DE2825107A1 - Kassette fuer eine speicherplatte - Google Patents
Kassette fuer eine speicherplatteInfo
- Publication number
- DE2825107A1 DE2825107A1 DE19782825107 DE2825107A DE2825107A1 DE 2825107 A1 DE2825107 A1 DE 2825107A1 DE 19782825107 DE19782825107 DE 19782825107 DE 2825107 A DE2825107 A DE 2825107A DE 2825107 A1 DE2825107 A1 DE 2825107A1
- Authority
- DE
- Germany
- Prior art keywords
- opening
- cassette
- plate
- disk
- cassette according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000000087 stabilizing effect Effects 0.000 claims description 14
- 238000003780 insertion Methods 0.000 claims description 9
- 230000037431 insertion Effects 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 6
- 238000010276 construction Methods 0.000 claims description 4
- 210000002435 tendon Anatomy 0.000 claims description 3
- 230000003014 reinforcing effect Effects 0.000 claims 1
- 210000003128 head Anatomy 0.000 description 36
- 230000007246 mechanism Effects 0.000 description 6
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 239000003570 air Substances 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- MMOXZBCLCQITDF-UHFFFAOYSA-N N,N-diethyl-m-toluamide Chemical compound CCN(CC)C(=O)C1=CC=CC(C)=C1 MMOXZBCLCQITDF-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 210000000887 face Anatomy 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 238000007726 management method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B17/00—Guiding record carriers not specifically of filamentary or web form, or of supports therefor
- G11B17/02—Details
- G11B17/022—Positioning or locking of single discs
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B23/00—Record carriers not specific to the method of recording or reproducing; Accessories, e.g. containers, specially adapted for co-operation with the recording or reproducing apparatus ; Intermediate mediums; Apparatus or processes specially adapted for their manufacture
- G11B23/02—Containers; Storing means both adapted to cooperate with the recording or reproducing means
- G11B23/03—Containers for flat record carriers
- G11B23/033—Containers for flat record carriers for flexible discs
Landscapes
- Feeding And Guiding Record Carriers (AREA)
- Automatic Disk Changers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27124/77A GB1525849A (en) | 1977-06-29 | 1977-06-29 | Record disc cartridge |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2825107A1 true DE2825107A1 (de) | 1979-01-04 |
Family
ID=10254618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782825107 Withdrawn DE2825107A1 (de) | 1977-06-29 | 1978-06-08 | Kassette fuer eine speicherplatte |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4131199A (cg-RX-API-DMAC10.html) |
| BE (1) | BE867215A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1114500A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2825107A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2396381A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1525849A (cg-RX-API-DMAC10.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3125094A1 (de) * | 1980-07-31 | 1982-03-11 | Naamloze Vennootschap Philips' Gloeilampenfabrieken, 5621 Eindhoven | "scheibeneinheit mit einer drehbaren kreisrunden informationsscheibe" |
| DE3131889A1 (de) * | 1980-08-14 | 1982-05-13 | Sony Corp., Tokyo | Flexible magnetplatten-kassette und aufzeichnungs- und/oder wiedergabevorrichtung dafuer |
| DE3131901A1 (de) * | 1980-08-14 | 1982-05-27 | Sony Corp., Tokyo | Flexible magnetplatten-kassette und aufzeichnungs- und/oder wiedergabevorrichtung dafuer |
| DE3325648A1 (de) * | 1982-07-19 | 1984-01-19 | Sony Corp., Tokyo | Ladevorrichtung fuer platten-kassetten |
| DE3443070A1 (de) * | 1983-11-24 | 1985-06-05 | Pioneer Electronic Corp., Tokio/Tokyo | Plattenspieler mit frontseiteneingabe |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4273342A (en) * | 1979-05-23 | 1981-06-16 | Rca Corporation | Protective cartridge for optical discs |
| US4235339A (en) * | 1979-06-04 | 1980-11-25 | Memorex Corporation | Latch and carrying handle assembly for magnetic recording disc cartridge |
| JPS5698759A (en) * | 1979-12-29 | 1981-08-08 | Sony Corp | Recording and reproducing device |
| CA1159952A (en) * | 1980-06-18 | 1984-01-03 | John W. Wenner | Reversible cartridge for flexible disks |
| HU180372B (en) * | 1980-07-29 | 1983-02-28 | Budapesti Radiotechnikai Gyar | Casette information recorder |
| GB2142766B (en) * | 1980-08-14 | 1985-09-11 | Sony Corp | Recording and/or reproducing apparatus for magnetic disc cassettes |
| US4400748A (en) * | 1981-04-22 | 1983-08-23 | Iomega Corporation | Flexible magnetic disk drive using a rigid cartridge |
| US4502083A (en) * | 1981-04-22 | 1985-02-26 | Iomega Corporation | Magnetic disk drive having a movable drive motor |
| US4571646A (en) * | 1981-04-22 | 1986-02-18 | Iomega Corporation | Magnetic disk drive having a movable drive motor |
| AU544979B2 (en) * | 1981-06-19 | 1985-06-27 | Matsushita Electric Industrial Co., Ltd. | Information disk cartridge |
| NL8105096A (nl) * | 1981-11-11 | 1983-06-01 | Philips Nv | Informatieschijfcassette. |
| JPS593756A (ja) * | 1982-06-29 | 1984-01-10 | Shin Etsu Polymer Co Ltd | 磁気デイスクカ−トリツジ |
| FR2537320A1 (fr) * | 1982-12-03 | 1984-06-08 | Thomson Csf | Cassette pour disque optique |
| US4497009A (en) * | 1983-01-11 | 1985-01-29 | Fuji Photo Film Co., Ltd. | Magnetic disk cartridge |
| US4471397A (en) * | 1983-07-28 | 1984-09-11 | Eastman Kodak Company | Magnetic disk cartridge |
| US4717981A (en) * | 1983-08-04 | 1988-01-05 | Syquest Technology | Hard disc cartridge arrangement with an automatically activated door |
| US4641209A (en) * | 1983-11-28 | 1987-02-03 | Micro Storage Ltd. | Disc type information storage and retrieval system |
| EP0146656B1 (en) * | 1983-12-21 | 1987-11-11 | International Business Machines Corporation | A disk cartridge having a flexible disk storage medium and a disk file including such a cartridge |
| AU93415S (en) | 1984-03-29 | 1986-09-11 | Sharp Kk | Memory card for electronic calculator |
| US4571718A (en) * | 1984-07-11 | 1986-02-18 | Eastman Kodak Company | Optical disk cartridge and cooperating apparatus |
| NL8402602A (nl) * | 1984-08-27 | 1986-03-17 | Philips Nv | Schijfcassette. |
| US4663677A (en) * | 1985-07-24 | 1987-05-05 | Iomega Corporation | Magnetic disk drive having a movable drive motor loading mechanism |
| US4843511A (en) * | 1985-09-27 | 1989-06-27 | Polaroid Corporation | Magnetic disk cassette having internal biasing ribs |
| WO1987003134A1 (en) * | 1985-11-19 | 1987-05-21 | Eastman Kodak Company | Record disk assembly |
| US4794480A (en) * | 1986-04-21 | 1988-12-27 | Iomega Corporation | Bernoulli plate in cartridge |
| US4768114A (en) * | 1986-10-31 | 1988-08-30 | Eastman Kodak Company | Disk cassette loading/unloading mechanism with rigid shutter opening device |
| US5440436A (en) * | 1992-11-13 | 1995-08-08 | Syquest Technology, Inc. | Removable cartridge disk drive with a 1.8 inch form factor |
| JP4006809B2 (ja) * | 1998-02-02 | 2007-11-14 | ソニー株式会社 | 情報記憶媒体カートリッジ |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1844952A (en) * | 1930-02-24 | 1932-02-16 | Freedman Morey | Pasteboard carton |
| US3416150A (en) * | 1965-08-02 | 1968-12-10 | Data Disc Inc | Magnetic recording disc cartridge |
| DE1774349B2 (de) * | 1967-05-31 | 1973-09-27 | Nippon Electric Co., Ltd., Tokio | Behälter für magnetische Speicherscheiben und Datenspeichereinrichtung |
| US3593327A (en) * | 1968-10-24 | 1971-07-13 | Singer Co | Memory-disc cartridge with loading mechanism |
| US3609722A (en) * | 1969-03-19 | 1971-09-28 | George E Zenzefilis | Center sealing data disc cassette and processing machine |
| US3912282A (en) * | 1972-11-17 | 1975-10-14 | Matsushita Electric Industrial Co Ltd | Recording and reproducing apparatus using flexible recording media |
| DE2644894A1 (de) * | 1976-10-05 | 1978-04-06 | Heiko Jansen | Kassette fuer eine aufzeichnungsplatte |
| DE2709944C3 (de) * | 1977-03-08 | 1979-08-30 | Standard Elektrik Lorenz Ag, 7000 Stuttgart | Drehbarer Folienspeicher |
-
1977
- 1977-06-29 GB GB27124/77A patent/GB1525849A/en not_active Expired
- 1977-10-27 US US05/846,228 patent/US4131199A/en not_active Expired - Lifetime
-
1978
- 1978-04-10 CA CA300,787A patent/CA1114500A/en not_active Expired
- 1978-05-12 FR FR7814826A patent/FR2396381A1/fr active Granted
- 1978-05-18 BE BE187813A patent/BE867215A/xx not_active IP Right Cessation
- 1978-06-08 DE DE19782825107 patent/DE2825107A1/de not_active Withdrawn
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3125094A1 (de) * | 1980-07-31 | 1982-03-11 | Naamloze Vennootschap Philips' Gloeilampenfabrieken, 5621 Eindhoven | "scheibeneinheit mit einer drehbaren kreisrunden informationsscheibe" |
| DE3131889A1 (de) * | 1980-08-14 | 1982-05-13 | Sony Corp., Tokyo | Flexible magnetplatten-kassette und aufzeichnungs- und/oder wiedergabevorrichtung dafuer |
| DE3131901A1 (de) * | 1980-08-14 | 1982-05-27 | Sony Corp., Tokyo | Flexible magnetplatten-kassette und aufzeichnungs- und/oder wiedergabevorrichtung dafuer |
| DE3325648A1 (de) * | 1982-07-19 | 1984-01-19 | Sony Corp., Tokyo | Ladevorrichtung fuer platten-kassetten |
| DE3443070A1 (de) * | 1983-11-24 | 1985-06-05 | Pioneer Electronic Corp., Tokio/Tokyo | Plattenspieler mit frontseiteneingabe |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2396381B1 (cg-RX-API-DMAC10.html) | 1982-12-17 |
| BE867215A (fr) | 1978-09-18 |
| CA1114500A (en) | 1981-12-15 |
| GB1525849A (en) | 1978-09-20 |
| US4131199A (en) | 1978-12-26 |
| FR2396381A1 (fr) | 1979-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2825107A1 (de) | Kassette fuer eine speicherplatte | |
| DE69316791T2 (de) | Begrenzung mit magnetischer Raste für optimalen Gebrauch der Plattenoberfläche | |
| DE69128770T2 (de) | Magnetplatteneinheit | |
| DE3131889C2 (cg-RX-API-DMAC10.html) | ||
| DE69416067T2 (de) | Platteneinheit mit Verriegelungssystem für den Abnehmerarm | |
| DE2839277C3 (de) | Einrichtung für das Zentrieren eines kreisscheibenförmigen Aufzeichnungsträgers an der Drehachse eines Aufzeichnungsgerätes | |
| DE68913702T2 (de) | Datenspeicherkassette mit einer Schreib-Schutz-Anordnung. | |
| DE69507471T2 (de) | Antriebgerät geeignet für benutzung mit datenspeicher kassetten mit verschiedene abmessung und datenspeicherkassetten dafür | |
| DE68910514T2 (de) | Abnehmbare kassette für ein plattenlaufwerk, betätigt durch eine schwingspule mit radialem arm. | |
| DE69513143T2 (de) | Führungskulisse in Kassette | |
| DE69011119T2 (de) | Magnetkopf-aufhaengevorrichtung zur verwendung bei photographischen filmen. | |
| DE2853216A1 (de) | Datenspeichergeraet mit auswechselbaren plattenkassetten | |
| DE2603134A1 (de) | Kassette zur aufnahme einer magnetisierbaren schallplatte | |
| DE8237133U1 (de) | Ladevorrichtung fuer plattenkassetten | |
| DE3529283A1 (de) | Scheibenkassette | |
| CH659906A5 (de) | Kassette mit einer flexiblen magnetscheibe. | |
| DE3713389C2 (de) | Magnetspeicher- und Datenwiedergewinnungseinrichtung | |
| DE3222844A1 (de) | Speicherplattenkassette | |
| DE69226026T2 (de) | Plattenkassette | |
| DE69903947T2 (de) | Datenspeicherbandkassette mit falscheinlege-verhinderungskerbe | |
| DE3116056C2 (de) | Schallplattenhaltevorrichtung für Plattenspieler | |
| DE3041275C2 (de) | Wandlerkopf-Schlittenführung | |
| DE60313581T2 (de) | Datenträgerkassette | |
| EP0024563B1 (de) | Kopfträgeranordnung für ein Diskettenlaufwerk | |
| DE69616786T2 (de) | Plattenkassette mit kopflade-/-entladerampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| 8139 | Disposal/non-payment of the annual fee |