DE3601285C2 - - Google Patents
Info
- Publication number
- DE3601285C2 DE3601285C2 DE3601285A DE3601285A DE3601285C2 DE 3601285 C2 DE3601285 C2 DE 3601285C2 DE 3601285 A DE3601285 A DE 3601285A DE 3601285 A DE3601285 A DE 3601285A DE 3601285 C2 DE3601285 C2 DE 3601285C2
- Authority
- DE
- Germany
- Prior art keywords
- mmol
- reaction
- cyano
- added
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 15
- BMMCNKYHQAKJBN-UHFFFAOYSA-N 4-phenyl-1h-pyrrole-3-carbonitrile Chemical class N#CC1=CNC=C1C1=CC=CC=C1 BMMCNKYHQAKJBN-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- -1 methylenedioxy Chemical group 0.000 claims description 3
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 2
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 41
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 4
- CDUQMGQIHYISOP-RMKNXTFCSA-N (e)-2-cyano-3-phenylprop-2-enoic acid Chemical compound OC(=O)C(\C#N)=C\C1=CC=CC=C1 CDUQMGQIHYISOP-RMKNXTFCSA-N 0.000 description 3
- SADKTSLRGYYBOS-UHFFFAOYSA-N 1-chloro-4-(isocyanomethylsulfonyl)benzene Chemical compound ClC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 SADKTSLRGYYBOS-UHFFFAOYSA-N 0.000 description 3
- GEWCXMLSRUQIDQ-UHFFFAOYSA-N 4-(2-chlorophenyl)-1h-pyrrole-3-carbonitrile Chemical compound ClC1=CC=CC=C1C1=CNC=C1C#N GEWCXMLSRUQIDQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- KCDAMWRCUXGACP-DHZHZOJOSA-N ethyl (e)-2-cyano-3-phenylprop-2-enoate Chemical compound CCOC(=O)C(\C#N)=C\C1=CC=CC=C1 KCDAMWRCUXGACP-DHZHZOJOSA-N 0.000 description 3
- OHUDHPKMAJDBPI-UHFFFAOYSA-N isocyanomethylsulfonylbenzene Chemical compound [C-]#[N+]CS(=O)(=O)C1=CC=CC=C1 OHUDHPKMAJDBPI-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000005233 alkylalcohol group Chemical group 0.000 description 2
- 238000003898 horticulture Methods 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- WLKDAZQHOLJYQE-UHFFFAOYSA-N 2-cyano-3-(2,3-dichlorophenyl)prop-2-enoic acid Chemical compound OC(=O)C(C#N)=CC1=CC=CC(Cl)=C1Cl WLKDAZQHOLJYQE-UHFFFAOYSA-N 0.000 description 1
- DMACYVMZKYRYSL-UHFFFAOYSA-N 2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid Chemical compound COC1=CC=C(C=C(C#N)C(O)=O)C=C1OC DMACYVMZKYRYSL-UHFFFAOYSA-N 0.000 description 1
- YYLUJSBONROLKZ-UHFFFAOYSA-N 2-cyano-3-(4-cyanophenyl)prop-2-enoic acid Chemical compound OC(=O)C(C#N)=CC1=CC=C(C#N)C=C1 YYLUJSBONROLKZ-UHFFFAOYSA-N 0.000 description 1
- JWRQPIFEFRGLSE-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1h-pyrrole-3-carbonitrile Chemical compound C1=C(OC)C(OC)=CC=C1C1=CNC=C1C#N JWRQPIFEFRGLSE-UHFFFAOYSA-N 0.000 description 1
- CJDIWEZPIAEWNK-UHFFFAOYSA-N 4-(4-cyanophenyl)-1h-pyrrole-3-carbonitrile Chemical compound N#CC1=CNC=C1C1=CC=C(C#N)C=C1 CJDIWEZPIAEWNK-UHFFFAOYSA-N 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- FKLFBQCQQYDUAM-UHFFFAOYSA-N fenpiclonil Chemical compound ClC1=CC=CC(C=2C(=CNC=2)C#N)=C1Cl FKLFBQCQQYDUAM-UHFFFAOYSA-N 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012770 industrial material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/814,893 US4680413A (en) | 1986-01-17 | 1985-12-30 | Process for the production of 3-phenyl-4-cyanopyrroles |
| GB8600031A GB2185013B (en) | 1986-01-17 | 1986-01-02 | Process for the production of 3-phenyl-4-cyanopyrroles |
| CH39/86A CH666683A5 (de) | 1986-01-17 | 1986-01-09 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen. |
| FR8600659A FR2593175B1 (fr) | 1986-01-17 | 1986-01-17 | Procede de production de 3-phenyl-4-cyanopyrroles. |
| NL8600095A NL194042C (nl) | 1986-01-17 | 1986-01-17 | Werkwijze voor de bereiding van 3-fenyl-4-cyaanpyrrolen. |
| DE19863601285 DE3601285A1 (de) | 1986-01-17 | 1986-01-17 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863601285 DE3601285A1 (de) | 1986-01-17 | 1986-01-17 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3601285A1 DE3601285A1 (de) | 1987-07-23 |
| DE3601285C2 true DE3601285C2 (cg-RX-API-DMAC7.html) | 1988-07-21 |
Family
ID=6292064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863601285 Granted DE3601285A1 (de) | 1986-01-17 | 1986-01-17 | Verfahren zur herstellung von 3-phenyl-4-cyanopyrrolen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4680413A (cg-RX-API-DMAC7.html) |
| CH (1) | CH666683A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE3601285A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2593175B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2185013B (cg-RX-API-DMAC7.html) |
| NL (1) | NL194042C (cg-RX-API-DMAC7.html) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3576952D1 (de) * | 1984-09-12 | 1990-05-10 | Ciba Geigy Ag | Verfahren zur herstellung von 4-phenyl-pyrrol-derivaten. |
| US4687861A (en) * | 1984-11-28 | 1987-08-18 | Ciba-Geigy Corporation | Microbicidal compositions |
| DE3718375A1 (de) * | 1987-06-02 | 1988-12-15 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| EP0310558A3 (de) * | 1987-10-02 | 1990-07-04 | Ciba-Geigy Ag | Mikrobizide Mittel |
| DE3800387A1 (de) * | 1988-01-09 | 1989-07-20 | Bayer Ag | Verfahren zur herstellung von 3-cyano-4-aryl-pyrrolen |
| US5194628A (en) * | 1988-03-18 | 1993-03-16 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| ATE104974T1 (de) * | 1988-03-18 | 1994-05-15 | Ciba Geigy Ag | Verfahren zur herstellung eines pyrrol-derivats. |
| US5420301A (en) * | 1988-03-18 | 1995-05-30 | Ciba-Geigy Corporation | Process for the preparation of substituted difluorobenzo-1,3-dioxoles |
| US4958030A (en) * | 1988-12-12 | 1990-09-18 | Ciba-Geigy Corporation | Process for the preparation of 3-phenylpyrrole derivatives |
| US5234943A (en) * | 1989-04-13 | 1993-08-10 | Bayer Aktiengesellschaft | Fungicidal 3-(2-chloro-3-trifluoromethylphenyl)-4-cyanopyrrole |
| US5166395A (en) * | 1989-04-13 | 1992-11-24 | Bayer Aktiengesellschaft | Fungicidal 3-cyano-4-phenyl-pyrroles |
| DE3912156A1 (de) * | 1989-04-13 | 1990-10-25 | Bayer Ag | 3-cyano-4-phenyl-pyrrol-derivate |
| DE4128132A1 (de) * | 1991-08-24 | 1993-02-25 | Bayer Ag | 3-(2-chlor-3-trifluormethylphenyl)-4-cyanopyrrol, dessen herstellung und verwendung und neue zwischenprodukte |
| US5118816A (en) * | 1990-12-26 | 1992-06-02 | American Cyanamid Company | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles |
| DE4107398A1 (de) * | 1991-03-08 | 1992-11-05 | Bayer Ag | Verfahren zur herstellung von in 3-stellung substituierten 4-cyano-pyrrolverbindungen |
| DE19812058C1 (de) * | 1998-03-19 | 1999-10-07 | Wella Ag | Diaminobenzol-Derivate und diese Verbindungen enthaltende Haarfärbemittel |
| US20090214475A1 (en) * | 2005-04-01 | 2009-08-27 | Algaen Corporation | Extractability and Bioavailability of the Natural Antioxidant Astaxanthin From a Green Alga, Haematococcus Pluvialis |
| PE20070404A1 (es) * | 2005-07-29 | 2007-05-10 | Wyeth Corp | Compuestos derivados de cianopirrol-sulfonamida como moduladores del receptor de progesterona |
| PE20070182A1 (es) * | 2005-07-29 | 2007-03-06 | Wyeth Corp | Derivados cianopirrol-fenil amida como moduladores del receptor de progesterona |
| PE20070341A1 (es) * | 2005-07-29 | 2007-04-13 | Wyeth Corp | Derivados de pirrol como moduladores del receptor de progesterona |
| WO2019006359A1 (en) | 2017-06-30 | 2019-01-03 | The Regents Of The University Of California | COMPOSITIONS AND METHODS FOR MODULATION OF HAIR GROWTH |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1457752A (fr) * | 1965-03-22 | 1966-01-24 | Fujisawa Pharmaceutical Co | Dérivés de l'acide phényl-3-pyrrole carboxylique-2 et procédés pour leur préparation |
| JPS5225108A (en) * | 1975-08-15 | 1977-02-24 | Jiyunkichi Yamaji | Paper screening machine for concaveeconvex stencil paper |
| JPS5235727U (cg-RX-API-DMAC7.html) * | 1975-09-02 | 1977-03-14 | ||
| JPS5511524A (en) * | 1978-07-10 | 1980-01-26 | Nippon Soda Co Ltd | Cyanopyrrole derivative, its preparation and agricultural and horticultural fungicide |
-
1985
- 1985-12-30 US US06/814,893 patent/US4680413A/en not_active Expired - Lifetime
-
1986
- 1986-01-02 GB GB8600031A patent/GB2185013B/en not_active Expired
- 1986-01-09 CH CH39/86A patent/CH666683A5/de not_active IP Right Cessation
- 1986-01-17 NL NL8600095A patent/NL194042C/nl not_active IP Right Cessation
- 1986-01-17 DE DE19863601285 patent/DE3601285A1/de active Granted
- 1986-01-17 FR FR8600659A patent/FR2593175B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL194042B (nl) | 2001-01-02 |
| CH666683A5 (de) | 1988-08-15 |
| FR2593175B1 (fr) | 1988-05-13 |
| GB2185013B (en) | 1989-11-01 |
| FR2593175A1 (fr) | 1987-07-24 |
| NL8600095A (nl) | 1987-08-17 |
| NL194042C (nl) | 2001-05-03 |
| GB2185013A (en) | 1987-07-08 |
| US4680413A (en) | 1987-07-14 |
| GB8600031D0 (en) | 1986-02-12 |
| DE3601285A1 (de) | 1987-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3601285C2 (cg-RX-API-DMAC7.html) | ||
| EP0019726B1 (de) | N-Azidosulfonylaryl-maleinimide sowie deren Verwendung | |
| DE2428387A1 (de) | 1,3-oxazino(5,6-c)rifamycine sowie ihre verwendung und verfahren zur herstellung derselben | |
| DE2858737C2 (cg-RX-API-DMAC7.html) | ||
| EP0000023A1 (de) | Omega-substituierte Pentyl-harnstoff-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| AT394723B (de) | Verfahren zur herstellung von neuen substituierten 7-oxomitosanen | |
| DE2320040A1 (de) | Verfahren zur herstellung von 7acylamino-desacetoxy-cephalosporansaeureester | |
| DE2356239A1 (de) | Benzophenon-derivate und verfahren zu ihrer herstellung | |
| EP0062853B1 (de) | Verfahren zur Herstellung von substituierten 3-Hydroxy-1,2,4-triazolen | |
| DE2537379A1 (de) | Substituierte 2-phenylimino-1,3- dithiolane, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide mittel | |
| DE2045440A1 (en) | Halosulphenyl-ureas - intermediates for plant protection agents | |
| DE1134382B (de) | Verfahren zur Herstellung von Thiolphosphor-, -phosphon-, -phosphin- bzw. Thionothiolphosphor-, -phosphon-, -phosphinsaeureestern | |
| DE3600332A1 (de) | Verfahren zur herstellung von pyron-3-carboxamidverbindungen | |
| EP0276721A1 (de) | 2-Cyan-2-oximino-acetamide | |
| DE1956711C3 (de) | Verfahren zur Herstellung von 2-Acylimidazolen | |
| EP0279366B1 (de) | Verfahren zur Herstellung von Pyrimidinen | |
| DE2154371A1 (de) | Fungizid fuer den pflanzenschutz | |
| DE2747303A1 (de) | Beta-lactame, verfahren zu ihrer herstellung, zwischenprodukte bei diesen verfahren, und derivate dieser verbindungen | |
| DE19520816A1 (de) | Herbizide Pyrrolinone | |
| DE1909494C3 (de) | Verfahren zur Herstellung von Triorganobleiverbindu nge n | |
| EP0158248A2 (de) | Verfahren zur Herstellung von Biphenylylsulfonylharnstoff- Derivaten, Zwischenprodukte für diese sowie Verfahren für die Herstellung der Zwischenprodukte | |
| AT334360B (de) | Verfahren zur herstellung von neuen heterocyklischen verbindungen | |
| DE2529549C3 (de) | Verfahren zur Herstellung von Phenylisopropylharnstoffen | |
| DE2819462C2 (cg-RX-API-DMAC7.html) | ||
| DE1935308C (de) | 4 Alkyl mitomycin B Derivate und ein Verfahren zu ihrer Herstel lung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |