DE3205388A1 - Verfahren zur herstellung von (omega)-indol-3-yl-alkanolen - Google Patents
Verfahren zur herstellung von (omega)-indol-3-yl-alkanolenInfo
- Publication number
- DE3205388A1 DE3205388A1 DE19823205388 DE3205388A DE3205388A1 DE 3205388 A1 DE3205388 A1 DE 3205388A1 DE 19823205388 DE19823205388 DE 19823205388 DE 3205388 A DE3205388 A DE 3205388A DE 3205388 A1 DE3205388 A1 DE 3205388A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- general formula
- context
- phenylhydrazine
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 40
- 238000002360 preparation method Methods 0.000 title claims description 5
- 229940067157 phenylhydrazine Drugs 0.000 claims abstract description 41
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 claims abstract description 37
- 238000006243 chemical reaction Methods 0.000 claims abstract description 30
- 239000002253 acid Substances 0.000 claims abstract description 27
- 239000002904 solvent Substances 0.000 claims abstract description 18
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- 230000001476 alcoholic effect Effects 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 10
- 125000003118 aryl group Chemical group 0.000 claims abstract description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 7
- 125000004104 aryloxy group Chemical group 0.000 claims abstract description 5
- -1 aralkyl radical Chemical class 0.000 claims description 35
- 239000011541 reaction mixture Substances 0.000 claims description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical group C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000000109 phenylethoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])O* 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims 6
- 150000005840 aryl radicals Chemical class 0.000 claims 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 abstract description 4
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- MBBOMCVGYCRMEA-UHFFFAOYSA-N tryptophol Chemical compound C1=CC=C2C(CCO)=CNC2=C1 MBBOMCVGYCRMEA-UHFFFAOYSA-N 0.000 description 37
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 13
- 238000004821 distillation Methods 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 12
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 11
- JOVOSQBPPZZESK-UHFFFAOYSA-N phenylhydrazine hydrochloride Chemical compound Cl.NNC1=CC=CC=C1 JOVOSQBPPZZESK-UHFFFAOYSA-N 0.000 description 10
- 229940038531 phenylhydrazine hydrochloride Drugs 0.000 description 10
- 150000004031 phenylhydrazines Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- OKAMTPRCXVGTND-UHFFFAOYSA-N 2-methoxyoxolane Chemical compound COC1CCCO1 OKAMTPRCXVGTND-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000002026 chloroform extract Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- LYPSVQXMCZIRGP-UHFFFAOYSA-N 3-(1h-indol-3-yl)propan-1-ol Chemical compound C1=CC=C2C(CCCO)=CNC2=C1 LYPSVQXMCZIRGP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- DBLCQDJUAPOYPD-UHFFFAOYSA-N 3-(1h-indol-3-yl)butan-1-ol Chemical compound C1=CC=C2C(C(CCO)C)=CNC2=C1 DBLCQDJUAPOYPD-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- SCZGZDLUGUYLRV-UHFFFAOYSA-N (2-methylphenyl)hydrazine Chemical compound CC1=CC=CC=C1NN SCZGZDLUGUYLRV-UHFFFAOYSA-N 0.000 description 1
- FRPRUNJFRGMFQW-UHFFFAOYSA-N (4-benzylphenyl)hydrazine Chemical compound C1=CC(NN)=CC=C1CC1=CC=CC=C1 FRPRUNJFRGMFQW-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SQMOOVFBFVTTGF-UHFFFAOYSA-N 1-benzyl-1-phenylhydrazine Chemical compound C=1C=CC=CC=1N(N)CC1=CC=CC=C1 SQMOOVFBFVTTGF-UHFFFAOYSA-N 0.000 description 1
- UMKLWBFJFMDZAH-UHFFFAOYSA-N 1-chloro-1-phenylhydrazine Chemical compound NN(Cl)C1=CC=CC=C1 UMKLWBFJFMDZAH-UHFFFAOYSA-N 0.000 description 1
- LFPDULKFWCXVIV-UHFFFAOYSA-N 1-methoxy-1-phenylhydrazine Chemical compound CON(N)C1=CC=CC=C1 LFPDULKFWCXVIV-UHFFFAOYSA-N 0.000 description 1
- MWOODERJGVWYJE-UHFFFAOYSA-N 1-methyl-1-phenylhydrazine Chemical compound CN(N)C1=CC=CC=C1 MWOODERJGVWYJE-UHFFFAOYSA-N 0.000 description 1
- PNWYCXIXWJEZLY-UHFFFAOYSA-N 1-phenyl-1-phenylmethoxyhydrazine Chemical compound C=1C=CC=CC=1N(N)OCC1=CC=CC=C1 PNWYCXIXWJEZLY-UHFFFAOYSA-N 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- DCAPAWBGZKNLGC-UHFFFAOYSA-N 2-(4-chloro-1h-indol-3-yl)ethanol Chemical compound C1=CC(Cl)=C2C(CCO)=CNC2=C1 DCAPAWBGZKNLGC-UHFFFAOYSA-N 0.000 description 1
- ZENXDUDCTZLSRP-UHFFFAOYSA-N 2-(5-bromo-1h-indol-3-yl)ethanol Chemical compound C1=C(Br)C=C2C(CCO)=CNC2=C1 ZENXDUDCTZLSRP-UHFFFAOYSA-N 0.000 description 1
- IEYZBUJHHBTQCR-UHFFFAOYSA-N 2-(5-chloro-1h-indol-3-yl)ethanol Chemical compound C1=C(Cl)C=C2C(CCO)=CNC2=C1 IEYZBUJHHBTQCR-UHFFFAOYSA-N 0.000 description 1
- SQAUQUOZCKVQND-UHFFFAOYSA-N 2-(5-phenylmethoxy-1h-indol-3-yl)ethanol Chemical compound C1=C2C(CCO)=CNC2=CC=C1OCC1=CC=CC=C1 SQAUQUOZCKVQND-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- JNODDICFTDYODH-UHFFFAOYSA-N 2-hydroxytetrahydrofuran Chemical class OC1CCCO1 JNODDICFTDYODH-UHFFFAOYSA-N 0.000 description 1
- VNYKMATXHYMXFE-UHFFFAOYSA-N 2-methoxy-4-methyloxane Chemical compound COC1CC(C)CCO1 VNYKMATXHYMXFE-UHFFFAOYSA-N 0.000 description 1
- ZXMCOSPZKVGRNK-UHFFFAOYSA-N 2-methoxy-4-methyloxolane Chemical compound COC1CC(C)CO1 ZXMCOSPZKVGRNK-UHFFFAOYSA-N 0.000 description 1
- XTDKZSUYCXHXJM-UHFFFAOYSA-N 2-methoxyoxane Chemical compound COC1CCCCO1 XTDKZSUYCXHXJM-UHFFFAOYSA-N 0.000 description 1
- OVRKATYHWPCGPZ-UHFFFAOYSA-N 4-methyloxane Chemical compound CC1CCOCC1 OVRKATYHWPCGPZ-UHFFFAOYSA-N 0.000 description 1
- QLWKTGDEPLRFAT-UHFFFAOYSA-N 5-Methoxytryptophol Chemical compound COC1=CC=C2NC=C(CCO)C2=C1 QLWKTGDEPLRFAT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 238000006783 Fischer indole synthesis reaction Methods 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- OVNUPJXMCMTQCN-UHFFFAOYSA-N hydron;(4-phenylmethoxyphenyl)hydrazine;chloride Chemical compound Cl.C1=CC(NN)=CC=C1OCC1=CC=CC=C1 OVNUPJXMCMTQCN-UHFFFAOYSA-N 0.000 description 1
- 229930005303 indole alkaloid Natural products 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- DCMUJUQQBAFVLJ-UHFFFAOYSA-N oxolan-2-yl acetate Chemical compound CC(=O)OC1CCCO1 DCMUJUQQBAFVLJ-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical compound CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 150000003527 tetrahydropyrans Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- JCMLRUNDSXARRW-UHFFFAOYSA-N trioxouranium Chemical compound O=[U](=O)=O JCMLRUNDSXARRW-UHFFFAOYSA-N 0.000 description 1
- NMEHNETUFHBYEG-IHKSMFQHSA-N tttn Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 NMEHNETUFHBYEG-IHKSMFQHSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/12—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2351481A JPS57139065A (en) | 1981-02-19 | 1981-02-19 | Preparation of omega-indole-3-ylalkanole compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3205388A1 true DE3205388A1 (de) | 1982-09-23 |
| DE3205388C2 DE3205388C2 (enExample) | 1988-10-06 |
Family
ID=12112550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823205388 Granted DE3205388A1 (de) | 1981-02-19 | 1982-02-16 | Verfahren zur herstellung von (omega)-indol-3-yl-alkanolen |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS57139065A (enExample) |
| BE (1) | BE892145A (enExample) |
| CH (1) | CH648018A5 (enExample) |
| DE (1) | DE3205388A1 (enExample) |
| FR (1) | FR2499987B1 (enExample) |
| HU (1) | HU186036B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6133453A (en) * | 1998-05-15 | 2000-10-17 | Pharm-Eco Laboratories, Inc. | Method for making substituted indoles |
| JP4745491B2 (ja) * | 2000-10-11 | 2011-08-10 | 株式会社明治 | インドール長鎖アルコール及びこれを含有する医薬 |
| US7407983B2 (en) | 2002-02-13 | 2008-08-05 | Meiji Dairies Corporation | Indole derivatives substituted with long-chain alcohols and medicaments containing them |
-
1981
- 1981-02-19 JP JP2351481A patent/JPS57139065A/ja active Granted
-
1982
- 1982-02-15 BE BE0/207318A patent/BE892145A/fr not_active IP Right Cessation
- 1982-02-16 DE DE19823205388 patent/DE3205388A1/de active Granted
- 1982-02-17 FR FR8203178A patent/FR2499987B1/fr not_active Expired
- 1982-02-18 HU HU49782A patent/HU186036B/hu not_active IP Right Cessation
- 1982-02-18 CH CH1017/82A patent/CH648018A5/de not_active IP Right Cessation
Non-Patent Citations (3)
| Title |
|---|
| US-Z: Chemical Abstracts, Bd. 74, 1971, Ref. 12 933 x * |
| US-Z: Chemical Abstracts, Bd.75, 1971, Ref. 76 512 n * |
| US-Z: Chemical Abstracts, Bd.78, 1973, Ref. 43 192 s * |
Also Published As
| Publication number | Publication date |
|---|---|
| CH648018A5 (de) | 1985-02-28 |
| BE892145A (fr) | 1982-05-27 |
| JPS57139065A (en) | 1982-08-27 |
| FR2499987A1 (fr) | 1982-08-20 |
| HU186036B (en) | 1985-05-28 |
| JPH0148267B2 (enExample) | 1989-10-18 |
| DE3205388C2 (enExample) | 1988-10-06 |
| FR2499987B1 (fr) | 1985-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2640275A1 (de) | Pharmakologisch wirksame substanz aus labiaten | |
| DE2125634A1 (de) | Verfahren zur Herstellung von neuen Cycloheptenderivaten | |
| DE2122643A1 (de) | 5-Chromenolester oder -äther, Verfahren zu ihrer Herstellung und Arzneipräparate | |
| DE2715080A1 (de) | Verfahren zur herstellung von cyclopentenon-derivaten | |
| DE2310141A1 (de) | Verfahren zur herstellung von 1phenyl-2-aminoaethanolderivaten | |
| DE1445882A1 (de) | Verfahren zur Herstellung von Pyridinderivaten | |
| DE3205388A1 (de) | Verfahren zur herstellung von (omega)-indol-3-yl-alkanolen | |
| DE2129507C3 (de) | Verfahren zur Herstellung von 8-Alkoxy-3halogenmethyl-4-acetoxy- 10-methylen-2,9dioxatricyclo(43,l,03 7 )decanen | |
| DE2108649C3 (de) | 2-Methyl-2-hepten-6-on-l-al und seine Acetale | |
| DE2917381A1 (de) | Verfahren zur herstellung von imidazolen | |
| DE2914166A1 (de) | Arylsubstituierte furane und verfahren zu ihrer herstellung | |
| DE1793570A1 (de) | Verfahren zur Herstellung von Veratrylketon | |
| DE2513803A1 (de) | Bicyclische kohlenwasserstoffderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2700341A1 (de) | Oxo-c-ring-benzopyrane | |
| AT268295B (de) | Verfahren zur Herstellung neuer Pyridazon-(3)-Verbindungen, deren Salzen bzw. quartären Trialkylammoniumsalzen | |
| DE1518771A1 (de) | Verfahren zur Herstellung von 2-(Dialkylmethyl)-5-alkyl-2-cyclohexen-1-onen | |
| CH632228A5 (en) | Process for the preparation of monoacetals of aromatic 1,2-diketones | |
| EP0045414B1 (de) | Verfahren zur Herstellung von 3-Amino-1-phenylpyrazol-5-on | |
| AT251579B (de) | Verfahren zur Herstellung von Pyridinderivaten | |
| AT214922B (de) | Verfahren zur Herstellung neuer 1,2,6-substituierter Piperidone-(4), bzw. ihrer Salze | |
| DE2501220C3 (de) | Verfahren zur Herstellung von substituierten l,7-Diphenyl-5-hydroxyhepta-( 1,4,6)-trien-(3)-onen | |
| AT206439B (de) | Verfahren zur Herstellung von neuen, racemischen oder optisch aktiven Piperidyl-(2)-arylmethanoläthern | |
| AT269170B (de) | Verfahren zur Herstellung von neuen 1-[(ω-1)-Oxoalkyl]-3,7- bzw. 7-[(ω-1)-Oxoalkyl]-1,3-dimethylxanthinen | |
| DE3005562C2 (de) | Verfahren zur Herstellung von 1-(1-Naphthoxy)-3-isopropylamino-2-propanol | |
| DE1443083C (de) | Verfahren zur Herstellung von 9,10 Secogona l,3,5(10),8(14>tetraenen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |