DE3587440T2 - Flüssige Bleichmittelzusammensetzungen. - Google Patents
Flüssige Bleichmittelzusammensetzungen.Info
- Publication number
- DE3587440T2 DE3587440T2 DE85202088T DE3587440T DE3587440T2 DE 3587440 T2 DE3587440 T2 DE 3587440T2 DE 85202088 T DE85202088 T DE 85202088T DE 3587440 T DE3587440 T DE 3587440T DE 3587440 T2 DE3587440 T2 DE 3587440T2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- composition according
- composition
- weight
- surfactant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Revoked
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 72
- 239000007788 liquid Substances 0.000 title claims description 6
- 238000004061 bleaching Methods 0.000 title abstract description 9
- 239000004094 surface-active agent Substances 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- -1 peroxy compound Chemical class 0.000 claims abstract description 20
- 230000008719 thickening Effects 0.000 claims abstract description 18
- 239000002253 acid Substances 0.000 claims abstract description 17
- 150000001412 amines Chemical class 0.000 claims abstract description 17
- 125000002091 cationic group Chemical group 0.000 claims abstract description 7
- 239000003599 detergent Substances 0.000 claims abstract description 3
- 239000003792 electrolyte Substances 0.000 claims abstract description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 25
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 21
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 20
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 claims description 20
- 239000007844 bleaching agent Substances 0.000 claims description 15
- 235000011149 sulphuric acid Nutrition 0.000 claims description 14
- 238000004140 cleaning Methods 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000013543 active substance Substances 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 239000001117 sulphuric acid Substances 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 3
- 229910017604 nitric acid Inorganic materials 0.000 claims description 3
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 claims description 2
- NUGJFLYPGQISPX-UHFFFAOYSA-N peroxydiphosphoric acid Chemical compound OP(O)(=O)OOP(O)(O)=O NUGJFLYPGQISPX-UHFFFAOYSA-N 0.000 claims description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-N peroxydisulfuric acid Chemical compound OS(=O)(=O)OOS(O)(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-N 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims 2
- 125000005210 alkyl ammonium group Chemical group 0.000 claims 1
- 150000003016 phosphoric acids Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 7
- 125000000217 alkyl group Chemical group 0.000 description 11
- 235000011007 phosphoric acid Nutrition 0.000 description 10
- 239000004816 latex Substances 0.000 description 9
- 229920000126 latex Polymers 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 8
- 239000002304 perfume Substances 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 5
- 235000019796 monopotassium phosphate Nutrition 0.000 description 5
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 5
- 239000007836 KH2PO4 Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 3
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 3
- RSVIRMFSJVHWJV-UHFFFAOYSA-N n,n-dimethyloctan-1-amine oxide Chemical compound CCCCCCCC[N+](C)(C)[O-] RSVIRMFSJVHWJV-UHFFFAOYSA-N 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- FHHJDRFHHWUPDG-UHFFFAOYSA-L peroxysulfate(2-) Chemical compound [O-]OS([O-])(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-L 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XXUJMEYKYHETBZ-UHFFFAOYSA-N ethyl 4-nitrophenyl ethylphosphonate Chemical compound CCOP(=O)(CC)OC1=CC=C([N+]([O-])=O)C=C1 XXUJMEYKYHETBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 2
- SFBHPFQSSDCYSL-UHFFFAOYSA-N n,n-dimethyltetradecan-1-amine Chemical compound CCCCCCCCCCCCCCN(C)C SFBHPFQSSDCYSL-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 2
- 125000001453 quaternary ammonium group Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- FBMQNRKSAWNXBT-UHFFFAOYSA-N 1,4-diaminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2N FBMQNRKSAWNXBT-UHFFFAOYSA-N 0.000 description 1
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 1
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000333569 Pyrola minor Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- ZVQSXJRBFRFWRO-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].[Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 ZVQSXJRBFRFWRO-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- UCRJJNVFJGKYQT-UHFFFAOYSA-M hexadecyl(trimethyl)azanium;hydron;sulfate Chemical compound OS([O-])(=O)=O.CCCCCCCCCCCCCCCC[N+](C)(C)C UCRJJNVFJGKYQT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000005528 methosulfate group Chemical group 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical group 0.000 description 1
- 150000004977 peroxyborates Chemical class 0.000 description 1
- 150000004978 peroxycarbonates Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009991 scouring Methods 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- PEKPGBKEIWFPAS-UHFFFAOYSA-J tetrapotassium;[oxido(oxidooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]OP([O-])(=O)OP([O-])([O-])=O PEKPGBKEIWFPAS-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/042—Acids
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3947—Liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB858500116A GB8500116D0 (en) | 1985-01-03 | 1985-01-03 | Liquid bleaching compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3587440D1 DE3587440D1 (de) | 1993-08-12 |
| DE3587440T2 true DE3587440T2 (de) | 1993-10-28 |
Family
ID=10572375
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE85202088T Revoked DE3587440T2 (de) | 1985-01-03 | 1985-12-17 | Flüssige Bleichmittelzusammensetzungen. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4666622A (enExample) |
| EP (1) | EP0188025B1 (enExample) |
| JP (1) | JPS61162598A (enExample) |
| AT (1) | ATE91301T1 (enExample) |
| AU (1) | AU568965B2 (enExample) |
| BR (1) | BR8506580A (enExample) |
| CA (1) | CA1266153A (enExample) |
| DE (1) | DE3587440T2 (enExample) |
| GB (1) | GB8500116D0 (enExample) |
| ZA (1) | ZA859871B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8508010D0 (en) * | 1985-03-27 | 1985-05-01 | Unilever Plc | Liquid bleaching compositions |
| JPS63502662A (ja) * | 1986-03-01 | 1988-10-06 | オ−チンクロス，ト−マス，ラルフ | 殺生剤、特に殺ウイルス組成物 |
| US4895669A (en) * | 1986-11-03 | 1990-01-23 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4804491A (en) * | 1986-11-03 | 1989-02-14 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| NO170944C (no) * | 1987-01-24 | 1992-12-30 | Akzo Nv | Fortykkede, vandige preparater, samt anvendelse av slike |
| CA1337783C (en) * | 1987-07-06 | 1995-12-26 | S.C. Johnson & Son, Inc. | Spray application of bleach compositions |
| DE3914827C2 (de) * | 1989-05-05 | 1995-06-14 | Schuelke & Mayr Gmbh | Flüssiges Desinfektionsmittelkonzentrat |
| US5106523A (en) * | 1989-06-16 | 1992-04-21 | The Clorox Company | Thickened acidic liquid composition with amine fwa useful as a bleaching agent vehicle |
| AU668900B2 (en) * | 1991-12-21 | 1996-05-23 | Jeyes Limited | Alkaline hydrogen peroxide composition |
| DE69224389T2 (de) * | 1992-11-16 | 1998-08-13 | The Procter & Gamble Co., Cincinnati, Ohio | Reinigungs- und Bleichmittelzusammensetzungen |
| GB9225333D0 (en) * | 1992-12-03 | 1993-01-27 | Jeyes Group Plc | Lavatory cleansing compositions |
| ES2123633T3 (es) * | 1992-12-04 | 1999-01-16 | Procter & Gamble | Composicion limpiadora de caracter acido autoespesada. |
| US5656580A (en) * | 1992-12-04 | 1997-08-12 | The Procter & Gamble Company | Acidic cleaning compositions self-thickened by a mixture of cationic and nonionic surfactants |
| CA2150914C (en) * | 1992-12-04 | 1999-07-13 | Michel Jean Carrie | Self-thickened acidic cleaning composition |
| EP0672748B1 (en) * | 1994-03-14 | 1999-09-01 | The Procter & Gamble Company | Stable strongly acidic aqueous compositions containing persulfate salts |
| US5879584A (en) * | 1994-09-10 | 1999-03-09 | The Procter & Gamble Company | Process for manufacturing aqueous compositions comprising peracids |
| JPH10509992A (ja) * | 1994-11-25 | 1998-09-29 | ザ、プロクター、エンド、ギャンブル、カンパニー | 濃厚な漂白組成物、使用法およびそれらの製造法 |
| GB9425882D0 (en) * | 1994-12-21 | 1995-02-22 | Solvay Interox Ltd | Thickened peracid compositions |
| GB2297976A (en) * | 1995-02-01 | 1996-08-21 | Reckitt & Colmann Prod Ltd | Improvements in or relating to a bleaching process |
| US5529663A (en) * | 1995-04-03 | 1996-06-25 | The United States Of America As Represented By The Secretary Of Agriculture | Delignification of lignocellulosic materials with peroxymonophosphoric acid |
| EP0742279A1 (en) * | 1995-05-10 | 1996-11-13 | The Procter & Gamble Company | Acidic aqueous liquid compositions |
| EP0745663A1 (en) | 1995-05-31 | 1996-12-04 | The Procter & Gamble Company | Colored acidic aqueous liquid compositions comprising a peroxy-bleach |
| US5910473A (en) * | 1995-05-31 | 1999-06-08 | The Procter & Gamble Company | Colored acidic aqueous liquid compositions comprising a peroxy-bleach |
| US6248705B1 (en) * | 1996-01-12 | 2001-06-19 | The Procter & Gamble Company | Stable perfumed bleaching compositions |
| EP0784091A1 (en) | 1996-01-12 | 1997-07-16 | The Procter & Gamble Company | Stable perfumed bleaching composition |
| US5972866A (en) * | 1997-02-05 | 1999-10-26 | Ecolab, Inc. | Thickened noncorrosive cleaner |
| US6010729A (en) | 1998-08-20 | 2000-01-04 | Ecolab Inc. | Treatment of animal carcasses |
| US5935921A (en) * | 1999-01-26 | 1999-08-10 | Colgate-Palmolive Co. | Liquid descaling composition |
| JP2004508291A (ja) * | 2000-04-28 | 2004-03-18 | イーコラブ インコーポレイティド | 抗菌組成物 |
| US7150884B1 (en) | 2000-07-12 | 2006-12-19 | Ecolab Inc. | Composition for inhibition of microbial growth |
| US6479454B1 (en) | 2000-10-05 | 2002-11-12 | Ecolab Inc. | Antimicrobial compositions and methods containing hydrogen peroxide and octyl amine oxide |
| US7316824B2 (en) * | 2000-12-15 | 2008-01-08 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6514556B2 (en) * | 2000-12-15 | 2003-02-04 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6635286B2 (en) * | 2001-06-29 | 2003-10-21 | Ecolab Inc. | Peroxy acid treatment to control pathogenic organisms on growing plants |
| GB0118156D0 (en) * | 2001-07-25 | 2001-09-19 | Pittards Plc | Leather production |
| DE10136208A1 (de) * | 2001-07-25 | 2003-02-13 | Henkel Kgaa | Saures wässriges Reinigungsmittel |
| US20040029757A1 (en) * | 2002-08-08 | 2004-02-12 | Ecolab Inc. | Hand dishwashing detergent composition and methods for manufacturing and using |
| US7622606B2 (en) | 2003-01-17 | 2009-11-24 | Ecolab Inc. | Peroxycarboxylic acid compositions with reduced odor |
| US20050161636A1 (en) * | 2004-01-09 | 2005-07-28 | Ecolab Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US7504123B2 (en) | 2004-01-09 | 2009-03-17 | Ecolab Inc. | Methods for washing poultry during processing with medium chain peroxycarboxylic acid compositions |
| US7887641B2 (en) * | 2004-01-09 | 2011-02-15 | Ecolab Usa Inc. | Neutral or alkaline medium chain peroxycarboxylic acid compositions and methods employing them |
| US8999175B2 (en) * | 2004-01-09 | 2015-04-07 | Ecolab Usa Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US7771737B2 (en) * | 2004-01-09 | 2010-08-10 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| EP1703791B1 (en) * | 2004-01-09 | 2014-07-23 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US7507429B2 (en) * | 2004-01-09 | 2009-03-24 | Ecolab Inc. | Methods for washing carcasses, meat, or meat products with medium chain peroxycarboxylic acid compositions |
| US20060135627A1 (en) * | 2004-08-17 | 2006-06-22 | Seren Frantz | Structured surfactant compositions |
| US7754670B2 (en) * | 2005-07-06 | 2010-07-13 | Ecolab Inc. | Surfactant peroxycarboxylic acid compositions |
| WO2008043638A1 (en) * | 2006-10-13 | 2008-04-17 | Unilever N.V. | Aqueous liquid bleach compositions |
| US7547421B2 (en) * | 2006-10-18 | 2009-06-16 | Ecolab Inc. | Apparatus and method for making a peroxycarboxylic acid |
| US8075857B2 (en) | 2006-10-18 | 2011-12-13 | Ecolab Usa Inc. | Apparatus and method for making a peroxycarboxylic acid |
| GB201103964D0 (en) * | 2011-03-09 | 2011-04-20 | Reckitt Benckiser Nv | Composition |
| WO2013110349A1 (en) * | 2012-01-27 | 2013-08-01 | Ecolab Inc. | Low temperature sulfoperoxycarboxylic acid containing cleaning composition |
| US9752105B2 (en) | 2012-09-13 | 2017-09-05 | Ecolab Usa Inc. | Two step method of cleaning, sanitizing, and rinsing a surface |
| US20140308162A1 (en) | 2013-04-15 | 2014-10-16 | Ecolab Usa Inc. | Peroxycarboxylic acid based sanitizing rinse additives for use in ware washing |
| JP7334174B2 (ja) | 2018-02-14 | 2023-08-28 | エコラボ ユーエスエー インコーポレイティド | 膜からバイオフィルムおよび胞子を低減するための組成物および方法 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1121594B (de) * | 1960-07-07 | 1962-01-11 | Henkel & Cie Gmbh | Verfahren zur Herstellung fluessiger, lagerbestaendiger, Aktivsauerstoff enthaltender Konzentrate |
| DE1467968A1 (de) * | 1964-02-11 | 1969-02-13 | Krug Geb Laschkowsky Ruth | Oxydationsmittel enthaltendes Mittel zum Reinigen von Zahnprothesen |
| BE755338A (fr) * | 1969-08-29 | 1971-02-26 | Unilever Nv | Compositions de blanchiment |
| US3852210A (en) * | 1972-08-11 | 1974-12-03 | Flow Pharma Inc | Stable liquid detergent concentrates containing active oxygen |
| US3956159A (en) * | 1974-11-25 | 1976-05-11 | The Procter & Gamble Company | Stable concentrated liquid peroxygen bleach composition |
| DE2612587A1 (de) * | 1975-03-27 | 1976-10-14 | Procter & Gamble | Bleichmittel |
| US3976318A (en) * | 1975-09-22 | 1976-08-24 | Krus Joseph W | Burglar-proof lock protector |
| DE2654164C2 (de) * | 1976-11-30 | 1978-08-10 | Schuelke & Mayr Gmbh, 2000 Norderstedt | Wäßrige Perglutarsäurelösung und deren Verwendung |
| US4166794A (en) * | 1978-05-25 | 1979-09-04 | Colgate-Palmolive Company | Liquid bleach-softener compositions |
| JPS557218A (en) * | 1978-06-29 | 1980-01-19 | Kao Corp | Stable quaternary ammonium salt composition |
| US4238192A (en) * | 1979-01-22 | 1980-12-09 | S. C. Johnson & Son, Inc. | Hydrogen peroxide bleach composition |
| AU529441B2 (en) * | 1979-01-25 | 1983-06-09 | Ven Brush Pty Ltd | Drive arrangement for floor servicing machine |
| GB2071688B (en) * | 1980-03-13 | 1984-02-08 | Jeyes Ltd | Liquid cleaning and descaling compositions |
| GB2073233B (en) * | 1980-04-03 | 1983-10-05 | Arrow Chem Ltd | Cleaning compositions |
| US4414127A (en) * | 1981-07-06 | 1983-11-08 | Syntex (U.S.A.) Inc. | Contact lens cleaning solutions |
| US4470919A (en) * | 1982-02-03 | 1984-09-11 | The Procter & Gamble Company | Oxygen-bleach-containing liquid detergent compositions |
| DE3205317A1 (de) * | 1982-02-15 | 1983-08-25 | Henkel KGaA, 4000 Düsseldorf | Mittel und verfahren zum nachbehandeln gewaschener waesche |
-
1985
- 1985-01-03 GB GB858500116A patent/GB8500116D0/en active Pending
- 1985-12-17 AT AT85202088T patent/ATE91301T1/de not_active IP Right Cessation
- 1985-12-17 DE DE85202088T patent/DE3587440T2/de not_active Revoked
- 1985-12-17 EP EP85202088A patent/EP0188025B1/en not_active Revoked
- 1985-12-19 CA CA000498174A patent/CA1266153A/en not_active Expired - Fee Related
- 1985-12-20 US US06/811,921 patent/US4666622A/en not_active Expired - Lifetime
- 1985-12-27 JP JP60299781A patent/JPS61162598A/ja active Granted
- 1985-12-30 ZA ZA859871A patent/ZA859871B/xx unknown
- 1985-12-30 BR BR8506580A patent/BR8506580A/pt not_active IP Right Cessation
- 1985-12-30 AU AU51764/85A patent/AU568965B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0437880B2 (enExample) | 1992-06-22 |
| ZA859871B (en) | 1987-08-26 |
| CA1266153A (en) | 1990-02-27 |
| AU568965B2 (en) | 1988-01-14 |
| JPS61162598A (ja) | 1986-07-23 |
| DE3587440D1 (de) | 1993-08-12 |
| EP0188025A3 (en) | 1990-01-17 |
| BR8506580A (pt) | 1986-09-09 |
| EP0188025B1 (en) | 1993-07-07 |
| US4666622A (en) | 1987-05-19 |
| ATE91301T1 (de) | 1993-07-15 |
| EP0188025A2 (en) | 1986-07-23 |
| GB8500116D0 (en) | 1985-02-13 |
| AU5176485A (en) | 1986-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0188025B1 (en) | Liquid bleaching compositions | |
| DE3689859T2 (de) | Flüssige Bleichmittelzusammensetzungen. | |
| DE3789533T3 (de) | Verdickte, wässerige Reinigungsmittel. | |
| DE69534500T2 (de) | Mit n-alkyl-n-acylaminosäuren und myristyl/cetyl-dimethylaminoxide verdickte reinigungszusammensetzungen | |
| DE3726912A1 (de) | Fluessige mittel zum reinigen harter oberflaechen | |
| DE69205730T2 (de) | Reinigungsmittelzusammensetzungen mit eigener Selbstverdickungsfähigkeit. | |
| DE2530539C3 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE2161821B2 (de) | Waschmittelbrei | |
| DE2448502A1 (de) | Wasch- und reinigungsmittelzusammensetzungen und verfahren zu ihrer herstellung | |
| DE2161699A1 (de) | Reinigungs- und Waschmittelmischung | |
| DE69332313T2 (de) | Verfahren zur herstellung von tensidhaltigen mischungen | |
| DE1172791B (de) | Waschmittel aus synthetischen Waschaktiv-substanzen | |
| EP0171494A1 (de) | Kombiniertes Reinigungs-/Bleich-Mittel für die Behandlung des Spülwassers von Toilettenautomaten und dessen Anwendung | |
| EP0051232B1 (de) | Handreinigungsmittel | |
| DE4413433A1 (de) | Wäßrige Bleichmittel | |
| EP1051471A2 (de) | Bleich- und desinfektionsmittel | |
| DE2144592B2 (de) | Waschmittel | |
| DE19626906C1 (de) | Mittel für die Reinigung harter Oberflächen | |
| DE4418847A1 (de) | Bleich- und Reinigungsmittel | |
| DE2438136C3 (de) | Reinigungsmittelmischung | |
| DE2359767A1 (de) | Fluessiges reinigungsmittel | |
| DE69314698T2 (de) | Verwendung eines Amids als Verdickungsmittel und dieses enthaltende Zusammensetzung | |
| EP1075506B1 (de) | Bleich- und desinfektionsmittel | |
| DE2447500A1 (de) | Aminpolyphosphate, deren gemische und waessrige loesungen sowie solche phosphate enthaltende reinigungsmittel | |
| DE2605341A1 (de) | Fluessiges reinigungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |