DE2747011C2 - - Google Patents
Info
- Publication number
- DE2747011C2 DE2747011C2 DE2747011A DE2747011A DE2747011C2 DE 2747011 C2 DE2747011 C2 DE 2747011C2 DE 2747011 A DE2747011 A DE 2747011A DE 2747011 A DE2747011 A DE 2747011A DE 2747011 C2 DE2747011 C2 DE 2747011C2
- Authority
- DE
- Germany
- Prior art keywords
- amino
- acid
- hydroxynaphthalene
- parts
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- CLBQHDAKOPHNQI-UHFFFAOYSA-N 3-amino-2-hydroxynaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(O)(=O)=O)=C(O)C(N)=CC2=C1 CLBQHDAKOPHNQI-UHFFFAOYSA-N 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 6
- 238000010168 coupling process Methods 0.000 claims description 6
- 238000005859 coupling reaction Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000000243 solution Substances 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 2
- ZCNCWYFISJTFHB-UHFFFAOYSA-N 4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(NC)=CC=C21 ZCNCWYFISJTFHB-UHFFFAOYSA-N 0.000 description 2
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 2
- HMNPDEGBVWDHAR-UHFFFAOYSA-N 8-aminonaphthalen-1-ol Chemical compound C1=CC(O)=C2C(N)=CC=CC2=C1 HMNPDEGBVWDHAR-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- 239000001044 red dye Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- HIVUAOXLSJITPA-UHFFFAOYSA-N 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=C(S(O)(=O)=O)C(N)=CC=C21 HIVUAOXLSJITPA-UHFFFAOYSA-N 0.000 description 1
- OLCKRGCUQOKQCM-UHFFFAOYSA-N 2-fluoro-1,3,5-triazine Chemical compound FC1=NC=NC=N1 OLCKRGCUQOKQCM-UHFFFAOYSA-N 0.000 description 1
- VNWVMZDJPMCAKD-UHFFFAOYSA-N 3-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1O VNWVMZDJPMCAKD-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- LRDIEHDJWYRVPT-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 LRDIEHDJWYRVPT-UHFFFAOYSA-N 0.000 description 1
- SEHCLGZKORRUKN-UHFFFAOYSA-N 4-hydroxy-6-(methylamino)naphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC)=CC=C21 SEHCLGZKORRUKN-UHFFFAOYSA-N 0.000 description 1
- NRNGQXBLASGPLB-UHFFFAOYSA-N 6-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NCC)=CC=C21 NRNGQXBLASGPLB-UHFFFAOYSA-N 0.000 description 1
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 1
- DXQHKRLJFRUIKF-UHFFFAOYSA-N 7-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(NCC)=CC=C21 DXQHKRLJFRUIKF-UHFFFAOYSA-N 0.000 description 1
- NWYPJANFHLUNFH-UHFFFAOYSA-N 7-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=C(O)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 NWYPJANFHLUNFH-UHFFFAOYSA-N 0.000 description 1
- KSWRZJNADSIDKV-UHFFFAOYSA-N 8-amino-3-hydroxynaphthalene-1,6-disulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 KSWRZJNADSIDKV-UHFFFAOYSA-N 0.000 description 1
- GGZZISOUXJHYOY-UHFFFAOYSA-N 8-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1O GGZZISOUXJHYOY-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- -1 amino compound Chemical class 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/08—Azo dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/44—One nitrogen atom with halogen atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1330776A CH634061A5 (de) | 1976-10-21 | 1976-10-21 | Verfahren zur monoacylierung von aminohydroxynaphthalinsulfonsaeuren mit 2,4,6-trifluor-s-triazin. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2747011A1 DE2747011A1 (de) | 1978-04-27 |
| DE2747011C2 true DE2747011C2 (enExample) | 1990-08-23 |
Family
ID=4391284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772747011 Granted DE2747011A1 (de) | 1976-10-21 | 1977-10-19 | Verfahren zur monoacylierung von aminohydroxynaphtalinsulfonsaeuren mit 2,4,6-triflour-s-triazin |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4189570A (enExample) |
| JP (2) | JPS5353677A (enExample) |
| BE (1) | BE859929A (enExample) |
| BR (1) | BR7707031A (enExample) |
| CA (1) | CA1085394A (enExample) |
| CH (1) | CH634061A5 (enExample) |
| CS (1) | CS194819B2 (enExample) |
| DE (1) | DE2747011A1 (enExample) |
| FR (1) | FR2368479A1 (enExample) |
| GB (1) | GB1544894A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3010502C2 (de) * | 1980-03-19 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihalogentriazinyl-aminonaphthol-Verbindungen |
| JPS6033145B2 (ja) * | 1982-10-27 | 1985-08-01 | 三菱化学株式会社 | 記録液 |
| EP0172790B1 (de) * | 1984-08-21 | 1992-07-29 | Ciba-Geigy Ag | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminonaphtholsulfonsäuren |
| DE3545460A1 (de) * | 1985-12-20 | 1987-07-02 | Bayer Ag | Verfahren zur herstellung von fluortriazinylverbindungen |
| DE3727253A1 (de) * | 1987-08-15 | 1989-02-23 | Bayer Ag | Verfahren zur monoacylierung wasserloeslicher organischer aminoverbindungen mit 2,4,6-trifluortriazin in waessrigem medium |
| DE3917046A1 (de) * | 1989-05-25 | 1990-11-29 | Bayer Ag | Verfahren zur herstellung von substituierten 2,4-diamino-6-fluor-s-triazinen |
| EP0546993A1 (de) * | 1991-12-09 | 1993-06-16 | Ciba-Geigy Ag | Wasserlöschliche Triazinderivate zur photochemischen und thermischen Stabilisierung von Polyamidfasermaterialien |
| EP0682019A1 (de) * | 1994-05-06 | 1995-11-15 | Hoechst Aktiengesellschaft | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminen |
| DE19750701A1 (de) * | 1997-11-15 | 1999-05-20 | Dystar Textilfarben Gmbh & Co | Verfahren zur Umsetzung von fluorsubstituierten Heterocyclen mit Aminen in Gegenwart von Phasentransfer-Katalysatoren |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1625530A (en) * | 1927-04-19 | Intermediate product for the synthesis ob dyes and process op making | ||
| DE1644208C3 (de) | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| DE1810279A1 (de) * | 1968-11-22 | 1970-08-06 | Bayer Ag | Aminonaphthalinsulfonsaeuren |
| US3945989A (en) * | 1969-07-11 | 1976-03-23 | Ciba-Geigy Ag | Fluoro triazine containing water insoluble azo dyestuff |
| CH612448A5 (enExample) * | 1974-12-20 | 1979-07-31 | Ciba Geigy Ag |
-
1976
- 1976-10-21 CH CH1330776A patent/CH634061A5/de not_active IP Right Cessation
-
1977
- 1977-10-13 US US05/841,762 patent/US4189570A/en not_active Expired - Lifetime
- 1977-10-19 CS CS776804A patent/CS194819B2/cs unknown
- 1977-10-19 GB GB43585/77A patent/GB1544894A/en not_active Expired
- 1977-10-19 DE DE19772747011 patent/DE2747011A1/de active Granted
- 1977-10-19 CA CA289,019A patent/CA1085394A/en not_active Expired
- 1977-10-19 FR FR7731524A patent/FR2368479A1/fr active Granted
- 1977-10-20 BR BR7707031A patent/BR7707031A/pt unknown
- 1977-10-20 BE BE181907A patent/BE859929A/xx not_active IP Right Cessation
- 1977-10-21 JP JP12592277A patent/JPS5353677A/ja active Granted
-
1988
- 1988-07-27 JP JP63185704A patent/JPH01163269A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4189570A (en) | 1980-02-19 |
| JPS5353677A (en) | 1978-05-16 |
| FR2368479B1 (enExample) | 1980-06-06 |
| CA1085394A (en) | 1980-09-09 |
| JPH0130826B2 (enExample) | 1989-06-22 |
| JPH01163269A (ja) | 1989-06-27 |
| FR2368479A1 (fr) | 1978-05-19 |
| CH634061A5 (de) | 1983-01-14 |
| BE859929A (fr) | 1978-04-20 |
| JPH0338306B2 (enExample) | 1991-06-10 |
| CS194819B2 (en) | 1979-12-31 |
| DE2747011A1 (de) | 1978-04-27 |
| BR7707031A (pt) | 1978-07-18 |
| GB1544894A (en) | 1979-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2747011C2 (enExample) | ||
| EP0014844B1 (de) | Fluortriazin-Derivate, Verfahren zur Herstellung von Fluortriazin-Derivaten und von Reaktivfarbstoffen und deren Verwendung | |
| EP0172790B1 (de) | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminonaphtholsulfonsäuren | |
| DE2746109A1 (de) | Verfahren zur monoacylierung wasserloeslicher organischer aminoverbindungen | |
| DE69311402T2 (de) | Zusammensetzungen und wässrige Lösungen reaktiver Azofarbstoffe | |
| EP0145655B1 (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| DE69215399T3 (de) | Bismuth oxychloride nacreous pigment having improved weather fastness and the production thereof | |
| DE2831994A1 (de) | Verfahren zur herstellung von tobias- saeure | |
| DE69810061T2 (de) | Verfahren zur Reinigung einer Bromverbindung | |
| EP0458110A1 (de) | Verfahren zur kontinuierlichen Umsetzung von Cyanurfluorid mit Aminen. | |
| DE69116829T2 (de) | Wasserlösliche Thioharnstoffdioxidderivate und Verfahren zu ihrer Herstellung | |
| CH681722A5 (enExample) | ||
| DE2932951A1 (de) | Verfahren zur herstellung von hexamethylen-bis-dicyandiamid | |
| DD275678A1 (de) | Verfahren zur gewinnung von cyanursaeure | |
| EP0519246B1 (de) | Verfahren zur Herstellung von N,N'-bis-[7-(4-hydroxy-2-sulfo)naphthyl]-harnstoff | |
| EP0813518B1 (de) | Verfahren zur herstellung von alpha,beta-diaminoacrylnitrilen | |
| DE3927470A1 (de) | Waessrige loesungen von natriumsalzen des trimercapto-s-triazins, deren herstellung und verwendung | |
| DE1238330B (de) | Verfahren zur Herstellung photographischer Silberhalogenidemulsionen nach der Flockungsmethode | |
| DE1146064B (de) | Verfahren zur Herstellung von Monohalogen-amino-1, 3, 5-triazinen | |
| DE2022292A1 (de) | Verfahren zur Herstellung von Methacrylamid | |
| DD275694A1 (de) | Verfahren zur verwertung von nebenprodukten der synthese von 2,4-dioxohexahydro-1,3,5-triazin | |
| DE2939552A1 (de) | Verfahren zur herstellung von chlor-bis(alkylamino)-s-triazinen | |
| DE1745135B2 (de) | Verfahren zur Herstellung eines Polymeren | |
| CH630107A5 (en) | Process for monoacylating water-soluble organic chromophoric amino compounds | |
| DE1032731B (de) | Verfahren zur selektiven Sulfatierung von Aminoalkoholen in der Aminogruppe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |