DE2929591A1 - Mischungen von optischen aufhellern - Google Patents
Mischungen von optischen aufhellernInfo
- Publication number
- DE2929591A1 DE2929591A1 DE19792929591 DE2929591A DE2929591A1 DE 2929591 A1 DE2929591 A1 DE 2929591A1 DE 19792929591 DE19792929591 DE 19792929591 DE 2929591 A DE2929591 A DE 2929591A DE 2929591 A1 DE2929591 A1 DE 2929591A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- group
- phenyl
- substituted
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 20
- 230000003287 optical effect Effects 0.000 title claims abstract description 13
- -1 p-cyanophenyl group Chemical group 0.000 claims abstract description 41
- 150000001875 compounds Chemical class 0.000 claims abstract description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 56
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 150000003254 radicals Chemical class 0.000 claims description 21
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 17
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 13
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 150000003857 carboxamides Chemical class 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 229920000728 polyester Polymers 0.000 claims description 4
- 125000005504 styryl group Chemical group 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000003106 haloaryl group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical compound OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000005561 phenanthryl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims 1
- 125000004103 aminoalkyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 238000005282 brightening Methods 0.000 claims 1
- 239000000463 material Substances 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 1
- YPDMBLQOYRZPJJ-UHFFFAOYSA-N 2-[4-(1-cyano-2-phenylethenyl)phenyl]-3-phenylprop-2-enenitrile Chemical class C=1C=C(C(=CC=2C=CC=CC=2)C#N)C=CC=1C(C#N)=CC1=CC=CC=C1 YPDMBLQOYRZPJJ-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 125000005599 alkyl carboxylate group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Prostheses (AREA)
- Dental Preparations (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792929591 DE2929591A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
| ES493375A ES8105054A1 (es) | 1979-07-21 | 1980-07-15 | Procedimiento para la preparacion de mezclas de aclaradores opticos |
| US06/169,873 US4336155A (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners |
| EP80104161A EP0023026B1 (de) | 1979-07-21 | 1980-07-16 | Mischungen von optischen Aufhellern und deren Verwendung |
| AT80104161T ATE6375T1 (de) | 1979-07-21 | 1980-07-16 | Mischungen von optischen aufhellern und deren verwendung. |
| DE8080104161T DE3066691D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
| BR8004499A BR8004499A (pt) | 1979-07-21 | 1980-07-18 | Composicoes de aclaradores oticos e sua aplicacao |
| AU60638/80A AU533250B2 (en) | 1979-07-21 | 1980-07-18 | Mixtures of stilbene optical brighteners |
| CA000356457A CA1153160A (en) | 1979-07-21 | 1980-07-18 | Mixtures of optical brighteners |
| ZA00804367A ZA804367B (en) | 1979-07-21 | 1980-07-18 | Mixtures of optical brighteners |
| JP9769480A JPS5618656A (en) | 1979-07-21 | 1980-07-18 | Fluorescent whitening agent mixture |
| PH24316A PH16626A (en) | 1979-07-21 | 1980-07-21 | Mixtures of optical brighteners |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792929591 DE2929591A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2929591A1 true DE2929591A1 (de) | 1981-02-05 |
Family
ID=6076374
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792929591 Withdrawn DE2929591A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
| DE8080104161T Expired DE3066691D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080104161T Expired DE3066691D1 (en) | 1979-07-21 | 1980-07-16 | Mixtures of optical brighteners and their use |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4336155A (enExample) |
| EP (1) | EP0023026B1 (enExample) |
| JP (1) | JPS5618656A (enExample) |
| AT (1) | ATE6375T1 (enExample) |
| AU (1) | AU533250B2 (enExample) |
| BR (1) | BR8004499A (enExample) |
| CA (1) | CA1153160A (enExample) |
| DE (2) | DE2929591A1 (enExample) |
| ES (1) | ES8105054A1 (enExample) |
| PH (1) | PH16626A (enExample) |
| ZA (1) | ZA804367B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3070041D1 (en) * | 1979-12-13 | 1985-03-07 | Ciba Geigy Ag | Optical brighteners from bistyryl benzene, process for their preparation and their use |
| DE3001066A1 (de) * | 1980-01-12 | 1981-07-16 | Basf Ag, 6700 Ludwigshafen | Mischungen optischer aufheller |
| DE3001065A1 (de) * | 1980-01-12 | 1981-07-16 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von optischen aufhellern |
| DE3027479A1 (de) * | 1980-07-19 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern und deren verwendung |
| DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
| US4778622A (en) * | 1986-03-21 | 1988-10-18 | Ciba-Geigy Corporation | Mixtures of fluorescent whitening agents |
| EP0242335B1 (de) * | 1986-04-18 | 1991-05-08 | Ciba-Geigy Ag | Mischungen von optischen Aufhellern |
| CH671956A5 (enExample) * | 1987-01-29 | 1989-10-13 | Ciba Geigy Ag | |
| DE3878550D1 (de) * | 1987-11-27 | 1993-03-25 | Ciba Geigy Ag | Aufhellerdispersion. |
| DE19607046A1 (de) * | 1996-02-24 | 1997-08-28 | Hoechst Ag | Mischungen von optischen Aufhellern für Kunststoffe |
| DE10219993A1 (de) * | 2002-05-03 | 2003-11-20 | Basf Ag | Verfahren zum Aufhellen von textilen Materialien |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1469821B2 (de) * | 1959-06-24 | 1972-03-23 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Optische Aufheller für makromolekulare organische Stoffe |
| FR1415977A (fr) * | 1963-10-31 | 1965-10-29 | Basf Ag | Procédé pour l'azurage optique de matériaux en polyesters et en polyamides synthétiques |
| CH533670A (de) * | 1968-12-05 | 1973-02-15 | Ciba Geigy Ag | Optische Aufhellmittel enthaltende anorganische Weisspigmente |
| DE2037854C2 (de) * | 1970-07-30 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | 3-(4-Chlor-1-pyrazolyl)-7-v-triazol-2-yl-cumarin-Verbindungen und deren Verwendung zum optischen Aufhellen |
| JPS544973A (en) * | 1977-06-13 | 1979-01-16 | Daiken Trade & Industry | Waterproof treatment for board |
-
1979
- 1979-07-21 DE DE19792929591 patent/DE2929591A1/de not_active Withdrawn
-
1980
- 1980-07-15 ES ES493375A patent/ES8105054A1/es not_active Expired
- 1980-07-16 DE DE8080104161T patent/DE3066691D1/de not_active Expired
- 1980-07-16 AT AT80104161T patent/ATE6375T1/de active
- 1980-07-16 US US06/169,873 patent/US4336155A/en not_active Expired - Lifetime
- 1980-07-16 EP EP80104161A patent/EP0023026B1/de not_active Expired
- 1980-07-18 AU AU60638/80A patent/AU533250B2/en not_active Ceased
- 1980-07-18 ZA ZA00804367A patent/ZA804367B/xx unknown
- 1980-07-18 BR BR8004499A patent/BR8004499A/pt not_active IP Right Cessation
- 1980-07-18 CA CA000356457A patent/CA1153160A/en not_active Expired
- 1980-07-18 JP JP9769480A patent/JPS5618656A/ja active Granted
- 1980-07-21 PH PH24316A patent/PH16626A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4336155A (en) | 1982-06-22 |
| AU533250B2 (en) | 1983-11-10 |
| CA1153160A (en) | 1983-09-06 |
| ATE6375T1 (de) | 1984-03-15 |
| ZA804367B (en) | 1981-07-29 |
| ES493375A0 (es) | 1981-05-16 |
| ES8105054A1 (es) | 1981-05-16 |
| EP0023026B1 (de) | 1984-02-22 |
| EP0023026A1 (de) | 1981-01-28 |
| JPH0116868B2 (enExample) | 1989-03-28 |
| DE3066691D1 (en) | 1984-03-29 |
| AU6063880A (en) | 1981-01-22 |
| PH16626A (en) | 1983-12-05 |
| BR8004499A (pt) | 1981-01-27 |
| JPS5618656A (en) | 1981-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0023028B1 (de) | Mischungen von optischen Aufhellern und deren Verwendung | |
| DE2929591A1 (de) | Mischungen von optischen aufhellern | |
| DE2721084B2 (de) | Mischungen von optischen Aufhellern | |
| DE2031774A1 (de) | Benzofurane | |
| DE2629703C3 (de) | Aufhellermischungen und deren Verwendung | |
| EP0044996B1 (de) | Mischungen von optischen Aufhellern | |
| EP0035694B1 (de) | Mischungen von optischen Aufhellern | |
| EP0058880B1 (de) | Mischungen von optischen Aufhellern | |
| DE19732109A1 (de) | Mischungen von optischen Aufhellern | |
| DE2459393C3 (de) | Mittel zum Flammfestmachen von synthetischem Fasermaterial aus Polyester oder Polyamid | |
| CH634077A5 (de) | Kationische aufheller. | |
| EP0054511B1 (de) | 4-Styryl-4'-vinylbiphenyle, Verfahren zu deren Herstellung und deren Verwendung als optische Aufheller | |
| EP0011824A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE2759217A1 (de) | Mischungen von optischen aufhellern | |
| DE2839936A1 (de) | Mischungen von optischen aufhellern und deren verwendung zum optischen aufhellen | |
| DE1802642C3 (de) | Fluoreszierende 1- (Pyrazolinylphenylsulfonyl)-piperazine | |
| DE1105375B (de) | Optische Aufheller | |
| EP0005465A1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| DE1545895C3 (de) | Pyrazolinverbindungen | |
| DE2217284A1 (de) | Neue Pyrazolinverbindungen als optische Aufheller | |
| DE1238431B (de) | Optische Aufhellmittel | |
| DE1469223C (de) | Optische Aufhellungsmittel | |
| DE4011927A1 (de) | Verwendung von pyrrolo-pyrrol-verbindungen zum faerben und bedrucken von fasermaterialien | |
| EP0280652A1 (de) | Verfahren zur Erhöhung des Weissgrades von polyesterhaltigem Textilmaterial | |
| CH432462A (de) | Nichtstaubende Farbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |