DE3200125C2 - - Google Patents
Info
- Publication number
- DE3200125C2 DE3200125C2 DE3200125A DE3200125A DE3200125C2 DE 3200125 C2 DE3200125 C2 DE 3200125C2 DE 3200125 A DE3200125 A DE 3200125A DE 3200125 A DE3200125 A DE 3200125A DE 3200125 C2 DE3200125 C2 DE 3200125C2
- Authority
- DE
- Germany
- Prior art keywords
- monomer
- group
- polymer
- polymerization
- inorganic substance
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000178 monomer Substances 0.000 claims description 115
- 229920000642 polymer Polymers 0.000 claims description 64
- 239000000126 substance Substances 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 38
- 238000006116 polymerization reaction Methods 0.000 claims description 31
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 22
- 229920002554 vinyl polymer Polymers 0.000 claims description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 19
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 13
- GBAOBIBJACZTNA-UHFFFAOYSA-L calcium sulfite Chemical compound [Ca+2].[O-]S([O-])=O GBAOBIBJACZTNA-UHFFFAOYSA-L 0.000 claims description 13
- 235000010261 calcium sulphite Nutrition 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 229920000620 organic polymer Polymers 0.000 claims description 8
- 238000010526 radical polymerization reaction Methods 0.000 claims description 8
- GMRBDVHOLANMHA-UHFFFAOYSA-M sodium;4-methyl-3-oxopent-4-ene-1-sulfonate Chemical compound [Na+].CC(=C)C(=O)CCS([O-])(=O)=O GMRBDVHOLANMHA-UHFFFAOYSA-M 0.000 claims description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 6
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 claims description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 5
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 claims description 5
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 claims description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical group 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 229920000049 Carbon (fiber) Polymers 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims description 3
- 239000012298 atmosphere Substances 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- 235000011132 calcium sulphate Nutrition 0.000 claims description 3
- 239000004917 carbon fiber Substances 0.000 claims description 3
- 239000004927 clay Substances 0.000 claims description 3
- 229910052570 clay Inorganic materials 0.000 claims description 3
- 239000003365 glass fiber Substances 0.000 claims description 3
- 229910002804 graphite Inorganic materials 0.000 claims description 3
- 239000010439 graphite Substances 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 235000012239 silicon dioxide Nutrition 0.000 claims description 3
- 239000000454 talc Substances 0.000 claims description 3
- 229910052623 talc Inorganic materials 0.000 claims description 3
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 3
- 239000011787 zinc oxide Substances 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- KANDGEKYVKOLCF-UHFFFAOYSA-M sodium;5-methyl-4-oxohex-5-ene-1-sulfonate Chemical compound [Na+].CC(=C)C(=O)CCCS([O-])(=O)=O KANDGEKYVKOLCF-UHFFFAOYSA-M 0.000 claims description 2
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 claims 1
- 239000006229 carbon black Substances 0.000 claims 1
- 238000000034 method Methods 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 16
- 230000037048 polymerization activity Effects 0.000 description 15
- 230000000052 comparative effect Effects 0.000 description 12
- 238000000605 extraction Methods 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000006185 dispersion Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000002131 composite material Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 5
- 229910021641 deionized water Inorganic materials 0.000 description 5
- 238000011156 evaluation Methods 0.000 description 5
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 5
- 239000004926 polymethyl methacrylate Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000000227 grinding Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 238000012719 thermal polymerization Methods 0.000 description 4
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 3
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 238000005054 agglomeration Methods 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 229930016911 cinnamic acid Natural products 0.000 description 3
- 235000013985 cinnamic acid Nutrition 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- SZHIIIPPJJXYRY-UHFFFAOYSA-M sodium;2-methylprop-2-ene-1-sulfonate Chemical compound [Na+].CC(=C)CS([O-])(=O)=O SZHIIIPPJJXYRY-UHFFFAOYSA-M 0.000 description 3
- DIKJULDDNQFCJG-UHFFFAOYSA-M sodium;prop-2-ene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC=C DIKJULDDNQFCJG-UHFFFAOYSA-M 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- UIERETOOQGIECD-ONEGZZNKSA-N tiglic acid Chemical compound C\C=C(/C)C(O)=O UIERETOOQGIECD-ONEGZZNKSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 238000012685 gas phase polymerization Methods 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- -1 sodium 3-methacryloylpropane sulfate Chemical compound 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 238000010539 anionic addition polymerization reaction Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000012718 coordination polymerization Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940079826 hydrogen sulfite Drugs 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229920000592 inorganic polymer Polymers 0.000 description 1
- 238000012690 ionic polymerization Methods 0.000 description 1
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/44—Polymerisation in the presence of compounding ingredients, e.g. plasticisers, dyestuffs, fillers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP93781A JPS57115412A (en) | 1981-01-06 | 1981-01-06 | Production of novel polymer composition |
| JP3554981A JPS57149314A (en) | 1981-03-12 | 1981-03-12 | Production of novel polymer composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3200125A1 DE3200125A1 (de) | 1982-10-21 |
| DE3200125C2 true DE3200125C2 (cg-RX-API-DMAC10.html) | 1989-07-13 |
Family
ID=26334045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3200125A Granted DE3200125A1 (de) | 1981-01-06 | 1982-01-05 | Polymermasse |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US4435540A (cg-RX-API-DMAC10.html) |
| DE (1) | DE3200125A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2497515B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2090602B (cg-RX-API-DMAC10.html) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2090602B (en) * | 1981-01-06 | 1984-08-15 | Mitsubishi Rayon Co | Polymer composition |
| AU565936B2 (en) * | 1983-06-29 | 1987-10-01 | Toyo Soda Manufacturing Co. Ltd. | Aqueous colored polymer |
| GB8322200D0 (en) * | 1983-08-18 | 1983-09-21 | Smith & Nephew Ass | Bandages |
| US4678819A (en) * | 1984-08-30 | 1987-07-07 | Mitsubishi Rayon Co., Ltd. | Compositions for artificial marbles and process for producing artificial marbles therefrom |
| EP0212621B1 (en) * | 1985-08-29 | 1993-10-13 | Mitsubishi Rayon Co., Ltd. | Method for preparing a polymeric composition |
| FR2594125B1 (fr) * | 1986-02-10 | 1988-06-10 | Grp Tech Ingenierie | Nouveau procede de composition coulable de grande durete a base d'un complexe resines-charges greffees par voie chimique |
| US4762863A (en) * | 1987-03-30 | 1988-08-09 | Mitsubishi Rayon Co., Ltd. | Photopolymerizable dental composition containing a hexafunctional urethane methacrylate based on isocyanuric acid |
| JPS63316709A (ja) * | 1987-06-19 | 1988-12-26 | Mitsubishi Rayon Co Ltd | 光重合性歯科用組成物 |
| AU608857B2 (en) * | 1987-07-31 | 1991-04-18 | Mitsubishi Rayon Company Limited | Dental adhesive composition |
| US4997878A (en) * | 1988-12-29 | 1991-03-05 | Exxon Research And Engineering Company | Hydrophobically associating polymers containing dimethyl acrylamide functionality |
| GB8920283D0 (en) * | 1989-09-07 | 1989-10-18 | Hill Robert G Q | Self temperature limiting electro-conducting composites |
| US5268412A (en) * | 1990-11-21 | 1993-12-07 | Eastman Kodak Company | Polymer blends for aqueous dispersions having improved freeze-thaw stability |
| US5663224A (en) * | 1991-12-03 | 1997-09-02 | Rohm And Haas Company | Process for preparing an aqueous dispersion |
| WO1993011181A1 (en) * | 1991-12-03 | 1993-06-10 | Emmons William D | Process for preparing an aqueous dispersion including polymeric latex and titanium dioxide pigment |
| US6080802A (en) * | 1991-12-03 | 2000-06-27 | Rohm And Haas Company | Process for preparing an aqueous dispersion of composite particles including polymeric latex adsorbed to titanium dioxide |
| DE4405745C2 (de) * | 1994-02-23 | 1998-05-14 | Rehau Ag & Co | Thermoplaste enthaltend in-situ verkapselte Füllstoffe und deren Verwendung |
| US5587422A (en) * | 1994-05-18 | 1996-12-24 | Cornell Research Foundation, Inc. | Single phase solids containing metalloploymers |
| US5591784A (en) * | 1994-06-17 | 1997-01-07 | Three Bond Co., Ltd. | Curing of fiber-reinforced composite structures |
| US5837763A (en) * | 1995-06-07 | 1998-11-17 | Amcol International Corporation | Compositions and methods for manufacturing waxes filled with intercalates and exfoliates formed with oligomers and polymers |
| US5552469A (en) * | 1995-06-07 | 1996-09-03 | Amcol International Corporation | Intercalates and exfoliates formed with oligomers and polymers and composite materials containing same |
| US5698624A (en) * | 1995-06-07 | 1997-12-16 | Amcol International Corporation | Exfoliated layered materials and nanocomposites comprising matrix polymers and said exfoliated layered materials formed with water-insoluble oligomers and polymers |
| US5721306A (en) * | 1995-06-07 | 1998-02-24 | Amcol International Corporation | Viscous carrier compositions, including gels, formed with an organic liquid carrier and a layered material:polymer complex |
| US5578672A (en) * | 1995-06-07 | 1996-11-26 | Amcol International Corporation | Intercalates; exfoliates; process for manufacturing intercalates and exfoliates and composite materials containing same |
| US5760121A (en) * | 1995-06-07 | 1998-06-02 | Amcol International Corporation | Intercalates and exfoliates formed with oligomers and polymers and composite materials containing same |
| US5844032A (en) * | 1995-06-07 | 1998-12-01 | Amcol International Corporation | Intercalates and exfoliates formed with non-EVOH monomers, oligomers and polymers; and EVOH composite materials containing same |
| US6228903B1 (en) | 1995-06-07 | 2001-05-08 | Amcol International Corporation | Exfoliated layered materials and nanocomposites comprising said exfoliated layered materials having water-insoluble oligomers or polymers adhered thereto |
| US5849830A (en) * | 1995-06-07 | 1998-12-15 | Amcol International Corporation | Intercalates and exfoliates formed with N-alkenyl amides and/or acrylate-functional pyrrolidone and allylic monomers, oligomers and copolymers and composite materials containing same |
| US5686187A (en) * | 1995-12-14 | 1997-11-11 | Basf Corporation | Molded polyurethane SRIM articles |
| US5686526A (en) * | 1995-12-14 | 1997-11-11 | Basf Corporation | Process of making molded polyurethane articles |
| US5716439A (en) * | 1995-12-14 | 1998-02-10 | Basf Corporation | Internal mold release compositions |
| US5880197A (en) * | 1995-12-22 | 1999-03-09 | Amcol International Corporation | Intercalates and exfoliates formed with monomeric amines and amides: composite materials containing same and methods of modifying rheology therewith |
| US5830528A (en) * | 1996-05-29 | 1998-11-03 | Amcol International Corporation | Intercalates and exfoliates formed with hydroxyl-functional; polyhydroxyl-functional; and aromatic compounds; composites materials containing same and methods of modifying rheology therewith |
| US6287634B1 (en) | 1995-12-22 | 2001-09-11 | Amcol International Corporation | Intercalates and exfoliates formed with monomeric ethers and esters; composite materials containing same methods of modifying rheology therewith |
| US5804613A (en) * | 1995-12-22 | 1998-09-08 | Amcol International Corporation | Intercalates and exfoliates formed with monomeric carbonyl-functional organic compounds, including carboxylic and polycarboxylic acids; aldehydes; and ketones; composite materials containing same and methods of modifying rheology therewith |
| US5730996A (en) * | 1996-05-23 | 1998-03-24 | Amcol International Corporation | Intercalates and expoliates formed with organic pesticide compounds and compositions containing the same |
| US6251980B1 (en) | 1996-12-06 | 2001-06-26 | Amcol International Corporation | Nanocomposites formed by onium ion-intercalated clay and rigid anhydride-cured epoxy resins |
| US6124365A (en) | 1996-12-06 | 2000-09-26 | Amcol Internatioanl Corporation | Intercalates and exfoliates formed with long chain (C6+) or aromatic matrix polymer-compatible monomeric, oligomeric or polymeric intercalant compounds and composite materials containing same |
| US5952095A (en) * | 1996-12-06 | 1999-09-14 | Amcol International Corporation | Intercalates and exfoliates formed with long chain (C10 +) monomeric organic intercalant compounds; and composite materials containing same |
| US5968999A (en) * | 1997-10-28 | 1999-10-19 | Charlotte-Mecklenburg Hospital Authority | Bone cement compositions |
| US6090734A (en) * | 1998-03-18 | 2000-07-18 | Amcol International Corporation | Process for purifying clay by the hydrothermal conversion of silica impurities to a dioctahedral or trioctahedral smectite clay |
| US6235533B1 (en) | 1998-03-18 | 2001-05-22 | Amcol International Corporation | Method of determining the composition of clay deposit |
| US6050509A (en) * | 1998-03-18 | 2000-04-18 | Amcol International Corporation | Method of manufacturing polymer-grade clay for use in nanocomposites |
| US6376591B1 (en) | 1998-12-07 | 2002-04-23 | Amcol International Corporation | High barrier amorphous polyamide-clay intercalates, exfoliates, and nanocomposite and a process for preparing same |
| WO2000034375A1 (en) | 1998-12-07 | 2000-06-15 | Eastman Chemical Company | A polymer/clay nanocomposite comprising a clay mixture and a process for making same |
| US6262162B1 (en) | 1999-03-19 | 2001-07-17 | Amcol International Corporation | Layered compositions with multi-charged onium ions as exchange cations, and their application to prepare monomer, oligomer, and polymer intercalates and nanocomposites prepared with the layered compositions of the intercalates |
| US6225394B1 (en) | 1999-06-01 | 2001-05-01 | Amcol International Corporation | Intercalates formed by co-intercalation of onium ion spacing/coupling agents and monomer, oligomer or polymer ethylene vinyl alcohol (EVOH) intercalants and nanocomposites prepared with the intercalates |
| US6407155B1 (en) | 2000-03-01 | 2002-06-18 | Amcol International Corporation | Intercalates formed via coupling agent-reaction and onium ion-intercalation pre-treatment of layered material for polymer intercalation |
| US6462122B1 (en) | 2000-03-01 | 2002-10-08 | Amcol International Corporation | Intercalates formed with polypropylene/maleic anhydride-modified polypropylene intercalants |
| US6632868B2 (en) | 2000-03-01 | 2003-10-14 | Amcol International Corporation | Intercalates formed with polypropylene/maleic anhydride-modified polypropylene intercalants |
| US6828370B2 (en) * | 2000-05-30 | 2004-12-07 | Amcol International Corporation | Intercalates and exfoliates thereof having an improved level of extractable material |
| US6737464B1 (en) | 2000-05-30 | 2004-05-18 | University Of South Carolina Research Foundation | Polymer nanocomposite comprising a matrix polymer and a layered clay material having a low quartz content |
| GB2401045B (en) * | 2004-01-14 | 2005-03-09 | Nargis Abdul Gani | To investigate the potential of using beetle odours to deter slugs in vining peas |
| TWI818054B (zh) * | 2018-08-31 | 2023-10-11 | 美商陶氏全球科技有限責任公司 | 具有氣味控制組分之纖維 |
Family Cites Families (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3265644A (en) * | 1963-02-18 | 1966-08-09 | Nat Lead Co | Particle-polymer compositions and process for making same |
| DE1720988B1 (de) * | 1966-08-18 | 1972-05-31 | Japan Gas Chemical Company Inc | Verfahren zur herstellung einer russ-kunstharz-masse |
| FR1545604A (fr) * | 1967-06-05 | 1968-11-15 | Monsanto Co | Procédé de polymérisation de résines acryliques coulées |
| US3536785A (en) * | 1967-08-02 | 1970-10-27 | Atlantic Richfield Co | Colloidal silica as a suspending agent in styrene polymerization |
| US3997708A (en) * | 1969-01-10 | 1976-12-14 | Phillips Petroleum Company | Organocalcium pyridine-type polymerization initiators |
| DE1939544A1 (de) * | 1969-08-04 | 1971-03-04 | Akad Wissenschaften Ddr | Verfahren zur Oberflaechenmodifizierung anorganischer Fuellstoffe fuer Thermoplaste |
| US3897586A (en) * | 1970-08-05 | 1975-07-29 | Du Pont | Polymer coated pigment particles and a process for their preparation |
| GB1421529A (en) * | 1971-09-29 | 1976-01-21 | Rothmans International Ltd | Polymers |
| JPS4888184A (cg-RX-API-DMAC10.html) * | 1972-02-24 | 1973-11-19 | ||
| JPS5146552B2 (cg-RX-API-DMAC10.html) * | 1972-12-04 | 1976-12-09 | ||
| US4130512A (en) | 1973-01-10 | 1978-12-19 | National Research Development Corporation | Ion exchange materials |
| CH588521A5 (en) * | 1973-03-07 | 1977-06-15 | Asahi Chemical Ind | Tough thermoplastic materials - contg. thermoplastic polymers and reaction prods. of inorganic cpds. and unsaturated carboxylic acids |
| US3884871A (en) | 1973-06-29 | 1975-05-20 | Nl Industries Inc | Process for coating pigment particles with organic polymers |
| US4048136A (en) | 1973-07-07 | 1977-09-13 | Mitsui Toatsu Kagaku Kabushiki Kaisha (Mitsui Toatsu Chem., Inc.) | Metallic tone powder coating composition |
| US3946139A (en) | 1974-01-17 | 1976-03-23 | W. R. Grace & Co. | Vinylidene chloride copolymer latexes |
| US3970234A (en) * | 1974-08-23 | 1976-07-20 | Pace, Incorporated | Vacuum desoldering device for soldering irons |
| GB1510645A (en) | 1974-12-11 | 1978-05-10 | Ciba Geigy Ag | Making shaped articles from particulate material and an anaerobic adhesive |
| US4015991A (en) | 1975-08-08 | 1977-04-05 | Calgon Corporation | Low fluid loss cementing compositions containing hydrolyzed acrylamide/2-acrylamido-2-methylpropane sulfonic acid derivative copolymers and their use |
| JPS5231912A (en) * | 1975-09-05 | 1977-03-10 | Nippon Steel Corp | Removing method of skidmark at metal piece heating |
| US4184030A (en) * | 1975-09-22 | 1980-01-15 | E. I. Du Pont De Nemours And Company | Process and composition for polymerizing and curing methyl methacrylate monomer-polymer syrups in the presence of metal salts of hemi-peresters of maleic acid |
| US4060511A (en) | 1976-01-07 | 1977-11-29 | The Goodyear Tire & Rubber Company | Pigmented, particulate powder coating composition |
| US4147681A (en) | 1976-02-24 | 1979-04-03 | Calgon Corporation | Stable, self-inverting water-in-oil emulsions |
| US4089883A (en) * | 1976-07-09 | 1978-05-16 | Blount David H | Process for the production of organic hydroxy silicate compounds and their condensation products |
| US4194920A (en) | 1976-08-06 | 1980-03-25 | Marion Darrah | Intrachromoleucospheruloid pigment compositions and processes for producing same |
| US4102856A (en) | 1977-02-15 | 1978-07-25 | Lee Pharmaceuticals | Dental restorative compositions and process of using them |
| DE2927249A1 (de) * | 1978-07-07 | 1980-01-17 | Sinloihi Co Ltd | Feine kugelfoermige polymerteilchen mit einem gehalt an einem anorganischen pigment und/oder einem schwarzen faerbungsmittel, sowie verfahren zu deren herstellung |
| DE2917272A1 (de) * | 1979-04-27 | 1980-11-06 | Bayer Ag | Verfahren zur loesungsmittelfreien herstellung von hydrophilen fuellstoffpulvern |
| US4230810A (en) | 1979-05-07 | 1980-10-28 | The Goodyear Tire & Rubber Company | Method of preparing resin |
| US4292419A (en) * | 1979-05-15 | 1981-09-29 | Mitsubishi Rayon Co., Ltd. | Process for producing radiation-shielding plastic materials |
| DE2941978A1 (de) * | 1979-10-17 | 1981-04-30 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von pulverfoermigen polymerisaten |
| GB2090602B (en) * | 1981-01-06 | 1984-08-15 | Mitsubishi Rayon Co | Polymer composition |
-
1981
- 1981-12-23 GB GB8138848A patent/GB2090602B/en not_active Expired
- 1981-12-31 US US06/336,460 patent/US4435540A/en not_active Expired - Lifetime
-
1982
- 1982-01-05 FR FR8200063A patent/FR2497515B1/fr not_active Expired
- 1982-01-05 DE DE3200125A patent/DE3200125A1/de active Granted
-
1984
- 1984-08-14 US US06/640,252 patent/US4546145A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4435540A (en) | 1984-03-06 |
| FR2497515B1 (fr) | 1986-11-14 |
| GB2090602B (en) | 1984-08-15 |
| GB2090602A (en) | 1982-07-14 |
| US4546145A (en) | 1985-10-08 |
| FR2497515A1 (fr) | 1982-07-09 |
| DE3200125A1 (de) | 1982-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3200125C2 (cg-RX-API-DMAC10.html) | ||
| DE1911882C3 (cg-RX-API-DMAC10.html) | ||
| EP0009179B1 (de) | Verfahren zur Herstellung leicht dispergierbarer Titandioxidpigmente | |
| DE3300526C2 (cg-RX-API-DMAC10.html) | ||
| EP0245647A1 (de) | Polymethacrylat-Formmasse mit hoher Wärmeformbeständigkeit und hoher thermischer Stabilität | |
| EP0033365A1 (de) | Verfahren zur Herstellung schlagzäher Formmassen | |
| DE2249023A1 (de) | Vinylchloridharzmassen und verfahren zu ihrer herstellung | |
| DE69408306T2 (de) | Latex für lacke ohne lösungsmittel mit verbesserter auswaschbarkeit | |
| DE3348126C2 (cg-RX-API-DMAC10.html) | ||
| DE69214578T2 (de) | Verfahren zur Herstellung eines Toner-Harzes | |
| DE2416988A1 (de) | Verfahren zur herstellung von vinylchloridharzmassen | |
| DE3128370A1 (de) | Verfahren zur herstellung von copolymeren einer aromatischen vinylverbindung und solche copolymere enthaltende harzmassen | |
| DE951300C (de) | Verfahren zur Herstellung einer gut faerbbaren Acrylnitrilkunststoffmasse | |
| EP3356423B1 (de) | Verfahren zur herstellung von acrylatkautschuk bei reduzierter emulgatorkonzentration | |
| DE2307270C3 (de) | Polyvinylchlorid enthaltende thermoplastische Massen | |
| DE2435513A1 (de) | Herstellung von mit polymeren gepfropften anorganischen pigmenten oder fuellstoffen und deren verwendung | |
| DE947024C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| DE2021398A1 (de) | Verfahren zur Koagulation von Pfropfpolymer-Latices | |
| DE69034072T2 (de) | Flammhemmende Zusammensetzungen | |
| DE1520969A1 (de) | Verfahren zur Herstellung harzartiger Copolymerisationsprodukte aus ungesaettigten Nitrilen | |
| DE2748565A1 (de) | Schlagfeste harzmasse | |
| EP1049737A1 (de) | Verfahren zum fällen von mikrosuspensionspolymerisaten | |
| DE3689160T2 (de) | Verfahren zur Herstellung einer Polymerzusammensetzung. | |
| DE948642C (de) | Verfahren zur Herstellung von Mischpolymerisaten auf Grundlage von Vinylidencyanid | |
| DE1082734B (de) | Verfahren zur Herstellung von schlagfestem Polyvinylchlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OR8 | Request for search as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8105 | Search report available | ||
| 8105 | Search report available | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |