DE3001579A1 - Verfahren zur herstellung von anthranilsaeurealkylestern - Google Patents
Verfahren zur herstellung von anthranilsaeurealkylesternInfo
- Publication number
- DE3001579A1 DE3001579A1 DE19803001579 DE3001579A DE3001579A1 DE 3001579 A1 DE3001579 A1 DE 3001579A1 DE 19803001579 DE19803001579 DE 19803001579 DE 3001579 A DE3001579 A DE 3001579A DE 3001579 A1 DE3001579 A1 DE 3001579A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- formula
- hydrogen peroxide
- acid alkyl
- alkyl esters
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000002148 esters Chemical class 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000002253 acid Substances 0.000 title description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 26
- RWZYAGGXGHYGMB-UHFFFAOYSA-N o-aminobenzenecarboxylic acid Natural products NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- -1 alkyl anthranil esters Chemical class 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000006396 nitration reaction Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- GPSDUZXPYCFOSQ-UHFFFAOYSA-N m-toluic acid Chemical compound CC1=CC=CC(C(O)=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-N 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical class NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GTQHJCOHNAFHRE-UHFFFAOYSA-N 1,10-dibromodecane Chemical compound BrCCCCCCCCCCBr GTQHJCOHNAFHRE-UHFFFAOYSA-N 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- YBJCDTIWNDBNTM-UHFFFAOYSA-N 1-methylsulfonylethane Chemical compound CCS(C)(=O)=O YBJCDTIWNDBNTM-UHFFFAOYSA-N 0.000 description 1
- DHBHUGJZAZYELM-UHFFFAOYSA-N 2-(butylamino)benzoic acid Chemical compound CCCCNC1=CC=CC=C1C(O)=O DHBHUGJZAZYELM-UHFFFAOYSA-N 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical compound CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- XJSIFUPIMNOLLW-UHFFFAOYSA-N 3,5-dichloro-2-(methylamino)benzoic acid Chemical compound CNC1=C(Cl)C=C(Cl)C=C1C(O)=O XJSIFUPIMNOLLW-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 1
- AYGGQJHJRFZDFH-UHFFFAOYSA-N 5,7-dichloro-1h-indole-2,3-dione Chemical compound ClC1=CC(Cl)=CC2=C1NC(=O)C2=O AYGGQJHJRFZDFH-UHFFFAOYSA-N 0.000 description 1
- MBVCESWADCIXJN-UHFFFAOYSA-N 5-Bromoisatin Chemical compound BrC1=CC=C2NC(=O)C(=O)C2=C1 MBVCESWADCIXJN-UHFFFAOYSA-N 0.000 description 1
- UNMYHYODJHKLOC-UHFFFAOYSA-N 5-Nitroisatin Chemical compound [O-][N+](=O)C1=CC=C2NC(=O)C(=O)C2=C1 UNMYHYODJHKLOC-UHFFFAOYSA-N 0.000 description 1
- QRRSIFNWHCKMSW-UHFFFAOYSA-N 5-methyl-2-nitrobenzoic acid Chemical compound CC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1 QRRSIFNWHCKMSW-UHFFFAOYSA-N 0.000 description 1
- MXLDJTXXAYVWDF-UHFFFAOYSA-N 7-(trifluoromethyl)-1h-indole-2,3-dione Chemical compound FC(F)(F)C1=CC=CC2=C1NC(=O)C2=O MXLDJTXXAYVWDF-UHFFFAOYSA-N 0.000 description 1
- UEHZKEABUOAZSH-UHFFFAOYSA-N 7-methyl-1h-indole-2,3-dione Chemical compound CC1=CC=CC2=C1NC(=O)C2=O UEHZKEABUOAZSH-UHFFFAOYSA-N 0.000 description 1
- 239000004343 Calcium peroxide Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 101000835998 Homo sapiens SRA stem-loop-interacting RNA-binding protein, mitochondrial Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical compound [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100025491 SRA stem-loop-interacting RNA-binding protein, mitochondrial Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 206010042496 Sunburn Diseases 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 230000003712 anti-aging effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LHJQIRIGXXHNLA-UHFFFAOYSA-N calcium peroxide Chemical compound [Ca+2].[O-][O-] LHJQIRIGXXHNLA-UHFFFAOYSA-N 0.000 description 1
- 235000019402 calcium peroxide Nutrition 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- DLINORNFHVEIFE-UHFFFAOYSA-N hydrogen peroxide;zinc Chemical compound [Zn].OO DLINORNFHVEIFE-UHFFFAOYSA-N 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 229940035429 isobutyl alcohol Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229960004995 magnesium peroxide Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- COTQUWGKILPGMY-UHFFFAOYSA-N methyl 2-amino-3-(trifluoromethyl)benzoate Chemical compound COC(=O)C1=CC=CC(C(F)(F)F)=C1N COTQUWGKILPGMY-UHFFFAOYSA-N 0.000 description 1
- VSFYTPXXMLJNAU-UHFFFAOYSA-N methyl 2-amino-3-methylbenzoate Chemical compound COC(=O)C1=CC=CC(C)=C1N VSFYTPXXMLJNAU-UHFFFAOYSA-N 0.000 description 1
- QVNYNHCNNGKULA-UHFFFAOYSA-N methyl 2-amino-5-bromobenzoate Chemical compound COC(=O)C1=CC(Br)=CC=C1N QVNYNHCNNGKULA-UHFFFAOYSA-N 0.000 description 1
- VOQBLPBLKSXCDB-UHFFFAOYSA-N methyl 2-amino-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC=C1N VOQBLPBLKSXCDB-UHFFFAOYSA-N 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229940105296 zinc peroxide Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/22—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from lactams, cyclic ketones or cyclic oximes, e.g. by reactions involving Beckmann rearrangement
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Indole Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803001579 DE3001579A1 (de) | 1980-01-17 | 1980-01-17 | Verfahren zur herstellung von anthranilsaeurealkylestern |
| DD80226025A DD155164A5 (de) | 1980-01-17 | 1980-12-12 | Verfahren zur herstellung von anthranilsaeurealkylestern |
| IL61740A IL61740A (en) | 1980-01-17 | 1980-12-17 | Preparation of alkyl anthranilates |
| US06/217,453 US4310677A (en) | 1980-01-17 | 1980-12-17 | Preparation of alkyl anthranilates |
| EP81100065A EP0032672B1 (de) | 1980-01-17 | 1981-01-08 | Verfahren zur Herstellung von Anthranilsäurealkylestern |
| DE8181100065T DE3160888D1 (en) | 1980-01-17 | 1981-01-08 | Process for the preparation of alkylesters of anthranilic acid |
| BR8100198A BR8100198A (pt) | 1980-01-17 | 1981-01-14 | Processo para obtencao de estres alquilicos do acido antranilico |
| JP395381A JPS56100747A (en) | 1980-01-17 | 1981-01-16 | Manufacture of anthranylic acid alkyl ester |
| HU8199A HU185027B (en) | 1980-01-17 | 1981-01-16 | Process for preparing anthranilic acid alkyl esters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803001579 DE3001579A1 (de) | 1980-01-17 | 1980-01-17 | Verfahren zur herstellung von anthranilsaeurealkylestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3001579A1 true DE3001579A1 (de) | 1981-07-23 |
Family
ID=6092299
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803001579 Withdrawn DE3001579A1 (de) | 1980-01-17 | 1980-01-17 | Verfahren zur herstellung von anthranilsaeurealkylestern |
| DE8181100065T Expired DE3160888D1 (en) | 1980-01-17 | 1981-01-08 | Process for the preparation of alkylesters of anthranilic acid |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181100065T Expired DE3160888D1 (en) | 1980-01-17 | 1981-01-08 | Process for the preparation of alkylesters of anthranilic acid |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4310677A (enExample) |
| EP (1) | EP0032672B1 (enExample) |
| JP (1) | JPS56100747A (enExample) |
| BR (1) | BR8100198A (enExample) |
| DD (1) | DD155164A5 (enExample) |
| DE (2) | DE3001579A1 (enExample) |
| HU (1) | HU185027B (enExample) |
| IL (1) | IL61740A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4818273A (en) * | 1983-11-14 | 1989-04-04 | The Dow Chemical Company | Substituted 1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamides, compositions containing them, and their utility as herbicides |
| US5026507A (en) * | 1989-05-04 | 1991-06-25 | Westvaco Corporation | Fluorescent whitening agents, products comprising the agent and method of use thereof |
| US5189210A (en) * | 1992-04-30 | 1993-02-23 | Dowelanco | Process for the preparation of 3- and/or 5-substituted anthranilic acids |
| WO2001053251A1 (en) * | 2000-01-20 | 2001-07-26 | Sumitomo Seika Chemicals Co., Ltd. | Process for producing 3-nitro-2-(mono-substituted)aminobenzoic acid ester |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE375616C (de) * | 1921-05-27 | 1923-05-15 | Kalle & Co Aktien Ges | Verfahren zur Darstellung von o-Aminocarbonsaeuren der Benzolreihe |
| US2170185A (en) * | 1936-04-01 | 1939-08-22 | Givaudan Delawanna Inc | Menthyl anthranilate and process of preparing same |
| US2653971A (en) * | 1951-07-27 | 1953-09-29 | Maumee Dev Company | Manufacture of anthranilic acid |
| US3625989A (en) * | 1967-08-25 | 1971-12-07 | Standard Oil Co | Process for preparing methyl anthranilates |
| US3621017A (en) * | 1967-09-30 | 1971-11-16 | Basf Ag | Salts of thiadiazinones |
| DE2636423C2 (de) * | 1976-08-13 | 1978-10-26 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Anthranilsäureestern |
| ZA786230B (en) * | 1977-12-21 | 1979-10-31 | Smithkline Corp | 8 and/or 9 substituted 2-benzazepine compounds |
| DE2834168C2 (de) * | 1978-08-04 | 1984-02-09 | Troponwerke GmbH & Co KG, 5000 Köln | Verfahren zur Herstellung von 2-(2-Hydroxyäthoxy)äthyl-N-(α,α,α-trifluor-m-tolyl)anthranilat |
-
1980
- 1980-01-17 DE DE19803001579 patent/DE3001579A1/de not_active Withdrawn
- 1980-12-12 DD DD80226025A patent/DD155164A5/de unknown
- 1980-12-17 IL IL61740A patent/IL61740A/xx unknown
- 1980-12-17 US US06/217,453 patent/US4310677A/en not_active Expired - Lifetime
-
1981
- 1981-01-08 DE DE8181100065T patent/DE3160888D1/de not_active Expired
- 1981-01-08 EP EP81100065A patent/EP0032672B1/de not_active Expired
- 1981-01-14 BR BR8100198A patent/BR8100198A/pt unknown
- 1981-01-16 JP JP395381A patent/JPS56100747A/ja active Granted
- 1981-01-16 HU HU8199A patent/HU185027B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL61740A0 (en) | 1981-01-30 |
| US4310677A (en) | 1982-01-12 |
| JPH021134B2 (enExample) | 1990-01-10 |
| DD155164A5 (de) | 1982-05-19 |
| HU185027B (en) | 1984-11-28 |
| BR8100198A (pt) | 1981-08-04 |
| DE3160888D1 (en) | 1983-10-27 |
| JPS56100747A (en) | 1981-08-12 |
| IL61740A (en) | 1984-03-30 |
| EP0032672A3 (en) | 1981-12-09 |
| EP0032672B1 (de) | 1983-09-21 |
| EP0032672A2 (de) | 1981-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2400887A1 (de) | Verfahren zur herstellung von nitroderivaten aromatischer verbindungen | |
| DD153835A5 (de) | Verfahren zur herstellung von 5-carbonyl-10-oxo-10,11-dihydro-5h-dibenz[b,f]azepin | |
| DE3001579A1 (de) | Verfahren zur herstellung von anthranilsaeurealkylestern | |
| DE1670248C3 (de) | Verfahren zur Herstellung von 4-Isothiazolcarbonsäuren | |
| EP0206147B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodibenzylen | |
| EP0537592A1 (de) | Verfahren zur Herstellung von 2-Nitro-5-fluor- bzw. -5-chlor-phenol | |
| DE2357063C2 (de) | Verfahren zur Herstellung von N-Isopropyl-2,1,3-benzothiadiazin-4-on-2,2-dioxid | |
| EP0020969A1 (de) | Verfahren zur Herstellung eines Gemischs von 3-Chloranthranilsäurealkylester und 6-Chloranthranilsäurealkylester | |
| DE4402403A1 (de) | Verfahren zur Herstellung von substituierten Phenylessigsäurederivaten und neue Zwischenprodukte | |
| DE2943125A1 (de) | Verfahren zur herstellung von 1-(4-chlorbenzoyl)-5-methoxy-2-methyl-3-indol acetoxyessigsaeure | |
| DE1933525A1 (de) | Verfahren zur Herstellung von chlor- und/oder cyansubstituierten Hydroxybenzonitrilen oder deren Alkali- oder Erdalkalisalzen | |
| EP0423595B1 (de) | Verfahren zur Herstellung von 3-Trichlormethyl-pyridin | |
| DE549206C (de) | Verfahren zur Darstellung von Halogen-1 íñ 2-benzanthrachinonen | |
| DE927149C (de) | Verfahren zur Herstellung von Hexachlorindenon und Pentachloroxyindenon bzw. von 1, 3-Diketohexachlorhydrinden | |
| DE2549036C3 (de) | Verfahren zur Herstellung von 4,4'-Dinitro-diphenylcarbonat | |
| DE2527575C3 (de) | Verfahren zur Herstellung von 5-Methyl-2-nitrophenol | |
| DE2401819A1 (de) | Sulfamidsaeurehalogenide und verfahren zu ihrer herstellung | |
| DE2321332C2 (de) | Verfahren zur Herstellung von 2-Nitro-5-chlor-benzolsulfonsäurechlorid oder von 2-Nitro-5-chlor-benzolsulfonsäure | |
| DE2451725C2 (de) | Verfahren zur Herstellung von 4- Methyloxazol | |
| DE19523448A1 (de) | Verfahren zur Herstellung von 2-substituierten Cyclopentanonen | |
| DE935365C (de) | Verfahren zur Herstellung von Ketoverbindungen | |
| EP0157225A1 (de) | Verfahren zur Herstellung von Benzimidazolyl,-Benzoxazolyl- und Benzthiazolyloxyphenoxypropionsäurederivaten | |
| DE1668208B2 (de) | Tricyclische Amine, deren Salze, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| CH616151A5 (enExample) | ||
| DE3411196A1 (de) | Verfahren zur herstellung von 4-halogennaphthalsaeureanhydriden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |