DE3445552A1 - Verbessertes verfahren zur herstellung von aromatischen carbonaten - Google Patents
Verbessertes verfahren zur herstellung von aromatischen carbonatenInfo
- Publication number
- DE3445552A1 DE3445552A1 DE19843445552 DE3445552A DE3445552A1 DE 3445552 A1 DE3445552 A1 DE 3445552A1 DE 19843445552 DE19843445552 DE 19843445552 DE 3445552 A DE3445552 A DE 3445552A DE 3445552 A1 DE3445552 A1 DE 3445552A1
- Authority
- DE
- Germany
- Prior art keywords
- radicals
- carbonates
- carbonate
- aromatic
- aliphatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 title claims description 25
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- -1 hydrocarbon radicals Chemical class 0.000 claims description 82
- 238000000034 method Methods 0.000 claims description 39
- 239000003054 catalyst Substances 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 36
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 31
- 230000003197 catalytic effect Effects 0.000 claims description 12
- 239000000376 reactant Substances 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 150000005840 aryl radicals Chemical class 0.000 claims description 8
- 229930195733 hydrocarbon Natural products 0.000 claims description 8
- 150000002989 phenols Chemical class 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 3
- 229910020923 Sn-O Inorganic materials 0.000 claims 1
- 150000003606 tin compounds Chemical class 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 238000005809 transesterification reaction Methods 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 7
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 239000011968 lewis acid catalyst Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ZBBLRPRYYSJUCZ-GRHBHMESSA-L (z)-but-2-enedioate;dibutyltin(2+) Chemical compound [O-]C(=O)\C=C/C([O-])=O.CCCC[Sn+2]CCCC ZBBLRPRYYSJUCZ-GRHBHMESSA-L 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 3
- YCNSGSUGQPDYTK-UHFFFAOYSA-N ethyl phenyl carbonate Chemical compound CCOC(=O)OC1=CC=CC=C1 YCNSGSUGQPDYTK-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- QRZPLIREDJPIHE-UHFFFAOYSA-N (2-chlorophenyl) ethyl carbonate Chemical compound CCOC(=O)OC1=CC=CC=C1Cl QRZPLIREDJPIHE-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- MUCRFDZUHPMASM-UHFFFAOYSA-N bis(2-chlorophenyl) carbonate Chemical compound ClC1=CC=CC=C1OC(=O)OC1=CC=CC=C1Cl MUCRFDZUHPMASM-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 2
- 150000005677 organic carbonates Chemical class 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KPJSPBQYZLWYAM-UHFFFAOYSA-N (2,6-dimethylphenyl) ethyl carbonate Chemical compound CCOC(=O)OC1=C(C)C=CC=C1C KPJSPBQYZLWYAM-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RGCPMRIOBZXXBR-UHFFFAOYSA-N butan-1-olate;dibutyltin(2+) Chemical compound CCCCO[Sn](CCCC)(CCCC)OCCCC RGCPMRIOBZXXBR-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C68/00—Preparation of esters of carbonic or haloformic acids
- C07C68/06—Preparation of esters of carbonic or haloformic acids from organic carbonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/96—Esters of carbonic or haloformic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/565,888 US4554110A (en) | 1983-12-27 | 1983-12-27 | Process for the preparation of aromatic carbonates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3445552A1 true DE3445552A1 (de) | 1985-07-04 |
Family
ID=24260535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843445552 Withdrawn DE3445552A1 (de) | 1983-12-27 | 1984-12-14 | Verbessertes verfahren zur herstellung von aromatischen carbonaten |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4554110A (enExample) |
| JP (1) | JPS60169444A (enExample) |
| DE (1) | DE3445552A1 (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0444293A1 (de) * | 1990-03-02 | 1991-09-04 | Bayer Ag | Verfahren zur Herstellung von mindestens eine aromatische Estergruppe enthaltenden Kohlensäurediestern |
| US5344954A (en) * | 1992-08-13 | 1994-09-06 | Bayer Aktiengesellschaft | Process for the preparation of diaryl carbonates |
| EP0785184A1 (en) | 1996-01-16 | 1997-07-23 | ENICHEM S.p.A. | Continuous process for the preparation of phenyl methyl carbonate |
| EP1995233A2 (de) | 2007-05-25 | 2008-11-26 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Arylalkylcarbonaten aus Dialkylcarbonaten |
| EP2036880A2 (de) | 2007-09-14 | 2009-03-18 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| EP2062868A2 (de) | 2007-11-20 | 2009-05-27 | Bayer MaterialScience AG | Verfahren zur Reinigung von Diarylcarbonaten |
| DE102008029514A1 (de) | 2008-06-21 | 2009-12-24 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| EP2239249A1 (de) | 2009-04-08 | 2010-10-13 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| EP2322261A2 (de) | 2009-11-14 | 2011-05-18 | Bayer MaterialScience AG | Verfahren zur Reinigung von Dialkylcarbonaten |
| DE102010042937A1 (de) | 2010-10-08 | 2012-04-12 | Bayer Materialscience Aktiengesellschaft | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| EP2650278A1 (de) | 2012-04-11 | 2013-10-16 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| WO2014095776A1 (de) | 2012-12-18 | 2014-06-26 | Bayer Materialscience Ag | Verfahren zur herstellung von diarylcarbonat |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5166393A (en) * | 1987-10-05 | 1992-11-24 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing diaryl carbonate |
| US5034557A (en) * | 1988-04-16 | 1991-07-23 | Mitsui Petrochemical Industries, Ltd. | Process for production of aromatic carbonate compound |
| JP2569351B2 (ja) * | 1988-04-16 | 1997-01-08 | 三井石油化学工業株式会社 | 芳香族カーボネート化合物を製造する方法 |
| JP2540590B2 (ja) * | 1988-04-16 | 1996-10-02 | 三井石油化学工業株式会社 | 芳香族カ―ボネ―ト化合物を製造する方法 |
| US5221761A (en) * | 1992-04-29 | 1993-06-22 | Instituto Guido Donegani | Melt transesterification process for the production of polycarbonates |
| CA2207146A1 (en) * | 1996-05-28 | 1997-11-28 | Atofina Chemicals, Inc. | Catalyst for low temperature cure of blocked isocyanates |
| US5770672A (en) * | 1997-04-03 | 1998-06-23 | Elf Atochem North America, Inc. | Catalyst for low temperature cure of blocked isocyanates |
| US6093842A (en) * | 1998-09-25 | 2000-07-25 | General Electric Company | Process for continuous production of carbonate esters |
| US6600061B1 (en) | 2000-11-15 | 2003-07-29 | General Electric Company | Method for the continuous production of aromatic carbonates |
| AU2003206228A1 (en) * | 2002-02-05 | 2003-09-02 | Lg Chem, Ltd. | Continuous method for preparing aromatic carbonate using a heterogeneous catalyst and a reaction apparatus for the same |
| EP1760085B1 (en) * | 2004-05-19 | 2014-02-26 | Asahi Kasei Chemicals Corporation | Process for production of alkyltin alkoxides |
| CA2559821A1 (en) | 2004-06-14 | 2005-12-22 | Asahi Kasei Chemicals Corporation | Method for producing an aromatic polycarbonate |
| US7919644B2 (en) | 2004-06-17 | 2011-04-05 | Asahi Kasei Chemicals Corporation | Process for producing an aromatic carbonate |
| CN100594208C (zh) * | 2004-06-25 | 2010-03-17 | 旭化成化学株式会社 | 芳香族碳酸酯的工业制备方法 |
| EP1762559A4 (en) * | 2004-06-25 | 2008-05-07 | Asahi Kasei Chemicals Corp | PROCESS FOR PRODUCING AROMATIC CARBONATE AT THE INDUSTRIAL SCALE |
| KR100846332B1 (ko) * | 2004-07-13 | 2008-07-15 | 아사히 가세이 케미칼즈 가부시키가이샤 | 방향족 카보네이트류의 공업적 제조법 |
| BRPI0513330A (pt) * | 2004-07-14 | 2008-05-06 | Asahi Kasei Chemicals Corp | processo para a produção de um carbonato aromático, e, carbonato aromático |
| JP4292210B2 (ja) * | 2004-08-25 | 2009-07-08 | 旭化成ケミカルズ株式会社 | 高純度ジフェニルカーボネートの工業的製造方法 |
| BRPI0514732A (pt) * | 2004-09-02 | 2008-06-24 | Asahi Kasei Chemicals Corp | aperfeiçoamento em um processo industrial para a produção de um carbonato de difenila de pureza elevada, carbonato de difenila de pureza elevada, e, processo para a produção do mesmo |
| EP1787976A4 (en) * | 2004-09-03 | 2008-08-13 | Asahi Kasei Chemicals Corp | METHOD FOR THE PRODUCTION OF HIGH-PURITY DIARYLCARBONATE IN INDUSTRIAL STANDARD |
| US7884251B2 (en) * | 2004-09-17 | 2011-02-08 | Asahi Kasei Chemicals Corporation | Industrial process for separating out by-produced alcohols |
| BRPI0514906A (pt) * | 2004-09-21 | 2008-06-24 | Asahi Kasei Chemicals Corp | processo industrial para a separação de um álcool subproduzido em um caso de produção em massa contìnua de um carbonato aromático em uma escala industrial |
| US20080223711A1 (en) * | 2004-09-27 | 2008-09-18 | Asahi Kasei Chemicals Corporation | Industrial Process for Production of Aromatic Carbonate |
| EP1801095B1 (en) | 2004-10-14 | 2012-07-18 | Asahi Kasei Chemicals Corporation | Process for production of high-purity diaryl carbonate |
| TWI321561B (en) * | 2004-12-21 | 2010-03-11 | Asahi Kasei Chemicals Corp | Method for producing aromatic carbonate |
| RU2372322C2 (ru) * | 2004-12-24 | 2009-11-10 | Асахи Касеи Кемикалз Корпорейшн | Способ получения ароматического карбоната |
| US7378540B2 (en) * | 2005-10-21 | 2008-05-27 | Catalytic Distillation Technologies | Process for producing organic carbonates |
| TWI404701B (zh) * | 2007-01-23 | 2013-08-11 | Shell Int Research | 製備碳酸二芳酯之方法 |
| US8110698B2 (en) | 2008-02-11 | 2012-02-07 | Shell Oil Company | Process for producing diphenyl carbonate |
| US7851645B2 (en) * | 2008-02-11 | 2010-12-14 | Catalytic Distillation Technologies | Process for continuous production of organic carbonates or organic carbamates and solid catalysts therefore |
| DE102009030680A1 (de) * | 2009-06-26 | 2010-12-30 | Bayer Materialscience Ag | Verfahren zur Herstellung von Dialkylcarbonaten aus Alkylencarbonaten und Alkoholen |
| EP2711353B1 (en) | 2012-09-20 | 2018-10-31 | SABIC Global Technologies B.V. | Process for the continuous manufacture of aryl alkyl carbonate and diaryl carbonate using vapor recompression |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4182726A (en) * | 1974-06-25 | 1980-01-08 | Snamprogetti, S.P.A. | Process for the preparation of aromatic carbonates |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3376329A (en) * | 1965-03-31 | 1968-04-02 | Ethyl Corp | Preparation of dialkyltin oxides |
| US3466311A (en) * | 1966-07-18 | 1969-09-09 | Nitto Kasei Co Ltd | Preparation of dialkyltin oxides |
| US3493592A (en) * | 1968-01-15 | 1970-02-03 | Ethyl Corp | Preparation of dialkyltins and dialkyltin oxides |
| US3853960A (en) * | 1970-07-13 | 1974-12-10 | Proctor Chem Co Inc | Process for the manufacture of penthaerythritol tetracarbamate |
-
1983
- 1983-12-27 US US06/565,888 patent/US4554110A/en not_active Expired - Fee Related
-
1984
- 1984-12-14 DE DE19843445552 patent/DE3445552A1/de not_active Withdrawn
- 1984-12-19 JP JP59266545A patent/JPS60169444A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4182726A (en) * | 1974-06-25 | 1980-01-08 | Snamprogetti, S.P.A. | Process for the preparation of aromatic carbonates |
Cited By (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5149856A (en) * | 1990-03-02 | 1992-09-22 | Bayer Aktiengesellschaft | Process for the preparation of carbonic acid diesters containing at least one aromatic ester group |
| EP0444293A1 (de) * | 1990-03-02 | 1991-09-04 | Bayer Ag | Verfahren zur Herstellung von mindestens eine aromatische Estergruppe enthaltenden Kohlensäurediestern |
| US5344954A (en) * | 1992-08-13 | 1994-09-06 | Bayer Aktiengesellschaft | Process for the preparation of diaryl carbonates |
| EP0785184A1 (en) | 1996-01-16 | 1997-07-23 | ENICHEM S.p.A. | Continuous process for the preparation of phenyl methyl carbonate |
| US8003817B2 (en) | 2007-05-25 | 2011-08-23 | Bayer Materialscience Ag | Process for the preparation of diaryl carbonates or arylalkyl carbonates from dialkyl carbonates |
| EP1995233A2 (de) | 2007-05-25 | 2008-11-26 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Arylalkylcarbonaten aus Dialkylcarbonaten |
| EP2036880A2 (de) | 2007-09-14 | 2009-03-18 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| DE102007044033A1 (de) | 2007-09-14 | 2009-03-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| EP2062868A2 (de) | 2007-11-20 | 2009-05-27 | Bayer MaterialScience AG | Verfahren zur Reinigung von Diarylcarbonaten |
| DE102007055266A1 (de) | 2007-11-20 | 2009-05-28 | Bayer Materialscience Ag | Verfahren zur Reinigung von Diarylcarbonaten |
| DE102008029514A1 (de) | 2008-06-21 | 2009-12-24 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| US9040732B2 (en) | 2008-06-21 | 2015-05-26 | Bayer Materialscience Ag | Process for preparing diaryl carbonates from dialkyl carbonates |
| EP2239249A1 (de) | 2009-04-08 | 2010-10-13 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| US8952189B2 (en) | 2009-04-08 | 2015-02-10 | Bayer Materialscience Ag | Process for preparing diaryl carbonates or alkyl aryl carbonates from dialkyl carbonates |
| DE102009016853A1 (de) | 2009-04-08 | 2010-10-14 | Bayer Materialscience Ag | Verfahren zur Herstellung von Diaryl- oder Alkylarylcarbonaten aus Dialkylcarbonaten |
| DE102009053370A1 (de) | 2009-11-14 | 2011-05-19 | Bayer Materialscience Ag | Verfahren zur Reinigung von Dialkylcarbonaten |
| EP2322261A2 (de) | 2009-11-14 | 2011-05-18 | Bayer MaterialScience AG | Verfahren zur Reinigung von Dialkylcarbonaten |
| DE102010042937A1 (de) | 2010-10-08 | 2012-04-12 | Bayer Materialscience Aktiengesellschaft | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| EP2457891A1 (de) | 2010-10-08 | 2012-05-30 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| US8304509B2 (en) | 2010-10-08 | 2012-11-06 | Bayer Intellectual Property Gmbh | Process for preparing diaryl carbonates from dialkyl carbonates |
| EP2650278A1 (de) | 2012-04-11 | 2013-10-16 | Bayer MaterialScience AG | Verfahren zur Herstellung von Diarylcarbonaten aus Dialkylcarbonaten |
| WO2014095776A1 (de) | 2012-12-18 | 2014-06-26 | Bayer Materialscience Ag | Verfahren zur herstellung von diarylcarbonat |
| US9765012B2 (en) | 2012-12-18 | 2017-09-19 | Covestro Deutschland Ag | Method for producing diaryl carbonate |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6261582B2 (enExample) | 1987-12-22 |
| JPS60169444A (ja) | 1985-09-02 |
| US4554110A (en) | 1985-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3445552A1 (de) | Verbessertes verfahren zur herstellung von aromatischen carbonaten | |
| DE3445555A1 (de) | Verbessertes verfahren zur herstellung von aromatischen carbonaten | |
| DE3445553A1 (de) | Verbessertes verfahren zur herstellung von aromatischen carbonaten | |
| EP0001083B1 (de) | Verfahren zur Herstellung von Dialkylcarbonaten | |
| DE2552907A1 (de) | Verfahren zur herstellung von aromatischen carbonaten | |
| DE68920355T2 (de) | Herstellungsverfahren von aromatischen Karbonatverbindungen. | |
| DE2528412B2 (de) | Verfahren zur Herstellung von aromatischen Carbonaten | |
| DE69409595T2 (de) | Verfahren zur Herstellung von Dialkylcarbonat | |
| DE2736062A1 (de) | Verfahren zur herstellung aromatischer kohlensaeureester | |
| DE68904217T2 (de) | Verfahren zur herstellung von esterverbindungen. | |
| EP0572870A1 (de) | Verfahren zur Herstellung von organischen Carbonaten mit mindestens einer aromatischen Estergruppe | |
| DE69320580T2 (de) | Kontinuierliche Produktion von aromatischen Carbonaten | |
| DE1493622C2 (de) | Verfahren zur Herstellung von 2,6-Di-tertiär-butylphenol | |
| DE1239309B (de) | Verfahren zur Herstellung von Estern der Orthophosphorsaeure | |
| EP0444293A1 (de) | Verfahren zur Herstellung von mindestens eine aromatische Estergruppe enthaltenden Kohlensäurediestern | |
| DE2525442C3 (de) | Verfahren zur Herstellung geminaler Dihalogenide | |
| EP0008648B1 (de) | Verfahren zur Herstellung von Phosphorsäure-triestern und nach diesem Verfahren hergestellte Verbindungen | |
| EP0013958B1 (de) | Verfahren zur Herstellung von Kohlensäureestern und Polycarbonaten | |
| DE2725255A1 (de) | Verfahren zur herstellung von dimethylaminoaethylmethacrylat | |
| DE2437586A1 (de) | Verfahren zur herstellung von monomethylzinntrichlorid | |
| DE1768202C3 (de) | Verfahren zu* Herstellung von aromatischen Sulfiden | |
| DE1075584B (de) | Verfahren zur Herstellung von tertiären aliphatischen Estern der phosphorigen Säure | |
| DE3040692A1 (de) | Verfahren zur herstellung aliphatischer isocyanate | |
| DE2230912A1 (de) | Verfahren zur Herstellung von Estern von Phosphorsäuren | |
| DE2064108A1 (de) | Verfahren zur Herstellung von 4,4 Bis phenol A |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8130 | Withdrawal |