CA1153160A - Mixtures of optical brighteners - Google Patents
Mixtures of optical brightenersInfo
- Publication number
- CA1153160A CA1153160A CA000356457A CA356457A CA1153160A CA 1153160 A CA1153160 A CA 1153160A CA 000356457 A CA000356457 A CA 000356457A CA 356457 A CA356457 A CA 356457A CA 1153160 A CA1153160 A CA 1153160A
- Authority
- CA
- Canada
- Prior art keywords
- denotes
- alkyl
- group
- phenyl
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 30
- 230000003287 optical effect Effects 0.000 title claims abstract description 28
- -1 p-cyanophenyl group Chemical group 0.000 claims abstract description 52
- 150000001875 compounds Chemical class 0.000 claims abstract description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 53
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 47
- 239000001257 hydrogen Substances 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 150000003254 radicals Chemical class 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 14
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 11
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 229940124530 sulfonamide Drugs 0.000 claims description 9
- 150000003456 sulfonamides Chemical class 0.000 claims description 9
- 150000003857 carboxamides Chemical class 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229920000728 polyester Polymers 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000005605 benzo group Chemical group 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 238000005282 brightening Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000002657 fibrous material Substances 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000005504 styryl group Chemical group 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- MALIONKMKPITBV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-n-[2-(4-sulfamoylphenyl)ethyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)CC1=CC=C(O)C(Cl)=C1 MALIONKMKPITBV-UHFFFAOYSA-N 0.000 claims description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- NFGODEMQGQNUKK-UHFFFAOYSA-M [6-(diethylamino)-9-(2-octadecoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium;chloride Chemical group [Cl-].CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C1=C2C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C21 NFGODEMQGQNUKK-UHFFFAOYSA-M 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000005157 alkyl carboxy group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical compound OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 claims description 2
- 125000005518 carboxamido group Chemical group 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000005561 phenanthryl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- 125000001725 pyrenyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 6
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229960005141 piperazine Drugs 0.000 claims 1
- 125000005208 trialkylammonium group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 4
- 239000000306 component Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- YPDMBLQOYRZPJJ-UHFFFAOYSA-N 2-[4-(1-cyano-2-phenylethenyl)phenyl]-3-phenylprop-2-enenitrile Chemical class C=1C=C(C(=CC=2C=CC=CC=2)C#N)C=CC=1C(C#N)=CC1=CC=CC=C1 YPDMBLQOYRZPJJ-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Prostheses (AREA)
- Dental Preparations (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792929591 DE2929591A1 (de) | 1979-07-21 | 1979-07-21 | Mischungen von optischen aufhellern |
| DEP2929591.8 | 1979-07-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1153160A true CA1153160A (en) | 1983-09-06 |
Family
ID=6076374
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000356457A Expired CA1153160A (en) | 1979-07-21 | 1980-07-18 | Mixtures of optical brighteners |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4336155A (enExample) |
| EP (1) | EP0023026B1 (enExample) |
| JP (1) | JPS5618656A (enExample) |
| AT (1) | ATE6375T1 (enExample) |
| AU (1) | AU533250B2 (enExample) |
| BR (1) | BR8004499A (enExample) |
| CA (1) | CA1153160A (enExample) |
| DE (2) | DE2929591A1 (enExample) |
| ES (1) | ES8105054A1 (enExample) |
| PH (1) | PH16626A (enExample) |
| ZA (1) | ZA804367B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0030917B2 (de) * | 1979-12-13 | 1991-03-20 | Ciba-Geigy Ag | Optische Aufheller aus Bis-styrylbenzolverbindungen, Verfahren zu deren Herstellung und deren Verwendung |
| DE3001066A1 (de) * | 1980-01-12 | 1981-07-16 | Basf Ag, 6700 Ludwigshafen | Mischungen optischer aufheller |
| DE3001065A1 (de) * | 1980-01-12 | 1981-07-16 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von optischen aufhellern |
| DE3027479A1 (de) * | 1980-07-19 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern und deren verwendung |
| DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
| US4778622A (en) * | 1986-03-21 | 1988-10-18 | Ciba-Geigy Corporation | Mixtures of fluorescent whitening agents |
| EP0242335B1 (de) * | 1986-04-18 | 1991-05-08 | Ciba-Geigy Ag | Mischungen von optischen Aufhellern |
| CH671956A5 (enExample) * | 1987-01-29 | 1989-10-13 | Ciba Geigy Ag | |
| ES2053807T3 (es) * | 1987-11-27 | 1994-08-01 | Ciba Geigy Ag | Dispersion blanqueadora acuosa y procedimiento para su preparacion. |
| DE19607046A1 (de) * | 1996-02-24 | 1997-08-28 | Hoechst Ag | Mischungen von optischen Aufhellern für Kunststoffe |
| DE10219993A1 (de) * | 2002-05-03 | 2003-11-20 | Basf Ag | Verfahren zum Aufhellen von textilen Materialien |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1469821B2 (de) * | 1959-06-24 | 1972-03-23 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Optische Aufheller für makromolekulare organische Stoffe |
| FR1415977A (fr) * | 1963-10-31 | 1965-10-29 | Basf Ag | Procédé pour l'azurage optique de matériaux en polyesters et en polyamides synthétiques |
| CH533670A (de) * | 1968-12-05 | 1973-02-15 | Ciba Geigy Ag | Optische Aufhellmittel enthaltende anorganische Weisspigmente |
| DE2037854C2 (de) * | 1970-07-30 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | 3-(4-Chlor-1-pyrazolyl)-7-v-triazol-2-yl-cumarin-Verbindungen und deren Verwendung zum optischen Aufhellen |
| JPS544973A (en) * | 1977-06-13 | 1979-01-16 | Daiken Trade & Industry | Waterproof treatment for board |
-
1979
- 1979-07-21 DE DE19792929591 patent/DE2929591A1/de not_active Withdrawn
-
1980
- 1980-07-15 ES ES493375A patent/ES8105054A1/es not_active Expired
- 1980-07-16 AT AT80104161T patent/ATE6375T1/de active
- 1980-07-16 US US06/169,873 patent/US4336155A/en not_active Expired - Lifetime
- 1980-07-16 DE DE8080104161T patent/DE3066691D1/de not_active Expired
- 1980-07-16 EP EP80104161A patent/EP0023026B1/de not_active Expired
- 1980-07-18 CA CA000356457A patent/CA1153160A/en not_active Expired
- 1980-07-18 JP JP9769480A patent/JPS5618656A/ja active Granted
- 1980-07-18 ZA ZA00804367A patent/ZA804367B/xx unknown
- 1980-07-18 BR BR8004499A patent/BR8004499A/pt not_active IP Right Cessation
- 1980-07-18 AU AU60638/80A patent/AU533250B2/en not_active Ceased
- 1980-07-21 PH PH24316A patent/PH16626A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5618656A (en) | 1981-02-21 |
| DE3066691D1 (en) | 1984-03-29 |
| BR8004499A (pt) | 1981-01-27 |
| EP0023026A1 (de) | 1981-01-28 |
| AU6063880A (en) | 1981-01-22 |
| ES493375A0 (es) | 1981-05-16 |
| AU533250B2 (en) | 1983-11-10 |
| US4336155A (en) | 1982-06-22 |
| ES8105054A1 (es) | 1981-05-16 |
| EP0023026B1 (de) | 1984-02-22 |
| PH16626A (en) | 1983-12-05 |
| ATE6375T1 (de) | 1984-03-15 |
| DE2929591A1 (de) | 1981-02-05 |
| ZA804367B (en) | 1981-07-29 |
| JPH0116868B2 (enExample) | 1989-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1153160A (en) | Mixtures of optical brighteners | |
| CA1151806A (en) | Mixtures of optical brighteners | |
| US6045586A (en) | Compounds having ultra-violet absorption properties | |
| US6036731A (en) | Crosslinking of cellulosic fiber materials | |
| US4360679A (en) | Benzofuranyl-benzimidazoles | |
| GB1590228A (en) | Benzoxazole compounds | |
| US4169810A (en) | Mixtures of optical brighteners | |
| KR100475209B1 (ko) | 트리아진유도체,이의제조방법및이를포함하는조성물 | |
| US3900419A (en) | Benzofurans | |
| CA1156403A (en) | Stable aqueous formulations of stilbene fluorescent whitening agents | |
| CA1154910A (en) | Mixtures of optical brighteners | |
| CA1161208A (en) | Mixtures of optical brighteners and their use | |
| US3467600A (en) | Combination optical brightener for terephthalic acid polyester fibers | |
| IE45428B1 (en) | Brightener mixtures | |
| US4022772A (en) | Styrene compounds | |
| CA1191002A (en) | Mixtures of optical brighteners | |
| US3242177A (en) | 7-(5-triazinyl-amino)-3-aryl-coumarin compounds | |
| JPH0288546A (ja) | カチオン化合物、その製造方法ならびに塩基性染色可能なポリアミド、ポリアクリルニトリル及びポリエステル繊維材料の光化学的安定化のためのその使用方法 | |
| KR830002399B1 (ko) | 광학적 광택제 혼합물 | |
| US3242188A (en) | New 2-azolyl-5-oxadiazolyl-thiophene compounds | |
| US3444180A (en) | Oxdiazole compounds | |
| US4141900A (en) | 3-Phenyl-7-(v-triazol-2-yl)-coumarins | |
| US3674714A (en) | Fluorescent 1-(pyrazolinylphenylsulphonyl) piperazines | |
| US4165435A (en) | Fire retardant s-triazine derivatives | |
| CA1138448A (en) | Triazolostilbeneoxadiazole compounds, process for their manufacture and their use as optical brighteners |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |