DE3417858C2 - - Google Patents
Info
- Publication number
- DE3417858C2 DE3417858C2 DE3417858A DE3417858A DE3417858C2 DE 3417858 C2 DE3417858 C2 DE 3417858C2 DE 3417858 A DE3417858 A DE 3417858A DE 3417858 A DE3417858 A DE 3417858A DE 3417858 C2 DE3417858 C2 DE 3417858C2
- Authority
- DE
- Germany
- Prior art keywords
- shaft
- legs
- electrode
- leg
- electrodes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 15
- 230000005284 excitation Effects 0.000 claims description 13
- 239000013078 crystal Substances 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000010453 quartz Substances 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- QFJAZXGJBIMYLJ-UHFFFAOYSA-N 2,3-dihydroxybutanedioic acid;ethane-1,2-diamine Chemical compound NCCN.OC(=O)C(O)C(O)C(O)=O QFJAZXGJBIMYLJ-UHFFFAOYSA-N 0.000 claims description 3
- AVTYONGGKAJVTE-OLXYHTOASA-L potassium L-tartrate Chemical compound [K+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O AVTYONGGKAJVTE-OLXYHTOASA-L 0.000 claims description 3
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 claims description 2
- 235000016693 dipotassium tartrate Nutrition 0.000 claims description 2
- 235000019837 monoammonium phosphate Nutrition 0.000 claims description 2
- 239000001472 potassium tartrate Substances 0.000 claims description 2
- 210000002414 leg Anatomy 0.000 description 37
- 230000000694 effects Effects 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 230000005684 electric field Effects 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 210000000689 upper leg Anatomy 0.000 description 3
- 238000002955 isolation Methods 0.000 description 2
- 238000003491 array Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000010363 phase shift Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01C—MEASURING DISTANCES, LEVELS OR BEARINGS; SURVEYING; NAVIGATION; GYROSCOPIC INSTRUMENTS; PHOTOGRAMMETRY OR VIDEOGRAMMETRY
- G01C19/00—Gyroscopes; Turn-sensitive devices using vibrating masses; Turn-sensitive devices without moving masses; Measuring angular rate using gyroscopic effects
- G01C19/56—Turn-sensitive devices using vibrating masses, e.g. vibratory angular rate sensors based on Coriolis forces
- G01C19/5607—Turn-sensitive devices using vibrating masses, e.g. vibratory angular rate sensors based on Coriolis forces using vibrating tuning forks
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- General Physics & Mathematics (AREA)
- Radar, Positioning & Navigation (AREA)
- Remote Sensing (AREA)
- Gyroscopes (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB08411918A GB2158579B (en) | 1984-01-23 | 1984-05-10 | Angular rate sensor system |
| FR848407427A FR2564203B1 (fr) | 1984-01-23 | 1984-05-14 | Capteur de vitesse angulaire |
| DE19843417858 DE3417858A1 (de) | 1984-01-23 | 1984-05-14 | Winkelgeschwindigkeits-fuehlsystem |
| US07/147,621 USRE33479E (en) | 1984-01-23 | 1988-01-22 | Vibratory angular rate sensing system |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/572,782 US4538461A (en) | 1984-01-23 | 1984-01-23 | Vibratory angular rate sensing system |
| GB08411918A GB2158579B (en) | 1984-01-23 | 1984-05-10 | Angular rate sensor system |
| FR848407427A FR2564203B1 (fr) | 1984-01-23 | 1984-05-14 | Capteur de vitesse angulaire |
| DE19843417858 DE3417858A1 (de) | 1984-01-23 | 1984-05-14 | Winkelgeschwindigkeits-fuehlsystem |
| US85947486A | 1986-05-02 | 1986-05-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3417858A1 DE3417858A1 (de) | 1985-11-21 |
| DE3417858C2 true DE3417858C2 (enExample) | 1987-05-27 |
Family
ID=37808155
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843417858 Granted DE3417858A1 (de) | 1984-01-23 | 1984-05-14 | Winkelgeschwindigkeits-fuehlsystem |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | USRE33479E (enExample) |
| DE (1) | DE3417858A1 (enExample) |
| FR (1) | FR2564203B1 (enExample) |
| GB (1) | GB2158579B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4428405A1 (de) * | 1994-08-11 | 1996-02-15 | Karlsruhe Forschzent | Drehratensensor |
| DE19534947A1 (de) * | 1994-09-20 | 1996-03-28 | Alps Electric Co Ltd | Schwingkreiselgerät |
| DE19621320A1 (de) * | 1996-05-28 | 1997-12-11 | Teves Gmbh Alfred | Anordnung zur Erfassung und Auswertung von Gierbewegungen |
| DE19528961C2 (de) * | 1995-08-08 | 1998-10-29 | Daimler Benz Ag | Mikromechanischer Drehratensensor (DRS) und Sensoranordnung |
| DE4032559C2 (de) * | 1990-10-13 | 2000-11-23 | Bosch Gmbh Robert | Drehratensensor und Verfahren zur Herstellung |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3884481T2 (de) * | 1987-07-10 | 1994-04-28 | Nippon Denki Home Electronics | Oszillierender Kreisel. |
| SE466817B (sv) * | 1989-02-27 | 1992-04-06 | Bofors Ab | Foer gyro avsett sensorelement |
| US5473945A (en) * | 1990-02-14 | 1995-12-12 | The Charles Stark Draper Laboratory, Inc. | Micromechanical angular accelerometer with auxiliary linear accelerometer |
| US5357817A (en) * | 1990-04-19 | 1994-10-25 | Charles Stark Draper Laboratory, Inc. | Wide bandwidth stable member without angular accelerometers |
| ES2056580T3 (es) * | 1990-05-18 | 1994-10-01 | British Aerospace | Sensores inerciales. |
| DE4022495A1 (de) * | 1990-07-14 | 1992-01-23 | Bosch Gmbh Robert | Mikromechanischer drehratensensor |
| US5605598A (en) * | 1990-10-17 | 1997-02-25 | The Charles Stark Draper Laboratory Inc. | Monolithic micromechanical vibrating beam accelerometer with trimmable resonant frequency |
| US5408119A (en) | 1990-10-17 | 1995-04-18 | The Charles Stark Draper Laboratory, Inc. | Monolithic micromechanical vibrating string accelerometer with trimmable resonant frequency |
| US5635639A (en) * | 1991-09-11 | 1997-06-03 | The Charles Stark Draper Laboratory, Inc. | Micromechanical tuning fork angular rate sensor |
| US5331852A (en) * | 1991-09-11 | 1994-07-26 | The Charles Stark Draper Laboratory, Inc. | Electromagnetic rebalanced micromechanical transducer |
| US5408877A (en) * | 1992-03-16 | 1995-04-25 | The Charles Stark Draper Laboratory, Inc. | Micromechanical gyroscopic transducer with improved drive and sense capabilities |
| US5767405A (en) | 1992-04-07 | 1998-06-16 | The Charles Stark Draper Laboratory, Inc. | Comb-drive micromechanical tuning fork gyroscope with piezoelectric readout |
| US5349855A (en) * | 1992-04-07 | 1994-09-27 | The Charles Stark Draper Laboratory, Inc. | Comb drive micromechanical tuning fork gyro |
| JP3144600B2 (ja) | 1992-10-19 | 2001-03-12 | 日本電信電話株式会社 | 光振動ジャイロ |
| US5388458A (en) * | 1992-11-24 | 1995-02-14 | The Charles Stark Draper Laboratory, Inc. | Quartz resonant gyroscope or quartz resonant tuning fork gyroscope |
| US5650568A (en) | 1993-02-10 | 1997-07-22 | The Charles Stark Draper Laboratory, Inc. | Gimballed vibrating wheel gyroscope having strain relief features |
| US5555765A (en) * | 1993-02-10 | 1996-09-17 | The Charles Stark Draper Laboratory, Inc. | Gimballed vibrating wheel gyroscope |
| US5426970A (en) * | 1993-08-02 | 1995-06-27 | New Sd, Inc. | Rotation rate sensor with built in test circuit |
| DE4336004C2 (de) * | 1993-10-21 | 1998-05-28 | Siemens Ag | Schwingungsgyroskop |
| US5581035A (en) * | 1994-08-29 | 1996-12-03 | The Charles Stark Draper Laboratory, Inc. | Micromechanical sensor with a guard band electrode |
| US5646348A (en) | 1994-08-29 | 1997-07-08 | The Charles Stark Draper Laboratory, Inc. | Micromechanical sensor with a guard band electrode and fabrication technique therefor |
| US5725729A (en) * | 1994-09-26 | 1998-03-10 | The Charles Stark Draper Laboratory, Inc. | Process for micromechanical fabrication |
| DE19525217A1 (de) * | 1995-07-11 | 1997-01-16 | Teves Gmbh Alfred | Erfassung und Auswertung von sicherheitskritischen Meßgrößen |
| US5817942A (en) * | 1996-02-28 | 1998-10-06 | The Charles Stark Draper Laboratory, Inc. | Capacitive in-plane accelerometer |
| JP3752737B2 (ja) * | 1996-08-12 | 2006-03-08 | トヨタ自動車株式会社 | 角速度検出装置 |
| US5892153A (en) * | 1996-11-21 | 1999-04-06 | The Charles Stark Draper Laboratory, Inc. | Guard bands which control out-of-plane sensitivities in tuning fork gyroscopes and other sensors |
| US5783973A (en) | 1997-02-24 | 1998-07-21 | The Charles Stark Draper Laboratory, Inc. | Temperature insensitive silicon oscillator and precision voltage reference formed therefrom |
| US5911156A (en) | 1997-02-24 | 1999-06-08 | The Charles Stark Draper Laboratory, Inc. | Split electrode to minimize charge transients, motor amplitude mismatch errors, and sensitivity to vertical translation in tuning fork gyros and other devices |
| US5952574A (en) | 1997-04-29 | 1999-09-14 | The Charles Stark Draper Laboratory, Inc. | Trenches to reduce charging effects and to control out-of-plane sensitivities in tuning fork gyroscopes and other sensors |
| JPH11183176A (ja) | 1997-12-18 | 1999-07-09 | Fujitsu Ltd | 音叉型振動子及び音叉型振動ジャイロ |
| US6230563B1 (en) | 1998-06-09 | 2001-05-15 | Integrated Micro Instruments, Inc. | Dual-mass vibratory rate gyroscope with suppressed translational acceleration response and quadrature-error correction capability |
| FR2789171B1 (fr) * | 1999-02-01 | 2001-03-02 | Onera (Off Nat Aerospatiale) | Structure monolithique de gyrometre vibrant |
| US6189381B1 (en) | 1999-04-26 | 2001-02-20 | Sitek, Inc. | Angular rate sensor made from a structural wafer of single crystal silicon |
| US7051590B1 (en) | 1999-06-15 | 2006-05-30 | Analog Devices Imi, Inc. | Structure for attenuation or cancellation of quadrature error |
| US6823733B2 (en) * | 2002-11-04 | 2004-11-30 | Matsushita Electric Industrial Co., Ltd. | Z-axis vibration gyroscope |
| US8187902B2 (en) | 2008-07-09 | 2012-05-29 | The Charles Stark Draper Laboratory, Inc. | High performance sensors and methods for forming the same |
Family Cites Families (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2455939A (en) * | 1948-12-14 | Device for detecting turn or | ||
| GB611011A (en) * | 1943-01-13 | 1948-10-25 | Smith & Sons Ltd S | Improvements in or relating to devices for detecting or measuring rate of turn |
| US2513340A (en) * | 1945-10-17 | 1950-07-04 | Sperry Corp | Angular velocity responsive apparatus |
| GB618328A (en) * | 1945-10-17 | 1949-02-21 | Sperry Gyroscope Co Inc | Improvements in or relating to turn responsive apparatus |
| US2544646A (en) * | 1948-06-16 | 1951-03-13 | Sperry Corp | Angular velocity measuring instrument |
| GB730783A (en) * | 1952-08-08 | 1955-06-01 | Sperry Corp | Improvements in or relating to rate-of-turn-responsive apparatus |
| US2753173A (en) * | 1952-09-17 | 1956-07-03 | Sperry Rand Corp | Turn rate measuring instrument |
| GB742980A (en) * | 1953-12-23 | 1956-01-04 | Sperry Corp | Turn responsive apparatus |
| GB827860A (en) * | 1955-03-31 | 1960-02-10 | Clarence Hunter Mcshan | Improvements in or relating to electromechanical transducer systems |
| GB861436A (en) * | 1956-02-27 | 1961-02-22 | August Karolus | Improvements in and relating to devices responsive to angular movements |
| US3307409A (en) * | 1959-02-26 | 1967-03-07 | Jr George C Newton | Method of and apparatus for measuring angular motion |
| US3241377A (en) * | 1960-01-13 | 1966-03-22 | Jr George C Newton | Method of and apparatus for detecting angular motion |
| GB947310A (en) * | 1960-07-22 | 1964-01-22 | August Karolus | Improvements in or relating to rotation responsive devices |
| US3143889A (en) * | 1960-08-23 | 1964-08-11 | Westinghouse Electric Corp | Angular velocity measuring device |
| US3127775A (en) * | 1960-10-28 | 1964-04-07 | Gyrex Corp | Vibratory rate gyroscope |
| DE1269398B (de) * | 1960-12-07 | 1968-05-30 | Dr Phil August Karolus | Vorrichtung zur Messung von Drehgeschwindigkeiten und Drehrichtungen |
| GB989101A (en) * | 1961-07-11 | 1965-04-14 | Mini Of Aviat London | Improvements in gyroscope apparatus |
| US3141100A (en) * | 1962-06-21 | 1964-07-14 | Avco Corp | Piezoelectric resonance device |
| US3269192A (en) * | 1962-11-07 | 1966-08-30 | Gen Precision Inc | Tuning fork digital accelerometer |
| US3206986A (en) * | 1963-01-04 | 1965-09-21 | Western Electric Co | Apparatus for sensing selected movements of a body |
| US3258617A (en) * | 1963-02-07 | 1966-06-28 | Avco Corp | Piezoelectric device |
| FR1395116A (fr) * | 1964-04-10 | 1965-04-09 | Hawker Siddeley Dynamics Ltd | Perfectionnements aux dispositifs gyroscopiques |
| US3319472A (en) * | 1964-05-06 | 1967-05-16 | Varo | Combination time base accelerometer |
| US3465597A (en) * | 1965-05-25 | 1969-09-09 | Singer General Precision | Vibrating-column accelerometer |
| US3520195A (en) * | 1965-10-11 | 1970-07-14 | Gen Electric | Solid state angular velocity sensing device |
| GB1304496A (enExample) * | 1971-11-11 | 1973-01-24 | ||
| US3839915A (en) * | 1973-03-19 | 1974-10-08 | Northrop Corp | Turn rate sensor |
| GB1455046A (en) * | 1974-07-19 | 1976-11-10 | Shell Int Research | Arrangement and method for measuring the rate-of-turn of a ship |
| GB1540279A (en) * | 1977-06-27 | 1979-02-07 | Ferranti Ltd | Turn sensitive devices |
| DE2845008A1 (de) * | 1978-10-16 | 1980-04-30 | Philips Patentverwaltung | Beschleunigungsaufnehmer |
| US4381672A (en) * | 1981-03-04 | 1983-05-03 | The Bendix Corporation | Vibrating beam rotation sensor |
| US4429248A (en) * | 1981-05-27 | 1984-01-31 | Statek Corporation | Mounting apparatus and method for piezoelectric tuning fork |
| GB2111209B (en) * | 1981-12-08 | 1986-03-19 | Nat Res Dev | Piezoelectric oscillatory gyroscopes |
| NO823684L (no) * | 1982-01-21 | 1983-07-22 | Watson Ind Inc | Vinkelhastighetsensor. |
-
1984
- 1984-05-10 GB GB08411918A patent/GB2158579B/en not_active Expired
- 1984-05-14 DE DE19843417858 patent/DE3417858A1/de active Granted
- 1984-05-14 FR FR848407427A patent/FR2564203B1/fr not_active Expired
-
1988
- 1988-01-22 US US07/147,621 patent/USRE33479E/en not_active Expired - Lifetime
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4032559C2 (de) * | 1990-10-13 | 2000-11-23 | Bosch Gmbh Robert | Drehratensensor und Verfahren zur Herstellung |
| DE4428405A1 (de) * | 1994-08-11 | 1996-02-15 | Karlsruhe Forschzent | Drehratensensor |
| DE19534947A1 (de) * | 1994-09-20 | 1996-03-28 | Alps Electric Co Ltd | Schwingkreiselgerät |
| DE19534947C2 (de) * | 1994-09-20 | 1998-08-13 | Alps Electric Co Ltd | Schwingkreiselgerät |
| DE19528961C2 (de) * | 1995-08-08 | 1998-10-29 | Daimler Benz Ag | Mikromechanischer Drehratensensor (DRS) und Sensoranordnung |
| DE19621320A1 (de) * | 1996-05-28 | 1997-12-11 | Teves Gmbh Alfred | Anordnung zur Erfassung und Auswertung von Gierbewegungen |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2158579B (en) | 1988-07-13 |
| GB8411918D0 (en) | 1984-06-13 |
| FR2564203A1 (fr) | 1985-11-15 |
| FR2564203B1 (fr) | 1989-12-15 |
| USRE33479E (en) | 1990-12-11 |
| GB2158579A (en) | 1985-11-13 |
| DE3417858A1 (de) | 1985-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3417858C2 (enExample) | ||
| DE69008165T2 (de) | Fühlelement für ein gyroskop. | |
| DE19530007C2 (de) | Drehratensensor | |
| DE19643182B4 (de) | Schwingungskonstruktion | |
| DE69307587T2 (de) | Kreiselkompass | |
| DE60018165T2 (de) | Oszillationskreiselsensor und drehwinkelmessgerät | |
| DE69310315T2 (de) | Vibratordrehungsmessaufnehmer | |
| DE60032100T2 (de) | Mikrokreisel mit zwei resonanten Platten | |
| DE60033635T2 (de) | Stimmgabelumdrehungsmesser | |
| DE69505320T2 (de) | Kraft-Frequenz-Wandler mit vibrierenden Balken und Mittenkraftangriff | |
| DE1281695B (de) | Flachschwingende Messsaite | |
| DE602004009204T2 (de) | Wandler zur Winkelgeschwindigkeitsmessung | |
| DE69930652T2 (de) | Monolithischer miniatur-beschleunigungssensor | |
| DE3926504C2 (de) | Schwingkreisel | |
| EP0449836B1 (de) | Sensor zur bestimmung der winkelgeschwindigkeit | |
| DE69621372T2 (de) | Vibrationskreisel | |
| DE4431232C2 (de) | Integrierbares Feder-Masse-System | |
| DE29617410U1 (de) | Drehratensensor mit entkoppelten orthogonalen Primär- und Sekundärschwingungen | |
| DE69211228T2 (de) | Vibrationskreisel | |
| EP0973010A2 (de) | Mikromechanischer Drehratensensor mit Koppelstruktur | |
| DE3038660A1 (de) | Beschleunigungsaufnehmer mit piezoelektrischem wandlerelement | |
| DE69331116T2 (de) | Drehratensensor und Verfahren zu dessen Herstellung | |
| DE2842644A1 (de) | Quarzschwinger mit einer dicken- breiten-scherschwingung | |
| DE102017219933A1 (de) | Drehratensensor mit einem eine Haupterstreckungsebene aufweisenden Substrat, Herstellungsverfahren für einen Drehratensensor | |
| EP3060933B1 (de) | Gradientenmagnetometer und verfahren zur bestimmung einer einzelnen komponente eines gradiententensors eines magnetfelds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |