DE4036552C1 - - Google Patents
Info
- Publication number
- DE4036552C1 DE4036552C1 DE4036552A DE4036552A DE4036552C1 DE 4036552 C1 DE4036552 C1 DE 4036552C1 DE 4036552 A DE4036552 A DE 4036552A DE 4036552 A DE4036552 A DE 4036552A DE 4036552 C1 DE4036552 C1 DE 4036552C1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compound
- hydrogen
- radical
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 60
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 21
- 238000000034 method Methods 0.000 claims abstract description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 16
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 5
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 3
- -1 3-nitro-benzyl Chemical group 0.000 claims description 18
- BVHCYKZSWOWXPO-UHFFFAOYSA-N 1,3-dihydro-1,4-benzodiazepine-2-thione Chemical class N1C(=S)CN=CC2=CC=CC=C21 BVHCYKZSWOWXPO-UHFFFAOYSA-N 0.000 claims description 16
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Chemical group 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- RAFNCPHFRHZCPS-UHFFFAOYSA-N di(imidazol-1-yl)methanethione Chemical compound C1=CN=CN1C(=S)N1C=CN=C1 RAFNCPHFRHZCPS-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 238000007112 amidation reaction Methods 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 claims description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 4
- 239000013067 intermediate product Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N methyl alcohol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 2
- ATFOLJKYGAQWEZ-ZCFIWIBFSA-N (2R)-2-N-[(2,5-dichloro-3-nitrophenyl)methyl]propane-1,2-diamine Chemical compound ClC1=C(CN[C@@H](CN)C)C=C(C=C1[N+](=O)[O-])Cl ATFOLJKYGAQWEZ-ZCFIWIBFSA-N 0.000 description 1
- PARSQALDHYECKE-SSDOTTSWSA-N (2r)-2-n-[(2-bromo-3-nitrophenyl)methyl]propane-1,2-diamine Chemical compound NC[C@@H](C)NCC1=CC=CC([N+]([O-])=O)=C1Br PARSQALDHYECKE-SSDOTTSWSA-N 0.000 description 1
- QDQCVMLOCFOFAG-SSDOTTSWSA-N (2r)-2-n-[(2-chloro-3-nitrophenyl)methyl]propane-1,2-diamine Chemical compound NC[C@@H](C)NCC1=CC=CC([N+]([O-])=O)=C1Cl QDQCVMLOCFOFAG-SSDOTTSWSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 1
- AUAXYMOBWXOEQD-UHFFFAOYSA-N 2,5-dichloro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl AUAXYMOBWXOEQD-UHFFFAOYSA-N 0.000 description 1
- WTDJEGSXLFHZPY-UHFFFAOYSA-N 2-bromo-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1Br WTDJEGSXLFHZPY-UHFFFAOYSA-N 0.000 description 1
- BETVLJMOJDGFLC-UHFFFAOYSA-N 2-bromo-3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1Br BETVLJMOJDGFLC-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 208000030507 AIDS Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 241000450599 DNA viruses Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000031886 HIV Infections Diseases 0.000 description 1
- 241000713772 Human immunodeficiency virus 1 Species 0.000 description 1
- 241000713340 Human immunodeficiency virus 2 Species 0.000 description 1
- QNAYBMKLOCPYGJ-UWTATZPHSA-N L-Alanine Natural products C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- GJEAMHAFPYZYDE-UHFFFAOYSA-N [C].[S] Chemical compound [C].[S] GJEAMHAFPYZYDE-UHFFFAOYSA-N 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 241001493065 dsRNA viruses Species 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ROBXZHNBBCHEIQ-SCSAIBSYSA-N ethyl (2r)-2-aminopropanoate Chemical compound CCOC(=O)[C@@H](C)N ROBXZHNBBCHEIQ-SCSAIBSYSA-N 0.000 description 1
- ROBXZHNBBCHEIQ-BYPYZUCNSA-N ethyl (2s)-2-aminopropanoate Chemical compound CCOC(=O)[C@H](C)N ROBXZHNBBCHEIQ-BYPYZUCNSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- WTTIBCHOELPGFK-LBPRGKRZSA-N r82150 Chemical compound C1N(CC=C(C)C)[C@@H](C)CN2C(=S)NC3=CC=CC1=C32 WTTIBCHOELPGFK-LBPRGKRZSA-N 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/06—Peri-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/29—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4036552A DE4036552C1 (enExample) | 1990-11-16 | 1990-11-16 | |
| EP91918424A EP0557307A1 (de) | 1990-11-16 | 1991-10-29 | Verfahren zur herstellung von 4,5,6,7-tetrahydro-imidazo-(4,5,ljk) (1,4)-benzodiazepin-2-(1h)-thionen sowie zwischenprodukte |
| AU88559/91A AU8855991A (en) | 1990-11-16 | 1991-10-29 | Process for producing 4,5,6,7-tetrahydro-imidazo-(4,5,ljk) (1,4)-benzodiazepine-2-(1h)-thiones and intermediate products |
| JP3517660A JPH06502400A (ja) | 1990-11-16 | 1991-10-29 | 4,5,6,7−テトラヒドロ−イミダゾ−(4,5,1jk)(1,4)−ベンゾジアゼピン−2−(1H)−チオン並びに中間生成物の製造方法 |
| CA002096238A CA2096238A1 (en) | 1990-11-16 | 1991-10-29 | Process for the production of 4,5,6,7-tetrahydroimidazo-(4,5,ljk)(1,4)-benzodiazepine-2-( 1 h)-thiones as well as intermediate products |
| PCT/EP1991/002038 WO1992008706A1 (de) | 1990-11-16 | 1991-10-29 | Verfahren zur herstellung von 4,5,6,7-tetrahydro-imidazo-(4,5,ljk) (1,4)-benzodiazepin-2-(1h)-thionen sowie zwischenprodukte |
| IL100033A IL100033A0 (en) | 1990-11-16 | 1991-11-11 | Process for the production of 4,5,6,7-tetrahydroimidazo-(4,5,ljk)(1,4)-benzodiazepine-2-(1h)-thiones as well as intermediate products |
| ZA919050A ZA919050B (en) | 1990-11-16 | 1991-11-15 | Process for the production of 4,5,6,7-tetrahydro-imidazo-(4,5,ljk)(1,4)-benzidiazepine-2-(1h)-thiones as well as intermediate products |
| IE397991A IE913979A1 (en) | 1990-11-16 | 1991-11-15 | PROCESS FOR THE PRODUCTION OF¹4,5,6,7-TETRAHYDRO-IMIDAZO-(4,5,ljk)¹(1,4)-BENZODIAZEPINE-2-(1H)-THIONES AS WELL AS INTERMEDIATE¹PRODUCTS |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4036552A DE4036552C1 (enExample) | 1990-11-16 | 1990-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4036552C1 true DE4036552C1 (enExample) | 1992-02-06 |
Family
ID=6418388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4036552A Expired - Lifetime DE4036552C1 (enExample) | 1990-11-16 | 1990-11-16 |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0557307A1 (enExample) |
| JP (1) | JPH06502400A (enExample) |
| AU (1) | AU8855991A (enExample) |
| CA (1) | CA2096238A1 (enExample) |
| DE (1) | DE4036552C1 (enExample) |
| IE (1) | IE913979A1 (enExample) |
| IL (1) | IL100033A0 (enExample) |
| WO (1) | WO1992008706A1 (enExample) |
| ZA (1) | ZA919050B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5463049A (en) * | 1991-09-24 | 1995-10-31 | Janssen Pharmaceutica N.V. | Process for preparing enantiomerically pure imidazo[4,5,1-JK][1,4]-benzodiazepin-2(1H)-thiones |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ238664A (en) * | 1990-07-06 | 1992-12-23 | Janssen Pharmaceutica Nv | Substituted tetrahydroimidazo(1,4)benzodiazepin-2-(thi)ones and pharmaceutical anti-viral compositions |
| UA56197C2 (uk) | 1996-11-08 | 2003-05-15 | Зенека Лімітед | Гетероциклічні похідні |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0384522A1 (en) * | 1989-02-23 | 1990-08-29 | Janssen Pharmaceutica N.V. | Antiviral tetrahydroimidazo[1,4]benzodiazepin-2-thiones |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8806449D0 (en) * | 1988-03-18 | 1988-04-20 | Janssen Pharmaceutica Nv | Antiviral hexahydroimiazo(1 4)benzodiazepin-2-ones |
-
1990
- 1990-11-16 DE DE4036552A patent/DE4036552C1/de not_active Expired - Lifetime
-
1991
- 1991-10-29 CA CA002096238A patent/CA2096238A1/en not_active Abandoned
- 1991-10-29 WO PCT/EP1991/002038 patent/WO1992008706A1/de not_active Ceased
- 1991-10-29 AU AU88559/91A patent/AU8855991A/en not_active Abandoned
- 1991-10-29 EP EP91918424A patent/EP0557307A1/de not_active Withdrawn
- 1991-10-29 JP JP3517660A patent/JPH06502400A/ja active Pending
- 1991-11-11 IL IL100033A patent/IL100033A0/xx unknown
- 1991-11-15 IE IE397991A patent/IE913979A1/en unknown
- 1991-11-15 ZA ZA919050A patent/ZA919050B/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0384522A1 (en) * | 1989-02-23 | 1990-08-29 | Janssen Pharmaceutica N.V. | Antiviral tetrahydroimidazo[1,4]benzodiazepin-2-thiones |
Non-Patent Citations (1)
| Title |
|---|
| Nature Bd. 343, S. 470-474 (1990) * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5463049A (en) * | 1991-09-24 | 1995-10-31 | Janssen Pharmaceutica N.V. | Process for preparing enantiomerically pure imidazo[4,5,1-JK][1,4]-benzodiazepin-2(1H)-thiones |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0557307A1 (de) | 1993-09-01 |
| IL100033A0 (en) | 1992-08-18 |
| AU8855991A (en) | 1992-06-11 |
| ZA919050B (en) | 1992-08-26 |
| JPH06502400A (ja) | 1994-03-17 |
| CA2096238A1 (en) | 1992-05-17 |
| WO1992008706A1 (de) | 1992-05-29 |
| IE913979A1 (en) | 1992-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0262393B1 (de) | Aryloxycarbonsäurederivate, ihre Herstellung und Verwendung | |
| EP0350002B1 (de) | Neue Diphosphonsäurederivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2305092A1 (de) | Alpha-aminomethylbenzylalkoholderivate | |
| DE1670753A1 (de) | Verfahren zur Herstellung von 2-Cycloalkylaminooxazolinen | |
| EP0427963B1 (de) | Verfahren zur Herstellung reiner, unsymmetrisch disubstituierter Harnstoffe | |
| DE4036552C1 (enExample) | ||
| DD141020A5 (de) | Verfahren zur herstellung von neuen maleinimid-und sukzinimid-derivaten | |
| CH626352A5 (en) | Process for the preparation of 2,6-disubstituted 2-phenyliminoimidazolidines and their acid addition salts | |
| DE2918832A1 (de) | 5,6-dihydro-11-alkylen-morphantridin- 6-one | |
| DE2854069C2 (de) | Verfahren zur Gewinnung von optisch aktiven Basen | |
| EP0039835B1 (de) | Verfahren zur Herstellung von 2-Amino-6-nitrobenzthiazol | |
| DE1003716B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1257152B (de) | Verfahren zur Herstellung substituierter Malonsaeurehydrazide | |
| DE3940261A1 (de) | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe | |
| DE956306C (de) | Verfahren zur Herstellung von neuen Derivaten des Pyrimidins | |
| DE1046063B (de) | Verfahren zur Herstellung neuer, amoebicid wirkender Acetanilide | |
| EP0110219A1 (de) | Heterocyclisch substituierte Nitrile, ihre Herstellung und Verwendung als Arzneimittel | |
| DE1010968B (de) | Verfahren zur Herstellung von therapeutisch wirksamen Alkyleniminochinonen | |
| DE10249946A1 (de) | Verfahren zur Herstellung von 2-Amino-4-chlor-6-alkoxypyrimidinen | |
| DE2900506A1 (de) | Verfahren zur herstellung von 2-cyanmethylbenzimidazol | |
| CH655930A5 (de) | Verfahren zur herstellung von 3-hydroxybenzdiazepinonen. | |
| WO1984000032A1 (fr) | Amino-oxy-(mercapto-alcoyle)-benzenes, procede de leur preparation et produits pharmaceutiques les contenant | |
| AT263749B (de) | Verfahren zur Herstellung von Dibenzocycloheptaenderivaten und ihren Säureadditionssalzen | |
| DE968561C (de) | Verfahren zur Herstellung von am Aminostickstoff substituierten Monoaminoacylaniliden | |
| DE2742158A1 (de) | Herstellung substituierter harnstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of patent without earlier publication of application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |