DE2744538A1 - Photographisches material - Google Patents
Photographisches materialInfo
- Publication number
- DE2744538A1 DE2744538A1 DE19772744538 DE2744538A DE2744538A1 DE 2744538 A1 DE2744538 A1 DE 2744538A1 DE 19772744538 DE19772744538 DE 19772744538 DE 2744538 A DE2744538 A DE 2744538A DE 2744538 A1 DE2744538 A1 DE 2744538A1
- Authority
- DE
- Germany
- Prior art keywords
- antistatic
- notreadable
- power
- photographic material
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000463 material Substances 0.000 title claims description 61
- 229920001577 copolymer Polymers 0.000 claims description 81
- 239000011230 binding agent Substances 0.000 claims description 53
- 239000000839 emulsion Substances 0.000 claims description 32
- 239000011248 coating agent Substances 0.000 claims description 21
- 238000000576 coating method Methods 0.000 claims description 21
- 230000002209 hydrophobic effect Effects 0.000 claims description 19
- -1 silver halide Chemical class 0.000 claims description 19
- 230000005855 radiation Effects 0.000 claims description 11
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 claims description 8
- 239000000178 monomer Substances 0.000 claims description 8
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 claims description 7
- VXSASNNBOYCZMY-UHFFFAOYSA-M ethenyl-dimethyl-(2-phenylethyl)azanium;chloride Chemical compound [Cl-].C=C[N+](C)(C)CCC1=CC=CC=C1 VXSASNNBOYCZMY-UHFFFAOYSA-M 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229920002678 cellulose Polymers 0.000 claims description 6
- 239000001913 cellulose Substances 0.000 claims description 6
- 229910052709 silver Inorganic materials 0.000 claims description 6
- 239000004332 silver Substances 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229920001477 hydrophilic polymer Polymers 0.000 claims description 2
- 125000004437 phosphorous atom Chemical group 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 2
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 104
- 238000012360 testing method Methods 0.000 description 38
- 239000008199 coating composition Substances 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 229920000642 polymer Polymers 0.000 description 16
- 239000002904 solvent Substances 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 239000000758 substrate Substances 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- 230000001143 conditioned effect Effects 0.000 description 8
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical group C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000011161 development Methods 0.000 description 5
- 239000004816 latex Substances 0.000 description 5
- 229920000126 latex Polymers 0.000 description 5
- 238000005299 abrasion Methods 0.000 description 4
- 229910010271 silicon carbide Inorganic materials 0.000 description 4
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- SJNALLRHIVGIBI-UHFFFAOYSA-N allyl cyanide Chemical compound C=CCC#N SJNALLRHIVGIBI-UHFFFAOYSA-N 0.000 description 2
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 244000145841 kine Species 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- BVWUEIUNONATML-UHFFFAOYSA-N n-benzylethenamine Chemical group C=CNCC1=CC=CC=C1 BVWUEIUNONATML-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000011179 visual inspection Methods 0.000 description 2
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 description 1
- HMDQPBSDHHTRNI-UHFFFAOYSA-N 1-(chloromethyl)-3-ethenylbenzene Chemical compound ClCC1=CC=CC(C=C)=C1 HMDQPBSDHHTRNI-UHFFFAOYSA-N 0.000 description 1
- ZRZHXNCATOYMJH-UHFFFAOYSA-N 1-(chloromethyl)-4-ethenylbenzene Chemical compound ClCC1=CC=C(C=C)C=C1 ZRZHXNCATOYMJH-UHFFFAOYSA-N 0.000 description 1
- JONTXEXBTWSUKE-UHFFFAOYSA-N 2-(2-aminoethylsulfanyl)ethanamine Chemical compound NCCSCCN JONTXEXBTWSUKE-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GROXSGRIVDMIEN-UHFFFAOYSA-N 2-methyl-n-prop-2-enylprop-2-enamide Chemical compound CC(=C)C(=O)NCC=C GROXSGRIVDMIEN-UHFFFAOYSA-N 0.000 description 1
- FQMIAEWUVYWVNB-UHFFFAOYSA-N 3-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OC(C)CCOC(=O)C=C FQMIAEWUVYWVNB-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical group CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- LEVWYRKDKASIDU-IMJSIDKUSA-N L-cystine Chemical compound [O-]C(=O)[C@@H]([NH3+])CSSC[C@H]([NH3+])C([O-])=O LEVWYRKDKASIDU-IMJSIDKUSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 235000016720 allyl isothiocyanate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229920006318 anionic polymer Polymers 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OIPQUBBCOVJSNS-UHFFFAOYSA-L bromo(iodo)silver Chemical compound Br[Ag]I OIPQUBBCOVJSNS-UHFFFAOYSA-L 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229920006317 cationic polymer Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- PKCHODKZKBAVIJ-UHFFFAOYSA-L chloro(iodo)silver Chemical compound Cl[Ag]I PKCHODKZKBAVIJ-UHFFFAOYSA-L 0.000 description 1
- RCTFHBWTYQOVGJ-UHFFFAOYSA-N chloroform;dichloromethane Chemical compound ClCCl.ClC(Cl)Cl RCTFHBWTYQOVGJ-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 229960003067 cystine Drugs 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000020280 flat white Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002344 gold compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- BHGCNGDTJZDAEX-UHFFFAOYSA-N n,n-dimethylformamide;propan-2-ol Chemical compound CC(C)O.CN(C)C=O BHGCNGDTJZDAEX-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052594 sapphire Inorganic materials 0.000 description 1
- 239000010980 sapphire Substances 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/76—Photosensitive materials characterised by the base or auxiliary layers
- G03C1/85—Photosensitive materials characterised by the base or auxiliary layers characterised by antistatic additives or coatings
- G03C1/89—Macromolecular substances therefor
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Laminated Bodies (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/729,554 US4070189A (en) | 1976-10-04 | 1976-10-04 | Silver halide element with an antistatic layer |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2744538A1 true DE2744538A1 (de) | 1978-04-06 |
| DE2744538C2 DE2744538C2 (enExample) | 1989-07-20 |
Family
ID=24931572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772744538 Granted DE2744538A1 (de) | 1976-10-04 | 1977-10-04 | Photographisches material |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4070189A (enExample) |
| JP (1) | JPS6051693B2 (enExample) |
| AU (1) | AU514463B2 (enExample) |
| BR (1) | BR7706585A (enExample) |
| CA (1) | CA1095788A (enExample) |
| CH (1) | CH624493A5 (enExample) |
| DE (1) | DE2744538A1 (enExample) |
| FR (1) | FR2366597A1 (enExample) |
| GB (1) | GB1593332A (enExample) |
| MX (1) | MX147443A (enExample) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2800466C3 (de) * | 1978-01-05 | 1981-12-03 | Agfa-Gevaert Ag, 5090 Leverkusen | Photographisches Material |
| JPS5856858B2 (ja) * | 1978-10-24 | 1983-12-16 | 富士写真フイルム株式会社 | 帯電防止されたハロゲン化銀写真感光材料 |
| US4294739A (en) * | 1979-04-26 | 1981-10-13 | Eastman Kodak Company | Antistatic compositions comprising crosslinkable latex binders |
| GB2080559B (en) * | 1980-06-25 | 1983-10-12 | Fuji Photo Film Co Ltd | Silver halide photographic materials |
| US4431727A (en) * | 1982-06-14 | 1984-02-14 | Eastman Kodak Company | Protective overcoats for photographic elements |
| US4404276A (en) * | 1982-06-14 | 1983-09-13 | Eastman Kodak Company | Polymer compositions containing crosslinked silicone polycarbinol and having a low coefficient of friction |
| US4473676A (en) * | 1982-06-14 | 1984-09-25 | Eastman Kodak Company | Polymer compositions having a low coefficient of friction |
| USRE32514E (en) * | 1982-06-14 | 1987-10-06 | Eastman Kodak Company | Polymer compositions having a low coefficient of friction |
| US4575838A (en) * | 1984-02-29 | 1986-03-11 | Rca Corporation | Sandwich-type capacitive electronic discs |
| JPS61145544A (ja) * | 1984-12-19 | 1986-07-03 | Fuji Photo Film Co Ltd | 写真材料 |
| JPS61209445A (ja) * | 1985-03-08 | 1986-09-17 | Fuji Photo Film Co Ltd | 写真要素 |
| JPS61223736A (ja) * | 1985-03-28 | 1986-10-04 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| IT1223479B (it) * | 1987-12-16 | 1990-09-19 | Minnesota Mining & Mfg | Supporto fotografico antistatico ed elemento sensibile alla luce |
| US4839262A (en) * | 1988-03-01 | 1989-06-13 | Eastman Kodak Company | Bleach-accelerating compositions comprising sorbitan ester compounds and use thereof in photographic color processing |
| US5004669A (en) * | 1988-10-31 | 1991-04-02 | Konica Corporation | Light-sensitive silver halide photographic material |
| US5121285A (en) * | 1991-02-11 | 1992-06-09 | Eastman Kodak Company | Method and apparatus for eliminating residual charge on plastic sheets having an image formed thereon by a photocopier |
| JP2779724B2 (ja) * | 1992-01-17 | 1998-07-23 | 富士写真フイルム株式会社 | カチオン性高分子化合物 |
| US5326688A (en) * | 1993-05-27 | 1994-07-05 | Eastman Kodak Company | Coating compositions for antistatic layers for photographic elements |
| US5466567A (en) * | 1994-10-28 | 1995-11-14 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing conductive fine particles, a film-forming hydrophilic colloid and pre-crosslinked gelatin particles |
| US5529884A (en) | 1994-12-09 | 1996-06-25 | Eastman Kodak Company | Backing layer for laser ablative imaging |
| US6329128B1 (en) * | 1995-05-01 | 2001-12-11 | Eastman Kodak Company | Stable antihalation materials for photographic and photothermographic elements |
| US5723273A (en) * | 1996-09-11 | 1998-03-03 | Eastman Kodak Company | Protective overcoat for antistatic layer |
| US5700623A (en) * | 1997-01-21 | 1997-12-23 | Eastman Kodak Company | Thermally stable photographic bar code label containing an antistatic layer |
| US5766836A (en) * | 1997-01-28 | 1998-06-16 | Eastman Kodak Company | Three-layer backing for photographic element |
| US5747232A (en) * | 1997-02-27 | 1998-05-05 | Eastman Kodak Company | Motion imaging film comprising a carbon black-containing backing and a process surviving conductive subbing layer |
| US6225039B1 (en) | 1998-10-15 | 2001-05-01 | Eastman Kodak Company | Imaging element containing an electrically-conductive layer containing a sulfonated polyurethane and a transparent magnetic recording layer |
| US6096491A (en) * | 1998-10-15 | 2000-08-01 | Eastman Kodak Company | Antistatic layer for imaging element |
| US6124083A (en) * | 1998-10-15 | 2000-09-26 | Eastman Kodak Company | Antistatic layer with electrically conducting polymer for imaging element |
| US6300049B2 (en) | 1998-10-15 | 2001-10-09 | Eastman Kodak Company | Imaging element containing an electrically-conductive layer |
| US6048679A (en) * | 1998-12-28 | 2000-04-11 | Eastman Kodak Company | Antistatic layer coating compositions |
| US6077655A (en) * | 1999-03-25 | 2000-06-20 | Eastman Kodak Company | Antistatic layer for imaging element containing electrically conductive polymer and modified gelatin |
| US6187522B1 (en) | 1999-03-25 | 2001-02-13 | Eastman Kodak Company | Scratch resistant antistatic layer for imaging elements |
| US6140030A (en) * | 1999-05-06 | 2000-10-31 | Eastman Kodak Company | Photographic element containing two electrically-conductive agents |
| US6083674A (en) * | 1999-06-21 | 2000-07-04 | Eastman Kodak Company | Antistatic layer for lenticular surface |
| US20050065284A1 (en) * | 1999-08-06 | 2005-03-24 | Venkataram Krishnan | Novel latex compositions for deposition on various substrates |
| EP1081546A1 (en) | 1999-08-30 | 2001-03-07 | Eastman Kodak Company | Coating composition containing electrically-conductive polymer and solvent mixture |
| US6162596A (en) * | 1999-08-30 | 2000-12-19 | Eastman Kodak Company | Imaging elements containing an electrically-conductive layer comprising polythiophene and a cellulosic polymer binder |
| JP2003128819A (ja) * | 2001-10-29 | 2003-05-08 | Mitsubishi Polyester Film Copp | 帯電防止フィルム |
| JP2003155366A (ja) * | 2001-11-26 | 2003-05-27 | Mitsubishi Polyester Film Copp | 帯電防止フィルム |
| US20030141487A1 (en) * | 2001-12-26 | 2003-07-31 | Eastman Kodak Company | Composition containing electronically conductive polymer particles |
| US6800429B2 (en) | 2001-12-26 | 2004-10-05 | Eastman Kodak Company | Imaging materials with conductive layers containing electronically conductive polymer particles |
| US7163746B2 (en) | 2002-06-12 | 2007-01-16 | Eastman Kodak Company | Conductive polymers on acicular substrates |
| US7195036B2 (en) * | 2002-11-04 | 2007-03-27 | The Regents Of The University Of Michigan | Thermal micro-valves for micro-integrated devices |
| US7781498B2 (en) * | 2003-07-03 | 2010-08-24 | Mallard Creek Polymers, Inc. | Cationic latex as a carrier for bioactive ingredients and methods for making and using the same |
| US7981946B2 (en) * | 2003-07-03 | 2011-07-19 | Mallard Creek Polymers, Inc. | Antimicrobial and antistatic polymers and methods of using such polymers on various substrates |
| US7491753B2 (en) | 2003-07-03 | 2009-02-17 | Mallard Creek Polymers, Inc. | Antimicrobial and antistatic polymers and methods of using such polymers on various substrates |
| US6893790B2 (en) * | 2003-08-26 | 2005-05-17 | Eastman Kodak Company | Photopatterning of conductive electrode layers containing electrically-conductive polymer particles |
| US7033713B2 (en) * | 2003-08-26 | 2006-04-25 | Eastman Kodak | Electrographic patterning of conductive electrode layers containing electrically-conductive polymeric materials |
| US7163734B2 (en) | 2003-08-26 | 2007-01-16 | Eastman Kodak Company | Patterning of electrically conductive layers by ink printing methods |
| US20060062983A1 (en) * | 2004-09-17 | 2006-03-23 | Irvin Glen C Jr | Coatable conductive polyethylenedioxythiophene with carbon nanotubes |
| US7427441B2 (en) * | 2004-09-17 | 2008-09-23 | Eastman Kodak Co | Transparent polymeric coated conductor |
| US7781047B2 (en) * | 2004-10-21 | 2010-08-24 | Eastman Kodak Company | Polymeric conductor donor and transfer method |
| US7414313B2 (en) * | 2004-12-22 | 2008-08-19 | Eastman Kodak Company | Polymeric conductor donor and transfer method |
| US7638211B2 (en) * | 2005-02-09 | 2009-12-29 | Seagate Technology Llc | Mass storage apparatus using fluorine mediated self-assembly monolayers of nanoparticles recording medium |
| US7630029B2 (en) * | 2005-02-16 | 2009-12-08 | Industrial Technology Research Institute | Conductive absorption layer for flexible displays |
| US7557875B2 (en) * | 2005-03-22 | 2009-07-07 | Industrial Technology Research Institute | High performance flexible display with improved mechanical properties having electrically modulated material mixed with binder material in a ratio between 6:1 and 0.5:1 |
| US7438832B2 (en) * | 2005-03-29 | 2008-10-21 | Eastman Kodak Company | Ionic liquid and electronically conductive polymer mixtures |
| US7564528B2 (en) * | 2005-05-20 | 2009-07-21 | Industrial Technology Research Institute | Conductive layer to reduce drive voltage in displays |
| US7645497B2 (en) * | 2005-06-02 | 2010-01-12 | Eastman Kodak Company | Multi-layer conductor with carbon nanotubes |
| US7593004B2 (en) * | 2005-06-02 | 2009-09-22 | Eastman Kodak Company | Touchscreen with conductive layer comprising carbon nanotubes |
| US7535462B2 (en) * | 2005-06-02 | 2009-05-19 | Eastman Kodak Company | Touchscreen with one carbon nanotube conductive layer |
| US20070048249A1 (en) | 2005-08-24 | 2007-03-01 | Purdue Research Foundation | Hydrophilized bactericidal polymers |
| US7410825B2 (en) * | 2005-09-15 | 2008-08-12 | Eastman Kodak Company | Metal and electronically conductive polymer transfer |
| US20070141244A1 (en) * | 2005-12-19 | 2007-06-21 | Eastman Kodak Company | Method of making a polarizer plate |
| US7732007B2 (en) * | 2005-12-19 | 2010-06-08 | Eastman Kodak Company | Method of making a polarizer plate |
| US20080007518A1 (en) * | 2006-06-23 | 2008-01-10 | Debasis Majumdar | Conductive polymer coating with improved aging stability |
| US20080233062A1 (en) * | 2006-08-24 | 2008-09-25 | Venkataram Krishnan | Cationic latex as a carrier for active ingredients and methods for making and using the same |
| KR20090089843A (ko) | 2006-08-24 | 2009-08-24 | 맬러드 크리크 폴리머스 아이엔씨. | 생체활성 성분용 캐리어로서의 음이온성 라텍스 |
| US20080207774A1 (en) * | 2006-08-24 | 2008-08-28 | Venkataram Krishnan | Anionic latex as a carrier for active ingredients and methods for making and using the same |
| JP5404397B2 (ja) * | 2006-08-24 | 2014-01-29 | マラード クリーク ポリマーズ,インコーポレーテッド | 生物活性成分用の担体としてのカチオン性ラテックスならびにその製造方法および使用方法 |
| US20080264682A1 (en) * | 2007-04-24 | 2008-10-30 | John Catron | Substrate and negative imaging method for providing transparent conducting patterns |
| US8258078B2 (en) | 2009-08-27 | 2012-09-04 | Eastman Kodak Company | Image receiver elements |
| US8628840B2 (en) | 2011-06-29 | 2014-01-14 | Eastman Kodak Company | Electronically conductive laminate donor element |
| US8865298B2 (en) | 2011-06-29 | 2014-10-21 | Eastman Kodak Company | Article with metal grid composite and methods of preparing |
| US8709194B1 (en) | 2013-02-25 | 2014-04-29 | Eastman Kodak Company | Assembling an electrode device |
| US9017927B2 (en) | 2013-02-25 | 2015-04-28 | Eastman Kodak Company | Patterning of transparent conductive coatings |
| EP3629731A1 (en) | 2017-05-27 | 2020-04-08 | Poly Group LLC | Dispersible antimicrobial complex and coatings therefrom |
| WO2018232417A1 (en) | 2017-06-16 | 2018-12-20 | Poly Group LLC | Polymeric antimicrobial surfactant |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1547905A1 (de) * | 1965-05-06 | 1969-12-18 | Gen Aniline & Film Corp | Photographischer Film mit antistatischen Eigenschaften |
| US3958995A (en) * | 1974-11-19 | 1976-05-25 | Eastman Kodak Company | Photographic elements containing cross-linked mordants and processes of preparing said elements |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1301661A (enExample) * | 1969-01-29 | 1973-01-04 | ||
| BE757467A (enExample) * | 1969-10-29 | 1971-04-14 | Agfa Gevaert Nv | |
| US3674711A (en) * | 1969-12-10 | 1972-07-04 | Varian Associates | Electrically conductive transparent plastic material |
| US3798032A (en) * | 1971-10-06 | 1974-03-19 | Weyerhaeuser Co | Electroconductive coating, electrostatographic copy sheet, and methods of making and using the same |
| US3932179A (en) * | 1973-05-31 | 1976-01-13 | Eastman Kodak Company | Electrophotographic element containing a polymeric multi-phase interlayer |
-
1976
- 1976-10-04 US US05/729,554 patent/US4070189A/en not_active Expired - Lifetime
-
1977
- 1977-09-21 MX MX170648A patent/MX147443A/es unknown
- 1977-10-03 BR BR7706585A patent/BR7706585A/pt unknown
- 1977-10-03 CH CH1207577A patent/CH624493A5/fr not_active IP Right Cessation
- 1977-10-03 CA CA287,946A patent/CA1095788A/en not_active Expired
- 1977-10-04 GB GB41244/77A patent/GB1593332A/en not_active Expired
- 1977-10-04 FR FR7729736A patent/FR2366597A1/fr active Granted
- 1977-10-04 AU AU29331/77A patent/AU514463B2/en not_active Expired
- 1977-10-04 DE DE19772744538 patent/DE2744538A1/de active Granted
- 1977-10-04 JP JP52119388A patent/JPS6051693B2/ja not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1547905A1 (de) * | 1965-05-06 | 1969-12-18 | Gen Aniline & Film Corp | Photographischer Film mit antistatischen Eigenschaften |
| US3958995A (en) * | 1974-11-19 | 1976-05-25 | Eastman Kodak Company | Photographic elements containing cross-linked mordants and processes of preparing said elements |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2366597B1 (enExample) | 1980-03-21 |
| FR2366597A1 (fr) | 1978-04-28 |
| JPS6051693B2 (ja) | 1985-11-15 |
| JPS5345231A (en) | 1978-04-22 |
| CA1095788A (en) | 1981-02-17 |
| US4070189A (en) | 1978-01-24 |
| MX147443A (es) | 1982-12-03 |
| BR7706585A (pt) | 1978-07-18 |
| CH624493A5 (enExample) | 1981-07-31 |
| AU514463B2 (en) | 1981-02-12 |
| DE2744538C2 (enExample) | 1989-07-20 |
| GB1593332A (en) | 1981-07-15 |
| AU2933177A (en) | 1979-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2744538A1 (de) | Photographisches material | |
| DE2551786C3 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE68920416T2 (de) | Photographische, lichtempfindliche Silberhalogenidmaterialien. | |
| DE69107072T2 (de) | Vernetzte leitende polymere und diese enthaltende antistatische beschichtungen. | |
| DE1622274A1 (de) | Photographisches Material mit verbesserter Gleitfaehigkeit | |
| DE69116508T2 (de) | Zusammensetzungen für schutzbeschichtung und photographische elemente, die diese enthalten | |
| DE69608840T2 (de) | Photographische Elemente mit verbesserter Cinch-Kratzfestigkeit | |
| DE2003993C3 (de) | Mehrschichtiges photographisches Aufzeichnungsmaterial | |
| DE1447669A1 (de) | Verfahren zur Herstellung von lichtempfindlichem Material | |
| EP0093924A2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2622386A1 (de) | Verfahren zum aufbringen von haftschichten auf kunststoffolien | |
| DE3601657C2 (de) | Photographisches Aufzeichnungsmaterial für das Silbersalzdiffusionsübertragungsverfahren | |
| DE2249471A1 (de) | Photographisches, lichtempfindliches silberhalogenidelement | |
| DE1547744A1 (de) | Photographisches Material | |
| DE3884359T2 (de) | Antistatischer photographischer Träger und lichtempfindliches Element. | |
| DE69409030T2 (de) | Antistatische Beschichtungszusammensetzungen und daraus hergestellte antistatische Schichten | |
| DE69121202T2 (de) | Vernetzte leitende polymere und diese enthaltende antistatische beschichtungen | |
| DE69215508T2 (de) | Antistatische lichthofschatzschicht mit verbesserten eigenschaften | |
| DE1158365B (de) | Photographische Gelatine-Silberhalogenidemulsionen, Emulsionsschichten und Materialien | |
| DE1302345C2 (de) | Photographische silberhalogenidemulsion | |
| DE69123113T2 (de) | Photographisches lichtempfindliches Silbenhalogenidmaterial | |
| DE69324564T2 (de) | Photographisches Silberhalogenidmaterial, das monodisperse Polymerteilchen enthält | |
| DE69402464T2 (de) | Verfahren zur Herstellung antistatischer Schichten für photographische Elemente | |
| DE69006777T2 (de) | Antistatische Schicht. | |
| DE2745287A1 (de) | Photographisches aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BRANDES, J., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |