DE3876114T2 - Benzodioxol-derivate, diese enthaltende zusammensetzungen und deren verwendung zur herstellung von medikamenten. - Google Patents
Benzodioxol-derivate, diese enthaltende zusammensetzungen und deren verwendung zur herstellung von medikamenten.Info
- Publication number
- DE3876114T2 DE3876114T2 DE8888103164T DE3876114T DE3876114T2 DE 3876114 T2 DE3876114 T2 DE 3876114T2 DE 8888103164 T DE8888103164 T DE 8888103164T DE 3876114 T DE3876114 T DE 3876114T DE 3876114 T2 DE3876114 T2 DE 3876114T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- lower alkyl
- benzodioxol
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 83
- 239000003814 drug Substances 0.000 title claims description 10
- 239000000203 mixture Substances 0.000 title description 188
- 229940079593 drug Drugs 0.000 title description 6
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical class C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 title description 2
- -1 heterocyclic carboxylic acid Chemical class 0.000 claims description 154
- 125000000217 alkyl group Chemical group 0.000 claims description 118
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 81
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 69
- 150000003839 salts Chemical class 0.000 claims description 46
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 44
- 239000001257 hydrogen Substances 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 150000005528 benzodioxoles Chemical class 0.000 claims description 36
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 22
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 18
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 125000001624 naphthyl group Chemical group 0.000 claims description 10
- 125000003944 tolyl group Chemical group 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 7
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 6
- 208000019423 liver disease Diseases 0.000 claims description 6
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 5
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 5
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 159000000000 sodium salts Chemical group 0.000 claims description 4
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 3
- 239000004305 biphenyl Substances 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims description 3
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 125000005023 xylyl group Chemical group 0.000 claims description 3
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 12
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 389
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 384
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 275
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 266
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 249
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 207
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 204
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 204
- 238000005160 1H NMR spectroscopy Methods 0.000 description 165
- 239000000243 solution Substances 0.000 description 163
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 132
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 122
- 239000002904 solvent Substances 0.000 description 122
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 114
- 238000002844 melting Methods 0.000 description 114
- 230000008018 melting Effects 0.000 description 114
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 110
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 99
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 91
- 238000006243 chemical reaction Methods 0.000 description 86
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 82
- 239000013078 crystal Substances 0.000 description 82
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 80
- 238000000034 method Methods 0.000 description 78
- 235000011121 sodium hydroxide Nutrition 0.000 description 67
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 66
- 238000002360 preparation method Methods 0.000 description 62
- 239000011541 reaction mixture Substances 0.000 description 61
- 238000010992 reflux Methods 0.000 description 61
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 60
- 239000010410 layer Substances 0.000 description 59
- 238000001816 cooling Methods 0.000 description 55
- 238000010898 silica gel chromatography Methods 0.000 description 53
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 51
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 48
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 48
- 235000019341 magnesium sulphate Nutrition 0.000 description 48
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 48
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 48
- 239000002585 base Substances 0.000 description 46
- 239000012230 colorless oil Substances 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- 239000000284 extract Substances 0.000 description 39
- 239000003921 oil Substances 0.000 description 39
- 235000019198 oils Nutrition 0.000 description 39
- 238000000605 extraction Methods 0.000 description 37
- 239000000706 filtrate Substances 0.000 description 37
- 239000000843 powder Substances 0.000 description 37
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 36
- 238000005481 NMR spectroscopy Methods 0.000 description 35
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 35
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 34
- 229920006395 saturated elastomer Polymers 0.000 description 31
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 238000000354 decomposition reaction Methods 0.000 description 29
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 28
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 28
- 239000012044 organic layer Substances 0.000 description 27
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 27
- SIHMFDCTQXHVSJ-UHFFFAOYSA-N 2-(7,8-dihydro-5h-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetic acid Chemical compound C1=C2C(CC(=O)O)OCCC2=CC2=C1OCO2 SIHMFDCTQXHVSJ-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 26
- 238000012360 testing method Methods 0.000 description 26
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 25
- 238000010438 heat treatment Methods 0.000 description 25
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 23
- 239000011734 sodium Substances 0.000 description 23
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 23
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 21
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 21
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 20
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 19
- 239000002253 acid Substances 0.000 description 19
- 230000003197 catalytic effect Effects 0.000 description 19
- 230000005764 inhibitory process Effects 0.000 description 19
- 239000000725 suspension Substances 0.000 description 19
- IMEQHZBNJVZGIB-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethanethiol Chemical compound SCCC1=CC=C2OCOC2=C1 IMEQHZBNJVZGIB-UHFFFAOYSA-N 0.000 description 18
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 18
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 18
- 238000007796 conventional method Methods 0.000 description 18
- 235000017557 sodium bicarbonate Nutrition 0.000 description 18
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 18
- 239000003795 chemical substances by application Substances 0.000 description 17
- 229910000029 sodium carbonate Inorganic materials 0.000 description 17
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 16
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 16
- 125000005843 halogen group Chemical group 0.000 description 16
- 235000017550 sodium carbonate Nutrition 0.000 description 16
- 239000008096 xylene Substances 0.000 description 16
- 239000007864 aqueous solution Substances 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 15
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 14
- 229910052794 bromium Inorganic materials 0.000 description 14
- 229910052708 sodium Inorganic materials 0.000 description 14
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 13
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 13
- 150000008282 halocarbons Chemical class 0.000 description 13
- 229910000027 potassium carbonate Inorganic materials 0.000 description 13
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 12
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 12
- MIOPJNTWMNEORI-ZDFGOMNRSA-N [2,2,3,3,4,5,5-heptadeuterio-7-methyl-6-oxo-7-(trideuteriomethyl)-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid Chemical compound C12(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])(C2(C([2H])([2H])[2H])C)[2H])([2H])[2H])CS(=O)(=O)O MIOPJNTWMNEORI-ZDFGOMNRSA-N 0.000 description 12
- 150000001298 alcohols Chemical class 0.000 description 12
- 210000004185 liver Anatomy 0.000 description 12
- 235000011181 potassium carbonates Nutrition 0.000 description 12
- 235000011118 potassium hydroxide Nutrition 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 150000003573 thiols Chemical class 0.000 description 12
- MSWZFWKMSRAUBD-GASJEMHNSA-N 2-amino-2-deoxy-D-galactopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O MSWZFWKMSRAUBD-GASJEMHNSA-N 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 11
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- 239000003960 organic solvent Substances 0.000 description 11
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 11
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000007800 oxidant agent Substances 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- 238000005406 washing Methods 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- 239000010779 crude oil Substances 0.000 description 9
- 206010067125 Liver injury Diseases 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- 231100000753 hepatic injury Toxicity 0.000 description 8
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 8
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 8
- 239000012280 lithium aluminium hydride Substances 0.000 description 8
- 229920000609 methyl cellulose Polymers 0.000 description 8
- 239000001923 methylcellulose Substances 0.000 description 8
- 235000010981 methylcellulose Nutrition 0.000 description 8
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 8
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 8
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 7
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- 239000003513 alkali Substances 0.000 description 7
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 235000011089 carbon dioxide Nutrition 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 150000001805 chlorine compounds Chemical class 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 150000002170 ethers Chemical class 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 7
- SEWDXLUTUHQGNS-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)propan-2-ol Chemical compound CC(C)(O)C1=CC=C2OCOC2=C1 SEWDXLUTUHQGNS-UHFFFAOYSA-N 0.000 description 6
- CEDRGYFHLMEXKO-UHFFFAOYSA-N 2-[1-(1,3-benzodioxol-5-yl)butylsulfanyl]acetic acid Chemical compound OC(=O)CSC(CCC)C1=CC=C2OCOC2=C1 CEDRGYFHLMEXKO-UHFFFAOYSA-N 0.000 description 6
- BMHMKWXYXFBWMI-UHFFFAOYSA-N 3,4-Methylenedioxyacetophenone Chemical compound CC(=O)C1=CC=C2OCOC2=C1 BMHMKWXYXFBWMI-UHFFFAOYSA-N 0.000 description 6
- VWAVZAMMNJMAEM-UHFFFAOYSA-N 5-ethenyl-1,3-benzodioxole Chemical compound C=CC1=CC=C2OCOC2=C1 VWAVZAMMNJMAEM-UHFFFAOYSA-N 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000005708 Sodium hypochlorite Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 229960002449 glycine Drugs 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- 239000011630 iodine Substances 0.000 description 6
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 6
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 6
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- XEVMQFARCBZBRP-UHFFFAOYSA-N 6-methyl-1,3-benzodioxole-5-carbaldehyde Chemical compound C1=C(C=O)C(C)=CC2=C1OCO2 XEVMQFARCBZBRP-UHFFFAOYSA-N 0.000 description 5
- 239000007818 Grignard reagent Substances 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 5
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 5
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000004795 grignard reagents Chemical class 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- MZHMLCOCHWLLMD-UHFFFAOYSA-N 1-(6-methyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(C)C(C(O)C)=CC2=C1OCO2 MZHMLCOCHWLLMD-UHFFFAOYSA-N 0.000 description 4
- GAOPNILTHFZCJJ-UHFFFAOYSA-N 1-(6-methyl-1,3-benzodioxol-5-yl)propan-1-ol Chemical compound C1=C(C)C(C(O)CC)=CC2=C1OCO2 GAOPNILTHFZCJJ-UHFFFAOYSA-N 0.000 description 4
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- BRAVQKZAPQPNED-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)propan-2-ylsulfanyl]acetic acid Chemical compound OC(=O)CSC(C)(C)C1=CC=C2OCOC2=C1 BRAVQKZAPQPNED-UHFFFAOYSA-N 0.000 description 4
- CFFZDZCDUFSOFZ-UHFFFAOYSA-N 3,4-Dihydroxy-phenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C(O)=C1 CFFZDZCDUFSOFZ-UHFFFAOYSA-N 0.000 description 4
- BZOJLFJTAUQGKX-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)propane-1-thiol Chemical compound SCCCC1=CC=C2OCOC2=C1 BZOJLFJTAUQGKX-UHFFFAOYSA-N 0.000 description 4
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 230000001590 oxidative effect Effects 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000011736 potassium bicarbonate Substances 0.000 description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- ZMQAAUBTXCXRIC-UHFFFAOYSA-N safrole Chemical compound C=CCC1=CC=C2OCOC2=C1 ZMQAAUBTXCXRIC-UHFFFAOYSA-N 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- UUBGJQSWCBMIET-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)propane-2-thiol Chemical compound CC(S)CC1=CC=C2OCOC2=C1 UUBGJQSWCBMIET-UHFFFAOYSA-N 0.000 description 3
- HJGMKDYBRYTMHT-UHFFFAOYSA-N 1-(6-ethyl-1,3-benzodioxol-5-yl)propan-1-ol Chemical compound C1=C(CC)C(C(O)CC)=CC2=C1OCO2 HJGMKDYBRYTMHT-UHFFFAOYSA-N 0.000 description 3
- FJNODVQADCQYOE-UHFFFAOYSA-N 1-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]propan-2-one Chemical compound CC(=O)CSCCC1=CC=C2OCOC2=C1 FJNODVQADCQYOE-UHFFFAOYSA-N 0.000 description 3
- XIUIXHNDCDFXBK-UHFFFAOYSA-N 2-(6-ethyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C(CC)=CC2=C1OCO2 XIUIXHNDCDFXBK-UHFFFAOYSA-N 0.000 description 3
- RVNHFIWOKMANJR-UHFFFAOYSA-N 2-(6-methyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C(C)=CC2=C1OCO2 RVNHFIWOKMANJR-UHFFFAOYSA-N 0.000 description 3
- IWXCBYVBGYNKMB-UHFFFAOYSA-N 2-(6-propyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C(CCC)=CC2=C1OCO2 IWXCBYVBGYNKMB-UHFFFAOYSA-N 0.000 description 3
- PTTPMCLYLVPACE-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonyl chloride Chemical compound ClS(=O)(=O)CCSCCC1=CC=C2OCOC2=C1 PTTPMCLYLVPACE-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- UZGLOGCJCWBBIV-UHFFFAOYSA-N 3-(chloromethyl)pyridin-1-ium;chloride Chemical compound Cl.ClCC1=CC=CN=C1 UZGLOGCJCWBBIV-UHFFFAOYSA-N 0.000 description 3
- VYUNEQZLPXAEEM-UHFFFAOYSA-N 5-(chloromethyl)-6-propan-2-yl-1,3-benzodioxole Chemical compound C1=C(CCl)C(C(C)C)=CC2=C1OCO2 VYUNEQZLPXAEEM-UHFFFAOYSA-N 0.000 description 3
- HVXSFCYOHKGEPJ-UHFFFAOYSA-N 5-prop-1-en-2-yl-1,3-benzodioxole Chemical compound CC(=C)C1=CC=C2OCOC2=C1 HVXSFCYOHKGEPJ-UHFFFAOYSA-N 0.000 description 3
- JHUBNQSPUZXGKI-UHFFFAOYSA-N 5-propan-2-yl-1,3-benzodioxole Chemical compound CC(C)C1=CC=C2OCOC2=C1 JHUBNQSPUZXGKI-UHFFFAOYSA-N 0.000 description 3
- OEHNJQLMUXYRAH-UHFFFAOYSA-N 6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxol-7-ol Chemical compound C1=C2C(O)CCC2=CC2=C1OCO2 OEHNJQLMUXYRAH-UHFFFAOYSA-N 0.000 description 3
- ALEXUNIUOAOYSW-UHFFFAOYSA-N 6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxole-6-carboxylic acid Chemical compound C1=C2CC(C(=O)O)CC2=CC2=C1OCO2 ALEXUNIUOAOYSW-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 239000004378 Glycyrrhizin Substances 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- OLBDQOKDLSXJHW-UHFFFAOYSA-N ethyl 2-[1-(6-ethyl-1,3-benzodioxol-5-yl)propylsulfanyl]acetate Chemical compound C1=C(CC)C(C(CC)SCC(=O)OCC)=CC2=C1OCO2 OLBDQOKDLSXJHW-UHFFFAOYSA-N 0.000 description 3
- LPLVUJXQOOQHMX-UHFFFAOYSA-N glycyrrhetinic acid glycoside Natural products C1CC(C2C(C3(CCC4(C)CCC(C)(CC4C3=CC2=O)C(O)=O)C)(C)CC2)(C)C2C(C)(C)C1OC1OC(C(O)=O)C(O)C(O)C1OC1OC(C(O)=O)C(O)C(O)C1O LPLVUJXQOOQHMX-UHFFFAOYSA-N 0.000 description 3
- 229960004949 glycyrrhizic acid Drugs 0.000 description 3
- UYRUBYNTXSDKQT-UHFFFAOYSA-N glycyrrhizic acid Natural products CC1(C)C(CCC2(C)C1CCC3(C)C2C(=O)C=C4C5CC(C)(CCC5(C)CCC34C)C(=O)O)OC6OC(C(O)C(O)C6OC7OC(O)C(O)C(O)C7C(=O)O)C(=O)O UYRUBYNTXSDKQT-UHFFFAOYSA-N 0.000 description 3
- 235000019410 glycyrrhizin Nutrition 0.000 description 3
- LPLVUJXQOOQHMX-QWBHMCJMSA-N glycyrrhizinic acid Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@@H]1O[C@@H]1C([C@H]2[C@]([C@@H]3[C@@]([C@@]4(CC[C@@]5(C)CC[C@@](C)(C[C@H]5C4=CC3=O)C(O)=O)C)(C)CC2)(C)CC1)(C)C)C(O)=O)[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O LPLVUJXQOOQHMX-QWBHMCJMSA-N 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 229960003975 potassium Drugs 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 2
- JSQGHUXRNOIHGS-UHFFFAOYSA-N 1-(6-methyl-1,3-benzodioxol-5-yl)butan-1-ol Chemical compound C1=C(C)C(C(O)CCC)=CC2=C1OCO2 JSQGHUXRNOIHGS-UHFFFAOYSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- DKSCPXZPOFBPJP-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)butan-2-ol Chemical compound CCC(C)(O)C1=CC=C2OCOC2=C1 DKSCPXZPOFBPJP-UHFFFAOYSA-N 0.000 description 2
- GHTOSIDDOPIURF-UHFFFAOYSA-N 2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C=C2OC(C)(C)OC2=C1 GHTOSIDDOPIURF-UHFFFAOYSA-N 0.000 description 2
- ZPDVBWQYDLUQSC-UHFFFAOYSA-N 2-(2-methyl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C=C2OC(C)OC2=C1 ZPDVBWQYDLUQSC-UHFFFAOYSA-N 0.000 description 2
- ZOIUZQIADYLSJD-UHFFFAOYSA-N 2-(6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxol-7-ylsulfanyl)acetic acid Chemical compound C1=C2C(SCC(=O)O)CCC2=CC2=C1OCO2 ZOIUZQIADYLSJD-UHFFFAOYSA-N 0.000 description 2
- GRXXVBXCWMMQLP-UHFFFAOYSA-N 2-(6-benzyl-1,3-benzodioxol-5-yl)acetic acid Chemical compound OC(=O)CC1=CC=2OCOC=2C=C1CC1=CC=CC=C1 GRXXVBXCWMMQLP-UHFFFAOYSA-N 0.000 description 2
- HMSVEAZUILWKSV-UHFFFAOYSA-N 2-(6-benzyl-1,3-benzodioxol-5-yl)ethanol Chemical compound OCCC1=CC=2OCOC=2C=C1CC1=CC=CC=C1 HMSVEAZUILWKSV-UHFFFAOYSA-N 0.000 description 2
- YTTXKSYTXOAGIL-UHFFFAOYSA-N 2-(6-ethyl-1,3-benzodioxol-5-yl)acetic acid Chemical compound C1=C(CC(O)=O)C(CC)=CC2=C1OCO2 YTTXKSYTXOAGIL-UHFFFAOYSA-N 0.000 description 2
- CCKZIYNPIPVQPS-UHFFFAOYSA-N 2-(6-propan-2-yl-1,3-benzodioxol-5-yl)acetic acid Chemical compound C1=C(CC(O)=O)C(C(C)C)=CC2=C1OCO2 CCKZIYNPIPVQPS-UHFFFAOYSA-N 0.000 description 2
- WGSJGKDBTADXQF-UHFFFAOYSA-N 2-(6-propan-2-yl-1,3-benzodioxol-5-yl)acetonitrile Chemical compound C1=C(CC#N)C(C(C)C)=CC2=C1OCO2 WGSJGKDBTADXQF-UHFFFAOYSA-N 0.000 description 2
- SBVSPAAUAXLFGJ-UHFFFAOYSA-N 2-(6-propan-2-yl-1,3-benzodioxol-5-yl)ethanol Chemical compound C1=C(CCO)C(C(C)C)=CC2=C1OCO2 SBVSPAAUAXLFGJ-UHFFFAOYSA-N 0.000 description 2
- VNIXBILJLGJXBM-UHFFFAOYSA-N 2-(6-propyl-1,3-benzodioxol-5-yl)acetonitrile Chemical compound C1=C(CC#N)C(CCC)=CC2=C1OCO2 VNIXBILJLGJXBM-UHFFFAOYSA-N 0.000 description 2
- XGQCSCCURDZHQK-UHFFFAOYSA-N 2-[1-(1,3-benzodioxol-5-yl)butan-2-ylsulfanyl]acetic acid Chemical compound OC(=O)CSC(CC)CC1=CC=C2OCOC2=C1 XGQCSCCURDZHQK-UHFFFAOYSA-N 0.000 description 2
- NGOUKVBXMPCTHX-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethyldisulfanyl]ethyl pyridine-3-carboxylate Chemical compound C=1C=C2OCOC2=CC=1CCSSCCOC(=O)C1=CC=CN=C1 NGOUKVBXMPCTHX-UHFFFAOYSA-N 0.000 description 2
- PPJLUQYTSSJUKJ-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)SCCC1=CC=C2OCOC2=C1 PPJLUQYTSSJUKJ-UHFFFAOYSA-N 0.000 description 2
- HXZJIADEJCGLJN-UHFFFAOYSA-N 2-[2-(2-methyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetic acid Chemical compound C1=C(CCSCC(O)=O)C=C2OC(C)OC2=C1 HXZJIADEJCGLJN-UHFFFAOYSA-N 0.000 description 2
- UUKCTJUNVCEMBI-UHFFFAOYSA-N 2-[2-(6-propan-2-yl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetic acid Chemical compound C1=C(CCSCC(O)=O)C(C(C)C)=CC2=C1OCO2 UUKCTJUNVCEMBI-UHFFFAOYSA-N 0.000 description 2
- UJPZHTURXVAQHE-UHFFFAOYSA-N 2-[2-(6-propyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetic acid Chemical compound C1=C(CCSCC(O)=O)C(CCC)=CC2=C1OCO2 UJPZHTURXVAQHE-UHFFFAOYSA-N 0.000 description 2
- DYMUPAIUVXVHGZ-UHFFFAOYSA-N 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethanol Chemical compound OCCSSCCCC1=CC=C2OCOC2=C1 DYMUPAIUVXVHGZ-UHFFFAOYSA-N 0.000 description 2
- GRUOPBWKNRBEKZ-UHFFFAOYSA-N 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate Chemical compound C=1C=C2OCOC2=CC=1CCCSSCCOC(=O)C1=CC=CN=C1 GRUOPBWKNRBEKZ-UHFFFAOYSA-N 0.000 description 2
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- 125000005916 2-methylpentyl group Chemical group 0.000 description 2
- UMLRPJRYOFHZSL-UHFFFAOYSA-N 3-(6-ethyl-1,3-benzodioxol-5-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C(CC)=CC2=C1OCO2 UMLRPJRYOFHZSL-UHFFFAOYSA-N 0.000 description 2
- QUQUADZHGRWBLG-UHFFFAOYSA-N 3-(6-methyl-1,3-benzodioxol-5-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C(C)=CC2=C1OCO2 QUQUADZHGRWBLG-UHFFFAOYSA-N 0.000 description 2
- ADFYFPOJQIEJOH-UHFFFAOYSA-N 3-[6-(2-ethylsulfanylethyl)-1,3-benzodioxol-5-yl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(CCSCC)=CC2=C1OCO2 ADFYFPOJQIEJOH-UHFFFAOYSA-N 0.000 description 2
- QOPCUAGVPQUIBE-UHFFFAOYSA-N 3-[6-(ethoxymethyl)-1,3-benzodioxol-5-yl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(COCC)=CC2=C1OCO2 QOPCUAGVPQUIBE-UHFFFAOYSA-N 0.000 description 2
- SIFWENMBYQXCFD-UHFFFAOYSA-N 3-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(COC)=CC2=C1OCO2 SIFWENMBYQXCFD-UHFFFAOYSA-N 0.000 description 2
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005917 3-methylpentyl group Chemical group 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- CCARPEUWUWIJPX-UHFFFAOYSA-N 5-(2-bromoethyl)-1,3-benzodioxole Chemical compound BrCCC1=CC=C2OCOC2=C1 CCARPEUWUWIJPX-UHFFFAOYSA-N 0.000 description 2
- QBAYKAXJUZXKAZ-UHFFFAOYSA-N 5-(2-ethylsulfanylethyl)-1,3-benzodioxole Chemical compound CCSCCC1=CC=C2OCOC2=C1 QBAYKAXJUZXKAZ-UHFFFAOYSA-N 0.000 description 2
- WQNMMRUYFYJZIF-UHFFFAOYSA-N 5-(2-methylprop-1-enyl)-1,3-benzodioxole Chemical compound CC(C)=CC1=CC=C2OCOC2=C1 WQNMMRUYFYJZIF-UHFFFAOYSA-N 0.000 description 2
- VXICFKRSWQYWHO-UHFFFAOYSA-N 5-(2-methylsulfanylethyl)-1,3-benzodioxole Chemical compound CSCCC1=CC=C2OCOC2=C1 VXICFKRSWQYWHO-UHFFFAOYSA-N 0.000 description 2
- POLAVUVVBKLQNP-UHFFFAOYSA-N 5-(chloromethyl)-6-methyl-1,3-benzodioxole Chemical compound C1=C(CCl)C(C)=CC2=C1OCO2 POLAVUVVBKLQNP-UHFFFAOYSA-N 0.000 description 2
- HERYYLFZPLNJDW-UHFFFAOYSA-N 5-(chloromethyl)-6-propyl-1,3-benzodioxole Chemical compound C1=C(CCl)C(CCC)=CC2=C1OCO2 HERYYLFZPLNJDW-UHFFFAOYSA-N 0.000 description 2
- VSNOAPVXEHRMIE-UHFFFAOYSA-N 5-bromo-6-(2-phenylmethoxyethyl)-1,3-benzodioxole Chemical compound BrC1=CC=2OCOC=2C=C1CCOCC1=CC=CC=C1 VSNOAPVXEHRMIE-UHFFFAOYSA-N 0.000 description 2
- VLFYGYDQXIJVIX-UHFFFAOYSA-N 5-bromo-6-propan-2-yl-1,3-benzodioxole Chemical compound C1=C(Br)C(C(C)C)=CC2=C1OCO2 VLFYGYDQXIJVIX-UHFFFAOYSA-N 0.000 description 2
- ARGITQZGLVBTTI-UHFFFAOYSA-N 5-ethyl-1,3-benzodioxole Chemical compound CCC1=CC=C2OCOC2=C1 ARGITQZGLVBTTI-UHFFFAOYSA-N 0.000 description 2
- PGSGSDFDJINRSD-UHFFFAOYSA-N 5-methyl-6-(2-phenylmethoxyethyl)-1,3-benzodioxole Chemical compound CC1=CC=2OCOC=2C=C1CCOCC1=CC=CC=C1 PGSGSDFDJINRSD-UHFFFAOYSA-N 0.000 description 2
- VYGXJZFJKGPAFE-UHFFFAOYSA-N 5h-cyclopenta[f][1,3]benzodioxole Chemical compound C1=C2OCOC2=CC2=C1C=CC2 VYGXJZFJKGPAFE-UHFFFAOYSA-N 0.000 description 2
- IWHCDRGFOZDIBK-UHFFFAOYSA-N 6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxol-6-ol Chemical compound C1=C2CC(O)CC2=CC2=C1OCO2 IWHCDRGFOZDIBK-UHFFFAOYSA-N 0.000 description 2
- ISPRIXUKOHKYEU-UHFFFAOYSA-N 6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxole-6-carbonitrile Chemical compound C1=C2CC(C#N)CC2=CC2=C1OCO2 ISPRIXUKOHKYEU-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241001072983 Mentha Species 0.000 description 2
- 235000014435 Mentha Nutrition 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical class ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- XIJOWGTZTAQNSO-UHFFFAOYSA-N [4-(2-hydroxyethyl)-5-methyl-1,2-oxazol-3-yl] acetate Chemical compound CC(=O)OC1=NOC(C)=C1CCO XIJOWGTZTAQNSO-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 230000007882 cirrhosis Effects 0.000 description 2
- 208000019425 cirrhosis of liver Diseases 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- BLEJTPRVCIILKB-UHFFFAOYSA-N diethyl 2-[(6-propyl-1,3-benzodioxol-5-yl)methyl]propanedioate Chemical compound C1=C(CC(C(=O)OCC)C(=O)OCC)C(CCC)=CC2=C1OCO2 BLEJTPRVCIILKB-UHFFFAOYSA-N 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- PHJJQOFVZHBEEB-UHFFFAOYSA-N ethyl 2-(7,8-dihydro-5h-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetate Chemical compound C1=C2C(CC(=O)OCC)OCCC2=CC2=C1OCO2 PHJJQOFVZHBEEB-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 2
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 2
- 210000002381 plasma Anatomy 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000003449 preventive effect Effects 0.000 description 2
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000010254 subcutaneous injection Methods 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- WORJEOGGNQDSOE-ASTXPPQBSA-N trichloro(deuterio)methane;trideuterio(deuteriooxy)methane Chemical compound [2H]C(Cl)(Cl)Cl.[2H]OC([2H])([2H])[2H] WORJEOGGNQDSOE-ASTXPPQBSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- DIYWRNLYKJKHAM-MDOVXXIYSA-N (-)-cubebin Chemical compound C1=C2OCOC2=CC(C[C@@H]2[C@@H](CC=3C=C4OCOC4=CC=3)CO[C@@H]2O)=C1 DIYWRNLYKJKHAM-MDOVXXIYSA-N 0.000 description 1
- REPVLJRCJUVQFA-UHFFFAOYSA-N (-)-isopinocampheol Natural products C1C(O)C(C)C2C(C)(C)C1C2 REPVLJRCJUVQFA-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 150000005529 1,3-benzodioxoles Chemical class 0.000 description 1
- DQOWDEQSRZTALU-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)-2-methylpropan-1-ol Chemical compound CC(C)C(O)C1=CC=C2OCOC2=C1 DQOWDEQSRZTALU-UHFFFAOYSA-N 0.000 description 1
- JDNZZHLJFNDNMX-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)butan-1-ol Chemical compound CCCC(O)C1=CC=C2OCOC2=C1 JDNZZHLJFNDNMX-UHFFFAOYSA-N 0.000 description 1
- HVIYWLGVHHVGKB-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)pentan-1-ol Chemical compound CCCCC(O)C1=CC=C2OCOC2=C1 HVIYWLGVHHVGKB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- BHESCKPEROWHRI-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)ethyl acetate Chemical compound CC(=O)OCCC1=CC=C2OCOC2=C1 BHESCKPEROWHRI-UHFFFAOYSA-N 0.000 description 1
- DIZFUHWEXCVVBV-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylmethyldisulfanyl)ethanol Chemical compound OCCSSCC1=CC=C2OCOC2=C1 DIZFUHWEXCVVBV-UHFFFAOYSA-N 0.000 description 1
- ZVDLXUAWAKLCNE-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylmethyldisulfanyl)ethyl pyridine-3-carboxylate Chemical compound C=1C=C2OCOC2=CC=1CSSCCOC(=O)C1=CC=CN=C1 ZVDLXUAWAKLCNE-UHFFFAOYSA-N 0.000 description 1
- QDPJGXZGFSGNGI-UHFFFAOYSA-N 2-(5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-5-ylsulfanyl)acetic acid Chemical compound C1=C2C(SCC(=O)O)CCCC2=CC2=C1OCO2 QDPJGXZGFSGNGI-UHFFFAOYSA-N 0.000 description 1
- MYXYHIKQPBJHLS-UHFFFAOYSA-N 2-(6-propyl-1,3-benzodioxol-5-yl)acetic acid Chemical compound C1=C(CC(O)=O)C(CCC)=CC2=C1OCO2 MYXYHIKQPBJHLS-UHFFFAOYSA-N 0.000 description 1
- FIVPAKSKYSKSSO-UHFFFAOYSA-N 2-(benzyltrisulfanyl)ethanol Chemical compound OCCSSSCC1=CC=CC=C1 FIVPAKSKYSKSSO-UHFFFAOYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- CHCOBTKJDRDAHB-UHFFFAOYSA-N 2-[(6-propyl-1,3-benzodioxol-5-yl)methyl]propanedioic acid Chemical compound C1=C(CC(C(O)=O)C(O)=O)C(CCC)=CC2=C1OCO2 CHCOBTKJDRDAHB-UHFFFAOYSA-N 0.000 description 1
- MVCGTLZIAWQXOA-UHFFFAOYSA-N 2-[1-(1,3-benzodioxol-5-yl)butylsulfanyl]-n-methylacetamide Chemical compound CNC(=O)CSC(CCC)C1=CC=C2OCOC2=C1 MVCGTLZIAWQXOA-UHFFFAOYSA-N 0.000 description 1
- BCONOSBXTWVCNO-UHFFFAOYSA-N 2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]-n,n-dimethylethanesulfonamide Chemical compound CN(C)S(=O)(=O)CCSC(C)C1=CC=C2OCOC2=C1 BCONOSBXTWVCNO-UHFFFAOYSA-N 0.000 description 1
- LDYAKDFCTWLWBQ-UHFFFAOYSA-N 2-[1-(1,3-benzodioxol-5-yl)propan-2-yldisulfanyl]ethanol Chemical compound OCCSSC(C)CC1=CC=C2OCOC2=C1 LDYAKDFCTWLWBQ-UHFFFAOYSA-N 0.000 description 1
- HYYGCGMAKJZVKO-UHFFFAOYSA-N 2-[1-(6-methyl-1,3-benzodioxol-5-yl)ethylsulfonyl]acetic acid Chemical compound C1=C(C)C(C(C)S(=O)(=O)CC(O)=O)=CC2=C1OCO2 HYYGCGMAKJZVKO-UHFFFAOYSA-N 0.000 description 1
- NOJVRNYVBPLSIE-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethyldisulfanyl]ethanol Chemical compound OCCSSCCC1=CC=C2OCOC2=C1 NOJVRNYVBPLSIE-UHFFFAOYSA-N 0.000 description 1
- ILWMPCKHFBKFMW-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethyldisulfanyl]ethyl pyridine-3-carboxylate;hydrochloride Chemical compound Cl.C=1C=C2OCOC2=CC=1CCSSCCOC(=O)C1=CC=CN=C1 ILWMPCKHFBKFMW-UHFFFAOYSA-N 0.000 description 1
- JHEGNWFGZRIIBL-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethyl pyridine-3-carboxylate Chemical compound C=1C=C2OCOC2=CC=1CCSCCOC(=O)C1=CC=CN=C1 JHEGNWFGZRIIBL-UHFFFAOYSA-N 0.000 description 1
- LEEVMZIPDAEILE-UHFFFAOYSA-N 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate;hydrochloride Chemical compound Cl.C=1C=C2OCOC2=CC=1CCCSSCCOC(=O)C1=CC=CN=C1 LEEVMZIPDAEILE-UHFFFAOYSA-N 0.000 description 1
- LFQMONFNHOGGKG-UHFFFAOYSA-N 2-[[2-[4-(1,3-benzodioxol-5-yl)butylsulfanyl]acetyl]amino]acetic acid Chemical compound OC(=O)CNC(=O)CSCCCCC1=CC=C2OCOC2=C1 LFQMONFNHOGGKG-UHFFFAOYSA-N 0.000 description 1
- BCWMBGVCKRTSFJ-UHFFFAOYSA-N 2-amino-3-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]propanoic acid Chemical compound OC(=O)C(N)CSCCC1=CC=C2OCOC2=C1 BCWMBGVCKRTSFJ-UHFFFAOYSA-N 0.000 description 1
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- ZMRFRBHYXOQLDK-UHFFFAOYSA-N 2-phenylethanethiol Chemical compound SCCC1=CC=CC=C1 ZMRFRBHYXOQLDK-UHFFFAOYSA-N 0.000 description 1
- MCBXYBCPVRAKNT-UHFFFAOYSA-N 3-(6-propyl-1,3-benzodioxol-5-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C(CCC)=CC2=C1OCO2 MCBXYBCPVRAKNT-UHFFFAOYSA-N 0.000 description 1
- OCSTVBMHZXPRRY-UHFFFAOYSA-N 3-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CSCCC1=CC=C2OCOC2=C1 OCSTVBMHZXPRRY-UHFFFAOYSA-N 0.000 description 1
- LIQVHIOAGZQFKI-UHFFFAOYSA-N 3-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]propanamide Chemical compound NC(=O)CCSCCC1=CC=C2OCOC2=C1 LIQVHIOAGZQFKI-UHFFFAOYSA-N 0.000 description 1
- ABBWVMWCEOKCMN-UHFFFAOYSA-N 3-[6-(acetyloxymethyl)-1,3-benzodioxol-5-yl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(COC(=O)C)=CC2=C1OCO2 ABBWVMWCEOKCMN-UHFFFAOYSA-N 0.000 description 1
- AJHQKDMLJCLQIJ-UHFFFAOYSA-N 3-[6-(chloromethyl)-1,3-benzodioxol-5-yl]propanoic acid Chemical compound C1=C(CCl)C(CCC(=O)O)=CC2=C1OCO2 AJHQKDMLJCLQIJ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PRRZDZJYSJLDBS-UHFFFAOYSA-N 3-bromo-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CBr PRRZDZJYSJLDBS-UHFFFAOYSA-N 0.000 description 1
- MGONVLVGIXLZLA-UHFFFAOYSA-N 4-(2-hydroxyethyl)-5-methyl-1,2-oxazol-3-one Chemical compound CC=1ON=C(O)C=1CCO MGONVLVGIXLZLA-UHFFFAOYSA-N 0.000 description 1
- ZDHKVKPZQKYREU-UHFFFAOYSA-N 4-(chloromethyl)pyridine;hydron;chloride Chemical compound Cl.ClCC1=CC=NC=C1 ZDHKVKPZQKYREU-UHFFFAOYSA-N 0.000 description 1
- QKSDEFDQARKICE-UHFFFAOYSA-N 4-[2-(1,3-benzodioxol-5-yl)ethylsulfanylmethyl]pyridine Chemical compound C=1C=C2OCOC2=CC=1CCSCC1=CC=NC=C1 QKSDEFDQARKICE-UHFFFAOYSA-N 0.000 description 1
- LKLNTTMWFRNYLE-UHFFFAOYSA-N 5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one Chemical compound C1=C2C(=O)CCC2=CC2=C1OCO2 LKLNTTMWFRNYLE-UHFFFAOYSA-N 0.000 description 1
- NOSSPDHLBXXMRA-UHFFFAOYSA-N 5-(2-chloropropyl)-1,3-benzodioxole Chemical compound CC(Cl)CC1=CC=C2OCOC2=C1 NOSSPDHLBXXMRA-UHFFFAOYSA-N 0.000 description 1
- HVBQSPPDRGRLNO-UHFFFAOYSA-N 5-(2-ethylsulfinylethyl)-1,3-benzodioxole Chemical compound CCS(=O)CCC1=CC=C2OCOC2=C1 HVBQSPPDRGRLNO-UHFFFAOYSA-N 0.000 description 1
- PELMHWRYXQFCNQ-UHFFFAOYSA-N 5-(2-ethylsulfonylethyl)-1,3-benzodioxole Chemical compound CCS(=O)(=O)CCC1=CC=C2OCOC2=C1 PELMHWRYXQFCNQ-UHFFFAOYSA-N 0.000 description 1
- GNOYWEYNEPWOFW-UHFFFAOYSA-N 5-(2-methylsulfinylethyl)-1,3-benzodioxole Chemical compound CS(=O)CCC1=CC=C2OCOC2=C1 GNOYWEYNEPWOFW-UHFFFAOYSA-N 0.000 description 1
- ISUQREMGXKHYJX-UHFFFAOYSA-N 5-(2-methylsulfonylethyl)-1,3-benzodioxole Chemical compound CS(=O)(=O)CCC1=CC=C2OCOC2=C1 ISUQREMGXKHYJX-UHFFFAOYSA-N 0.000 description 1
- JLXHPZXPBNYHSU-UHFFFAOYSA-N 5-(2-propan-2-ylsulfinylethyl)-1,3-benzodioxole Chemical compound CC(C)S(=O)CCC1=CC=C2OCOC2=C1 JLXHPZXPBNYHSU-UHFFFAOYSA-N 0.000 description 1
- ZLMZMSBNIVMXHF-ONEGZZNKSA-N 5-[(e)-but-1-enyl]-1,3-benzodioxole Chemical compound CC\C=C\C1=CC=C2OCOC2=C1 ZLMZMSBNIVMXHF-ONEGZZNKSA-N 0.000 description 1
- CLPGSBYPEDMFCD-UHFFFAOYSA-N 5-[2-[1-(1,3-benzodioxol-5-yl)propan-2-yldisulfanyl]propyl]-1,3-benzodioxole Chemical compound C1=C2OCOC2=CC(CC(C)SSC(CC=2C=C3OCOC3=CC=2)C)=C1 CLPGSBYPEDMFCD-UHFFFAOYSA-N 0.000 description 1
- ABTCROZXLNQBAP-UHFFFAOYSA-N 5-[2-[2-(1,3-benzodioxol-5-yl)ethyldisulfanyl]ethyl]-1,3-benzodioxole Chemical compound C1=C2OCOC2=CC(CCSSCCC=2C=C3OCOC3=CC=2)=C1 ABTCROZXLNQBAP-UHFFFAOYSA-N 0.000 description 1
- DYMOQGMUTXVZHG-UHFFFAOYSA-N 5-[3-(2-phenylethyldisulfanyl)propyl]-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1CCCSSCCC1=CC=CC=C1 DYMOQGMUTXVZHG-UHFFFAOYSA-N 0.000 description 1
- JBLGDWXZIKBSFX-UHFFFAOYSA-N 5-[3-(nonyldisulfanyl)propyl]-1,3-benzodioxole Chemical compound CCCCCCCCCSSCCCC1=CC=C2OCOC2=C1 JBLGDWXZIKBSFX-UHFFFAOYSA-N 0.000 description 1
- FDTVPJJPRVAQMG-UHFFFAOYSA-N 5-benzyl-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1CC1=CC=CC=C1 FDTVPJJPRVAQMG-UHFFFAOYSA-N 0.000 description 1
- GHPODDMCSOYWNE-UHFFFAOYSA-N 5-methyl-1,3-benzodioxole Chemical compound CC1=CC=C2OCOC2=C1 GHPODDMCSOYWNE-UHFFFAOYSA-N 0.000 description 1
- NTZLWARVWMHHEN-UHFFFAOYSA-N 7,8-dihydro-6h-benzo[f][1,3]benzodioxol-5-one Chemical compound C1=C2C(=O)CCCC2=CC2=C1OCO2 NTZLWARVWMHHEN-UHFFFAOYSA-N 0.000 description 1
- USVZHTBPMMSRHY-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-chlorophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Cl USVZHTBPMMSRHY-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- CKLJMWTZIZZHCS-UHFFFAOYSA-N Aspartic acid Chemical compound OC(=O)C(N)CC(O)=O CKLJMWTZIZZHCS-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- MIFMUTDOHCUWAB-UHFFFAOYSA-M C1OC=2C=C3CC(CC3=CC2O1)C(=O)[O-].[Na+] Chemical compound C1OC=2C=C3CC(CC3=CC2O1)C(=O)[O-].[Na+] MIFMUTDOHCUWAB-UHFFFAOYSA-M 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000080208 Canella winterana Species 0.000 description 1
- 235000008499 Canella winterana Nutrition 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000008964 Chemical and Drug Induced Liver Injury Diseases 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 206010008909 Chronic Hepatitis Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- MYEIDJPOUKASEC-UHFFFAOYSA-N Dihydrosafrole Chemical compound CCCC1=CC=C2OCOC2=C1 MYEIDJPOUKASEC-UHFFFAOYSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- 206010072268 Drug-induced liver injury Diseases 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010019728 Hepatitis alcoholic Diseases 0.000 description 1
- 206010019799 Hepatitis viral Diseases 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- IFQSXNOEEPCSLW-DKWTVANSSA-N L-cysteine hydrochloride Chemical compound Cl.SC[C@H](N)C(O)=O IFQSXNOEEPCSLW-DKWTVANSSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 240000003718 Petiveria alliacea Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- IDUQCZOULGYDID-UHFFFAOYSA-M [Na+].C1=C(CCSCC([O-])=O)C(C)=CC2=C1OCO2 Chemical compound [Na+].C1=C(CCSCC([O-])=O)C(C)=CC2=C1OCO2 IDUQCZOULGYDID-UHFFFAOYSA-M 0.000 description 1
- FROQUPODLFZXLS-UHFFFAOYSA-M [Na+].C1=C(CCSCC([O-])=O)C(CC)=CC2=C1OCO2 Chemical compound [Na+].C1=C(CCSCC([O-])=O)C(CC)=CC2=C1OCO2 FROQUPODLFZXLS-UHFFFAOYSA-M 0.000 description 1
- YTQQLPXQSYJVJD-UHFFFAOYSA-M [Na+].C1=C(CCSCC([O-])=O)C(CCC)=CC2=C1OCO2 Chemical compound [Na+].C1=C(CCSCC([O-])=O)C(CCC)=CC2=C1OCO2 YTQQLPXQSYJVJD-UHFFFAOYSA-M 0.000 description 1
- LNCMZMADESUEPW-UHFFFAOYSA-M [Na+].C1=C(CCSCC([O-])=O)C=C2OC(C)(C)OC2=C1 Chemical compound [Na+].C1=C(CCSCC([O-])=O)C=C2OC(C)(C)OC2=C1 LNCMZMADESUEPW-UHFFFAOYSA-M 0.000 description 1
- AWHCNTFZSAYQTL-UHFFFAOYSA-M [Na+].C1=C(CCSCC([O-])=O)C=C2OC(C)OC2=C1 Chemical compound [Na+].C1=C(CCSCC([O-])=O)C=C2OC(C)OC2=C1 AWHCNTFZSAYQTL-UHFFFAOYSA-M 0.000 description 1
- LCAJLRMNELWYNW-UHFFFAOYSA-M [Na+].[O-]C(=O)C(C#N)SCCC1=CC=C2OCOC2=C1 Chemical compound [Na+].[O-]C(=O)C(C#N)SCCC1=CC=C2OCOC2=C1 LCAJLRMNELWYNW-UHFFFAOYSA-M 0.000 description 1
- JGIOVHZASSIOHB-UHFFFAOYSA-M [Na+].[O-]C(=O)CSC(CC)CC1=CC=C2OCOC2=C1 Chemical compound [Na+].[O-]C(=O)CSC(CC)CC1=CC=C2OCOC2=C1 JGIOVHZASSIOHB-UHFFFAOYSA-M 0.000 description 1
- OEUCQPQOIZWVDP-UHFFFAOYSA-M [Na+].[O-]C(=O)CSCCC1=CC=C2OCOC2=C1 Chemical compound [Na+].[O-]C(=O)CSCCC1=CC=C2OCOC2=C1 OEUCQPQOIZWVDP-UHFFFAOYSA-M 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 231100000354 acute hepatitis Toxicity 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 208000002353 alcoholic hepatitis Diseases 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- XUEHVOLRMXNRKQ-KHMAMNHCSA-N alpha cubebene Natural products CC(C)[C@@H]([C@H]12)CC[C@@H](C)[C@]32[C@@H]1C(C)=CC3 XUEHVOLRMXNRKQ-KHMAMNHCSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229940116229 borneol Drugs 0.000 description 1
- CKDOCTFBFTVPSN-UHFFFAOYSA-N borneol Natural products C1CC2(C)C(C)CC1C2(C)C CKDOCTFBFTVPSN-UHFFFAOYSA-N 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 201000001352 cholecystitis Diseases 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229940017545 cinnamon bark Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- DTGKSKDOIYIVQL-UHFFFAOYSA-N dl-isoborneol Natural products C1CC2(C)C(O)CC1C2(C)C DTGKSKDOIYIVQL-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 231100000594 drug induced liver disease Toxicity 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- PDZAZJHFLGCKNH-UHFFFAOYSA-N ethyl 2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]acetate Chemical compound CCOC(=O)CSCCC1=CC=C2OCOC2=C1 PDZAZJHFLGCKNH-UHFFFAOYSA-N 0.000 description 1
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 1
- KJTAOZLZNJPGJE-UHFFFAOYSA-N ethyl 3-[6-(2-hydroxyethyl)-1,3-benzodioxol-5-yl]prop-2-enoate Chemical compound C1=C(CCO)C(C=CC(=O)OCC)=CC2=C1OCO2 KJTAOZLZNJPGJE-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229940014259 gelatin Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 231100000283 hepatitis Toxicity 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- WFNASTYGEKUMIY-UHFFFAOYSA-N hydron;1h-imidazol-5-ylmethanol;chloride Chemical compound Cl.OCC1=CN=CN1 WFNASTYGEKUMIY-UHFFFAOYSA-N 0.000 description 1
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940071676 hydroxypropylcellulose Drugs 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- WOBVWKYTMMHGKT-UHFFFAOYSA-N n,n-diethyl-2-[2-(6-ethyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetamide Chemical compound C1=C(CC)C(CCSCC(=O)N(CC)CC)=CC2=C1OCO2 WOBVWKYTMMHGKT-UHFFFAOYSA-N 0.000 description 1
- DUMQHCOKDBOHOA-UHFFFAOYSA-N n,n-dimethyl-2-[1-(6-methyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetamide Chemical compound C1=C(C)C(C(SCC(=O)N(C)C)C)=CC2=C1OCO2 DUMQHCOKDBOHOA-UHFFFAOYSA-N 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- ZVEZMVFBMOOHAT-UHFFFAOYSA-N nonane-1-thiol Chemical compound CCCCCCCCCS ZVEZMVFBMOOHAT-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003002 pH adjusting agent Substances 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229940081310 piperonal Drugs 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006225 propoxyethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- JNOCQGZRFVMRSW-UHFFFAOYSA-M sodium 2-[(6-benzyl-1,3-benzodioxol-5-yl)methylsulfanyl]acetate Chemical compound [Na+].[O-]C(=O)CSCC1=CC=2OCOC=2C=C1CC1=CC=CC=C1 JNOCQGZRFVMRSW-UHFFFAOYSA-M 0.000 description 1
- YIXYFPLRFWHSDP-UHFFFAOYSA-M sodium 2-[(6-methyl-1,3-benzodioxol-5-yl)methylsulfanyl]acetate Chemical compound [Na+].C1=C(CSCC([O-])=O)C(C)=CC2=C1OCO2 YIXYFPLRFWHSDP-UHFFFAOYSA-M 0.000 description 1
- QGLGVCYLUKRKJQ-UHFFFAOYSA-M sodium 2-[(6-propan-2-yl-1,3-benzodioxol-5-yl)methylsulfanyl]acetate Chemical compound [Na+].C1=C(CSCC([O-])=O)C(C(C)C)=CC2=C1OCO2 QGLGVCYLUKRKJQ-UHFFFAOYSA-M 0.000 description 1
- SZUVNISAFMUMFT-UHFFFAOYSA-M sodium 2-[1-(1,3-benzodioxol-5-yl)pentylsulfanyl]acetate Chemical compound [Na+].CCCCC(SCC([O-])=O)C1=CC=C2OCOC2=C1 SZUVNISAFMUMFT-UHFFFAOYSA-M 0.000 description 1
- IXIFPGCMHPMDRO-UHFFFAOYSA-M sodium 2-[1-(6-ethyl-1,3-benzodioxol-5-yl)propylsulfanyl]acetate Chemical compound [Na+].C1=C(CC)C(C(SCC([O-])=O)CC)=CC2=C1OCO2 IXIFPGCMHPMDRO-UHFFFAOYSA-M 0.000 description 1
- IYDGVCITJUKRRC-UHFFFAOYSA-M sodium 2-[1-(6-methyl-1,3-benzodioxol-5-yl)butylsulfanyl]acetate Chemical compound [Na+].C1=C(C)C(C(SCC([O-])=O)CCC)=CC2=C1OCO2 IYDGVCITJUKRRC-UHFFFAOYSA-M 0.000 description 1
- PQSDTEDIAPLLEO-UHFFFAOYSA-M sodium 2-[1-(6-methyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate Chemical compound [Na+].C1=C(C)C(C(SCC([O-])=O)C)=CC2=C1OCO2 PQSDTEDIAPLLEO-UHFFFAOYSA-M 0.000 description 1
- HOQKHRZCVKUCKK-UHFFFAOYSA-M sodium 2-[1-(6-methyl-1,3-benzodioxol-5-yl)propylsulfanyl]acetate Chemical compound [Na+].C1=C(C)C(C(SCC([O-])=O)CC)=CC2=C1OCO2 HOQKHRZCVKUCKK-UHFFFAOYSA-M 0.000 description 1
- OAVXTHUHBFSVGC-UHFFFAOYSA-M sodium 2-[2-(1,3-benzodioxol-5-yl)butan-2-ylsulfanyl]acetate Chemical compound [Na+].[O-]C(=O)CSC(C)(CC)C1=CC=C2OCOC2=C1 OAVXTHUHBFSVGC-UHFFFAOYSA-M 0.000 description 1
- RWYWIUCLZGPVIY-UHFFFAOYSA-M sodium 2-[2-(1,3-benzodioxol-5-yl)propan-2-ylsulfanyl]acetate Chemical compound [Na+].[O-]C(=O)CSC(C)(C)C1=CC=C2OCOC2=C1 RWYWIUCLZGPVIY-UHFFFAOYSA-M 0.000 description 1
- CLZCUTWVGPBZSP-UHFFFAOYSA-M sodium 2-[2-(6-benzyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate Chemical compound [Na+].[O-]C(=O)CSCCC1=CC=2OCOC=2C=C1CC1=CC=CC=C1 CLZCUTWVGPBZSP-UHFFFAOYSA-M 0.000 description 1
- UWVWLDBNFGAFOS-UHFFFAOYSA-M sodium 2-[2-(6-propan-2-yl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate Chemical compound [Na+].C1=C(CCSCC([O-])=O)C(C(C)C)=CC2=C1OCO2 UWVWLDBNFGAFOS-UHFFFAOYSA-M 0.000 description 1
- VPDNNFIYGRKPSO-UHFFFAOYSA-M sodium 2-[phenyl-(6-propan-2-yl-1,3-benzodioxol-5-yl)methyl]sulfanylacetate Chemical compound [Na+].CC(C)C1=CC=2OCOC=2C=C1C(SCC([O-])=O)C1=CC=CC=C1 VPDNNFIYGRKPSO-UHFFFAOYSA-M 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000011182 sodium carbonates Nutrition 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- SGSJKJRSVLQQNW-UHFFFAOYSA-M sodium;2-(6,7-dihydro-5h-cyclopenta[f][1,3]benzodioxol-7-ylsulfanyl)acetate Chemical compound [Na+].C1=C2C(SCC(=O)[O-])CCC2=CC2=C1OCO2 SGSJKJRSVLQQNW-UHFFFAOYSA-M 0.000 description 1
- HHRUJVCFZHQOCG-UHFFFAOYSA-M sodium;2-[1-(1,3-benzodioxol-5-yl)butylsulfanyl]acetate Chemical compound [Na+].[O-]C(=O)CSC(CCC)C1=CC=C2OCOC2=C1 HHRUJVCFZHQOCG-UHFFFAOYSA-M 0.000 description 1
- IZDLYSMNTROVIV-UHFFFAOYSA-M sodium;2-[1-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CCSC(C)C1=CC=C2OCOC2=C1 IZDLYSMNTROVIV-UHFFFAOYSA-M 0.000 description 1
- KUPDUUHZGIFJSJ-UHFFFAOYSA-M sodium;2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]-2-methylpropanoate Chemical compound [Na+].[O-]C(=O)C(C)(C)SCCC1=CC=C2OCOC2=C1 KUPDUUHZGIFJSJ-UHFFFAOYSA-M 0.000 description 1
- DWXPGFKULUOFOA-UHFFFAOYSA-M sodium;2-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]ethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CCSCCC1=CC=C2OCOC2=C1 DWXPGFKULUOFOA-UHFFFAOYSA-M 0.000 description 1
- DHUWCFFLLGBCMY-UHFFFAOYSA-M sodium;2-[[2-[4-(1,3-benzodioxol-5-yl)butylsulfanyl]acetyl]amino]acetate Chemical compound [Na+].[O-]C(=O)CNC(=O)CSCCCCC1=CC=C2OCOC2=C1 DHUWCFFLLGBCMY-UHFFFAOYSA-M 0.000 description 1
- SGICJKZFUQNAKN-UHFFFAOYSA-M sodium;2-amino-3-[2-(1,3-benzodioxol-5-yl)ethylsulfanyl]propanoate Chemical compound [Na+].[O-]C(=O)C(N)CSCCC1=CC=C2OCOC2=C1 SGICJKZFUQNAKN-UHFFFAOYSA-M 0.000 description 1
- HNFOAHXBHLWKNF-UHFFFAOYSA-M sodium;2-bromoethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CCBr HNFOAHXBHLWKNF-UHFFFAOYSA-M 0.000 description 1
- PFYLDIKCNIKWMV-UHFFFAOYSA-M sodium;3-(6-ethyl-1,3-benzodioxol-5-yl)propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(CC)=CC2=C1OCO2 PFYLDIKCNIKWMV-UHFFFAOYSA-M 0.000 description 1
- CXFQWEYEZRCILV-UHFFFAOYSA-M sodium;3-(6-methyl-1,3-benzodioxol-5-yl)propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(C)=CC2=C1OCO2 CXFQWEYEZRCILV-UHFFFAOYSA-M 0.000 description 1
- GQCSFZPIBSNQIT-UHFFFAOYSA-M sodium;3-(6-propyl-1,3-benzodioxol-5-yl)propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(CCC)=CC2=C1OCO2 GQCSFZPIBSNQIT-UHFFFAOYSA-M 0.000 description 1
- IAAVTTNFLGSYPN-UHFFFAOYSA-M sodium;3-[6-(2-ethylsulfanylethyl)-1,3-benzodioxol-5-yl]propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(CCSCC)=CC2=C1OCO2 IAAVTTNFLGSYPN-UHFFFAOYSA-M 0.000 description 1
- NTZWLFBXTKASHR-UHFFFAOYSA-M sodium;3-[6-(ethoxymethyl)-1,3-benzodioxol-5-yl]propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(COCC)=CC2=C1OCO2 NTZWLFBXTKASHR-UHFFFAOYSA-M 0.000 description 1
- NPMMTKDTMOISSQ-UHFFFAOYSA-M sodium;3-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]propanoate Chemical compound [Na+].C1=C(CCC([O-])=O)C(COC)=CC2=C1OCO2 NPMMTKDTMOISSQ-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000013599 spices Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000003637 steroidlike Effects 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- HSOZCYIMJQTYEX-UHFFFAOYSA-M triphenyl(propan-2-yl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C(C)C)C1=CC=CC=C1 HSOZCYIMJQTYEX-UHFFFAOYSA-M 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000001862 viral hepatitis Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/54—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/56—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/70—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with ring systems containing two or more relevant rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4914187 | 1987-03-04 | ||
| JP62082258A JP2535528B2 (ja) | 1987-04-03 | 1987-04-03 | 〔2−(1,3−ベンゾジオキソ−ル−5−イル)エチル〕チオ誘導体 |
| JP62103724A JP2535532B2 (ja) | 1987-04-27 | 1987-04-27 | ベンゾジオキソ−ル誘導体 |
| JP62105508A JP2588193B2 (ja) | 1987-04-28 | 1987-04-28 | ベンゾジオキソ−ル誘導体 |
| JP62105509A JP2535533B2 (ja) | 1987-04-28 | 1987-04-28 | ベンゾジオキソ−ル誘導体 |
| JP24349287 | 1987-09-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3876114D1 DE3876114D1 (de) | 1993-01-07 |
| DE3876114T2 true DE3876114T2 (de) | 1993-04-22 |
Family
ID=27550353
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8888103164T Expired - Fee Related DE3876114T2 (de) | 1987-03-04 | 1988-03-02 | Benzodioxol-derivate, diese enthaltende zusammensetzungen und deren verwendung zur herstellung von medikamenten. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US5110956A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0281098B1 (cg-RX-API-DMAC10.html) |
| KR (1) | KR910005428B1 (cg-RX-API-DMAC10.html) |
| CN (1) | CN88101155A (cg-RX-API-DMAC10.html) |
| AU (1) | AU600800B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1311241C (cg-RX-API-DMAC10.html) |
| DE (1) | DE3876114T2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK114388A (cg-RX-API-DMAC10.html) |
| ES (1) | ES2052622T3 (cg-RX-API-DMAC10.html) |
| FI (1) | FI880905A7 (cg-RX-API-DMAC10.html) |
| GR (1) | GR3006337T3 (cg-RX-API-DMAC10.html) |
| HU (1) | HU201046B (cg-RX-API-DMAC10.html) |
| NO (1) | NO880922L (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ223725A (cg-RX-API-DMAC10.html) |
| PH (1) | PH26101A (cg-RX-API-DMAC10.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245053A (en) * | 1990-05-04 | 1993-09-14 | American Cyanamid Company | Substituted 5-(2-(2-aryl-2-hydroxyethyl)-amino)propyl)-1,3-benzodioxoles |
| US5559105A (en) * | 1992-07-17 | 1996-09-24 | Smithkline Beecham Corporation | Endothelin receptor antagonists |
| US5932741A (en) * | 1997-01-31 | 1999-08-03 | Hoechst Marion Roussel | Imidazole-5-carboxylic acid compounds |
| KR100632794B1 (ko) * | 2004-01-26 | 2006-10-13 | 한상민 | 1,3-벤조디옥솔-5-릴메틸 메틸 설폰 및 그 유도체, 그의 제조방법 및 이를 함유하는 미백용 조성물 |
| CN101798297B (zh) * | 2009-02-11 | 2013-02-27 | 中国科学院上海药物研究所 | 大叶蒟素的化学合成方法 |
| WO2012173842A2 (en) * | 2011-06-13 | 2012-12-20 | Fmc Corporation | Purification process for para-methallylpyrocatechol |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2112069B1 (cg-RX-API-DMAC10.html) * | 1970-09-11 | 1973-12-21 | Ciba Geigy Ag | |
| JPS5021949B2 (cg-RX-API-DMAC10.html) * | 1972-08-15 | 1975-07-26 | ||
| JPS6229522A (ja) * | 1985-07-29 | 1987-02-07 | Shin Nippon Yakuhin Kk | 肝臓疾患治療剤 |
| JPS6239583A (ja) * | 1985-08-14 | 1987-02-20 | Yamanouchi Pharmaceut Co Ltd | ベンゾジオキソ−ル誘導体及びその製造法 |
-
1988
- 1988-02-23 PH PH36545A patent/PH26101A/en unknown
- 1988-02-26 FI FI880905A patent/FI880905A7/fi not_active Application Discontinuation
- 1988-03-02 EP EP88103164A patent/EP0281098B1/en not_active Expired - Lifetime
- 1988-03-02 NO NO880922A patent/NO880922L/no unknown
- 1988-03-02 ES ES88103164T patent/ES2052622T3/es not_active Expired - Lifetime
- 1988-03-02 DE DE8888103164T patent/DE3876114T2/de not_active Expired - Fee Related
- 1988-03-02 CA CA000560311A patent/CA1311241C/en not_active Expired - Fee Related
- 1988-03-02 NZ NZ223725A patent/NZ223725A/xx unknown
- 1988-03-03 HU HU881039A patent/HU201046B/hu not_active IP Right Cessation
- 1988-03-03 DK DK114388A patent/DK114388A/da not_active Application Discontinuation
- 1988-03-04 KR KR1019880002264A patent/KR910005428B1/ko not_active Expired
- 1988-03-04 CN CN198888101155A patent/CN88101155A/zh active Pending
- 1988-03-04 AU AU12764/88A patent/AU600800B2/en not_active Ceased
-
1990
- 1990-04-23 US US07/517,444 patent/US5110956A/en not_active Expired - Fee Related
-
1992
- 1992-11-26 GR GR920402452T patent/GR3006337T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KR910005428B1 (ko) | 1991-07-29 |
| CN88101155A (zh) | 1988-09-28 |
| FI880905L (fi) | 1988-09-05 |
| NO880922L (no) | 1988-09-05 |
| EP0281098A1 (en) | 1988-09-07 |
| KR880011140A (ko) | 1988-10-26 |
| PH26101A (en) | 1992-02-06 |
| FI880905A7 (fi) | 1988-09-05 |
| DK114388D0 (da) | 1988-03-03 |
| FI880905A0 (fi) | 1988-02-26 |
| CA1311241C (en) | 1992-12-08 |
| ES2052622T3 (es) | 1994-07-16 |
| EP0281098B1 (en) | 1992-11-25 |
| DE3876114D1 (de) | 1993-01-07 |
| NO880922D0 (no) | 1988-03-02 |
| HU201046B (en) | 1990-09-28 |
| HUT49867A (en) | 1989-11-28 |
| GR3006337T3 (cg-RX-API-DMAC10.html) | 1993-06-21 |
| US5110956A (en) | 1992-05-05 |
| NZ223725A (en) | 1989-09-27 |
| DK114388A (da) | 1988-09-05 |
| AU600800B2 (en) | 1990-08-23 |
| AU1276488A (en) | 1988-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69418704T2 (de) | Anthranilsäure derivate | |
| DE69718026T2 (de) | Fluorierte 1,4-disubstituierte piperidin-derivate | |
| DE69331122T2 (de) | 4-Aminochinazolin-Derivate, deren Verwendung als Heilmittel | |
| DE69108138T2 (de) | Imidazopyridinderivate und ihre Verwendung. | |
| DE3851114T2 (de) | Trizyklische Verbindungen. | |
| DE69217312T2 (de) | Tricyclische Heterocyclen als PGE2-Antagonisten | |
| JPS60169476A (ja) | 新規のピリジン−2−エ−テル、その製造法及び該化合物を含有する、鎮痛作用を有する医薬品 | |
| CH660731A5 (de) | Aminderivate und deren salze. | |
| DE69232883T2 (de) | Substituierte heterocyklische derivate, verwendbar als plättchenaggregationshemmstoffe | |
| FR2589152A1 (fr) | Derives pyridine-3-carboxamides et leur application comme inhibiteurs de la croissance des plantes | |
| DE3522579C2 (de) | Neue 1,4-Dihydropyridin-Derivate und Salze derselben, Verfahren zur Herstellung derselben und pharmazeutische Mittel mit einem Gehalt derselben | |
| CN109678815A (zh) | N-苄基苯甲酰胺类衍生物及其制备方法与制药用途 | |
| DE69110828T2 (de) | Heterozyklische Aminderivate, deren Herstellung und deren Verwendung. | |
| DE3876114T2 (de) | Benzodioxol-derivate, diese enthaltende zusammensetzungen und deren verwendung zur herstellung von medikamenten. | |
| DE2635516B2 (de) | Neue Derivate des Thiazole [3,4-b] isochinoline, ihre Herstellung und die sie enthaltenden Zusammensetzungen | |
| DE3232462A1 (de) | 2-nitro-1,1-ethendiamine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE3739882A1 (de) | Substituierte hydroxylamine | |
| DE3885482T2 (de) | Pyridyloxy-Derivate. | |
| CZ177892A3 (en) | AMINOMETHYL SUBSTITUTED 2,3-DIHYDROPYRAN(2,3-b)PYRIDINES, PROCESS OF THEIR PREPARATION AND THEIR USE IN MEDICAMENTS | |
| DE68917049T2 (de) | Furylthiazol-Derivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzungen, die sie enthalten. | |
| DE68913167T2 (de) | Indol-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate. | |
| DE68924416T2 (de) | Carboximidamid-Derivate. | |
| EP0211157A1 (de) | Isoxazolderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutischen Präparate | |
| DD287038A5 (de) | Benzodioxolderivate | |
| DE69301003T2 (de) | Hydroxylaminderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |