dieses als aktiven Bestandteil enthaltendes Mittel zur Bekämpfung von PflanzenkrankheitenInfo
- Publication number
- DE69708004T2 DE69708004T2 DE69708004T DE69708004T DE69708004T2 DE 69708004 T2 DE69708004 T2 DE 69708004T2 DE 69708004 T DE69708004 T DE 69708004T DE 69708004 T DE69708004 T DE 69708004T DE 69708004 T2 DE69708004 T2 DE 69708004T2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- substituted
- active ingredient
- formula
- derivative according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 201000010099 disease Diseases 0.000 title claims description 42
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 title claims description 42
- 239000004480 active ingredient Substances 0.000 title claims description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 39
- 239000000417 fungicide Substances 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 230000000855 fungicidal effect Effects 0.000 claims description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 238000003898 horticulture Methods 0.000 claims description 6
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 66
- 238000000034 method Methods 0.000 description 65
- 239000000203 mixture Substances 0.000 description 61
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- -1 methoxy, methylthio, methylsulfinyl Chemical group 0.000 description 45
- 125000004432 carbon atom Chemical group C* 0.000 description 39
- 239000000243 solution Substances 0.000 description 37
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 36
- 238000009472 formulation Methods 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 34
- 238000012360 testing method Methods 0.000 description 33
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 30
- 230000006378 damage Effects 0.000 description 29
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 230000000694 effects Effects 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- 150000001448 anilines Chemical class 0.000 description 22
- 241000196324 Embryophyta Species 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 21
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 20
- 229920006395 saturated elastomer Polymers 0.000 description 20
- 241000221785 Erysiphales Species 0.000 description 19
- 239000002904 solvent Substances 0.000 description 17
- 239000004563 wettable powder Substances 0.000 description 17
- 240000007594 Oryza sativa Species 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 239000003513 alkali Substances 0.000 description 15
- 150000001342 alkaline earth metals Chemical class 0.000 description 15
- 238000006722 reduction reaction Methods 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 241000233866 Fungi Species 0.000 description 13
- 239000002585 base Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 230000009969 flowable effect Effects 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 235000007164 Oryza sativa Nutrition 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 235000009566 rice Nutrition 0.000 description 11
- 239000001632 sodium acetate Substances 0.000 description 11
- 235000017281 sodium acetate Nutrition 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 229910052801 chlorine Inorganic materials 0.000 description 10
- 238000011081 inoculation Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 10
- LPZZJKBLKQOBMZ-UHFFFAOYSA-N 2-(4-methylpentan-2-yl)aniline Chemical compound CC(C)CC(C)C1=CC=CC=C1N LPZZJKBLKQOBMZ-UHFFFAOYSA-N 0.000 description 9
- 241000123650 Botrytis cinerea Species 0.000 description 9
- 241000220225 Malus Species 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002671 adjuvant Substances 0.000 description 9
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 9
- 230000006911 nucleation Effects 0.000 description 9
- 238000010899 nucleation Methods 0.000 description 9
- 244000066764 Ailanthus triphysa Species 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- 240000008067 Cucumis sativus Species 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 8
- 150000002828 nitro derivatives Chemical class 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 7
- 240000001987 Pyrus communis Species 0.000 description 7
- 235000014443 Pyrus communis Nutrition 0.000 description 7
- 206010039509 Scab Diseases 0.000 description 7
- 241000209140 Triticum Species 0.000 description 7
- 235000021307 Triticum Nutrition 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 230000001276 controlling effect Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000010790 dilution Methods 0.000 description 6
- 239000012895 dilution Substances 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- 230000003902 lesion Effects 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 240000009088 Fragaria x ananassa Species 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 241000813090 Rhizoctonia solani Species 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000002917 insecticide Substances 0.000 description 5
- OHQRLPNHIRFOEU-UHFFFAOYSA-N 1-(3-methylbutyl)-2-nitrobenzene Chemical compound CC(C)CCC1=CC=CC=C1[N+]([O-])=O OHQRLPNHIRFOEU-UHFFFAOYSA-N 0.000 description 4
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 241000223600 Alternaria Species 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 241001330975 Magnaporthe oryzae Species 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- 241000317981 Podosphaera fuliginea Species 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 244000061458 Solanum melongena Species 0.000 description 4
- 235000002597 Solanum melongena Nutrition 0.000 description 4
- 241000228452 Venturia inaequalis Species 0.000 description 4
- 241000219094 Vitaceae Species 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 235000021021 grapes Nutrition 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 230000008635 plant growth Effects 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 3
- KFKVECZQALNWSR-UHFFFAOYSA-N 1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride Chemical compound CN1C=C(C(Cl)=O)C(C(F)(F)F)=N1 KFKVECZQALNWSR-UHFFFAOYSA-N 0.000 description 3
- JTOMQXXKQNNQIM-UHFFFAOYSA-N 2,4-dimethyl-1,3-thiazole-5-carbonyl chloride Chemical compound CC1=NC(C)=C(C(Cl)=O)S1 JTOMQXXKQNNQIM-UHFFFAOYSA-N 0.000 description 3
- RFVAXXMMLNCSIJ-UHFFFAOYSA-N 2-(3-methylbutyl)aniline Chemical compound CC(C)CCC1=CC=CC=C1N RFVAXXMMLNCSIJ-UHFFFAOYSA-N 0.000 description 3
- RRRNZSSVWZJCSC-UHFFFAOYSA-N 2-(3-methylpentyl)aniline Chemical compound CCC(C)CCC1=CC=CC=C1N RRRNZSSVWZJCSC-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XAGHOERSGQXGPB-UHFFFAOYSA-N 4-chloro-2-(4-methylpentan-2-yl)aniline Chemical compound CC(C)CC(C)C1=CC(Cl)=CC=C1N XAGHOERSGQXGPB-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000412366 Alternaria mali Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920000298 Cellophane Polymers 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 239000007818 Grignard reagent Substances 0.000 description 3
- 241001194823 Gymnosporangium asiaticum Species 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 206010027146 Melanoderma Diseases 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- 241000220324 Pyrus Species 0.000 description 3
- 241000221662 Sclerotinia Species 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- 235000002595 Solanum tuberosum Nutrition 0.000 description 3
- 101100020289 Xenopus laevis koza gene Proteins 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 235000021017 pears Nutrition 0.000 description 3
- 235000012015 potatoes Nutrition 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 230000004763 spore germination Effects 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 235000021012 strawberries Nutrition 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000001238 wet grinding Methods 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 2
- MDCCBJLCTOTLKM-UHFFFAOYSA-N 1-bromo-3-methylpentane Chemical compound CCC(C)CCBr MDCCBJLCTOTLKM-UHFFFAOYSA-N 0.000 description 2
- AIFOSNFDNBWXLL-UHFFFAOYSA-N 1-methyl-n-[2-(3-methylpentyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CCC(C)CCC1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F AIFOSNFDNBWXLL-UHFFFAOYSA-N 0.000 description 2
- ALCQWRSVKLBMAK-UHFFFAOYSA-N 1-methyl-n-[2-(4-methylpent-1-en-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CC(C)CC(=C)C1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F ALCQWRSVKLBMAK-UHFFFAOYSA-N 0.000 description 2
- JOTPMMADMYKHAD-UHFFFAOYSA-N 1-methyl-n-[2-(4-methylpent-2-en-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CC(C)C=C(C)C1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F JOTPMMADMYKHAD-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- VIPRCXZSMIWMGB-UHFFFAOYSA-N 2-(2-aminophenyl)-4-methylpentan-2-ol Chemical compound CC(C)CC(C)(O)C1=CC=CC=C1N VIPRCXZSMIWMGB-UHFFFAOYSA-N 0.000 description 2
- OIVVXEQMMSNPME-UHFFFAOYSA-N 2-(4-methylpent-1-en-2-yl)aniline Chemical compound CC(C)CC(=C)C1=CC=CC=C1N OIVVXEQMMSNPME-UHFFFAOYSA-N 0.000 description 2
- BLPHHNLBVZYIAN-UHFFFAOYSA-N 2-(4-methylpent-2-en-2-yl)aniline Chemical compound CC(C)C=C(C)C1=CC=CC=C1N BLPHHNLBVZYIAN-UHFFFAOYSA-N 0.000 description 2
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 2
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- XNXIYYFOYIUJIW-UHFFFAOYSA-N 3-methylbutylbenzene Chemical compound CC(C)CCC1=CC=CC=C1 XNXIYYFOYIUJIW-UHFFFAOYSA-N 0.000 description 2
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 2
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 2
- HLFWRHBKZHISBJ-UHFFFAOYSA-N 4-chloro-2-(3-methylpentyl)-1-nitrobenzene Chemical compound CCC(C)CCC1=CC(Cl)=CC=C1[N+]([O-])=O HLFWRHBKZHISBJ-UHFFFAOYSA-N 0.000 description 2
- XLGNNYPZHAFUQC-UHFFFAOYSA-N 4-chloro-2-(4-methylpentan-2-yl)-1-nitrobenzene Chemical compound CC(C)CC(C)C1=CC(Cl)=CC=C1[N+]([O-])=O XLGNNYPZHAFUQC-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 240000006108 Allium ampeloprasum Species 0.000 description 2
- 235000005254 Allium ampeloprasum Nutrition 0.000 description 2
- 241000352690 Alternaria kikuchiana Species 0.000 description 2
- 241000213004 Alternaria solani Species 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 235000016623 Fragaria vesca Nutrition 0.000 description 2
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 2
- 241000223195 Fusarium graminearum Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 235000003228 Lactuca sativa Nutrition 0.000 description 2
- WLLGXSLBOPFWQV-UHFFFAOYSA-N MGK 264 Chemical compound C1=CC2CC1C1C2C(=O)N(CC(CC)CCCC)C1=O WLLGXSLBOPFWQV-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241000083073 Neopseudocercosporella capsellae Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 241000315044 Passalora arachidicola Species 0.000 description 2
- 241001115351 Physalospora Species 0.000 description 2
- 241001337928 Podosphaera leucotricha Species 0.000 description 2
- 241001294742 Podosphaera macularis Species 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- 240000005809 Prunus persica Species 0.000 description 2
- 235000006040 Prunus persica var persica Nutrition 0.000 description 2
- 241000221696 Sclerotinia sclerotiorum Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 241001669638 Venturia nashicola Species 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 235000021016 apples Nutrition 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 2
- 239000000292 calcium oxide Substances 0.000 description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000010432 cotyledon development Effects 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000004465 cycloalkenyloxy group Chemical group 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000006298 dechlorination reaction Methods 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 2
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 230000005087 leaf formation Effects 0.000 description 2
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 2
- 239000011654 magnesium acetate Substances 0.000 description 2
- 235000011285 magnesium acetate Nutrition 0.000 description 2
- 229940069446 magnesium acetate Drugs 0.000 description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 2
- 239000001095 magnesium carbonate Substances 0.000 description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- RCNSTAUWVCCADW-UHFFFAOYSA-N n-[4-chloro-2-(3-methylpentyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CCC(C)CCC1=CC(Cl)=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F RCNSTAUWVCCADW-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- DQJCHOQLCLEDLL-UHFFFAOYSA-N tricyclazole Chemical compound CC1=CC=CC2=C1N1C=NN=C1S2 DQJCHOQLCLEDLL-UHFFFAOYSA-N 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XAAYNJHJDDETLW-UHFFFAOYSA-N 1-(3-methylbutyl)-4-nitrobenzene Chemical compound CC(C)CCC1=CC=C([N+]([O-])=O)C=C1 XAAYNJHJDDETLW-UHFFFAOYSA-N 0.000 description 1
- ODECLJLPAXGUIK-UHFFFAOYSA-N 1-methyl-n-[2-(3-methylbutyl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CC(C)CCC1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F ODECLJLPAXGUIK-UHFFFAOYSA-N 0.000 description 1
- JILLWYOFJGHBEP-UHFFFAOYSA-N 1-methyl-n-[2-(4-methylpentan-2-yl)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F JILLWYOFJGHBEP-UHFFFAOYSA-N 0.000 description 1
- QCONQRVTJOOYNC-UHFFFAOYSA-N 2,4-dimethyl-n-[2-(4-methylpentan-2-yl)phenyl]-1,3-thiazole-5-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=C(C)N=C(C)S1 QCONQRVTJOOYNC-UHFFFAOYSA-N 0.000 description 1
- STMIIPIFODONDC-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(O)(CCCC)CN1C=NC=N1 STMIIPIFODONDC-UHFFFAOYSA-N 0.000 description 1
- IUXIOXCOPJFKMQ-UHFFFAOYSA-N 2-bromo-4-methylpentane Chemical compound CC(C)CC(C)Br IUXIOXCOPJFKMQ-UHFFFAOYSA-N 0.000 description 1
- WNJINNZMSVNKJD-UHFFFAOYSA-N 2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl chloride Chemical group CC1=NC(C(F)(F)F)=C(C(Cl)=O)S1 WNJINNZMSVNKJD-UHFFFAOYSA-N 0.000 description 1
- YXXCCCPDDJEBJN-UHFFFAOYSA-N 2-methyl-n-[2-(4-methylpentan-2-yl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=C(C(F)(F)F)N=C(C)S1 YXXCCCPDDJEBJN-UHFFFAOYSA-N 0.000 description 1
- IKOOGXUHKYHAEJ-UHFFFAOYSA-N 3-(difluoromethyl)-1-methyl-n-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=CN(C)N=C1C(F)F IKOOGXUHKYHAEJ-UHFFFAOYSA-N 0.000 description 1
- MZGPCLIDFPCPTI-UHFFFAOYSA-N 3-(difluoromethyl)-1-methylpyrazole-4-carbonyl chloride Chemical compound CN1C=C(C(Cl)=O)C(C(F)F)=N1 MZGPCLIDFPCPTI-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- HWENYBAJCFKJIN-UHFFFAOYSA-N 4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carbonyl chloride Chemical compound CC1=NC(C(F)F)=C(C(Cl)=O)S1 HWENYBAJCFKJIN-UHFFFAOYSA-N 0.000 description 1
- YAHPDEIJZQWSRF-UHFFFAOYSA-N 4-(difluoromethyl)-2-methyl-n-[2-(4-methylpentan-2-yl)phenyl]-1,3-thiazole-5-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=C(C(F)F)N=C(C)S1 YAHPDEIJZQWSRF-UHFFFAOYSA-N 0.000 description 1
- GXFUKKNSDKUJBR-UHFFFAOYSA-N 4-chloro-2-(3-methylpentyl)aniline Chemical compound CCC(C)CCC1=CC(Cl)=CC=C1N GXFUKKNSDKUJBR-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000212251 Alternaria dauci Species 0.000 description 1
- 241000266416 Alternaria japonica Species 0.000 description 1
- 241000323752 Alternaria longipes Species 0.000 description 1
- 241000212254 Alternaria porri Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 235000021537 Beetroot Nutrition 0.000 description 1
- 241001450781 Bipolaris oryzae Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000895523 Blumeria graminis f. sp. hordei Species 0.000 description 1
- 241001465180 Botrytis Species 0.000 description 1
- 235000010149 Brassica rapa subsp chinensis Nutrition 0.000 description 1
- 235000000536 Brassica rapa subsp pekinensis Nutrition 0.000 description 1
- 241000499436 Brassica rapa subsp. pekinensis Species 0.000 description 1
- 241000219193 Brassicaceae Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241001157813 Cercospora Species 0.000 description 1
- 241000530549 Cercospora beticola Species 0.000 description 1
- 241001658057 Cercospora kikuchii Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- 241000222290 Cladosporium Species 0.000 description 1
- 238000006214 Clemmensen reduction reaction Methods 0.000 description 1
- 241001133184 Colletotrichum agaves Species 0.000 description 1
- 241000152100 Colletotrichum horii Species 0.000 description 1
- 241001120669 Colletotrichum lindemuthianum Species 0.000 description 1
- 241000222235 Colletotrichum orbiculare Species 0.000 description 1
- 241000998302 Colletotrichum tabaci Species 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 241000219104 Cucurbitaceae Species 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- 208000001840 Dandruff Diseases 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241001508802 Diaporthe Species 0.000 description 1
- 239000005947 Dimethoate Substances 0.000 description 1
- 235000011511 Diospyros Nutrition 0.000 description 1
- 241000723267 Diospyros Species 0.000 description 1
- 241000663351 Diplocarpon rosae Species 0.000 description 1
- 241001523339 Discula theae-sinensis Species 0.000 description 1
- AIGRXSNSLVJMEA-UHFFFAOYSA-N EPN Chemical compound C=1C=CC=CC=1P(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-UHFFFAOYSA-N 0.000 description 1
- 241000901048 Elsinoe ampelina Species 0.000 description 1
- 241001568757 Elsinoe glycines Species 0.000 description 1
- 241001564064 Elsinoe theae Species 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- 241001489205 Erysiphe pisi Species 0.000 description 1
- 241001411323 Exobasidium reticulatum Species 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000221778 Fusarium fujikuroi Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000221557 Gymnosporangium Species 0.000 description 1
- 241001540851 Gymnosporangium yamadae Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWKSKIMOESPYIA-BYPYZUCNSA-N L-N-acetyl-Cysteine Chemical compound CC(=O)N[C@@H](CS)C(O)=O PWKSKIMOESPYIA-BYPYZUCNSA-N 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000081841 Malus domestica Species 0.000 description 1
- 208000003351 Melanosis Diseases 0.000 description 1
- 239000005807 Metalaxyl Substances 0.000 description 1
- 239000005916 Methomyl Substances 0.000 description 1
- 241000862466 Monilinia laxa Species 0.000 description 1
- 241001459558 Monographella nivalis Species 0.000 description 1
- 241000131448 Mycosphaerella Species 0.000 description 1
- 241001433116 Mycosphaerella nawae Species 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001668536 Oculimacula yallundae Species 0.000 description 1
- 241000736122 Parastagonospora nodorum Species 0.000 description 1
- 241001098206 Phakopsora ampelopsidis Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241001480007 Phomopsis Species 0.000 description 1
- 241001557902 Phomopsis sp. Species 0.000 description 1
- 241000579813 Phyllactinia Species 0.000 description 1
- 241001270527 Phyllosticta citrullina Species 0.000 description 1
- 239000005923 Pirimicarb Substances 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 241000896203 Podosphaera pannosa Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000005820 Prochloraz Substances 0.000 description 1
- 241000301598 Pseudocercospora kaki Species 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 241001246058 Puccinia allii Species 0.000 description 1
- 241000221301 Puccinia graminis Species 0.000 description 1
- 241001123559 Puccinia hordei Species 0.000 description 1
- 241000312975 Puccinia horiana Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 241001123583 Puccinia striiformis Species 0.000 description 1
- 241000228454 Pyrenophora graminea Species 0.000 description 1
- 241000520648 Pyrenophora teres Species 0.000 description 1
- 241000231139 Pyricularia Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241001515786 Rhynchosporium Species 0.000 description 1
- 241001515790 Rhynchosporium secalis Species 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000109329 Rosa xanthina Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- OUNSASXJZHBGAI-UHFFFAOYSA-N Salithion Chemical compound C1=CC=C2OP(OC)(=S)OCC2=C1 OUNSASXJZHBGAI-UHFFFAOYSA-N 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- 241000336765 Septoria chrysanthemella Species 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 241000227724 Sphaceloma Species 0.000 description 1
- 241000579741 Sphaerotheca <fungi> Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 239000005842 Thiophanate-methyl Substances 0.000 description 1
- 239000005858 Triflumizole Substances 0.000 description 1
- 241000051572 Typhula sp. Species 0.000 description 1
- 241000007070 Ustilago nuda Species 0.000 description 1
- 241000233791 Ustilago tritici Species 0.000 description 1
- 241001512566 Valsa mali Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241001669640 Venturia carpophila Species 0.000 description 1
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 1
- 241001360088 Zymoseptoria tritici Species 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000005012 alkyl thioether group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940053202 antiepileptics carboxamide derivative Drugs 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920006184 cellulose methylcellulose Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 230000009194 climbing Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- YREQHYQNNWYQCJ-UHFFFAOYSA-N etofenprox Chemical compound C1=CC(OCC)=CC=C1C(C)(C)COCC1=CC=CC(OC=2C=CC=CC=2)=C1 YREQHYQNNWYQCJ-UHFFFAOYSA-N 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- DIRFUJHNVNOBMY-UHFFFAOYSA-N fenobucarb Chemical compound CCC(C)C1=CC=CC=C1OC(=O)NC DIRFUJHNVNOBMY-UHFFFAOYSA-N 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 244000000004 fungal plant pathogen Species 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000000750 industrial fungicide Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 235000014413 iron hydroxide Nutrition 0.000 description 1
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- QPPQHRDVPBTVEV-UHFFFAOYSA-N isopropyl dihydrogen phosphate Chemical compound CC(C)OP(O)(O)=O QPPQHRDVPBTVEV-UHFFFAOYSA-N 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 230000011890 leaf development Effects 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- DQDWATOXYCARFV-UHFFFAOYSA-M magnesium;2-methanidylpropane;bromide Chemical compound [Mg+2].[Br-].CC(C)[CH2-] DQDWATOXYCARFV-UHFFFAOYSA-M 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- UHXUZOCRWCRNSJ-QPJJXVBHSA-N methomyl Chemical compound CNC(=O)O\N=C(/C)SC UHXUZOCRWCRNSJ-QPJJXVBHSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- VOEYXMAFNDNNED-UHFFFAOYSA-N metolcarb Chemical compound CNC(=O)OC1=CC=CC(C)=C1 VOEYXMAFNDNNED-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- FTKBGTQXUNIPOP-UHFFFAOYSA-N n-(2-butan-2-ylphenyl)-1,3-dimethylpyrazole-4-carboxamide Chemical compound CCC(C)C1=CC=CC=C1NC(=O)C1=CN(C)N=C1C FTKBGTQXUNIPOP-UHFFFAOYSA-N 0.000 description 1
- CRVRNQAFZPGVBT-UHFFFAOYSA-N n-[4-chloro-2-(4-methylpentan-2-yl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound CC(C)CC(C)C1=CC(Cl)=CC=C1NC(=O)C1=CN(C)N=C1C(F)(F)F CRVRNQAFZPGVBT-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- UWVQIROCRJWDKL-UHFFFAOYSA-N oxadixyl Chemical compound CC=1C=CC=C(C)C=1N(C(=O)COC)N1CCOC1=O UWVQIROCRJWDKL-UHFFFAOYSA-N 0.000 description 1
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XAMUDJHXFNRLCY-UHFFFAOYSA-N phenthoate Chemical compound CCOC(=O)C(SP(=S)(OC)OC)C1=CC=CC=C1 XAMUDJHXFNRLCY-UHFFFAOYSA-N 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 description 1
- QXJKBPAVAHBARF-BETUJISGSA-N procymidone Chemical compound O=C([C@]1(C)C[C@@]1(C1=O)C)N1C1=CC(Cl)=CC(Cl)=C1 QXJKBPAVAHBARF-BETUJISGSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000011802 pulverized particle Substances 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- CXJSOEPQXUCJSA-UHFFFAOYSA-N pyridaphenthion Chemical compound N1=C(OP(=S)(OCC)OCC)C=CC(=O)N1C1=CC=CC=C1 CXJSOEPQXUCJSA-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- HSMVPDGQOIQYSR-KGENOOAVSA-N triflumizole Chemical compound C1=CN=CN1C(/COCCC)=N/C1=CC=C(Cl)C=C1C(F)(F)F HSMVPDGQOIQYSR-KGENOOAVSA-N 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/24—Radicals substituted by oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/56—1,2-Diazoles; Hydrogenated 1,2-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
- A01N43/78—1,3-Thiazoles; Hydrogenated 1,3-thiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/45—Monoamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Pest Control & Pesticides (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP21572496 | 1996-08-15 | ||
| JP09059106 | 1997-03-13 | ||
| JP9338820A JPH10251240A (ja) | 1996-08-15 | 1997-12-09 | 置換カルボン酸アニリド誘導体およびこれを有効成分とする農園芸用殺菌剤 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69708004D1 DE69708004D1 (de) | 2001-12-13 |
| DE69708004T2 true DE69708004T2 (de) | 2002-04-18 |
Family
ID=34084202
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69708004T Expired - Lifetime DE69708004T2 (de) | 1996-08-15 | 1997-08-14 | Substituiertes Carboxanilid-Derivat und dieses als aktiven Bestandteil enthaltendes Mittel zur Bekämpfung von Pflanzenkrankheiten |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US5914344A (https=) |
| EP (1) | EP0824099B1 (https=) |
| JP (2) | JP3982879B2 (https=) |
| KR (1) | KR100281248B1 (https=) |
| CN (2) | CN1067063C (https=) |
| CA (1) | CA2213111C (https=) |
| DE (1) | DE69708004T2 (https=) |
| ES (1) | ES2164972T3 (https=) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP4517454B2 (ja) * | 2000-06-01 | 2010-08-04 | 宇部興産株式会社 | 4−(1−フルオロエチル)チアゾール−5−カルボン酸アミド誘導体及び農園芸用の有害生物防除剤 |
| US7105565B2 (en) | 2000-11-08 | 2006-09-12 | Syngenta Crop Protection, Inc. | Pyrrolcarboxamides and pyrrolcarbothioamides and their agrochemical uses |
| GB0101996D0 (en) | 2001-01-25 | 2001-03-14 | Syngenta Participations Ag | Organtic compounds |
| ATE536345T1 (de) | 2001-05-31 | 2011-12-15 | Nihon Nohyaku Co Ltd | Substituierte anilidderivate, deren zwischenprodukte, chemikalien für die landwirtschaft und den gartenbau und deren verwendung |
| DE10136065A1 (de) * | 2001-07-25 | 2003-02-13 | Bayer Cropscience Ag | Pyrazolylcarboxanilide |
| DE10229595A1 (de) * | 2002-07-02 | 2004-01-15 | Bayer Cropscience Ag | Phenylbenzamide |
| DE10303589A1 (de) * | 2003-01-29 | 2004-08-12 | Bayer Cropscience Ag | Pyrazolylcarboxanilide |
| PL378118A1 (pl) * | 2003-02-14 | 2006-03-06 | Bayer Cropscience Aktiengesellschaft | Oksatiinokarboksyamisy |
| KR20060017605A (ko) * | 2003-05-21 | 2006-02-24 | 바이엘 크롭사이언스 아게 | 디플루오로메틸벤즈아닐리드, 미생물을 구제하기 위한 그의용도, 중간체 생성물 및 그의 용도 |
| DE10325438A1 (de) * | 2003-05-21 | 2004-12-09 | Bayer Cropscience Ag | Difluormethylbenzanilide |
| WO2004103975A1 (de) * | 2003-05-21 | 2004-12-02 | Bayer Cropscience Aktiengesellschaft | Iodpyrazolylcarboxanilide |
| US20060178513A1 (en) * | 2003-07-10 | 2006-08-10 | Ralf Dunkel | Pyridinylanilides |
| MXPA06004308A (es) * | 2003-10-23 | 2006-06-05 | Bayer Cropscience Ag | Isopentilcarboxanilidas para la lucha contra los microorganismos indeseables. |
| DE10349501A1 (de) * | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10352067A1 (de) * | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Isopentylcarboxanilide |
| DE10349497A1 (de) * | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | N-substituierte Pyrazolylcarboxanilide |
| DE10349502A1 (de) * | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | 1,3-Dimethylbutylcarboxanilide |
| DE102004005786A1 (de) * | 2004-02-06 | 2005-08-25 | Bayer Cropscience Ag | Haloalkylcarboxamide |
| DE102004005787A1 (de) | 2004-02-06 | 2005-08-25 | Bayer Cropscience Ag | Carboxamide |
| DE102004005785A1 (de) | 2004-02-06 | 2005-08-25 | Bayer Cropscience Ag | 2-Halogenfuryl/thienyl-3-carboxamide |
| JP2006076990A (ja) | 2004-03-12 | 2006-03-23 | Bayer Cropscience Ag | 殺虫性ベンゼンジカルボキサミド類 |
| DE102004029972A1 (de) * | 2004-06-21 | 2006-01-05 | Bayer Cropscience Ag | Beizmittel zur Bekämpfung von phytopathogenen Pilzen |
| GB0418048D0 (en) * | 2004-08-12 | 2004-09-15 | Syngenta Participations Ag | Method for protecting useful plants or plant propagation material |
| DE102005009457A1 (de) | 2005-03-02 | 2006-09-07 | Bayer Cropscience Ag | Verfahren zum Herstellen von Alkylaniliden |
| DE102005009458A1 (de) * | 2005-03-02 | 2006-09-07 | Bayer Cropscience Ag | Pyrazolylcarboxanilide |
| DE102005015850A1 (de) | 2005-04-07 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005022147A1 (de) * | 2005-04-28 | 2006-11-02 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| EP1721899A1 (en) * | 2005-05-13 | 2006-11-15 | Bayer CropScience S.A. | Process for the preparation of a carboxamide derivative |
| DE102005025989A1 (de) * | 2005-06-07 | 2007-01-11 | Bayer Cropscience Ag | Carboxamide |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| EA201270781A1 (ru) | 2005-06-09 | 2013-09-30 | Байер Кропсайенс Аг | Комбинации биологически активных веществ |
| KR20080033280A (ko) * | 2005-07-18 | 2008-04-16 | 신젠타 파티서페이션즈 아게 | 살미생물제로서의 피라졸-4-카복스아미드 유도체 |
| DE102005035300A1 (de) * | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005060467A1 (de) * | 2005-12-17 | 2007-06-21 | Bayer Cropscience Ag | Carboxamide |
| JPWO2007125749A1 (ja) * | 2006-04-26 | 2009-09-10 | 日本農薬株式会社 | ピラジンカルボキサミド誘導体及びこれを含有する植物病害防除剤 |
| DE102006033091A1 (de) * | 2006-07-14 | 2008-01-24 | Bayer Cropscience Ag | Verfahren zum Herstellen von in 1'-Stellung unverzweigten Alkenylnitrobenzolderivaten |
| DE102006033092A1 (de) | 2006-07-14 | 2008-01-24 | Bayer Cropscience Ag | Verfahren zum Herstellen von in 1'-Stellung unverzweigten Alkylnitrobenzolen und Alkylanilinen aus Nitrotoluolen |
| DE102006033090A1 (de) * | 2006-07-14 | 2008-01-24 | Bayer Cropscience Ag | Verfahren zum Herstellen von Alkylaniliden aus Halogenbenzolderivaten |
| WO2008017443A1 (en) * | 2006-08-08 | 2008-02-14 | Syngenta Participations Ag | Process for the production of aromatic amines in the presence of a palladium complex comprising a ferrocenyl biphosphine ligand |
| EP2109362A2 (en) * | 2007-02-14 | 2009-10-21 | Basf Se | Method of inducing virus tolerance of plants |
| ATE528278T1 (de) * | 2007-08-30 | 2011-10-15 | Albemarle Corp | Herstellung von 2-(1,3-dimethylbutyl)anilin und anderen verzweigten, alkylsubstituierten anilinen |
| JP2011511033A (ja) | 2008-02-05 | 2011-04-07 | ビーエーエスエフ ソシエタス・ヨーロピア | 植物体健康組成物 |
| WO2009098218A2 (en) * | 2008-02-05 | 2009-08-13 | Basf Se | Plant health composition |
| NZ600886A (en) | 2009-12-08 | 2013-06-28 | Basf Se | An agrochemical pesticidal mixture for increasing the yield and health of a plant |
| US8748342B2 (en) | 2009-12-08 | 2014-06-10 | Basf Se | Pesticidal mixtures |
| ES2567266T3 (es) | 2010-05-28 | 2016-04-21 | Basf Se | Mezclas de pesticidas |
| US8987470B2 (en) | 2010-10-27 | 2015-03-24 | Solvay Sa | Process for the preparation of pyrazole-4-carboxamides |
| CN103391925B (zh) | 2010-11-15 | 2017-06-06 | 拜耳知识产权有限责任公司 | 5‑卤代吡唑甲酰胺 |
| EP2980078A1 (en) | 2014-07-29 | 2016-02-03 | Solvay SA | Process for the preparation of pyrazole-4-carboxamides |
| CN104628646B (zh) * | 2015-02-16 | 2017-11-07 | 中国科学院上海有机化学研究所 | N‑吡唑基甲酰苯胺类化合物、中间体、组合物、制备方法及应用 |
| CN106674021B (zh) * | 2015-11-05 | 2019-03-08 | 联化科技(盐城)有限公司 | 一种取代苯胺的制备方法 |
| KR20230146389A (ko) | 2022-04-12 | 2023-10-19 | 세종대학교산학협력단 | 밀 도열병 저항성 증진 또는 개선용 조성물 및 밀 도열병 저항성 증진 또는 개선 방법 |
| CN119143613A (zh) * | 2024-11-15 | 2024-12-17 | 浙江工业大学 | 一种2-(3-甲基-1-亚甲基丁基)苯胺的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL103614A (en) * | 1991-11-22 | 1998-09-24 | Basf Ag | Carboxamides for controlling botrytis and certain novel such compounds |
| DE4231517A1 (de) * | 1992-09-21 | 1994-03-24 | Basf Ag | Carbonsäureanilide, Verfahren zu ihrer Herstellung und sie enthaltende Mittel zur Bekämpfung von Schadpilzen |
-
1997
- 1997-08-07 JP JP21346197A patent/JP3982879B2/ja not_active Expired - Lifetime
- 1997-08-07 US US08/908,187 patent/US5914344A/en not_active Expired - Lifetime
- 1997-08-14 KR KR1019970038982A patent/KR100281248B1/ko not_active Expired - Lifetime
- 1997-08-14 EP EP97114124A patent/EP0824099B1/en not_active Expired - Lifetime
- 1997-08-14 CA CA002213111A patent/CA2213111C/en not_active Expired - Lifetime
- 1997-08-14 ES ES97114124T patent/ES2164972T3/es not_active Expired - Lifetime
- 1997-08-14 DE DE69708004T patent/DE69708004T2/de not_active Expired - Lifetime
- 1997-08-15 CN CN97118681A patent/CN1067063C/zh not_active Expired - Lifetime
- 1997-12-09 JP JP9338820A patent/JPH10251240A/ja active Pending
-
1998
- 1998-09-09 US US09/150,170 patent/US5965774A/en not_active Expired - Lifetime
-
2000
- 2000-08-26 CN CN00126258A patent/CN1338452A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CN1338452A (zh) | 2002-03-06 |
| JPH10251240A (ja) | 1998-09-22 |
| KR19980018703A (ko) | 1998-06-05 |
| KR100281248B1 (ko) | 2001-02-01 |
| CN1067063C (zh) | 2001-06-13 |
| CN1178791A (zh) | 1998-04-15 |
| US5965774A (en) | 1999-10-12 |
| EP0824099B1 (en) | 2001-11-07 |
| ES2164972T3 (es) | 2002-03-01 |
| US5914344A (en) | 1999-06-22 |
| JP3982879B2 (ja) | 2007-09-26 |
| EP0824099A1 (en) | 1998-02-18 |
| DE69708004D1 (de) | 2001-12-13 |
| CA2213111C (en) | 2001-03-20 |
| JPH10310577A (ja) | 1998-11-24 |
| CA2213111A1 (en) | 1998-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69708004T2 (de) | Substituiertes Carboxanilid-Derivat und dieses als aktiven Bestandteil enthaltendes Mittel zur Bekämpfung von Pflanzenkrankheiten | |
| AU622640B2 (en) | Heterocyclic substituted dihaloisonicotinicacidamides for protecting plants against microorganisms | |
| DE3881478T2 (de) | Substituierte carbonsaeure-derivate, verfahren zu ihrer herstellung und diese enthaltende fungizide fuer acker- und gartenbau. | |
| DE3812967A1 (de) | Azolylmethyl-cyclopropyl-derivate | |
| EP0071568B1 (de) | Mandelsäure-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Mikroorganismen | |
| DE3713774C2 (de) | Pyrazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| DE3883695T2 (de) | Amid-Derivate, Verfahren zu deren Herstellung sowie diese enthaltende Fungizide in der Agrikultur und im Gartenbau. | |
| DE3779836T2 (de) | Iodopropargylcarbamat-derivate, herstellungsverfahren und fungizide mittel, die diese verbindungen enthalten. | |
| EP0310558A2 (de) | Mikrobizide Mittel | |
| DE2734365A1 (de) | Heterocyclische verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende fungizide zusammensetzungen | |
| DE69409611T2 (de) | Dithiocarbonimidderivate als Fungizide, Insektizide und Akarizide | |
| DE69402223T2 (de) | Antimikrobielle und fungizide Zusammensetzungen enthaltend Siliziumverbindungen, und ihre Verwendung in der Landwirtschaft und in Gartenbau | |
| JPH06172348A (ja) | 有害生物防除剤 | |
| SK5992002A3 (en) | Oxime O-ether compounds and fungicides for agricultural and horticultural use | |
| EP0334813B1 (de) | Mittel zum Schutz von Pflanzen gegen Krankheiten | |
| DE69528855T2 (de) | Pyrazolin-Derivate zur Bekämpfung von Pflanzenkrankheiten | |
| DD151403A5 (de) | Pflanzenfugizides mittel | |
| AU616176B2 (en) | Substituted isonicotinoylpyridinylhydrazine derivatives, the preparation thereof, compositions containing them and their use in the protection of plants against attack by harmful microorganisms | |
| DE68903918T2 (de) | Pyrazolverbindungen, verfahren zu deren herstellung, deren anwendung und zwischenprodukte fuer deren herstellung. | |
| DE3872634T2 (de) | Thiadiazine, verfahren zu deren herstellung und insektizide. | |
| CA1180334A (en) | N-sulphenylated biurets, processes for their preparation and their use as fungicides | |
| US5356899A (en) | Substituted hydroxyalkylpyridines | |
| DE3901723A1 (de) | Azolyl-derivate | |
| JP2002363164A (ja) | ピラゾールカルボキサミド類、その中間体およびこれを有効成分とする有害生物防除剤 | |
| DE69605529T2 (de) | Thiazol-derivate, diese enthaltende herbizide und verfahren zu deren anwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Representative=s name: PFENNING MEINIG & PARTNER GBR, 80339 MUENCHEN |
|
| 8328 | Change in the person/name/address of the agent |
Representative=s name: MAIWALD PATENTANWALTSGESELLSCHAFT MBH, 80335 MUENC |