DE3020689C2 - - Google Patents
Info
- Publication number
- DE3020689C2 DE3020689C2 DE3020689A DE3020689A DE3020689C2 DE 3020689 C2 DE3020689 C2 DE 3020689C2 DE 3020689 A DE3020689 A DE 3020689A DE 3020689 A DE3020689 A DE 3020689A DE 3020689 C2 DE3020689 C2 DE 3020689C2
- Authority
- DE
- Germany
- Prior art keywords
- water
- cellulose
- ether
- soluble
- modified
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920003086 cellulose ether Polymers 0.000 claims description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 19
- -1 hydroxypropyl residues Chemical group 0.000 claims description 19
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 5
- 238000006116 polymerization reaction Methods 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 239000004094 surface-active agent Substances 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 11
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 150000002430 hydrocarbons Chemical class 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 230000004048 modification Effects 0.000 description 6
- 238000012986 modification Methods 0.000 description 6
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- 235000021395 porridge Nutrition 0.000 description 4
- 239000002453 shampoo Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 150000002118 epoxides Chemical class 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 3
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 3
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000013772 propylene glycol Nutrition 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229960000776 sodium tetradecyl sulfate Drugs 0.000 description 3
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- 229920000896 Ethulose Polymers 0.000 description 2
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical class OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920003091 Methocel™ Polymers 0.000 description 2
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 238000009739 binding Methods 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- ZZNDQCACFUJAKJ-UHFFFAOYSA-N 1-phenyltridecan-1-one Chemical compound CCCCCCCCCCCCC(=O)C1=CC=CC=C1 ZZNDQCACFUJAKJ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 206010015946 Eye irritation Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- JZKFHQMONDVVNF-UHFFFAOYSA-N dodecyl sulfate;tris(2-hydroxyethyl)azanium Chemical compound OCCN(CCO)CCO.CCCCCCCCCCCCOS(O)(=O)=O JZKFHQMONDVVNF-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 231100000013 eye irritation Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000007613 slurry method Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08B—POLYSACCHARIDES; DERIVATIVES THEREOF
- C08B11/00—Preparation of cellulose ethers
- C08B11/193—Mixed ethers, i.e. ethers with two or more different etherifying groups
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/045,819 US4243802A (en) | 1979-06-06 | 1979-06-06 | Surfactant-soluble cellulose derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3020689A1 DE3020689A1 (de) | 1981-01-22 |
| DE3020689C2 true DE3020689C2 (enExample) | 1991-07-11 |
Family
ID=21940046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803020689 Granted DE3020689A1 (de) | 1979-06-06 | 1980-05-30 | Celluloseaether |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4243802A (enExample) |
| JP (1) | JPS56801A (enExample) |
| CA (1) | CA1137080A (enExample) |
| DE (1) | DE3020689A1 (enExample) |
| GB (1) | GB2053225B (enExample) |
| NL (1) | NL190121C (enExample) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529523A (en) * | 1982-06-08 | 1985-07-16 | Hercules Incorporated | Hydrophobically modified polymers |
| US4458068A (en) * | 1983-03-25 | 1984-07-03 | The Dow Chemical Company | Water-soluble, ternary cellulose ethers |
| US4663159A (en) * | 1985-02-01 | 1987-05-05 | Union Carbide Corporation | Hydrophobe substituted, water-soluble cationic polysaccharides |
| US4683004A (en) * | 1985-08-20 | 1987-07-28 | Union Carbide Corporation | Foamable compositions and processes for use thereof |
| US4939192A (en) * | 1987-06-17 | 1990-07-03 | Aqualon Company | Building composition containing 3-alkoxy-2-hydroxypropylhydroxyethyl cellulose |
| US4845207A (en) * | 1987-06-17 | 1989-07-04 | Aqualon Company | 3-alkoxy-2-hydroxypropylhydroxyethylcellulose and building composition containing the same |
| US4826970A (en) * | 1987-09-17 | 1989-05-02 | Hercules Incorporated | Carboxymethyl hydrophobically modified hydroxyethylcellulose |
| US4892589A (en) * | 1987-10-30 | 1990-01-09 | Aqualon Company | Composition comprising water-soluble, nonionic hydrophobically modified hydroxyethyl cellulose and water-soluble, nonionic hydroxyethyl cellulose |
| ATE108190T1 (de) | 1989-01-31 | 1994-07-15 | Union Carbide Chem Plastic | Polysaccharide mit alkaryl- oder aralkyl- hydrophoben und latexzusammensetzungen, die die polysaccharide enthalten. |
| SE463313B (sv) * | 1989-03-10 | 1990-11-05 | Berol Nobel Stenungssund Ab | Vattenloesliga, nonjoniska cellulosaetrar och deras anvaendning i maalarfaerger |
| US5062969A (en) * | 1989-05-22 | 1991-11-05 | Halliburton Company | Crosslinkable interpolymers |
| US5106609A (en) * | 1990-05-01 | 1992-04-21 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5100658A (en) * | 1989-08-07 | 1992-03-31 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5104646A (en) * | 1989-08-07 | 1992-04-14 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5093142A (en) * | 1989-09-19 | 1992-03-03 | Nabisco Brands, Inc. | Alcohol amine esters as low calorie fat mimetics |
| US5124445A (en) * | 1989-10-30 | 1992-06-23 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US5120838A (en) * | 1989-10-30 | 1992-06-09 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US4994112A (en) * | 1989-10-30 | 1991-02-19 | Aqualon Company | Hydrophobically modified cellulosic thickeners for paper coating |
| US5100657A (en) * | 1990-05-01 | 1992-03-31 | The Procter & Gamble Company | Clean conditioning compositions for hair |
| US5512091A (en) * | 1990-08-13 | 1996-04-30 | Steiner; Carol A. | Associative polymer hydrogels |
| BR9205780A (pt) * | 1991-03-19 | 1994-06-28 | Procter & Gamble | Composições cosméticas contendo polímero não iônico hidrofobicamente modificado e tensoativo de amônio quaternário insaturado |
| US5807543A (en) * | 1993-08-27 | 1998-09-15 | The Procter & Gamble Co. | Cosmetic compositions containing hydrophobically modified nonionic polymer and unsaturated quaternary ammonium surfactant |
| ES2090655T3 (es) | 1991-06-07 | 1996-10-16 | Procter & Gamble | Agentes y composiciones para el modelado del cabello que contienen polimeros hidrofobos para el modelado del cabello. |
| US5277899A (en) * | 1991-10-15 | 1994-01-11 | The Procter & Gamble Company | Hair setting composition with combination of cationic conditioners |
| JPH08508538A (ja) * | 1993-04-15 | 1996-09-10 | アクゾ ノーベル ナムローゼ フェンノートシャップ | アミド変性されたカルボキシル含有多糖類を作る方法およびそのようにして得られる脂肪族アミド変性した多糖類 |
| EP0799292A4 (en) * | 1994-12-03 | 2000-03-08 | Procter & Gamble | CLEANING COMPOSITIONS |
| GB9424476D0 (en) * | 1994-12-03 | 1995-01-18 | Procter & Gamble | Cleansing compositions |
| US5612397A (en) * | 1994-12-19 | 1997-03-18 | Rohm And Haas Company | Composition having wet state clarity |
| US5504123A (en) * | 1994-12-20 | 1996-04-02 | Union Carbide Chemicals & Plastics Technology Corporation | Dual functional cellulosic additives for latex compositions |
| US6068697A (en) * | 1996-11-27 | 2000-05-30 | Kao Corporation | Polysaccharide derivatives and hydraulic compositions |
| US6093217A (en) | 1997-02-05 | 2000-07-25 | Akzo Nobel N.V. | Sizing of paper |
| US5804166A (en) * | 1997-05-09 | 1998-09-08 | Hercules Incorporated | Low VOC hair sprays containing cellulose ethers |
| BR9810004A (pt) | 1997-06-13 | 2000-08-01 | Akzo Nobel Nv | éter de celulose aniÈnica hidrofobicamente modificada, e, uso do mesmo |
| SE514347C2 (sv) * | 1998-08-06 | 2001-02-12 | Akzo Nobel Nv | Nonjonisk cellulosaeter och dess användning som förtjockningsmedel i färgkompositioner |
| US6162877A (en) * | 1998-12-04 | 2000-12-19 | Hercules Incorporated | Hydrophobically modified comb copolymers |
| WO2001009424A1 (en) * | 1999-07-28 | 2001-02-08 | Kimberly-Clark Worldwide, Inc. | Cd extensible cloth-like nonwoven for facing and liner |
| US6417268B1 (en) | 1999-12-06 | 2002-07-09 | Hercules Incorporated | Method for making hydrophobically associative polymers, methods of use and compositions |
| US20030045844A1 (en) * | 2000-04-14 | 2003-03-06 | Taylor Jack Draper | Dimensionally stable, breathable, stretch-thinned, elastic films |
| US6405801B1 (en) * | 2000-12-08 | 2002-06-18 | Halliburton Energy Services, Inc. | Environmentally acceptable well cement fluid loss control additives, compositions and methods |
| FR2818539B1 (fr) † | 2000-12-22 | 2004-04-30 | Oreal | Composition pour la teinture d'oxydation des fibres keratiniques comprenant au moins 4,5 ou 3,4 diamino pyrazole ou triamino pyrazole et au moins un compose cellulosique particulier, et procede de teinture |
| US7018945B2 (en) * | 2002-07-02 | 2006-03-28 | Kimberly-Clark Worldwide, Inc. | Composition and method for treating fibers and nonwoven substrates |
| EP1531980A1 (en) * | 2002-08-30 | 2005-05-25 | Kimberly-Clark Worldwide, Inc. | Device and process for treating flexible web by stretching between intermeshing forming surfaces |
| US20040110442A1 (en) * | 2002-08-30 | 2004-06-10 | Hannong Rhim | Stretchable nonwoven materials with controlled retraction force and methods of making same |
| US6881375B2 (en) * | 2002-08-30 | 2005-04-19 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber into a web |
| US6896843B2 (en) * | 2002-08-30 | 2005-05-24 | Kimberly-Clark Worldwide, Inc. | Method of making a web which is extensible in at least one direction |
| US20040043214A1 (en) * | 2002-08-30 | 2004-03-04 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber and a web formed from such fibers |
| US20040121675A1 (en) * | 2002-12-23 | 2004-06-24 | Kimberly-Clark Worklwide, Inc. | Treatment of substrates for improving ink adhesion to the substrates |
| US7226880B2 (en) * | 2002-12-31 | 2007-06-05 | Kimberly-Clark Worldwide, Inc. | Breathable, extensible films made with two-component single resins |
| US7932196B2 (en) | 2003-08-22 | 2011-04-26 | Kimberly-Clark Worldwide, Inc. | Microporous stretch thinned film/nonwoven laminates and limited use or disposable product applications |
| US7220478B2 (en) * | 2003-08-22 | 2007-05-22 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic films, methods of making same, and limited use or disposable product applications |
| US7270723B2 (en) | 2003-11-07 | 2007-09-18 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic film laminates, methods of making same, and limited use or disposable product applications |
| US20060147716A1 (en) * | 2004-12-30 | 2006-07-06 | Jaime Braverman | Elastic films with reduced roll blocking capability, methods of making same, and limited use or disposable product applications incorporating same |
| US8236385B2 (en) * | 2005-04-29 | 2012-08-07 | Kimberly Clark Corporation | Treatment of substrates for improving ink adhesion to the substrates |
| JP5696740B2 (ja) * | 2012-12-13 | 2015-04-08 | キヤノンマーケティングジャパン株式会社 | 滅菌装置、滅菌方法、プログラム |
| RU2671577C2 (ru) | 2013-03-15 | 2018-11-02 | Геркулес Ллк | Состав и способ получения композиций для личной гигиены, обладающих улучшенными характеристиками осаждения |
| JP2021063228A (ja) * | 2020-12-24 | 2021-04-22 | 花王株式会社 | エーテル化セルロース繊維及び水を含有する組成物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2010818A (en) * | 1932-06-02 | 1935-08-13 | Du Pont | Etherification of cellulose |
| US3091542A (en) * | 1960-09-20 | 1963-05-28 | Dow Chemical Co | Insolubilization of water-soluble cellulose ethers |
| US3272640A (en) * | 1960-12-22 | 1966-09-13 | Hercules Powder Co Ltd | Water insolubilizing and insensitizing process |
| US3435027A (en) * | 1965-12-13 | 1969-03-25 | Hercules Inc | Cellulose ether-esters and process |
| SE366760B (enExample) * | 1967-12-18 | 1974-05-06 | J Sjoevall | |
| US3824085A (en) * | 1972-02-01 | 1974-07-16 | Anheuser Busch | Esters of polymeric hydroxypropyl carbohydrates and method of using same as gelling agent for organic solvents |
| US3894839A (en) * | 1972-09-21 | 1975-07-15 | Us Of Amercia As Represented B | Process for acylating functional groups bearing active hydrogen with isopropenyl esters of long chain fatty acids |
| US3960514A (en) * | 1974-04-01 | 1976-06-01 | Anheuser-Busch, Incorporated | Synergistic organic solvent gellant |
| US4107426A (en) * | 1976-07-06 | 1978-08-15 | Roy Gerald Gordon | Process for treating cellulose |
| JPS5515906A (en) * | 1978-07-12 | 1980-02-04 | Toshiba Corp | Glass joining method |
| US4228277A (en) * | 1979-02-12 | 1980-10-14 | Hercules Incorporated | Modified nonionic cellulose ethers |
-
1979
- 1979-06-06 US US06/045,819 patent/US4243802A/en not_active Expired - Lifetime
-
1980
- 1980-03-25 CA CA000348330A patent/CA1137080A/en not_active Expired
- 1980-05-30 DE DE19803020689 patent/DE3020689A1/de active Granted
- 1980-06-04 NL NLAANVRAGE8003241,A patent/NL190121C/xx not_active IP Right Cessation
- 1980-06-05 GB GB8018468A patent/GB2053225B/en not_active Expired
- 1980-06-06 JP JP7653680A patent/JPS56801A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0128042B2 (enExample) | 1989-05-31 |
| GB2053225A (en) | 1981-02-04 |
| NL190121B (nl) | 1993-06-01 |
| NL190121C (nl) | 1993-11-01 |
| NL8003241A (nl) | 1980-12-09 |
| CA1137080A (en) | 1982-12-07 |
| GB2053225B (en) | 1983-03-02 |
| US4243802A (en) | 1981-01-06 |
| JPS56801A (en) | 1981-01-07 |
| DE3020689A1 (de) | 1981-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3020689C2 (enExample) | ||
| DE3004161C2 (enExample) | ||
| DE2358150C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern | |
| EP0080976B1 (de) | Gemische aus quaternären, polymeren Ammoniumsalzen auf Acrylbasis, aus quaternären, mono- bis oligomeren Ammoniumsalzen und aus Tensiden, deren Herstellung und Verwendung in kosmetischen Mitteln | |
| DE69129608T2 (de) | Niedrigviskose-Polysaccharidzusammensetzung mit hohem Festkörpergehalt | |
| DE69408454T3 (de) | Verfahren zur herstellung von amid-modifiziertem carboxyl enthaltenden polysaccharid und so erzeugtes fettsäureamid modifiziertes polysaccharid | |
| DE3883561T2 (de) | Hydrophobisch modifizierte, nichtionische Polygalaktomannanäther. | |
| DE69112285T2 (de) | Verwendung von Cyclodextrin und Verfahren um die Viskosität zu erniedrigen. | |
| DE3687142T2 (de) | Herstellung von wasserloeslichen chitin-oligomeren durch teilweise hydrolyse von chitin. | |
| EP0382150B1 (de) | Verfahren zur Herstellung von aktivierten Chitosanen und deren Verwendung bei der Herstellung von Chitosanderivaten | |
| DE69400928T2 (de) | Verwendung von beta-Cylodextrin und Verfahren zur Verbesserung von Verdickungsmitteln für Wässrige Systeme | |
| DE1215123B (de) | Verfahren zur Herstellung feinzerkleinerter, wasserunloeslicher Polysaccharidderivate von kolloidaler Teilchengroesse | |
| DE69521170T2 (de) | Guargummizusammensetzung und Verfahren zur deren Herstellung | |
| DE2412014A1 (de) | Nichtionische zelluloseaether | |
| DE3140637A1 (de) | Polymerhaltiges gemisch zum verdicken von waessrigen systemen, verfahren zu seiner herstellung sowie bohrfluessigkeit | |
| WO1998056828A1 (de) | Verfahren zur herstellung von reinem guarkernmehl | |
| DE3025094A1 (de) | Vernetzte cellulosesulfatester, deren herstellung und verwendung | |
| EP0638589B1 (de) | Verfahren zur Herstellung von Inulinderivaten | |
| DE69528194T2 (de) | Verfahren zur herstellung einer wässrigen celluloseethersuspension und trockenmischung geeignet zur verwendung bei der herstellung der suspension | |
| DE3820030C1 (enExample) | ||
| DE69018440T2 (de) | Verfahren zur herstellung von hyaluronsäure mit niedrigem molekulargewicht. | |
| EP0319865B1 (de) | Carboxymethylsulfoethylcellulose und Verfahren zu ihrer Herstellung | |
| DE19849441A1 (de) | Sulfoalkylgruppenhaltige hydrophob modifizierte Celluloseether, Verfahren zu deren Herstellung sowie deren Verwndung als Schutzkolloide bei Polymerisationen | |
| DE69508933T2 (de) | Wässrige suspension einer cellulose-ether, verfahren zu deren herstellung und zusammensetzung | |
| DE3872346T2 (de) | Ionenaustauscher aus basis von vernetztem glukomannan. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: LEDERER, F., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUEN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C08B 11/193 |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings |