DE3220591A1 - Cyanoacrylat-klebstoffzusammensetzung mit verbesserten thermischen eigenschaften - Google Patents
Cyanoacrylat-klebstoffzusammensetzung mit verbesserten thermischen eigenschaftenInfo
- Publication number
- DE3220591A1 DE3220591A1 DE19823220591 DE3220591A DE3220591A1 DE 3220591 A1 DE3220591 A1 DE 3220591A1 DE 19823220591 DE19823220591 DE 19823220591 DE 3220591 A DE3220591 A DE 3220591A DE 3220591 A1 DE3220591 A1 DE 3220591A1
- Authority
- DE
- Germany
- Prior art keywords
- adhesive composition
- composition according
- weight
- alkyl
- cyanoacrylate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000000203 mixture Substances 0.000 title claims description 82
- FGBJXOREULPLGL-UHFFFAOYSA-N ethyl cyanoacrylate Chemical compound CCOC(=O)C(=C)C#N FGBJXOREULPLGL-UHFFFAOYSA-N 0.000 title claims description 9
- 239000004830 Super Glue Substances 0.000 title claims description 8
- 239000000853 adhesive Substances 0.000 claims description 26
- 230000001070 adhesive effect Effects 0.000 claims description 26
- 239000000178 monomer Substances 0.000 claims description 17
- -1 heterocyclic radical Chemical class 0.000 claims description 13
- 239000000654 additive Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 239000003112 inhibitor Substances 0.000 claims description 11
- 229920001651 Cyanoacrylate Polymers 0.000 claims description 10
- MWCLLHOVUTZFKS-UHFFFAOYSA-N Methyl cyanoacrylate Chemical compound COC(=O)C(=C)C#N MWCLLHOVUTZFKS-UHFFFAOYSA-N 0.000 claims description 10
- 230000000996 additive effect Effects 0.000 claims description 9
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 6
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 238000010526 radical polymerization reaction Methods 0.000 claims description 5
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 238000010539 anionic addition polymerization reaction Methods 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 claims description 4
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 claims description 3
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 claims description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- 239000002202 Polyethylene glycol Substances 0.000 claims description 3
- 229940053009 ethyl cyanoacrylate Drugs 0.000 claims description 3
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 claims description 3
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 3
- 229920001223 polyethylene glycol Polymers 0.000 claims description 3
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 2
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 claims description 2
- LTHJXDSHSVNJKG-UHFFFAOYSA-N 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOCCOC(=O)C(C)=C LTHJXDSHSVNJKG-UHFFFAOYSA-N 0.000 claims description 2
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 2
- 229930192627 Naphthoquinone Natural products 0.000 claims description 2
- LCXXNKZQVOXMEH-UHFFFAOYSA-N Tetrahydrofurfuryl methacrylate Chemical compound CC(=C)C(=O)OCC1CCCO1 LCXXNKZQVOXMEH-UHFFFAOYSA-N 0.000 claims description 2
- 150000004056 anthraquinones Chemical class 0.000 claims description 2
- 150000004054 benzoquinones Chemical class 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 150000002791 naphthoquinones Chemical class 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 3
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 claims 2
- 101000944174 Homo sapiens Histone acetyltransferase KAT6B Proteins 0.000 claims 2
- CLHYKAZPWIRRRD-UHFFFAOYSA-N 1-hydroxypropane-1-sulfonic acid Chemical compound CCC(O)S(O)(=O)=O CLHYKAZPWIRRRD-UHFFFAOYSA-N 0.000 claims 1
- IAXXETNIOYFMLW-COPLHBTASA-N [(1s,3s,4s)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate Chemical compound C1C[C@]2(C)[C@@H](OC(=O)C(=C)C)C[C@H]1C2(C)C IAXXETNIOYFMLW-COPLHBTASA-N 0.000 claims 1
- 238000012690 ionic polymerization Methods 0.000 claims 1
- 229940119545 isobornyl methacrylate Drugs 0.000 claims 1
- 229940102838 methylmethacrylate Drugs 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- 230000032683 aging Effects 0.000 description 6
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 239000013466 adhesive and sealant Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005979 thermal decomposition reaction Methods 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- 150000003923 2,5-pyrrolediones Chemical class 0.000 description 2
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 230000000712 assembly Effects 0.000 description 2
- 238000000429 assembly Methods 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- NLCKLZIHJQEMCU-UHFFFAOYSA-N cyano prop-2-enoate Chemical group C=CC(=O)OC#N NLCKLZIHJQEMCU-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- JFZBUNLOTDDXNY-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)propoxy]propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(C)OCC(C)OC(=O)C(C)=C JFZBUNLOTDDXNY-UHFFFAOYSA-N 0.000 description 1
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- JPQXSFFKVNVOMN-UHFFFAOYSA-N C(C=C)(=O)O.C(C=C)(=O)O.OCC(O)CO.OCC(O)CO.C=C.C=C.C=C.C=C Chemical compound C(C=C)(=O)O.C(C=C)(=O)O.OCC(O)CO.OCC(O)CO.C=C.C=C.C=C.C=C JPQXSFFKVNVOMN-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical class O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- YDKNBNOOCSNPNS-UHFFFAOYSA-N methyl 1,3-benzoxazole-2-carboxylate Chemical compound C1=CC=C2OC(C(=O)OC)=NC2=C1 YDKNBNOOCSNPNS-UHFFFAOYSA-N 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- ITCZEZQMUWEPQP-UHFFFAOYSA-N prop-2-enyl 2-cyanoprop-2-enoate Chemical compound C=CCOC(=O)C(=C)C#N ITCZEZQMUWEPQP-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003878 thermal aging Methods 0.000 description 1
- 238000001757 thermogravimetry curve Methods 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229940096522 trimethylolpropane triacrylate Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Sealing Material Composition (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24656081A | 1981-06-01 | 1981-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3220591A1 true DE3220591A1 (de) | 1983-01-05 |
Family
ID=22931200
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823220591 Ceased DE3220591A1 (de) | 1981-06-01 | 1982-06-01 | Cyanoacrylat-klebstoffzusammensetzung mit verbesserten thermischen eigenschaften |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS57207664A (enExample) |
| AU (2) | AU8433682A (enExample) |
| BE (1) | BE893260A (enExample) |
| BR (1) | BR8203122A (enExample) |
| CA (1) | CA1212199A (enExample) |
| DE (1) | DE3220591A1 (enExample) |
| FR (1) | FR2506777A1 (enExample) |
| GB (1) | GB2100273B (enExample) |
| IE (1) | IE53977B1 (enExample) |
| IT (1) | IT1197429B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5739205A (en) * | 1994-06-08 | 1998-04-14 | Taoka Chemical Company, Limited | α-cyanoacrylate adhesive composition |
| EP0686681B1 (en) * | 1994-06-08 | 1998-08-05 | Taoka Chemical Company, Limited | Alpha-cyanoacrylate adhesive composition |
| CN101258211B (zh) * | 2005-07-11 | 2012-05-30 | 汉高公司 | 增韧的氰基丙烯酸酯组合物 |
| JP4976575B1 (ja) * | 2011-07-07 | 2012-07-18 | ナミックス株式会社 | 樹脂組成物 |
| JP6246734B2 (ja) * | 2012-01-25 | 2017-12-13 | ヘンケル アイピー アンド ホールディング ゲゼルシャフト ミット ベシュレンクテル ハフツング | シアノアクリレート組成物 |
| WO2024062930A1 (ja) * | 2022-09-22 | 2024-03-28 | 株式会社クラレ | 接着剤、硬化物及び部材 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2816093A (en) * | 1954-06-02 | 1957-12-10 | Eastman Kodak Co | Mixed adhesive compositions including alpha-cyanoacrylate esters |
| US3692752A (en) * | 1968-10-31 | 1972-09-19 | Matsumoto Seiyaku Kogyo Kk | Adhesive composition containing {60 -cyanoacrylate as its main ingredient |
| DE2419882A1 (de) * | 1973-04-24 | 1974-11-07 | Tokyo Shibaura Electric Co | Waermebestaendige klebstoffzusammensetzung |
| DE2357321A1 (de) * | 1973-11-07 | 1975-05-22 | Trofimow | Cyanacrylat-klebstoff |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4922433A (enExample) * | 1972-06-21 | 1974-02-27 | ||
| JPS5211688B2 (enExample) * | 1973-04-24 | 1977-04-01 | ||
| JPS565873A (en) * | 1979-06-29 | 1981-01-21 | Taoka Chem Co Ltd | Adhesive composition |
-
1982
- 1982-04-28 CA CA000401860A patent/CA1212199A/en not_active Expired
- 1982-05-06 IE IE1083/82A patent/IE53977B1/en not_active IP Right Cessation
- 1982-05-07 JP JP57076438A patent/JPS57207664A/ja active Granted
- 1982-05-18 IT IT48441/82A patent/IT1197429B/it active
- 1982-05-21 BE BE0/208152A patent/BE893260A/fr not_active IP Right Cessation
- 1982-05-26 GB GB8215392A patent/GB2100273B/en not_active Expired
- 1982-05-28 FR FR8209346A patent/FR2506777A1/fr not_active Withdrawn
- 1982-05-28 BR BR8203122A patent/BR8203122A/pt unknown
- 1982-05-31 AU AU84336/82A patent/AU8433682A/en not_active Abandoned
- 1982-06-01 DE DE19823220591 patent/DE3220591A1/de not_active Ceased
-
1988
- 1988-03-17 AU AU13239/88A patent/AU1323988A/en not_active Abandoned
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2816093A (en) * | 1954-06-02 | 1957-12-10 | Eastman Kodak Co | Mixed adhesive compositions including alpha-cyanoacrylate esters |
| US3692752A (en) * | 1968-10-31 | 1972-09-19 | Matsumoto Seiyaku Kogyo Kk | Adhesive composition containing {60 -cyanoacrylate as its main ingredient |
| DE2419882A1 (de) * | 1973-04-24 | 1974-11-07 | Tokyo Shibaura Electric Co | Waermebestaendige klebstoffzusammensetzung |
| DE2357321A1 (de) * | 1973-11-07 | 1975-05-22 | Trofimow | Cyanacrylat-klebstoff |
Non-Patent Citations (1)
| Title |
|---|
| Referat v. JP 49-0 94 742 in Hochmolekularbe- richt 1977 * |
Also Published As
| Publication number | Publication date |
|---|---|
| BR8203122A (pt) | 1983-05-10 |
| AU8433682A (en) | 1982-12-09 |
| GB2100273B (en) | 1985-07-03 |
| BE893260A (fr) | 1982-11-22 |
| GB2100273A (en) | 1982-12-22 |
| FR2506777A1 (fr) | 1982-12-03 |
| IE53977B1 (en) | 1989-05-10 |
| AU1323988A (en) | 1988-06-09 |
| CA1212199A (en) | 1986-09-30 |
| IT8248441A0 (it) | 1982-05-18 |
| JPH0332591B2 (enExample) | 1991-05-13 |
| IE821083L (en) | 1982-12-01 |
| JPS57207664A (en) | 1982-12-20 |
| IT1197429B (it) | 1988-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102011017626B4 (de) | Verfahren zur Stabilisierung eines Reaktionsharzmörtels und dessen Vorläufermischungen, Harzmischung, Reaktionsharzmörtel, Mehrkomponenten - Mörtelsystem, dessen Verwendung sowie Patrone, Kartusche oder Folienbeutel umfassend das Mehrkomponenten - Mörtelsystem | |
| DE3008258C2 (de) | Verfahren zur Herstellung einer anaerob härtenden chemischen Zusammensetzung | |
| DE2849965C3 (de) | Klebstoff auf der Basis von Cyanacrylsäureestern | |
| DE2451350C3 (de) | Anaerob härtende Masse | |
| DE2060645C3 (de) | Stabilisierte anaerohbärtende Mischung | |
| DE2201549A1 (de) | Cyanoacrylat-klebstoffmassen mit verbesserter waermebestaendigkeit | |
| DE3400577A1 (de) | Cyanoacrylsaeureester-klebstoffe von verhaeltnismaessig geringem haftvermoegen an haut | |
| DE2620775A1 (de) | Anaerobe klebe- und dichtungsmittel | |
| DE3220591A1 (de) | Cyanoacrylat-klebstoffzusammensetzung mit verbesserten thermischen eigenschaften | |
| DE2441943C3 (de) | Anaerob härtende Klebstoffe und Dichtungsmassen | |
| DE2451577C2 (de) | Anaerobe Klebstoffmasse | |
| DE2441963A1 (de) | Anaerob haertende klebstoffe und dichtungsmassen | |
| DE2904018A1 (de) | Rotfarbiger leuchtstoff sowie verfahren zu seiner herstellung | |
| EP0356875B1 (de) | Neue radikalisch polymerisierbare Mehrstoffgemische und ihre Verwendung (I) | |
| DE2113094C3 (de) | Stabilisierte anaerob härtende Masse | |
| DE3820754C2 (enExample) | ||
| DE2649372C3 (de) | Anaerob härtende an der Luft stabile Massen und Verwendung derselben als Klebe- und Dichtungsmittel | |
| EP0641846B1 (de) | Durch radikalische Polymerisation aushärtende, geruchsarme (Meth-)acrylatzubereitungen und ihre Verwendung | |
| DE1807895C3 (de) | Stabilisierte Cyanacrylat-KIebstoffe | |
| DE1909992A1 (de) | Mittel und Verfahren zum Verbinden von Flaechen | |
| DE2612546A1 (de) | Loesbare cyanacrylat-klebstoffzusammensetzungen | |
| WO1993001218A1 (de) | Zusammensetzung mit olefinisch ungesättigten verbindungen und hydrazonen | |
| DE1922171C3 (de) | Verfahren zur Herstellung einer Peroxidpaste | |
| EP1954777B1 (de) | Klebestift mit polyurethan/polyacrylat-hybriddispersion | |
| DE2512288B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |