DE3733033C2 - - Google Patents
Info
- Publication number
- DE3733033C2 DE3733033C2 DE3733033A DE3733033A DE3733033C2 DE 3733033 C2 DE3733033 C2 DE 3733033C2 DE 3733033 A DE3733033 A DE 3733033A DE 3733033 A DE3733033 A DE 3733033A DE 3733033 C2 DE3733033 C2 DE 3733033C2
- Authority
- DE
- Germany
- Prior art keywords
- hydroxymethylphthalimide
- ether
- polymers
- bis
- phthalimidomethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 66
- 229920000642 polymer Polymers 0.000 claims description 50
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 38
- MNSGOOCAMMSKGI-UHFFFAOYSA-N N-(hydroxymethyl)phthalimide Chemical compound C1=CC=C2C(=O)N(CO)C(=O)C2=C1 MNSGOOCAMMSKGI-UHFFFAOYSA-N 0.000 claims description 35
- 239000003795 chemical substances by application Substances 0.000 claims description 31
- 230000008961 swelling Effects 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 17
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 16
- 150000001450 anions Chemical class 0.000 claims description 15
- 238000004519 manufacturing process Methods 0.000 claims description 15
- AKEXYVBHMPWUJF-UHFFFAOYSA-N 2-[(1,3-dioxoisoindol-2-yl)methoxymethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1COCN1C(=O)C2=CC=CC=C2C1=O AKEXYVBHMPWUJF-UHFFFAOYSA-N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 9
- 229920000620 organic polymer Polymers 0.000 claims description 9
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 3
- 150000002168 ethanoic acid esters Chemical class 0.000 claims description 3
- 239000008098 formaldehyde solution Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 26
- 239000011324 bead Substances 0.000 description 21
- 235000011121 sodium hydroxide Nutrition 0.000 description 20
- 230000000052 comparative effect Effects 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 8
- 229920002554 vinyl polymer Polymers 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 230000003204 osmotic effect Effects 0.000 description 5
- 239000011049 pearl Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 238000011068 loading method Methods 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000013112 stability test Methods 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 238000005096 rolling process Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 238000005830 amidoalkylation reaction Methods 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- UIYCHXAGWOYNNA-UHFFFAOYSA-N vinyl sulfide Chemical compound C=CSC=C UIYCHXAGWOYNNA-UHFFFAOYSA-N 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- FEKGWIHDBVDVSM-UHFFFAOYSA-N 1,1,1,2-tetrachloropropane Chemical compound CC(Cl)C(Cl)(Cl)Cl FEKGWIHDBVDVSM-UHFFFAOYSA-N 0.000 description 1
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- NWRZGFYWENINNX-UHFFFAOYSA-N 1,1,2-tris(ethenyl)cyclohexane Chemical compound C=CC1CCCCC1(C=C)C=C NWRZGFYWENINNX-UHFFFAOYSA-N 0.000 description 1
- WVAFEFUPWRPQSY-UHFFFAOYSA-N 1,2,3-tris(ethenyl)benzene Chemical compound C=CC1=CC=CC(C=C)=C1C=C WVAFEFUPWRPQSY-UHFFFAOYSA-N 0.000 description 1
- ZJQIXGGEADDPQB-UHFFFAOYSA-N 1,2-bis(ethenyl)-3,4-dimethylbenzene Chemical group CC1=CC=C(C=C)C(C=C)=C1C ZJQIXGGEADDPQB-UHFFFAOYSA-N 0.000 description 1
- QLLUAUADIMPKIH-UHFFFAOYSA-N 1,2-bis(ethenyl)naphthalene Chemical class C1=CC=CC2=C(C=C)C(C=C)=CC=C21 QLLUAUADIMPKIH-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- FCMUPMSEVHVOSE-UHFFFAOYSA-N 2,3-bis(ethenyl)pyridine Chemical compound C=CC1=CC=CN=C1C=C FCMUPMSEVHVOSE-UHFFFAOYSA-N 0.000 description 1
- LBQJCDLKJGOHEA-UHFFFAOYSA-N 2-ethenylbut-3-enylbenzene Chemical compound C=CC(C=C)CC1=CC=CC=C1 LBQJCDLKJGOHEA-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- AYGYHGXUJBFUJU-UHFFFAOYSA-N n-[2-(prop-2-enoylamino)ethyl]prop-2-enamide Chemical compound C=CC(=O)NCCNC(=O)C=C AYGYHGXUJBFUJU-UHFFFAOYSA-N 0.000 description 1
- SFBTTWXNCQVIEC-UHFFFAOYSA-N o-Vinylanisole Chemical compound COC1=CC=CC=C1C=C SFBTTWXNCQVIEC-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical compound C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 1
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical class C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 229960000834 vinyl ether Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/30—Introducing nitrogen atoms or nitrogen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2810/00—Chemical modification of a polymer
- C08F2810/20—Chemical modification of a polymer leading to a crosslinking, either explicitly or inherently
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Phenolic Resins Or Amino Resins (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873733033 DE3733033A1 (de) | 1987-09-30 | 1987-09-30 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften |
| US07/244,441 US4952608A (en) | 1987-09-30 | 1988-09-14 | Process for preparing synthetic resins having anion exchanger properties by amidomethylating a backbone polymer containing aromatic nuclei with a specially prepared N-hydroxymethyl phthalimide |
| DE8888115367T DE3868208D1 (de) | 1987-09-30 | 1988-09-20 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften. |
| EP88115367A EP0309861B1 (de) | 1987-09-30 | 1988-09-20 | Verfahren zur Herstellung von Kunstharzen mit anionenaustauschenden Eigenschaften |
| JP63239114A JP2539011B2 (ja) | 1987-09-30 | 1988-09-26 | 陰イオン交換性を有する合成樹脂の製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873733033 DE3733033A1 (de) | 1987-09-30 | 1987-09-30 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3733033A1 DE3733033A1 (de) | 1989-04-13 |
| DE3733033C2 true DE3733033C2 (enExample) | 1989-11-23 |
Family
ID=6337289
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873733033 Granted DE3733033A1 (de) | 1987-09-30 | 1987-09-30 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften |
| DE8888115367T Expired - Lifetime DE3868208D1 (de) | 1987-09-30 | 1988-09-20 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8888115367T Expired - Lifetime DE3868208D1 (de) | 1987-09-30 | 1988-09-20 | Verfahren zur herstellung von kunstharzen mit anionenaustauschenden eigenschaften. |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4952608A (enExample) |
| EP (1) | EP0309861B1 (enExample) |
| JP (1) | JP2539011B2 (enExample) |
| DE (2) | DE3733033A1 (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR0140659B1 (ko) * | 1992-10-28 | 1998-07-01 | 나카하라 쓰네오 | 아실아미도메틸화 폴리설폰 및 이의 제조방법 |
| DE4328075A1 (de) * | 1993-08-20 | 1995-02-23 | Bayer Ag | Verfahren zur Herstellung schwachbasischer Anionenaustauscher und dafür geeigneter Reagenzien |
| DE50014560D1 (de) * | 1999-08-27 | 2007-09-27 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von monodispersen, vernetzten Perlpolymerisaten mit Thioharnstoffgruppen und ihre Verwendung zur Adsorption von Metallverbindungen |
| EP1078690B1 (de) * | 1999-08-27 | 2011-10-12 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von monodispersen Ionenaustauschern mit chelatisierenden Gruppen |
| EP1078688B1 (de) * | 1999-08-27 | 2012-05-09 | LANXESS Deutschland GmbH | Verfahren zur Herstellung von monodispersen Anionenaustauschern |
| EP1078689A3 (de) * | 1999-08-27 | 2003-02-26 | Bayer Ag | Verfahren zur Herstellung von monodispersen Anionenaustauschern mit stark basischen funktionellen Gruppen |
| DE10023970A1 (de) * | 2000-05-16 | 2001-11-22 | Bayer Ag | Verfahren zur Gasadsorption mittels aminomethylierter Perlpolymerisate |
| DE10326666A1 (de) * | 2003-02-24 | 2004-09-02 | Bayer Ag | Stoffgemische |
| DE10327110A1 (de) * | 2003-06-13 | 2005-01-05 | Bayer Chemicals Ag | Arsenadsorbierende Ionenaustauscher |
| DE10353534A1 (de) * | 2003-11-14 | 2005-06-16 | Bayer Chemicals Ag | Chelataustauscher |
| DE102006045504A1 (de) | 2006-09-27 | 2008-04-03 | Lanxess Deutschland Gmbh | Wärmestabile Anionenaustauscher |
| DE102007040763A1 (de) | 2007-08-29 | 2009-03-05 | Lanxess Deutschland Gmbh | Borselektive Harze |
| DE102008012224A1 (de) * | 2008-03-03 | 2009-09-10 | Lanxess Deutschland Gmbh | Picolylaminharze |
| DE102009052934A1 (de) | 2009-11-12 | 2011-05-19 | Lanxess Deutschland Gmbh | Borselektive Harze |
| EP2330137B1 (de) | 2009-12-04 | 2013-06-26 | LANXESS Deutschland GmbH | Methylenaminoethylsulfonsäure-Chelatharze |
| US9486798B2 (en) | 2013-06-19 | 2016-11-08 | Dow Global Technologies Llc | Method for making anion exchange and chelant resins including aliphatic amino functional groups |
| CN105829282B (zh) | 2013-12-19 | 2018-08-28 | 朗盛德国有限责任公司 | 用于生产邻苯二甲酰亚胺的方法 |
| EP3183275B1 (de) * | 2014-08-20 | 2018-05-23 | Lanxess Deutschland GmbH | Sulfonierte, aminomethylierte chelatharze |
| US9776945B2 (en) | 2014-09-29 | 2017-10-03 | Rennovia Inc. | Preparation and separation of a di-carboxylic acid-containing mixture |
| EP3012272B1 (de) * | 2014-10-21 | 2017-11-15 | LANXESS Deutschland GmbH | Verfahren zur herstellung von aminomethylierten perlpolymerisaten |
| US9968926B2 (en) * | 2014-12-22 | 2018-05-15 | Lanxess Deutschland Gmbh | Method for producing amino methylated bead polymerizates |
| EP3237464B1 (de) * | 2014-12-22 | 2020-11-11 | LANXESS Deutschland GmbH | Verfahren zur herstellung von aminomethylierten perlpolymerisaten aus n-carbonsäuremethylphthalimidestern |
| RU2740210C2 (ru) | 2016-06-22 | 2021-01-12 | ЛЕНКСЕСС Дойчланд ГмбХ | Способ получения аминометилированных бисерных полимеризатов |
| CN117986513B (zh) * | 2024-04-07 | 2024-07-16 | 江西沐坤科技有限公司 | 一种树脂材料及其制备方法和应用、对稀土浸矿母液进行富集净化的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3767671A (en) * | 1971-09-01 | 1973-10-23 | Gen Electric | Trimellitimide derivatives |
| US3882053A (en) * | 1971-12-11 | 1975-05-06 | Bayer Ag | Anion exchange resins |
| US3925264A (en) * | 1972-03-08 | 1975-12-09 | Bayer Ag | Process for the production of anion exchangers |
| DE2418976C3 (de) * | 1974-04-19 | 1978-10-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von wasserunlöslichen Kunstharzen mit Anionenaustauscher-Eigenschaften |
| DE2519244C3 (de) * | 1975-04-30 | 1985-05-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Kunstharzen mit anionenaustauschenden Eigenschaften |
-
1987
- 1987-09-30 DE DE19873733033 patent/DE3733033A1/de active Granted
-
1988
- 1988-09-14 US US07/244,441 patent/US4952608A/en not_active Expired - Fee Related
- 1988-09-20 EP EP88115367A patent/EP0309861B1/de not_active Expired - Lifetime
- 1988-09-20 DE DE8888115367T patent/DE3868208D1/de not_active Expired - Lifetime
- 1988-09-26 JP JP63239114A patent/JP2539011B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JP2539011B2 (ja) | 1996-10-02 |
| DE3733033A1 (de) | 1989-04-13 |
| US4952608A (en) | 1990-08-28 |
| DE3868208D1 (de) | 1992-03-12 |
| EP0309861A2 (de) | 1989-04-05 |
| EP0309861B1 (de) | 1992-01-29 |
| EP0309861A3 (en) | 1989-08-09 |
| JPH01144412A (ja) | 1989-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3733033C2 (enExample) | ||
| DE69610322T2 (de) | Substituierte trifluorostyrol copolymere | |
| DE1420737C3 (de) | Verfahren zur Herstellung von vernetzten Mischpolymerisaten | |
| DE69500662T2 (de) | Verfahren zur Herstellung von Bisphenolen | |
| DE2418976C3 (de) | Verfahren zur Herstellung von wasserunlöslichen Kunstharzen mit Anionenaustauscher-Eigenschaften | |
| DE69507722T3 (de) | Vernetzte, geimpfte copolymerperlen und verfahren zu deren herstellung | |
| DE1919382B2 (de) | Verfahren zur Herstellung von Austauscherharzen | |
| DE69216445T2 (de) | Oxidationsbeständige Kationenaustauscherharze | |
| DE2519244C3 (de) | Verfahren zur Herstellung von Kunstharzen mit anionenaustauschenden Eigenschaften | |
| DE2223048A1 (de) | Hydrolytisch und thermisch bestaendige vinylaromatische Sulfonsaeureharze | |
| DE1542400A1 (de) | Katalysator fuer Vinylierungsreaktionen und Verfahren zu dessen Herstellung | |
| DE1570398B2 (enExample) | ||
| DD229992B5 (de) | Verfahren zur Herstellung von makropor¦sen sulfons{uregruppenhaltigen Polymeren | |
| DE2625328A1 (de) | Verfahren zur herstellung von amphoteren ionenaustauschern durch substitution hydrophiler polymerer | |
| DE2750542A1 (de) | Verfahren zur herstellung von polymeren, die freie oder in salzform befindliche aminische gruppen und quaternaere ammoniumgruppen enthalten sowie die dabei erhaltenen produkte | |
| DE908247C (de) | Verfahren zur Entfernung von Kationen aus fluessigen Medien | |
| DE2821392C3 (de) | Verfahren zur Gewinnung von Milchproteinen | |
| DE1233143B (de) | Verfahren zur Herstellung von sulfonierten Mischpolymerisaten | |
| WO1991010688A1 (de) | Wärmestabilisierter polyvinylalkohol und ein verfahren zu seiner herstellung | |
| DE1151120B (de) | Verfahren zur Herstellung von Ionenaustauscherharzen auf Polymerisatbasis | |
| DD243699A5 (de) | Verfahren zur herstellung von verbesserten vernetzten copolymerteilchen und von ionenaustauscherharzen daraus | |
| EP1172144A2 (de) | Sulfonierungsverfahren | |
| DE69405256T2 (de) | Verfahren zur Herstellung von Dicyclopentenyloxyethanol | |
| DE1595700C3 (de) | Verfahren zur Herstellung von Kationenaustauschern auf Basis vernetztet Acrylnitril-Polymerlsate | |
| DE1027875B (de) | Verfahren zur Herstellung von Ionenaustauschern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |