DE6752717U - Vorrichtung zur geraeuschdaempfung von antriebsmaschinen - Google Patents
Vorrichtung zur geraeuschdaempfung von antriebsmaschinenInfo
- Publication number
- DE6752717U DE6752717U DE19686752717 DE6752717U DE6752717U DE 6752717 U DE6752717 U DE 6752717U DE 19686752717 DE19686752717 DE 19686752717 DE 6752717 U DE6752717 U DE 6752717U DE 6752717 U DE6752717 U DE 6752717U
- Authority
- DE
- Germany
- Prior art keywords
- box
- outlet
- prime mover
- inner box
- air
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011358 absorbing material Substances 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000004744 fabric Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- 239000007789 gas Substances 0.000 description 4
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F02—COMBUSTION ENGINES; HOT-GAS OR COMBUSTION-PRODUCT ENGINE PLANTS
- F02B—INTERNAL-COMBUSTION PISTON ENGINES; COMBUSTION ENGINES IN GENERAL
- F02B77/00—Component parts, details or accessories, not otherwise provided for
- F02B77/11—Thermal or acoustic insulation
- F02B77/13—Acoustic insulation
Landscapes
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Acoustics & Sound (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Exhaust Silencers (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3859767A GB1166140A (en) | 1967-08-22 | 1967-08-22 | Apparatus for silencing an engine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE6752717U true DE6752717U (de) | 1969-03-13 |
Family
ID=10404494
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19686752717 Expired DE6752717U (de) | 1967-08-22 | 1968-08-20 | Vorrichtung zur geraeuschdaempfung von antriebsmaschinen |
Country Status (4)
| Country | Link |
|---|---|
| DE (1) | DE6752717U (enExample) |
| FR (1) | FR1577688A (enExample) |
| GB (1) | GB1166140A (enExample) |
| SE (1) | SE328307B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2400990A1 (de) * | 1973-06-19 | 1975-02-13 | Graco Inc | Schalldaempfer fuer druckluftmotor |
| DE2804653A1 (de) * | 1978-01-24 | 1979-08-09 | Bjoern Olov Erling Olofsson | Vorrichtung zur kuehlung und geraeuschdaempfung von kompressoren und vakuumpumpen |
| DE4321382A1 (de) * | 1993-06-26 | 1995-01-05 | Mtu Friedrichshafen Gmbh | Energiesysteme mit Gasturbinen |
| DE19904839A1 (de) * | 1999-02-08 | 2000-08-17 | Sachsenring Maschinenbau Gmbh | Kompressoranlage, vorzugsweise zum stationären Einsatz |
| DE102006040878A1 (de) * | 2006-08-31 | 2008-03-13 | Bayerische Motoren Werke Ag | Lagerungsanordnung einer Einheit von Hubkolbenmaschine und Motor |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4877529U (enExample) * | 1971-12-28 | 1973-09-25 | ||
| JPS5247767Y2 (enExample) * | 1972-06-19 | 1977-10-29 | ||
| JPS4927807A (enExample) * | 1972-07-08 | 1974-03-12 | ||
| SE369543B (enExample) * | 1973-08-27 | 1974-09-02 | Atlas Copco Ab | |
| JPS5064855U (enExample) * | 1973-10-16 | 1975-06-12 | ||
| JPS5066053U (enExample) * | 1973-10-19 | 1975-06-13 | ||
| JPS5098203U (enExample) * | 1974-01-14 | 1975-08-15 | ||
| JPS5131103U (enExample) * | 1974-08-29 | 1976-03-06 | ||
| DE2458629A1 (de) * | 1974-12-11 | 1976-06-24 | Hatz Motoren | Brennkraftmaschine mit geraeuschdaempfender umkleidung |
| DE2509065A1 (de) * | 1975-03-01 | 1976-09-09 | Volkswagenwerk Ag | Gehaeuseartige anordnung zur schalldaempfung |
| JPS5251939U (enExample) * | 1975-10-13 | 1977-04-14 | ||
| JPS5254736U (enExample) * | 1975-10-17 | 1977-04-20 | ||
| JPS5339806U (enExample) * | 1976-09-10 | 1978-04-06 | ||
| SE406955B (sv) * | 1977-06-23 | 1979-03-05 | Cederbaum Jerzy Henryk | Anordning vid en for ett tystgaende motorkraftaggregat avsedd ljudabsorptionskammare |
| AT365309B (de) * | 1977-08-18 | 1982-01-11 | List Hans | Brennkraftmaschine mit schalldaemmender verschalung |
| AT373364B (de) * | 1977-10-28 | 1984-01-10 | List Hans | Brennkraftmaschine mit schalldaemmender verschalung |
| AT350855B (de) * | 1977-11-23 | 1979-06-25 | List Hans | Brennkraftmaschine |
| DE2826145C2 (de) * | 1978-06-15 | 1986-04-10 | Volkswagen AG, 3180 Wolfsburg | Gekapselte Brennkraftmaschine, insbesondere für ein Kraftfahrzeug |
| US4264282A (en) * | 1979-01-03 | 1981-04-28 | K. C. Mosier Company | Air compressor apparatus including noise-reducing means |
| US4385678A (en) | 1979-02-23 | 1983-05-31 | Cederbaum Jerzy H | Silent-running internal combustion motor power unit |
| US4516657A (en) * | 1982-09-29 | 1985-05-14 | Allard Edward F | Sound suppression of engine noise |
| DE3636934A1 (de) * | 1986-10-30 | 1988-05-05 | Kloeckner Humboldt Deutz Ag | Doppelt gekapselte brennkraftmaschine |
| GB2266922A (en) * | 1992-05-05 | 1993-11-17 | Russell David Hill | Cooling an engine in a casing. |
| GB2351795B (en) * | 1998-10-19 | 2003-04-02 | Rhys Scrivener | Housing apparatus |
| GB2347399B (en) * | 1999-03-05 | 2003-04-09 | Draftex Ind Ltd | Improvements in or relating to engines |
| US6321557B1 (en) * | 1999-07-02 | 2001-11-27 | Rhys Scrivener | Housing apparatus |
| WO2007045030A1 (en) * | 2005-10-18 | 2007-04-26 | Ghd Pty Ltd | An engine enclosure |
| CN107328957A (zh) * | 2017-07-07 | 2017-11-07 | 深圳市信维通信股份有限公司 | 一种静音箱 |
| IT201800003062A1 (it) * | 2018-02-28 | 2019-08-28 | Ned S R L | Sistema per l'abbattimento della rumorosita' di un gruppo elettrogeno |
-
1967
- 1967-08-22 GB GB3859767A patent/GB1166140A/en not_active Expired
-
1968
- 1968-08-20 DE DE19686752717 patent/DE6752717U/de not_active Expired
- 1968-08-21 SE SE1127768A patent/SE328307B/xx unknown
- 1968-08-21 FR FR1577688D patent/FR1577688A/fr not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2400990A1 (de) * | 1973-06-19 | 1975-02-13 | Graco Inc | Schalldaempfer fuer druckluftmotor |
| DE2804653A1 (de) * | 1978-01-24 | 1979-08-09 | Bjoern Olov Erling Olofsson | Vorrichtung zur kuehlung und geraeuschdaempfung von kompressoren und vakuumpumpen |
| DE4321382A1 (de) * | 1993-06-26 | 1995-01-05 | Mtu Friedrichshafen Gmbh | Energiesysteme mit Gasturbinen |
| DE19904839A1 (de) * | 1999-02-08 | 2000-08-17 | Sachsenring Maschinenbau Gmbh | Kompressoranlage, vorzugsweise zum stationären Einsatz |
| DE19904839C2 (de) * | 1999-02-08 | 2003-10-16 | Zwickauer Maschinen Und Anlage | Kompressoranlage, vorzugsweise zum stationären Einsatz |
| DE102006040878A1 (de) * | 2006-08-31 | 2008-03-13 | Bayerische Motoren Werke Ag | Lagerungsanordnung einer Einheit von Hubkolbenmaschine und Motor |
| DE102006040878B4 (de) * | 2006-08-31 | 2010-07-01 | Bayerische Motoren Werke Aktiengesellschaft | Lagerungsanordnung einer Einheit von Hubkolbenmaschine und Motor |
Also Published As
| Publication number | Publication date |
|---|---|
| SE328307B (enExample) | 1970-09-14 |
| FR1577688A (enExample) | 1969-08-08 |
| GB1166140A (en) | 1969-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE6752717U (de) | Vorrichtung zur geraeuschdaempfung von antriebsmaschinen | |
| DE2129504C2 (de) | Heckteil für Omnibusse mit Heckmotor | |
| DE2441045A1 (de) | Schalldaemmgehaeuse fuer maschinenaggregate mit kuehler | |
| DE2349460A1 (de) | Vorrichtung zur schalldaemmung in rotationsmaschinen | |
| DE2424093A1 (de) | Stationaere kraftwerksanlage | |
| DE880823C (de) | Luftgekuehlte Brennkraftmaschine | |
| DE2703227A1 (de) | Geraeuschdaempfendes gehaeuse fuer eine brennkraftmaschine | |
| DE2509065A1 (de) | Gehaeuseartige anordnung zur schalldaempfung | |
| DE728617C (de) | Einrichtung an einem Luefter zur Verminderung des durch die Schwingungen des Luftstromes erzeugten Geraeusches durch Interferenzwirkung | |
| DE887917C (de) | Kuehlung verbrennungselektrischer Fahrzeugantriebe, insbesondere von Kettenfahrzeugen | |
| DE1669265U (de) | Ansaugschalldaempfer, insbesondere fuer brennkraftmaschinen, geblaese od. dgl. | |
| DE1476332A1 (de) | Wasserkuehlung eines Motors | |
| DE821727C (de) | Brennkraftmaschinen-Anlage | |
| DE903023C (de) | Ortsbewegliches Drucklufterzeugungsaggregat | |
| DE562452C (de) | Zweitakt-Brennkraftmaschine mit sternfoermig angeordneten Zylindern | |
| DE1292668B (de) | Schalldaempfer fuer in Rohren stroemende Gase | |
| DE1920774U (de) | Ansauggeraeuschdaempfer fuer v-kolbenkompressoren. | |
| DE866114C (de) | Brennkraftmaschine mit zwei Schleudergeblaesen fuer die Spuelung oder Aufladung | |
| AT143533B (de) | Elektrischer Staubsauger. | |
| DE913320C (de) | OElleitflaeche fuer elektrische Apparate | |
| DE899131C (de) | Zweitakt-Brennkraftmaschine in V-Anordnung der Zylinder mit Schleudergeblaese und Einspritzpumpe | |
| DE499192C (de) | Luftgekuehlte Brennkraftmaschine | |
| AT223435B (de) | Vorrichtung zur Kühlung des Motoröles bei wassergekühlten Brennkraftmaschinen | |
| DE922024C (de) | Zweitakt-Brennkraftmaschine mit Schleudergeblaese | |
| AT121623B (de) | Propellersauzuganlage mit Turbinenantrieb. |