DE2810692B2 - Doppelsiebpapiermaschine - Google Patents
DoppelsiebpapiermaschineInfo
- Publication number
- DE2810692B2 DE2810692B2 DE2810692A DE2810692A DE2810692B2 DE 2810692 B2 DE2810692 B2 DE 2810692B2 DE 2810692 A DE2810692 A DE 2810692A DE 2810692 A DE2810692 A DE 2810692A DE 2810692 B2 DE2810692 B2 DE 2810692B2
- Authority
- DE
- Germany
- Prior art keywords
- cylinder
- machine according
- shoe
- dewatering
- sieves
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000011888 foil Substances 0.000 claims description 4
- 239000004745 nonwoven fabric Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims description 2
- 238000011144 upstream manufacturing Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000000481 breast Anatomy 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000010438 granite Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- YSGSDAIMSCVPHG-UHFFFAOYSA-N valyl-methionine Chemical compound CSCCC(C(O)=O)NC(=O)C(N)C(C)C YSGSDAIMSCVPHG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F9/00—Complete machines for making continuous webs of paper
- D21F9/003—Complete machines for making continuous webs of paper of the twin-wire type
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F9/00—Complete machines for making continuous webs of paper
- D21F9/02—Complete machines for making continuous webs of paper of the Fourdrinier type
Landscapes
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH40678 | 1978-01-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2810692A1 DE2810692A1 (de) | 1979-07-19 |
| DE2810692B2 true DE2810692B2 (de) | 1980-01-17 |
Family
ID=4186304
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2810692A Withdrawn DE2810692B2 (de) | 1978-01-16 | 1978-03-11 | Doppelsiebpapiermaschine |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4176005A (enExample) |
| JP (1) | JPS54151604A (enExample) |
| AR (1) | AR216205A1 (enExample) |
| AT (1) | AT359368B (enExample) |
| BR (1) | BR7900224A (enExample) |
| CA (1) | CA1082019A (enExample) |
| DE (1) | DE2810692B2 (enExample) |
| ES (1) | ES476804A1 (enExample) |
| FI (1) | FI69663B (enExample) |
| FR (1) | FR2414581A1 (enExample) |
| GB (1) | GB2012330B (enExample) |
| IT (1) | IT1110068B (enExample) |
| SE (1) | SE434658B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2951183A1 (de) | 1979-12-19 | 1981-07-09 | Andreas Kufferath KG, 5160 Düren | Verfahren zur beeinflussung eines vorentwaesserten faservlieses auf einem sieb und vorrichtung zur durchfuehrung des verfahrens |
| DE3123131A1 (de) * | 1981-06-11 | 1982-12-30 | J.M. Voith Gmbh, 7920 Heidenheim | "leitwalze mit wasserfuehrungselement fuer ein papiermaschinen-siebband" |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4167441A (en) * | 1978-05-03 | 1979-09-11 | Sandy Hill Corporation | Papermaking machine |
| AT379622B (de) * | 1980-11-26 | 1986-02-10 | Escher Wyss Gmbh | Papiermaschine mit zwei beweglichen wasserdurchlaessigen entwaesserungsbaendern, z.b. sieben |
| DE3107926A1 (de) * | 1981-03-02 | 1982-11-04 | Escher Wyss Gmbh, 7980 Ravensburg | Verfahren zum ausbilden einer mehrlagigen papierbahn in einem doppelsiebformer und doppelsiebformer zur durchfuehrung des verfahrens |
| AT375111B (de) | 1981-04-08 | 1984-07-10 | Escher Wyss Gmbh | Doppelsieb-papiermaschine |
| DE3131957A1 (de) * | 1981-07-24 | 1983-02-10 | Escher Wyss Gmbh, 7980 Ravensburg | Entwaesserungseinheit fuer langsieb-papiermaschinen |
| DE3153305C2 (de) * | 1981-09-04 | 1986-10-23 | Sulzer-Escher Wyss GmbH, 7980 Ravensburg | Entwässerungseinheit für Langsieb-Papiermaschinen |
| FI813027L (fi) * | 1981-09-29 | 1983-03-30 | Ahlstroem Oy | Banformningsfoerfarande och -anordning |
| US4484981A (en) * | 1982-07-26 | 1984-11-27 | Feldmuhle Aktiengesellschaft | Papermaking dewatering apparatus having wire support means with cooling water feed means |
| US4532008A (en) * | 1983-07-22 | 1985-07-30 | The Black Clawson Company | Horizontal twin wire machine |
| US4561938A (en) * | 1984-02-17 | 1985-12-31 | M/K Plank Corporation | Forming roll apparatus |
| DE3425077A1 (de) * | 1984-05-25 | 1985-11-28 | Sulzer-Escher Wyss GmbH, 7980 Ravensburg | Doppelsieb-papiermaschine |
| FI83103C (fi) * | 1987-06-30 | 1992-12-15 | Tampella Oy Ab | Anordning foer att styra en mellan virorna gaoende bana upp pao en vira |
| FI873034A7 (fi) * | 1987-07-09 | 1989-01-10 | Tampella Oy Ab | Avvattningszon i en pappersmaskin. |
| US4861432A (en) * | 1987-11-03 | 1989-08-29 | Huyck Corporation | Dual compartment vacufoil unit to eliminate secondary headbox chatter |
| US4780183A (en) * | 1987-11-03 | 1988-10-25 | Huyck Corporation | Method of using a dual compartment vacufoil unit to eliminate secondary headbox chatter |
| DE4037017C2 (de) * | 1990-11-20 | 1994-12-08 | Escher Wyss Gmbh | Naßteil einer Doppelsieb-Papiermaschine |
| JPH07116678B2 (ja) * | 1991-10-30 | 1995-12-13 | 株式会社小林製作所 | ツインワイヤ式抄紙機 |
| DE59806909D1 (de) * | 1997-07-05 | 2003-02-20 | Voith Paper Patent Gmbh | Saugwalze für eine Papiermaschine |
| CN104246071A (zh) * | 2012-03-28 | 2014-12-24 | 沃依特专利有限责任公司 | 用于纸浆脱水的机器 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3201305A (en) * | 1962-11-05 | 1965-08-17 | David R Webster | Sheet forming method and apparatus |
| US3846233A (en) * | 1972-09-11 | 1974-11-05 | Valmet Oy | Papermaking machine having a single wire run and a double wire run over a downwardly curving dewatering box |
| US3876498A (en) * | 1973-09-14 | 1975-04-08 | Beloit Corp | Controlled forming wire separation on impervious roll of twin-wire papermaking machine |
| FI313874A7 (enExample) * | 1974-10-25 | 1976-04-26 | Valmet Oy | |
| FI74060C (fi) * | 1975-09-17 | 1987-12-10 | Valmet Oy | Tissuepappersmaskin. |
| CH606602A5 (enExample) * | 1975-10-02 | 1978-11-15 | Escher Wyss Gmbh |
-
1978
- 1978-01-19 AT AT39678A patent/AT359368B/de not_active IP Right Cessation
- 1978-03-11 DE DE2810692A patent/DE2810692B2/de not_active Withdrawn
- 1978-12-26 US US05/973,071 patent/US4176005A/en not_active Expired - Lifetime
- 1978-12-26 FR FR7836366A patent/FR2414581A1/fr active Granted
- 1978-12-28 CA CA318,731A patent/CA1082019A/en not_active Expired
-
1979
- 1979-01-05 AR AR275084A patent/AR216205A1/es active
- 1979-01-10 FI FI790068A patent/FI69663B/fi not_active Application Discontinuation
- 1979-01-11 SE SE7900265A patent/SE434658B/sv unknown
- 1979-01-11 IT IT19220/79A patent/IT1110068B/it active
- 1979-01-12 ES ES476804A patent/ES476804A1/es not_active Expired
- 1979-01-12 JP JP285679A patent/JPS54151604A/ja active Pending
- 1979-01-15 BR BR7900224A patent/BR7900224A/pt unknown
- 1979-01-16 GB GB791530A patent/GB2012330B/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2951183A1 (de) | 1979-12-19 | 1981-07-09 | Andreas Kufferath KG, 5160 Düren | Verfahren zur beeinflussung eines vorentwaesserten faservlieses auf einem sieb und vorrichtung zur durchfuehrung des verfahrens |
| DE3123131A1 (de) * | 1981-06-11 | 1982-12-30 | J.M. Voith Gmbh, 7920 Heidenheim | "leitwalze mit wasserfuehrungselement fuer ein papiermaschinen-siebband" |
Also Published As
| Publication number | Publication date |
|---|---|
| FI790068A7 (fi) | 1979-07-17 |
| US4176005A (en) | 1979-11-27 |
| ES476804A1 (es) | 1979-05-16 |
| SE434658B (sv) | 1984-08-06 |
| FR2414581A1 (fr) | 1979-08-10 |
| JPS54151604A (en) | 1979-11-29 |
| SE7900265L (sv) | 1979-07-17 |
| CA1082019A (en) | 1980-07-22 |
| FI69663B (fi) | 1985-11-29 |
| AR216205A1 (es) | 1979-11-30 |
| GB2012330B (en) | 1982-12-01 |
| IT7919220A0 (it) | 1979-01-11 |
| DE2810692A1 (de) | 1979-07-19 |
| AT359368B (de) | 1980-11-10 |
| BR7900224A (pt) | 1979-08-14 |
| IT1110068B (it) | 1985-12-23 |
| FR2414581B1 (enExample) | 1984-05-11 |
| GB2012330A (en) | 1979-07-25 |
| ATA39678A (de) | 1980-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2810692B2 (de) | Doppelsiebpapiermaschine | |
| DE2531839C3 (de) | Doppelsiebteil einer Papiermaschine | |
| DE69010976T3 (de) | Papierbahn formendes Verfahren und Vorrichtung. | |
| DE3100713A1 (de) | Papiermaschine mit zwei beweglichen wasserdurchlaessigen entwaesserungsbaendern, z.b. sieben" | |
| DE1786464B2 (de) | Vorrichtung zum Verdichten einer Flach- oder Langmaterialbahn. Ausscheidung aus: 1436919 | |
| EP0438681A1 (de) | Entwässerungsvorrichtung an einem Doppelsiebformer | |
| DE3217860A1 (de) | Zweisieb- formerpartie einer papiermaschine | |
| DE4301103C1 (de) | Siebpartie einer Papiermaschine | |
| DE1931686A1 (de) | Zweisieb-Papiermaschine | |
| DE4418900C2 (de) | Wickelmaschine zum Aufwickeln einer laufenden Papierbahn | |
| DE3708191C2 (enExample) | ||
| DE3306717C2 (de) | Bahnbildungspartie einer Langsiebpartie einer Papiermaschine | |
| AT16049U1 (de) | Siebpartie, insbesondere eine umgebaute siebpartie | |
| EP0837181B1 (de) | Pressenpartie | |
| DE3045279T1 (de) | Method and device in a paper making machine | |
| DE69713104T2 (de) | Doppelsiebformer für eine papiermaschine | |
| DE69824095T2 (de) | Entwässerungsvorrichtung für einen Doppelsiebformer in einer Papiermaschine | |
| EP0735182B1 (de) | Pressenpartie | |
| DE69217073T2 (de) | Entwasserungseinheit mit automatischer schlitzdüse | |
| EP0967323B1 (de) | Doppelsiebformer | |
| DE3014321A1 (de) | Papiermaschine mit einem siebzylinder | |
| DE102016120647B4 (de) | Verfahren zum Betreiben einer Maschine zur Herstellung einer Faserstoffbahn | |
| DE69314495T2 (de) | Verfahren und vorrichtung zum schneiden einer bahn in der nasspartie einer papiermaschine | |
| DE69415338T2 (de) | Formiervorrichtung zur formung einer faserstoffbahn | |
| DE4235102A1 (de) | Doppelsiebformer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| 8230 | Patent withdrawn |