DE3587440T2 - Flüssige Bleichmittelzusammensetzungen. - Google Patents
Flüssige Bleichmittelzusammensetzungen.Info
- Publication number
- DE3587440T2 DE3587440T2 DE85202088T DE3587440T DE3587440T2 DE 3587440 T2 DE3587440 T2 DE 3587440T2 DE 85202088 T DE85202088 T DE 85202088T DE 3587440 T DE3587440 T DE 3587440T DE 3587440 T2 DE3587440 T2 DE 3587440T2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- composition according
- composition
- weight
- surfactant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Revoked
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 72
- 239000007788 liquid Substances 0.000 title claims description 6
- 238000004061 bleaching Methods 0.000 title abstract description 9
- 239000004094 surface-active agent Substances 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- -1 peroxy compound Chemical class 0.000 claims abstract description 20
- 230000008719 thickening Effects 0.000 claims abstract description 18
- 239000002253 acid Substances 0.000 claims abstract description 17
- 150000001412 amines Chemical class 0.000 claims abstract description 17
- 125000002091 cationic group Chemical group 0.000 claims abstract description 7
- 239000003599 detergent Substances 0.000 claims abstract description 3
- 239000003792 electrolyte Substances 0.000 claims abstract description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 25
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 21
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 20
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 claims description 20
- 239000007844 bleaching agent Substances 0.000 claims description 15
- 235000011149 sulphuric acid Nutrition 0.000 claims description 14
- 238000004140 cleaning Methods 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000013543 active substance Substances 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 239000001117 sulphuric acid Substances 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 3
- 229910017604 nitric acid Inorganic materials 0.000 claims description 3
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 claims description 2
- NUGJFLYPGQISPX-UHFFFAOYSA-N peroxydiphosphoric acid Chemical compound OP(O)(=O)OOP(O)(O)=O NUGJFLYPGQISPX-UHFFFAOYSA-N 0.000 claims description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-N peroxydisulfuric acid Chemical compound OS(=O)(=O)OOS(O)(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-N 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims 2
- 125000005210 alkyl ammonium group Chemical group 0.000 claims 1
- 150000003016 phosphoric acids Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 7
- 125000000217 alkyl group Chemical group 0.000 description 11
- 235000011007 phosphoric acid Nutrition 0.000 description 10
- 239000004816 latex Substances 0.000 description 9
- 229920000126 latex Polymers 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 8
- 239000002304 perfume Substances 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 5
- 235000019796 monopotassium phosphate Nutrition 0.000 description 5
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 5
- 239000007836 KH2PO4 Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 3
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 3
- RSVIRMFSJVHWJV-UHFFFAOYSA-N n,n-dimethyloctan-1-amine oxide Chemical compound CCCCCCCC[N+](C)(C)[O-] RSVIRMFSJVHWJV-UHFFFAOYSA-N 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- FHHJDRFHHWUPDG-UHFFFAOYSA-L peroxysulfate(2-) Chemical compound [O-]OS([O-])(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-L 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XXUJMEYKYHETBZ-UHFFFAOYSA-N ethyl 4-nitrophenyl ethylphosphonate Chemical compound CCOP(=O)(CC)OC1=CC=C([N+]([O-])=O)C=C1 XXUJMEYKYHETBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 2
- SFBHPFQSSDCYSL-UHFFFAOYSA-N n,n-dimethyltetradecan-1-amine Chemical compound CCCCCCCCCCCCCCN(C)C SFBHPFQSSDCYSL-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 2
- 125000001453 quaternary ammonium group Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- FBMQNRKSAWNXBT-UHFFFAOYSA-N 1,4-diaminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2N FBMQNRKSAWNXBT-UHFFFAOYSA-N 0.000 description 1
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 1
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000333569 Pyrola minor Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- ZVQSXJRBFRFWRO-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].[Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 ZVQSXJRBFRFWRO-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- UCRJJNVFJGKYQT-UHFFFAOYSA-M hexadecyl(trimethyl)azanium;hydron;sulfate Chemical compound OS([O-])(=O)=O.CCCCCCCCCCCCCCCC[N+](C)(C)C UCRJJNVFJGKYQT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000005528 methosulfate group Chemical group 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002927 oxygen compounds Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical group 0.000 description 1
- 150000004977 peroxyborates Chemical class 0.000 description 1
- 150000004978 peroxycarbonates Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000009991 scouring Methods 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- PEKPGBKEIWFPAS-UHFFFAOYSA-J tetrapotassium;[oxido(oxidooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]OP([O-])(=O)OP([O-])([O-])=O PEKPGBKEIWFPAS-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/042—Acids
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3947—Liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB858500116A GB8500116D0 (en) | 1985-01-03 | 1985-01-03 | Liquid bleaching compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3587440D1 DE3587440D1 (de) | 1993-08-12 |
| DE3587440T2 true DE3587440T2 (de) | 1993-10-28 |
Family
ID=10572375
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE85202088T Revoked DE3587440T2 (de) | 1985-01-03 | 1985-12-17 | Flüssige Bleichmittelzusammensetzungen. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4666622A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0188025B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS61162598A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE91301T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU568965B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR8506580A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1266153A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3587440T2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB8500116D0 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA859871B (cg-RX-API-DMAC7.html) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8508010D0 (en) * | 1985-03-27 | 1985-05-01 | Unilever Plc | Liquid bleaching compositions |
| EP0260293B1 (en) * | 1986-03-01 | 1990-08-22 | AUCHINCLOSS, Thomas Ralph | Biocidal, particularly virucidal, compositions |
| US4895669A (en) * | 1986-11-03 | 1990-01-23 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4804491A (en) * | 1986-11-03 | 1989-02-14 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| NO170944C (no) * | 1987-01-24 | 1992-12-30 | Akzo Nv | Fortykkede, vandige preparater, samt anvendelse av slike |
| CA1337783C (en) * | 1987-07-06 | 1995-12-26 | S.C. Johnson & Son, Inc. | Spray application of bleach compositions |
| DE3914827C2 (de) * | 1989-05-05 | 1995-06-14 | Schuelke & Mayr Gmbh | Flüssiges Desinfektionsmittelkonzentrat |
| US5106523A (en) * | 1989-06-16 | 1992-04-21 | The Clorox Company | Thickened acidic liquid composition with amine fwa useful as a bleaching agent vehicle |
| WO1993013012A1 (en) * | 1991-12-21 | 1993-07-08 | Solvay Interox Limited | Alkaline hydrogen peroxide formulation |
| ATE163037T1 (de) * | 1992-11-16 | 1998-02-15 | Procter & Gamble | Reinigungs- und bleichmittelzusammensetzungen |
| GB9225333D0 (en) * | 1992-12-03 | 1993-01-27 | Jeyes Group Plc | Lavatory cleansing compositions |
| EP0601990B1 (en) * | 1992-12-04 | 1998-10-14 | The Procter & Gamble Company | Self-thickened acidic cleaning composition |
| US5656580A (en) * | 1992-12-04 | 1997-08-12 | The Procter & Gamble Company | Acidic cleaning compositions self-thickened by a mixture of cationic and nonionic surfactants |
| WO1994013769A1 (en) * | 1992-12-04 | 1994-06-23 | The Procter & Gamble Company | Self-thickneded acidic cleaning composition |
| ES2134920T3 (es) * | 1994-03-14 | 1999-10-16 | Procter & Gamble | Composiciones acuosas de caracter fuertemente acido, estables, que contienen sales de persulfato. |
| US5879584A (en) * | 1994-09-10 | 1999-03-09 | The Procter & Gamble Company | Process for manufacturing aqueous compositions comprising peracids |
| ES2189834T3 (es) * | 1994-11-25 | 2003-07-16 | Procter & Gamble | Composiciones decolorantes espesadas, metodo de empleo y procedimiento para fabricarlas. |
| GB9425882D0 (en) * | 1994-12-21 | 1995-02-22 | Solvay Interox Ltd | Thickened peracid compositions |
| GB2297976A (en) * | 1995-02-01 | 1996-08-21 | Reckitt & Colmann Prod Ltd | Improvements in or relating to a bleaching process |
| US5529663A (en) * | 1995-04-03 | 1996-06-25 | The United States Of America As Represented By The Secretary Of Agriculture | Delignification of lignocellulosic materials with peroxymonophosphoric acid |
| EP0742279A1 (en) * | 1995-05-10 | 1996-11-13 | The Procter & Gamble Company | Acidic aqueous liquid compositions |
| EP0745663A1 (en) | 1995-05-31 | 1996-12-04 | The Procter & Gamble Company | Colored acidic aqueous liquid compositions comprising a peroxy-bleach |
| US5910473A (en) * | 1995-05-31 | 1999-06-08 | The Procter & Gamble Company | Colored acidic aqueous liquid compositions comprising a peroxy-bleach |
| US6248705B1 (en) * | 1996-01-12 | 2001-06-19 | The Procter & Gamble Company | Stable perfumed bleaching compositions |
| EP0784091A1 (en) | 1996-01-12 | 1997-07-16 | The Procter & Gamble Company | Stable perfumed bleaching composition |
| US5972866A (en) * | 1997-02-05 | 1999-10-26 | Ecolab, Inc. | Thickened noncorrosive cleaner |
| US6010729A (en) | 1998-08-20 | 2000-01-04 | Ecolab Inc. | Treatment of animal carcasses |
| US5935921A (en) * | 1999-01-26 | 1999-08-10 | Colgate-Palmolive Co. | Liquid descaling composition |
| EP1276372B1 (en) * | 2000-04-28 | 2005-10-19 | Ecolab Inc. | Antimicrobial composition |
| US7150884B1 (en) | 2000-07-12 | 2006-12-19 | Ecolab Inc. | Composition for inhibition of microbial growth |
| US6479454B1 (en) | 2000-10-05 | 2002-11-12 | Ecolab Inc. | Antimicrobial compositions and methods containing hydrogen peroxide and octyl amine oxide |
| US7316824B2 (en) * | 2000-12-15 | 2008-01-08 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6514556B2 (en) | 2000-12-15 | 2003-02-04 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6635286B2 (en) * | 2001-06-29 | 2003-10-21 | Ecolab Inc. | Peroxy acid treatment to control pathogenic organisms on growing plants |
| DE10136208A1 (de) * | 2001-07-25 | 2003-02-13 | Henkel Kgaa | Saures wässriges Reinigungsmittel |
| GB0118156D0 (en) * | 2001-07-25 | 2001-09-19 | Pittards Plc | Leather production |
| US20040029757A1 (en) * | 2002-08-08 | 2004-02-12 | Ecolab Inc. | Hand dishwashing detergent composition and methods for manufacturing and using |
| US7622606B2 (en) | 2003-01-17 | 2009-11-24 | Ecolab Inc. | Peroxycarboxylic acid compositions with reduced odor |
| US8999175B2 (en) * | 2004-01-09 | 2015-04-07 | Ecolab Usa Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US7771737B2 (en) | 2004-01-09 | 2010-08-10 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US7507429B2 (en) * | 2004-01-09 | 2009-03-24 | Ecolab Inc. | Methods for washing carcasses, meat, or meat products with medium chain peroxycarboxylic acid compositions |
| US7504123B2 (en) | 2004-01-09 | 2009-03-17 | Ecolab Inc. | Methods for washing poultry during processing with medium chain peroxycarboxylic acid compositions |
| US7887641B2 (en) * | 2004-01-09 | 2011-02-15 | Ecolab Usa Inc. | Neutral or alkaline medium chain peroxycarboxylic acid compositions and methods employing them |
| WO2005070205A1 (en) * | 2004-01-09 | 2005-08-04 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US20050161636A1 (en) * | 2004-01-09 | 2005-07-28 | Ecolab Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US20060135627A1 (en) * | 2004-08-17 | 2006-06-22 | Seren Frantz | Structured surfactant compositions |
| US7754670B2 (en) | 2005-07-06 | 2010-07-13 | Ecolab Inc. | Surfactant peroxycarboxylic acid compositions |
| WO2008043638A1 (en) * | 2006-10-13 | 2008-04-17 | Unilever N.V. | Aqueous liquid bleach compositions |
| US7547421B2 (en) | 2006-10-18 | 2009-06-16 | Ecolab Inc. | Apparatus and method for making a peroxycarboxylic acid |
| US8075857B2 (en) | 2006-10-18 | 2011-12-13 | Ecolab Usa Inc. | Apparatus and method for making a peroxycarboxylic acid |
| GB201103964D0 (en) * | 2011-03-09 | 2011-04-20 | Reckitt Benckiser Nv | Composition |
| US20150010646A1 (en) * | 2012-01-27 | 2015-01-08 | Ecolab Usa Inc. | Low temperature sulfoperoxycarboxylic acid containing cleaning composition |
| US20140308162A1 (en) | 2013-04-15 | 2014-10-16 | Ecolab Usa Inc. | Peroxycarboxylic acid based sanitizing rinse additives for use in ware washing |
| US9752105B2 (en) | 2012-09-13 | 2017-09-05 | Ecolab Usa Inc. | Two step method of cleaning, sanitizing, and rinsing a surface |
| AU2019222696B2 (en) | 2018-02-14 | 2024-02-29 | Ecolab Usa Inc. | Compositions and methods for the reduction of biofilm and spores from membranes |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1121594B (de) * | 1960-07-07 | 1962-01-11 | Henkel & Cie Gmbh | Verfahren zur Herstellung fluessiger, lagerbestaendiger, Aktivsauerstoff enthaltender Konzentrate |
| DE1467968A1 (de) * | 1964-02-11 | 1969-02-13 | Krug Geb Laschkowsky Ruth | Oxydationsmittel enthaltendes Mittel zum Reinigen von Zahnprothesen |
| BE755338A (fr) * | 1969-08-29 | 1971-02-26 | Unilever Nv | Compositions de blanchiment |
| US3852210A (en) * | 1972-08-11 | 1974-12-03 | Flow Pharma Inc | Stable liquid detergent concentrates containing active oxygen |
| US3956159A (en) * | 1974-11-25 | 1976-05-11 | The Procter & Gamble Company | Stable concentrated liquid peroxygen bleach composition |
| DE2612587A1 (de) * | 1975-03-27 | 1976-10-14 | Procter & Gamble | Bleichmittel |
| US3976318A (en) * | 1975-09-22 | 1976-08-24 | Krus Joseph W | Burglar-proof lock protector |
| DE2654164C2 (de) * | 1976-11-30 | 1978-08-10 | Schuelke & Mayr Gmbh, 2000 Norderstedt | Wäßrige Perglutarsäurelösung und deren Verwendung |
| US4166794A (en) * | 1978-05-25 | 1979-09-04 | Colgate-Palmolive Company | Liquid bleach-softener compositions |
| JPS557218A (en) * | 1978-06-29 | 1980-01-19 | Kao Corp | Stable quaternary ammonium salt composition |
| US4238192A (en) * | 1979-01-22 | 1980-12-09 | S. C. Johnson & Son, Inc. | Hydrogen peroxide bleach composition |
| AU529441B2 (en) * | 1979-01-25 | 1983-06-09 | Ven Brush Pty Ltd | Drive arrangement for floor servicing machine |
| GB2071688B (en) * | 1980-03-13 | 1984-02-08 | Jeyes Ltd | Liquid cleaning and descaling compositions |
| GB2073233B (en) * | 1980-04-03 | 1983-10-05 | Arrow Chem Ltd | Cleaning compositions |
| US4414127A (en) * | 1981-07-06 | 1983-11-08 | Syntex (U.S.A.) Inc. | Contact lens cleaning solutions |
| DE3364292D1 (en) * | 1982-02-03 | 1986-08-07 | Procter & Gamble | Oxygen-bleach-containing liquid detergent compositions |
| DE3205317A1 (de) * | 1982-02-15 | 1983-08-25 | Henkel KGaA, 4000 Düsseldorf | Mittel und verfahren zum nachbehandeln gewaschener waesche |
-
1985
- 1985-01-03 GB GB858500116A patent/GB8500116D0/en active Pending
- 1985-12-17 DE DE85202088T patent/DE3587440T2/de not_active Revoked
- 1985-12-17 EP EP85202088A patent/EP0188025B1/en not_active Revoked
- 1985-12-17 AT AT85202088T patent/ATE91301T1/de not_active IP Right Cessation
- 1985-12-19 CA CA000498174A patent/CA1266153A/en not_active Expired - Fee Related
- 1985-12-20 US US06/811,921 patent/US4666622A/en not_active Expired - Lifetime
- 1985-12-27 JP JP60299781A patent/JPS61162598A/ja active Granted
- 1985-12-30 BR BR8506580A patent/BR8506580A/pt not_active IP Right Cessation
- 1985-12-30 AU AU51764/85A patent/AU568965B2/en not_active Ceased
- 1985-12-30 ZA ZA859871A patent/ZA859871B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0188025B1 (en) | 1993-07-07 |
| ATE91301T1 (de) | 1993-07-15 |
| JPH0437880B2 (cg-RX-API-DMAC7.html) | 1992-06-22 |
| GB8500116D0 (en) | 1985-02-13 |
| EP0188025A3 (en) | 1990-01-17 |
| CA1266153A (en) | 1990-02-27 |
| AU5176485A (en) | 1986-07-10 |
| EP0188025A2 (en) | 1986-07-23 |
| BR8506580A (pt) | 1986-09-09 |
| JPS61162598A (ja) | 1986-07-23 |
| DE3587440D1 (de) | 1993-08-12 |
| ZA859871B (en) | 1987-08-26 |
| US4666622A (en) | 1987-05-19 |
| AU568965B2 (en) | 1988-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3587440T2 (de) | Flüssige Bleichmittelzusammensetzungen. | |
| DE3689859T2 (de) | Flüssige Bleichmittelzusammensetzungen. | |
| DE3789533T3 (de) | Verdickte, wässerige Reinigungsmittel. | |
| DE3726912A1 (de) | Fluessige mittel zum reinigen harter oberflaechen | |
| DE69205730T2 (de) | Reinigungsmittelzusammensetzungen mit eigener Selbstverdickungsfähigkeit. | |
| DE2530539C3 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE2161821B2 (de) | Waschmittelbrei | |
| DE69528642T2 (de) | Saure Reinigungszusammensetzungen | |
| DE4333100C1 (de) | Bleich- und Desinfektionsmittel | |
| DE2448502A1 (de) | Wasch- und reinigungsmittelzusammensetzungen und verfahren zu ihrer herstellung | |
| DE69332313T2 (de) | Verfahren zur herstellung von tensidhaltigen mischungen | |
| DE1172791B (de) | Waschmittel aus synthetischen Waschaktiv-substanzen | |
| EP0171494A1 (de) | Kombiniertes Reinigungs-/Bleich-Mittel für die Behandlung des Spülwassers von Toilettenautomaten und dessen Anwendung | |
| EP0051232B1 (de) | Handreinigungsmittel | |
| DE4413433A1 (de) | Wäßrige Bleichmittel | |
| EP1051471A2 (de) | Bleich- und desinfektionsmittel | |
| DE2144592B2 (de) | Waschmittel | |
| DE19626906C1 (de) | Mittel für die Reinigung harter Oberflächen | |
| DE4418847A1 (de) | Bleich- und Reinigungsmittel | |
| DE2438136C3 (de) | Reinigungsmittelmischung | |
| DE2359767A1 (de) | Fluessiges reinigungsmittel | |
| DE69314698T2 (de) | Verwendung eines Amids als Verdickungsmittel und dieses enthaltende Zusammensetzung | |
| DE2447500A1 (de) | Aminpolyphosphate, deren gemische und waessrige loesungen sowie solche phosphate enthaltende reinigungsmittel | |
| DE2605341A1 (de) | Fluessiges reinigungsmittel | |
| DE19621048C2 (de) | Wäßrige Bleich- und Desinfektionsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |