DE3100972C2 - - Google Patents
Info
- Publication number
- DE3100972C2 DE3100972C2 DE3100972A DE3100972A DE3100972C2 DE 3100972 C2 DE3100972 C2 DE 3100972C2 DE 3100972 A DE3100972 A DE 3100972A DE 3100972 A DE3100972 A DE 3100972A DE 3100972 C2 DE3100972 C2 DE 3100972C2
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- alkyl
- compound
- product
- aluminum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 106
- 239000003054 catalyst Substances 0.000 claims description 97
- 239000000377 silicon dioxide Substances 0.000 claims description 51
- -1 aryl aluminum compound Chemical class 0.000 claims description 32
- 235000012239 silicon dioxide Nutrition 0.000 claims description 29
- 238000006116 polymerization reaction Methods 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 27
- 239000000047 product Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 20
- 239000010936 titanium Substances 0.000 claims description 20
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 19
- 239000005977 Ethylene Substances 0.000 claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 17
- 239000003426 co-catalyst Substances 0.000 claims description 15
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 15
- 229910052719 titanium Inorganic materials 0.000 claims description 14
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 13
- 150000002902 organometallic compounds Chemical class 0.000 claims description 13
- 150000004820 halides Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 229910052782 aluminium Inorganic materials 0.000 claims description 10
- 150000004703 alkoxides Chemical class 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229910052749 magnesium Inorganic materials 0.000 claims description 8
- 239000011777 magnesium Substances 0.000 claims description 8
- 230000008569 process Effects 0.000 claims description 8
- 238000007334 copolymerization reaction Methods 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- 125000005234 alkyl aluminium group Chemical group 0.000 claims description 6
- 150000005840 aryl radicals Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 238000010926 purge Methods 0.000 claims description 6
- 229910052720 vanadium Inorganic materials 0.000 claims description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 5
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 150000002430 hydrocarbons Chemical group 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- 239000011949 solid catalyst Substances 0.000 claims description 4
- 229910052726 zirconium Inorganic materials 0.000 claims description 4
- 101100058670 Aeromonas hydrophila subsp. hydrophila (strain ATCC 7966 / DSM 30187 / BCRC 13018 / CCUG 14551 / JCM 1027 / KCTC 2358 / NCIMB 9240 / NCTC 8049) bsr gene Proteins 0.000 claims description 3
- HPYIUKIBUJFXII-UHFFFAOYSA-N Cyclopentadienyl radical Chemical group [CH]1C=CC=C1 HPYIUKIBUJFXII-UHFFFAOYSA-N 0.000 claims description 3
- 239000006227 byproduct Substances 0.000 claims description 3
- 150000002736 metal compounds Chemical class 0.000 claims description 3
- 150000003377 silicon compounds Chemical class 0.000 claims description 3
- 239000002352 surface water Substances 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 31
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 30
- 238000002474 experimental method Methods 0.000 description 20
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 18
- 230000009257 reactivity Effects 0.000 description 18
- 229920000642 polymer Polymers 0.000 description 17
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 239000000243 solution Substances 0.000 description 13
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 13
- 230000000052 comparative effect Effects 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 229910000077 silane Inorganic materials 0.000 description 7
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 6
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- WVMSIBFANXCZKT-UHFFFAOYSA-N triethyl(hydroxy)silane Chemical compound CC[Si](O)(CC)CC WVMSIBFANXCZKT-UHFFFAOYSA-N 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 239000001282 iso-butane Substances 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 150000002901 organomagnesium compounds Chemical class 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 3
- 229910003074 TiCl4 Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- KJJBSBKRXUVBMX-UHFFFAOYSA-N magnesium;butane Chemical compound [Mg+2].CCC[CH2-].CCC[CH2-] KJJBSBKRXUVBMX-UHFFFAOYSA-N 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 3
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 2
- RSIHJDGMBDPTIM-UHFFFAOYSA-N ethoxy(trimethyl)silane Chemical compound CCO[Si](C)(C)C RSIHJDGMBDPTIM-UHFFFAOYSA-N 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 2
- 150000003609 titanium compounds Chemical class 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- NMTZQIYQFZGXQT-UHFFFAOYSA-N C[C]=C Chemical compound C[C]=C NMTZQIYQFZGXQT-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- RTQCAYKHUMWCEM-UHFFFAOYSA-N [Mg].ClO Chemical compound [Mg].ClO RTQCAYKHUMWCEM-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000009750 centrifugal casting Methods 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- HJXBDPDUCXORKZ-UHFFFAOYSA-N diethylalumane Chemical compound CC[AlH]CC HJXBDPDUCXORKZ-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000007725 thermal activation Methods 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical compound CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WCWWRDANFBTPCH-UHFFFAOYSA-N tris(2-methylpentyl)alumane Chemical compound CCCC(C)C[Al](CC(C)CCC)CC(C)CCC WCWWRDANFBTPCH-UHFFFAOYSA-N 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/112,560 US4530913A (en) | 1980-01-16 | 1980-01-16 | Polymerization catalyst and method |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3100972A1 DE3100972A1 (de) | 1982-03-18 |
| DE3100972C2 true DE3100972C2 (enExample) | 1991-06-06 |
Family
ID=22344583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3100972A Granted DE3100972A1 (de) | 1980-01-16 | 1981-01-14 | Mehrkomponenten-katalysatoren und deren herstellung und verwendung zur polymerisation und copolymerisation von 1-olefinen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4530913A (enExample) |
| JP (1) | JPS5920681B2 (enExample) |
| BE (1) | BE886427A (enExample) |
| CA (1) | CA1141365A (enExample) |
| DE (1) | DE3100972A1 (enExample) |
| FR (1) | FR2473527B1 (enExample) |
| GB (1) | GB2068007B (enExample) |
| IT (1) | IT1174318B (enExample) |
| SE (1) | SE449866B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4530912A (en) * | 1981-06-04 | 1985-07-23 | Chemplex Company | Polymerization catalyst and method |
| US4374753A (en) * | 1981-07-29 | 1983-02-22 | Chemplex Company | Polymerization catalyst and method |
| US4499198A (en) * | 1982-10-07 | 1985-02-12 | Chemplex Company | Polymerization catalysts and methods |
| JPS59182805A (ja) * | 1983-03-29 | 1984-10-17 | Nippon Oil Co Ltd | ポリオレフインの製造方法 |
| US4524141A (en) * | 1983-04-21 | 1985-06-18 | Chemplex Company | Polymerization catalysts and methods |
| US4567243A (en) * | 1983-04-21 | 1986-01-28 | Chemplex Company | Polymerization method |
| US4508843A (en) * | 1983-08-08 | 1985-04-02 | Exxon Research & Engineering Co. | Supported polyolefin catalyst for the polymerization of ethylene under high temperatures |
| US4490514A (en) * | 1983-08-16 | 1984-12-25 | Chemplex Company | High-temperature ethylene polymerization and copolymerization using dialuminoxane cocatalysts |
| US4754007A (en) * | 1985-03-08 | 1988-06-28 | Enron Chemical Company | Copolymerization of ethylene |
| JPH0721018B2 (ja) * | 1985-07-05 | 1995-03-08 | 東燃料株式会社 | オレフイン重合用触媒成分の製造方法 |
| DE3538576A1 (de) * | 1985-10-30 | 1987-05-07 | Basf Ag | Verfahren zum herstellen von homo- und copolymerisaten des ethylens mittels eines ziegler-katalysatorsystems |
| US5034365A (en) * | 1990-05-09 | 1991-07-23 | Quantum Chemical Corporation | Silica supported polymerization catalyst |
| US5275991A (en) * | 1987-09-21 | 1994-01-04 | Quantum Chemical Corporation | Supported high activity polyolefin catalyst component with regular distribution of magnesium values provided utilizing a controlled drying protocol |
| US5098969A (en) * | 1987-09-21 | 1992-03-24 | Quantum Chemical Corporation | Propylene polymerization using modified silica based catalyst |
| US5221650A (en) * | 1987-09-21 | 1993-06-22 | Quantum Chemical Corporation | Supported high activity polypropylene catalyst component with regular distribution of magnesium values provided utilizing a controlled drying protocol |
| US5143883A (en) * | 1987-09-21 | 1992-09-01 | Quantum Chemical Corporation | Modified silica based catalyst |
| US5145821A (en) * | 1990-05-09 | 1992-09-08 | Quantum Chemical Corporation | Silica supported polymerization catalyst system |
| US4831000A (en) * | 1988-01-15 | 1989-05-16 | Mobil Oil Corporatiion | Catalyst composition for preparing high density or linear low density olefin polymers of controlled molecular weight distribution |
| US5006618A (en) * | 1988-01-15 | 1991-04-09 | Mobil Oil Corporation | Process for preparing high density or medium density polymers |
| US5075271A (en) * | 1988-01-15 | 1991-12-24 | Mobil Oil Corporation | Olefin polymerization process for preparing high density or linear low density polymers of controlled molecular weight distribution |
| US4972033A (en) * | 1988-01-15 | 1990-11-20 | Mobil Oil Corporation | Olefin polymerization process for preparing high density or linear low density polymers of controlled molecular weight distribution |
| US4912074A (en) * | 1988-01-15 | 1990-03-27 | Mobil Oil Corporation | Catalyst composition for preparing high density or medium density olefin polymers |
| US4968653A (en) * | 1989-06-30 | 1990-11-06 | Quantum Chemical Corporation | Propylene polymerization catalyst |
| US5036147A (en) * | 1989-06-30 | 1991-07-30 | Quantum Chemical Corporation | Propylene polymerization method |
| JP2518298Y2 (ja) * | 1989-11-13 | 1996-11-27 | 三菱農機株式会社 | トラクターにおけるボンネット内部配置構造 |
| FI89066C (fi) * | 1989-11-20 | 1993-08-10 | Neste Oy | Foerfarande foer framstaellning av en polymeriseringskatalytkomponent foer olefiner, en polymeriseringskatalytkomponent framstaelld med foerfarandet och dess bruk |
| FI91968C (fi) * | 1989-11-28 | 1994-09-12 | Borealis Polymers Oy | -olefiinien polymerointiin tarkoitettu prokatalyyttikompositio, sen valmistus ja käyttö |
| FI85981C (fi) * | 1989-12-28 | 1992-06-25 | Neste Oy | Foerfarande foer framstaellning av en prokatalytkomposition avsedd foer polymerisering av olefiner samt anvaendning av kompositionen. |
| US5037789A (en) * | 1990-03-23 | 1991-08-06 | Quantum Chemical Corporation | Non-supported catalyst |
| US5232998A (en) * | 1990-05-09 | 1993-08-03 | Quantum Chemical Corporation | Olefin polymerization using silica supported catalyst |
| US6291384B1 (en) | 1991-11-06 | 2001-09-18 | Mobil Oil Corporation | High activity catalyst prepared with alkoxysilanes |
| US5939348A (en) * | 1991-11-06 | 1999-08-17 | Mobil Oil Corporation | Catalyst for the manufacture of polythylene with a narrow molecular weight distribution |
| US5470812A (en) * | 1991-11-06 | 1995-11-28 | Mobil Oil Corporation | High activity polyethylene catalysts prepared with alkoxysilane reagents |
| US5198399A (en) * | 1992-01-17 | 1993-03-30 | Quantum Chemical Corporation | Polymerization catalyst and method |
| US5344803A (en) * | 1993-01-29 | 1994-09-06 | Quantum Chemical Corporation | Cocatalyst for transition metal-containing α-olefin polymerization catalyst |
| US5334567A (en) * | 1993-01-29 | 1994-08-02 | Quantum Chemical Corporation | Cocatalyst for vanadium-containing ethylene polymerization catalyst |
| US5346872A (en) * | 1993-01-29 | 1994-09-13 | Quantum Chemical Corporation | Cocatalyst for vanadium/titanium containing polymerization catalyst |
| US5424263A (en) * | 1993-04-23 | 1995-06-13 | Quantum Chemical Corporation | Supported polymerization catalyst |
| US5422386A (en) * | 1993-08-30 | 1995-06-06 | Quantum Chemical Corporation | Process to simultaneously reactor-fill polyolefins and compatibilize fillers with polyolefins |
| US5412025A (en) * | 1993-08-30 | 1995-05-02 | Quantum Chemical Corporation | Method to reactor-fill polyolefins by employing a sticky prepolymer as a blending and compatibilizing agent |
| US5412001A (en) * | 1993-08-30 | 1995-05-02 | Quantum Chemical Corporation | Method to reactor-fill polyolefins by formation of a dual catalyst system causing compatibilization of the filler with the maxtrix polymer |
| DE69415829T2 (de) * | 1993-11-18 | 1999-05-20 | Mobil Oil Corp., Fairfax, Va. | Katalysatorzusammensetzung für die copolymerisation von ethylen |
| US6395669B1 (en) | 1996-01-18 | 2002-05-28 | Equistar Chemicals, Lp | Catalyst component and system |
| US6004024A (en) | 1997-11-14 | 1999-12-21 | Calgon Corporation | Emulsion feed assembly |
| US6030660A (en) * | 1997-12-19 | 2000-02-29 | General Electric Company | Method of steam stripping an inorganic powder |
| US6171993B1 (en) | 1998-12-04 | 2001-01-09 | Equistar Chemicals, Lp | Enhanced-impact LLDPE with a shear modifiable network structure |
| US6323148B1 (en) | 1998-12-04 | 2001-11-27 | Equistar Chemicals, Lp | Ethylene polymerization catalyst and catalyst system |
| CN1137141C (zh) * | 1999-01-12 | 2004-02-04 | 阿克佐诺贝尔公司 | 含水过氧化物乳液 |
| US6211311B1 (en) | 1999-05-25 | 2001-04-03 | Equistar Chemicals, L.P. | Supported olefin polymerization catalysts |
| US6294626B1 (en) | 1999-11-15 | 2001-09-25 | Equistar Chemicals, Lp | Olefin polymerization catalysts containing modified boraaryl ligands |
| US6476165B1 (en) | 2000-03-08 | 2002-11-05 | Equistar Chemicals, Lp | Olefin polymerization process using fatty amine additives and boron-modified supported catalyst |
| US6583242B2 (en) | 2001-08-02 | 2003-06-24 | Equistar Chemicals, Lp | Supported olefin polymerization catalysts |
| US6765074B2 (en) | 2002-09-27 | 2004-07-20 | Equistar Chemicals, Lp | Olefin polymerization process |
| EP1847555A1 (en) * | 2006-04-18 | 2007-10-24 | Borealis Technology Oy | Multi-branched Polypropylene |
| US7618913B2 (en) * | 2006-08-31 | 2009-11-17 | Formosa Plastics Corporation, U.S.A. | Highly active alpha-olefin copolymerization catalyst system |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2082153A5 (fr) * | 1970-03-05 | 1971-12-10 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| US3775391A (en) * | 1971-08-04 | 1973-11-27 | Ici Ltd | Vinyl polymerisation |
| US3943067A (en) * | 1972-05-15 | 1976-03-09 | Institut Francais Du Petrole | Process for manufacturing hydrogenation catalysts |
| DE2621591C2 (de) * | 1975-05-14 | 1986-03-13 | Nissan Chemical Industries, Ltd., Tokio/Tokyo | Verfahren zur Polymerisation von Äthylen |
| DE2742585A1 (de) * | 1976-09-28 | 1978-03-30 | Asahi Chemical Ind | Neue polymerisationskatalysatoren und ihre verwendung (i) |
| NL7702323A (nl) * | 1977-03-04 | 1978-09-06 | Stamicarbon | Katalysator voor de bereiding van polyalkenen. |
| DE2721058C2 (de) * | 1977-05-11 | 1983-08-25 | Basf Ag, 6700 Ludwigshafen | Verfahren zum Herstellen von Homo- und Copolymerisaten von C↓2↓- bis C↓6↓-α-Monoolefinen |
| US4301029A (en) * | 1979-01-10 | 1981-11-17 | Imperial Chemical Industries Limited | Olefin polymerization catalyst and the production and use thereof |
| EP0032309A3 (en) * | 1980-01-10 | 1981-08-05 | Imperial Chemical Industries Plc | Production of catalyst component, catalyst and use thereof |
-
1980
- 1980-01-16 US US06/112,560 patent/US4530913A/en not_active Expired - Lifetime
- 1980-10-08 CA CA000361820A patent/CA1141365A/en not_active Expired
- 1980-10-24 GB GB8034417A patent/GB2068007B/en not_active Expired
- 1980-11-06 IT IT50093/80A patent/IT1174318B/it active
- 1980-12-01 BE BE0/202995A patent/BE886427A/fr not_active IP Right Cessation
- 1980-12-02 FR FR8025552A patent/FR2473527B1/fr not_active Expired
-
1981
- 1981-01-07 SE SE8100046A patent/SE449866B/sv not_active IP Right Cessation
- 1981-01-14 DE DE3100972A patent/DE3100972A1/de active Granted
- 1981-01-14 JP JP56003307A patent/JPS5920681B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56104911A (en) | 1981-08-21 |
| IT1174318B (it) | 1987-07-01 |
| GB2068007B (en) | 1983-06-22 |
| SE449866B (sv) | 1987-05-25 |
| FR2473527A1 (fr) | 1981-07-17 |
| JPS5920681B2 (ja) | 1984-05-15 |
| IT8050093A0 (it) | 1980-11-06 |
| DE3100972A1 (de) | 1982-03-18 |
| BE886427A (fr) | 1981-04-01 |
| CA1141365A (en) | 1983-02-15 |
| SE8100046L (sv) | 1981-07-17 |
| GB2068007A (en) | 1981-08-05 |
| FR2473527B1 (fr) | 1985-11-15 |
| US4530913A (en) | 1985-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3100972C2 (enExample) | ||
| DE3213633C2 (enExample) | ||
| EP0069951B1 (de) | Verfahren zur Herstellung von Polyolefinen | |
| DE3028759C2 (enExample) | ||
| DE3751176T2 (de) | Katalysatorzusammensetzung für Olefinpolymerisation. | |
| DE2802517C2 (enExample) | ||
| DE69331098T2 (de) | Verfahren zur herstellung eines geträgerten metallocenkatalysatorsystems | |
| DE3206303C2 (de) | Feste titanhaltige Katalysatorkomponenten, deren Herstellung und deren Verwendung in Kombination mit einem Aktivator als Katalysatorsystem für die Polymerisation von Äthylen und dessen Copolymerisation mit α-Olefinen mit 3 bis 8 Kohlenstoffatomen | |
| DE2324766C2 (de) | Verfahren zur Niederdruckpolymerisation von α-Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE69125906T2 (de) | Olefinpolymerisation | |
| DE3228065A1 (de) | Feste olefin-polymerisations- und copolymerisations-katalysatorsysteme, deren herstellung und mit ihnen durchgefuehrte polymerisationsverfahren | |
| DE3784173T2 (de) | Olefinpolymerisationskatalysator. | |
| DE1420364A1 (de) | Verfahren zur Herstellung fester kristalliner Polymerisate aus Olefinen | |
| DE3328061C2 (enExample) | ||
| DE2757725A1 (de) | Verfahren zur herstellung von verbesserten aethylenpolymeren | |
| DE2111455A1 (de) | Verfahren zur Herstellung von Polyolefinen | |
| DE2504597A1 (de) | Katalysatorsystem zur polymerisation von olefinen, verfahren zu seiner herstellung und seine verwendung | |
| EP0401776B1 (de) | Verfahren zur Herstellung eines poly-1-olefins | |
| DE3889001T2 (de) | Verbesserte Chromkatalysatorzusammensetzungen. | |
| DE2901393C2 (enExample) | ||
| DE3003327C2 (enExample) | ||
| EP0010814A1 (de) | Verfahren zur Herstellung von pulverförmigen, thermoplastischen Copolymeren aus Äthylen und Buten-(1) | |
| DE2640679C2 (enExample) | ||
| DE2128046C3 (de) | Verfahren zur Herstellung von Äthylenpolymerisaten | |
| DE3538099A1 (de) | Verfahren zur homo- und mischpolymerisation von olefinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: C08F 10/00 |
|
| 8126 | Change of the secondary classification |
Ipc: C08F 4/64 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |