DE4241177C2 - Rutschfester Kleiderbügel - Google Patents
Rutschfester KleiderbügelInfo
- Publication number
- DE4241177C2 DE4241177C2 DE4241177A DE4241177A DE4241177C2 DE 4241177 C2 DE4241177 C2 DE 4241177C2 DE 4241177 A DE4241177 A DE 4241177A DE 4241177 A DE4241177 A DE 4241177A DE 4241177 C2 DE4241177 C2 DE 4241177C2
- Authority
- DE
- Germany
- Prior art keywords
- hanger according
- garment
- friction material
- humps
- styrene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000002783 friction material Substances 0.000 claims description 14
- 229920001971 elastomer Polymers 0.000 claims description 13
- 239000005060 rubber Substances 0.000 claims description 13
- 239000000178 monomer Substances 0.000 claims description 10
- 239000011248 coating agent Substances 0.000 claims description 9
- 238000000576 coating method Methods 0.000 claims description 9
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- 229920001400 block copolymer Polymers 0.000 claims description 7
- 239000000725 suspension Substances 0.000 claims description 4
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims 1
- 239000012858 resilient material Substances 0.000 description 23
- 210000002445 nipple Anatomy 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 3
- 239000011115 styrene butadiene Substances 0.000 description 3
- VSKJLJHPAFKHBX-UHFFFAOYSA-N 2-methylbuta-1,3-diene;styrene Chemical compound CC(=C)C=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 VSKJLJHPAFKHBX-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000002174 Styrene-butadiene Substances 0.000 description 2
- FACXGONDLDSNOE-UHFFFAOYSA-N buta-1,3-diene;styrene Chemical compound C=CC=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 FACXGONDLDSNOE-UHFFFAOYSA-N 0.000 description 2
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 2
- 238000005108 dry cleaning Methods 0.000 description 2
- BXOUVIIITJXIKB-UHFFFAOYSA-N ethene;styrene Chemical group C=C.C=CC1=CC=CC=C1 BXOUVIIITJXIKB-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 238000010409 ironing Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 229920000468 styrene butadiene styrene block copolymer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- ROGIWVXWXZRRMZ-UHFFFAOYSA-N 2-methylbuta-1,3-diene;styrene Chemical compound CC(=C)C=C.C=CC1=CC=CC=C1 ROGIWVXWXZRRMZ-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000009191 jumping Effects 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- -1 silk Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000004758 synthetic textile Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000012549 training Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G25/00—Household implements used in connection with wearing apparel; Dress, hat or umbrella holders
- A47G25/14—Clothing hangers, e.g. suit hangers
- A47G25/28—Hangers characterised by their shape
- A47G25/30—Hangers characterised by their shape to prevent slipping-off of the clothes
Landscapes
- Holders For Apparel And Elements Relating To Apparel (AREA)
- Details Of Garments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80523591A | 1991-12-11 | 1991-12-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE4241177A1 DE4241177A1 (enExample) | 1993-06-17 |
| DE4241177C2 true DE4241177C2 (de) | 1999-12-23 |
Family
ID=25191012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4241177A Expired - Fee Related DE4241177C2 (de) | 1991-12-11 | 1992-12-08 | Rutschfester Kleiderbügel |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5535927A (enExample) |
| CA (1) | CA2084611C (enExample) |
| DE (1) | DE4241177C2 (enExample) |
| GB (1) | GB2262226B (enExample) |
| HK (1) | HK1007944A1 (enExample) |
| MX (1) | MX9207174A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE20103910U1 (de) | 2001-03-06 | 2001-06-13 | Karner-Batts GmbH, 97737 Gemünden | Kleider- und Wäschebügel |
| DE10015072A1 (de) * | 2000-03-25 | 2001-10-04 | Schneider Innovative Produkte | Kleiderbügel |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5785216A (en) * | 1991-05-29 | 1998-07-28 | Spotless Plastics Pty. Ltd. | Method of molding hangers and apparatus for implementing method |
| GB2285574B (en) * | 1994-01-10 | 1998-04-08 | Ferguson Hangers Ltd | A garment hanger |
| AUPM836594A0 (en) * | 1994-09-23 | 1994-10-20 | Brooking, Mark Llewelyn | Garment hanger |
| US5839629A (en) * | 1997-06-09 | 1998-11-24 | Carlisle Plastics, Inc. | Color-coded hanger assembly and apparatus for making same |
| US5890634A (en) * | 1997-12-18 | 1999-04-06 | Carlisle Plastics, Inc. | Hanger with snap-on non-slip pads |
| US6359068B1 (en) | 1998-02-18 | 2002-03-19 | 3M Innovative Properties Company | High-friction polymer blends comprising polypropylene and thermoplastic block copolymers |
| US6070772A (en) * | 1998-05-11 | 2000-06-06 | Red Wing Products | Non-slip garment hanger with a coordinate loop |
| US6073819A (en) * | 1999-03-11 | 2000-06-13 | Wing; Kathleen A | Flexible non slip garment hanger |
| US6328186B1 (en) | 1999-07-19 | 2001-12-11 | Kathleen A Wing | Formable garment hanger |
| GB2377369A (en) * | 2001-05-17 | 2003-01-15 | Jean Maureen Peck | Padded dress hanger |
| USD518653S1 (en) * | 2002-11-28 | 2006-04-11 | Jan Cornelis De Groot | Foldable clothes hanger |
| GB2397756B (en) * | 2003-01-30 | 2005-12-21 | Braitrim | Non-slip garment hanger |
| CA2487230A1 (en) * | 2003-11-12 | 2005-05-12 | Spotless Plastics Pty. Ltd. | Knitwear hanger |
| USD502326S1 (en) * | 2004-03-30 | 2005-03-01 | Lori Greiner | Garment hanger |
| US7182231B1 (en) * | 2004-04-08 | 2007-02-27 | Lori Greiner | Garment hanger |
| US7398902B1 (en) | 2004-10-21 | 2008-07-15 | The Accessory Corp. | Anti-slip garment hanger |
| US7249698B2 (en) * | 2005-01-25 | 2007-07-31 | The Accessory Corp. | Garment hangers with improved gripping pads and improved methods of manufacture |
| USD531824S1 (en) | 2005-09-21 | 2006-11-14 | Wai Shing Yau | Garment hanger with dependent loop |
| USD527194S1 (en) | 2005-10-21 | 2006-08-29 | Wai Shing Yau | Information tab mount for garment hanger |
| US7628302B2 (en) | 2006-01-12 | 2009-12-08 | Wai Shing Yau | Garment hanger with dependent loop and accessory hanger |
| USD530526S1 (en) | 2006-01-18 | 2006-10-24 | Wai Shing Yau | Accessory hanger |
| USD570614S1 (en) | 2006-02-17 | 2008-06-10 | Wai Shing Yau | Pinch clip grip |
| US20070246490A1 (en) * | 2006-02-21 | 2007-10-25 | Spotless Plastics Pty. Ltd. | Shoulder support for garment hangers |
| US7537142B2 (en) | 2006-04-12 | 2009-05-26 | Wai Shing Plastic Products Ltd. | Pinch clip garment hanger with modular friction pads |
| US20080179355A1 (en) * | 2006-12-05 | 2008-07-31 | The Build-Up Plastic & Metal Co., Ltd. | Non-slip garment hanger |
| US20110133503A1 (en) * | 2009-12-07 | 2011-06-09 | John Mezzalingua Associates, Inc. | Cable spool carrying device |
| US20130320051A1 (en) * | 2012-05-30 | 2013-12-05 | George John Madden | Garment hanger with adjustable shoulder section and non-slip crease free horizontal pants section |
| US20180163755A1 (en) * | 2015-01-05 | 2018-06-14 | Pit Bull Products, Inc. | Holder With Liner For A Rod |
| US10835068B2 (en) | 2018-05-01 | 2020-11-17 | Julia Nejeschleba | Slip-resistant multipurpose wardrobe hanger |
| WO2021011734A1 (en) | 2019-07-16 | 2021-01-21 | DriFlower, LLC | Vegetation hanger |
| CA3149878A1 (en) | 2019-09-30 | 2021-04-08 | Todd Chandler LARKINS | Hang harvesting system |
| US11937552B2 (en) * | 2019-10-09 | 2024-03-26 | DriFlower, LLC | Vegetation hanger |
| US11930929B2 (en) | 2021-03-03 | 2024-03-19 | DriFlower, LLC | Vegetation hanging and drying system |
| CA3151193A1 (en) | 2021-03-16 | 2022-09-16 | DriFlower, LLC | System for hang harvesting vegetation |
| US12239224B2 (en) | 2021-04-06 | 2025-03-04 | DriFlower, LLC | Vegetation hanging and drying system and brackets thereof |
| USD1014101S1 (en) * | 2022-01-20 | 2024-02-13 | Shenzhen Eieihome Technology Co., Ltd | Hanger |
| US11910758B2 (en) | 2022-01-24 | 2024-02-27 | DriFlower, LLC | Vegetation hanger |
| USD1030426S1 (en) | 2022-01-24 | 2024-06-11 | DriFlower, LLC | Vegetation hanger |
| US11871704B2 (en) | 2022-04-20 | 2024-01-16 | DriFlower, LLC | Bracket assemblies of vegetation hanging and drying systems |
| USD1037799S1 (en) | 2022-09-26 | 2024-08-06 | DriFlower, LLC | Vegetation hanger |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1321997A (en) * | 1919-06-23 | 1919-11-18 | Isadore Duberstein | Garment-hanger. |
| DE1683722U (de) * | 1954-07-06 | 1954-09-23 | Wilhelm Fleissner | Kleiderbuegel. |
| DE919842C (de) * | 1948-09-21 | 1954-11-04 | Boris Oumansky | Kleiderbuegel |
| US2912149A (en) * | 1955-11-22 | 1959-11-10 | Truman W Stuard | Garment hanger |
| US3168970A (en) * | 1962-04-18 | 1965-02-09 | Harry W Wilson | Garment hanger having slip preventing means |
| DE2846746A1 (de) * | 1977-12-26 | 1979-06-28 | Geb Kotakari Aya Wakuta | Kleiderbuegel |
| DE8618751U1 (de) * | 1986-07-12 | 1986-09-04 | union Sinram & Wendt GmbH & Co KG, 3250 Hameln | Rutschfester Kleiderbügel |
| EP0412670A2 (en) * | 1989-08-07 | 1991-02-13 | Batts, Inc. | Article gripping means and method of making same |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1252386B (enExample) * | ||||
| US2835442A (en) * | 1958-05-20 | Parnell | ||
| US1320445A (en) * | 1919-08-18 | 1919-11-04 | James B Atkinson | Hanger. |
| US1886126A (en) * | 1931-09-30 | 1932-11-01 | Sessions Ivy | Garment hanger |
| US2132895A (en) * | 1937-12-04 | 1938-10-11 | James F Fewster | Garment hanger |
| US2376269A (en) * | 1943-05-15 | 1945-05-15 | Orchard Paper Company | Garment hanger |
| US2622742A (en) * | 1949-03-19 | 1952-12-23 | Oldham Joseph | Garment hanger |
| US2875930A (en) * | 1956-09-10 | 1959-03-03 | Lerner Albert | Dual garment hangers |
| US2981451A (en) * | 1958-08-29 | 1961-04-25 | Marshall R Friedman | Garment hanger |
| FR1258892A (fr) * | 1960-03-07 | 1961-04-21 | Pierre Kaeuffer S A | Cintre à vêtements perfectionné |
| US3085724A (en) * | 1960-06-10 | 1963-04-16 | Cornel L Wilde | Coat hanger separator |
| US3257049A (en) * | 1964-05-11 | 1966-06-21 | Smith Lerner Ind Inc | Coat hanger |
| US3358891A (en) * | 1965-02-25 | 1967-12-19 | Walter G Rowe | Anti-slip attachment for garment hanger |
| US3306506A (en) * | 1965-03-12 | 1967-02-28 | Batts John T Inc | Garment hanger construction |
| US3480245A (en) * | 1967-10-12 | 1969-11-25 | Carl E Gingher | Hanger stem |
| US3679100A (en) * | 1969-09-04 | 1972-07-25 | Beatrice Foods Co | Molded plastic garment hanger |
| DE2457738C3 (de) * | 1974-12-06 | 1978-05-03 | Leifheit International Guenter Leifheit Gmbh, 5408 Nassau | Kleiderbügel aus Kunststoff |
| US4046293A (en) * | 1976-07-28 | 1977-09-06 | John Thomas Batts, Inc. | Detachable bar for garment hanger |
| US4586637A (en) * | 1984-06-22 | 1986-05-06 | Seymour Lemel | Slip preventing means for garment hangers |
| NL8900731A (nl) * | 1989-03-23 | 1990-10-16 | Hazenveld Martin Gerard | Kleerhanger of dergelijke. |
| GB2242122A (en) * | 1990-03-19 | 1991-09-25 | Morplan | Garment hangers |
| US5170916A (en) * | 1991-06-27 | 1992-12-15 | A & E Products Group, A Division Of Carlisle Plastics, Inc. | Anti-slip garment hanger |
-
1992
- 1992-12-04 CA CA002084611A patent/CA2084611C/en not_active Expired - Fee Related
- 1992-12-08 DE DE4241177A patent/DE4241177C2/de not_active Expired - Fee Related
- 1992-12-10 GB GB9225764A patent/GB2262226B/en not_active Expired - Fee Related
- 1992-12-11 MX MX9207174A patent/MX9207174A/es unknown
-
1994
- 1994-06-03 US US08/253,820 patent/US5535927A/en not_active Expired - Lifetime
-
1998
- 1998-06-27 HK HK98107115A patent/HK1007944A1/xx not_active IP Right Cessation
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1321997A (en) * | 1919-06-23 | 1919-11-18 | Isadore Duberstein | Garment-hanger. |
| DE919842C (de) * | 1948-09-21 | 1954-11-04 | Boris Oumansky | Kleiderbuegel |
| DE1683722U (de) * | 1954-07-06 | 1954-09-23 | Wilhelm Fleissner | Kleiderbuegel. |
| US2912149A (en) * | 1955-11-22 | 1959-11-10 | Truman W Stuard | Garment hanger |
| US3168970A (en) * | 1962-04-18 | 1965-02-09 | Harry W Wilson | Garment hanger having slip preventing means |
| DE2846746A1 (de) * | 1977-12-26 | 1979-06-28 | Geb Kotakari Aya Wakuta | Kleiderbuegel |
| DE8618751U1 (de) * | 1986-07-12 | 1986-09-04 | union Sinram & Wendt GmbH & Co KG, 3250 Hameln | Rutschfester Kleiderbügel |
| EP0412670A2 (en) * | 1989-08-07 | 1991-02-13 | Batts, Inc. | Article gripping means and method of making same |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10015072A1 (de) * | 2000-03-25 | 2001-10-04 | Schneider Innovative Produkte | Kleiderbügel |
| DE20103910U1 (de) | 2001-03-06 | 2001-06-13 | Karner-Batts GmbH, 97737 Gemünden | Kleider- und Wäschebügel |
Also Published As
| Publication number | Publication date |
|---|---|
| MX9207174A (es) | 1994-03-31 |
| GB9225764D0 (en) | 1993-02-03 |
| GB2262226A (en) | 1993-06-16 |
| DE4241177A1 (enExample) | 1993-06-17 |
| CA2084611C (en) | 1997-03-18 |
| GB2262226B (en) | 1996-07-31 |
| CA2084611A1 (en) | 1993-06-12 |
| HK1007944A1 (en) | 1999-04-30 |
| US5535927A (en) | 1996-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4241177C2 (de) | Rutschfester Kleiderbügel | |
| DE4232911A1 (de) | Kleiderbuegel vom klammertyp mit lang haltbaren, rutschfesten oberflaechen | |
| DE2157764A1 (de) | Sportbekleidung | |
| DE102007008558A1 (de) | Aufeinander abgestimmte Kleiderbügelgarnitur variabler Länge | |
| DE1467731A1 (de) | Seifengebilde mit gesteigerter Gebrauchsfaehigkeit und Verfahren zur Erhoehung der Schaumbildung und Reinigungskraft von Stueckseife durch Einschliessen der Seife in einNetz | |
| DE3942238C2 (de) | Oberbekleidungsstück | |
| EP1152669B1 (de) | Textilie | |
| DE60204579T2 (de) | Bekleidungsstück | |
| DE3525441C2 (enExample) | ||
| DE1855720U (de) | Klammer aus geformtem kunststoff. | |
| DE3603483C2 (enExample) | ||
| DE806625C (de) | Schaustellungsstaender fuer Bekleidungsstuecke | |
| DE804236C (de) | Kleiderbuegel | |
| DE803550C (de) | Teppich oder Teilstueck eines Teppichs | |
| DE3343033C1 (de) | Kleiderbügel-Satz | |
| DE8602943U1 (de) | Kleiderhalter mit mindestens zwei großflächigen knopfförmigen Garderobenhaken | |
| DE2014564A1 (en) | Flexible foam-backed fabric | |
| DE839424C (de) | Knopf aus durch einen Stiel fest miteinander verbundener Knopf- und Fussplatte | |
| DE8023854U1 (de) | Rutschfester kleiderbuegel | |
| DE3133690A1 (de) | "einlagestoff fuer bekleidungsstuecke" | |
| DE7815065U1 (de) | Bekleidungsstueck aus einer mehrschichtbahn, insbesondere kaelteschutzanzug | |
| DE8805269U1 (de) | Trikot, Pullover, T-Shirt | |
| DE202021001924U1 (de) | Anti-Rutsch-Strumpfhose für eine Bekleidungsstückkombination mit eng anliegenden Kleidungsstücken | |
| DE2624805A1 (de) | Kleiderbuegel | |
| DE1768780U (de) | Garderobeablage. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: GHA BRANDS LTD., LABUAN, MY |
|
| 8328 | Change in the person/name/address of the agent |
Representative=s name: PATENTANWAELTE ISENBRUCK BOESL HOERSCHLER WICHMANN |
|
| R119 | Application deemed withdrawn, or ip right lapsed, due to non-payment of renewal fee |
Effective date: 20110701 |