DE2732782A1 - Verfahren zur gewinnung von phosphatsalzen aus waessrigen phosphorsaeureloesungen - Google Patents
Verfahren zur gewinnung von phosphatsalzen aus waessrigen phosphorsaeureloesungenInfo
- Publication number
- DE2732782A1 DE2732782A1 DE19772732782 DE2732782A DE2732782A1 DE 2732782 A1 DE2732782 A1 DE 2732782A1 DE 19772732782 DE19772732782 DE 19772732782 DE 2732782 A DE2732782 A DE 2732782A DE 2732782 A1 DE2732782 A1 DE 2732782A1
- Authority
- DE
- Germany
- Prior art keywords
- aqueous
- solvent
- phase
- ammonia
- phosphoric acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical class OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title claims description 85
- 229910000147 aluminium phosphate Inorganic materials 0.000 title claims description 40
- 238000000034 method Methods 0.000 title claims description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 76
- 239000002904 solvent Substances 0.000 claims description 58
- 229910021529 ammonia Inorganic materials 0.000 claims description 37
- 239000010410 layer Substances 0.000 claims description 37
- 239000008346 aqueous phase Substances 0.000 claims description 33
- 239000012071 phase Substances 0.000 claims description 29
- 229910052783 alkali metal Inorganic materials 0.000 claims description 23
- 150000001340 alkali metals Chemical class 0.000 claims description 22
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 17
- 239000003337 fertilizer Substances 0.000 claims description 17
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 239000002585 base Substances 0.000 claims description 13
- 239000003960 organic solvent Substances 0.000 claims description 13
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 13
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical group CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 9
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 9
- 150000003863 ammonium salts Chemical class 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 9
- -1 ammonium ions Chemical class 0.000 claims description 8
- 239000012535 impurity Substances 0.000 claims description 8
- 239000012044 organic layer Substances 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- 239000000243 solution Substances 0.000 claims description 8
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 claims description 7
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- 235000019837 monoammonium phosphate Nutrition 0.000 claims description 7
- 238000009835 boiling Methods 0.000 claims description 6
- 239000011260 aqueous acid Substances 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 claims description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001341 alkaline earth metal compounds Chemical class 0.000 claims description 4
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 claims description 4
- 150000007514 bases Chemical class 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 230000007935 neutral effect Effects 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000011973 solid acid Substances 0.000 claims description 2
- 239000003125 aqueous solvent Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- 239000002253 acid Substances 0.000 description 14
- 238000000605 extraction Methods 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 239000004254 Ammonium phosphate Substances 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 4
- 235000019289 ammonium phosphates Nutrition 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 150000001983 dialkylethers Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 3
- 150000003112 potassium compounds Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- ZRIUUUJAJJNDSS-UHFFFAOYSA-N ammonium phosphates Chemical class [NH4+].[NH4+].[NH4+].[O-]P([O-])([O-])=O ZRIUUUJAJJNDSS-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 229910052585 phosphate mineral Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- YVZLYNHKJASIHA-UHFFFAOYSA-L [Na+].[K+].OP(O)([O-])=O.OP(O)([O-])=O Chemical compound [Na+].[K+].OP(O)([O-])=O.OP(O)([O-])=O YVZLYNHKJASIHA-UHFFFAOYSA-L 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- BGNTUSKZDOUZCZ-UHFFFAOYSA-N tris(1-butoxyethyl) phosphate Chemical compound CCCCOC(C)OP(=O)(OC(C)OCCCC)OC(C)OCCCC BGNTUSKZDOUZCZ-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B7/00—Fertilisers based essentially on alkali or ammonium orthophosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB31257/76A GB1593970A (en) | 1977-10-27 | 1977-10-27 | Process for preparing phosphate products |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2732782A1 true DE2732782A1 (de) | 1978-02-02 |
Family
ID=10320392
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772732782 Withdrawn DE2732782A1 (de) | 1977-10-27 | 1977-07-20 | Verfahren zur gewinnung von phosphatsalzen aus waessrigen phosphorsaeureloesungen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4132540A (OSRAM) |
| JP (1) | JPS5315298A (OSRAM) |
| AU (1) | AU512538B2 (OSRAM) |
| BE (1) | BE857146A (OSRAM) |
| CA (1) | CA1105672A (OSRAM) |
| DE (1) | DE2732782A1 (OSRAM) |
| FR (1) | FR2359790A1 (OSRAM) |
| GB (1) | GB1593970A (OSRAM) |
| IL (1) | IL52552A (OSRAM) |
| IT (1) | IT1082793B (OSRAM) |
| NL (1) | NL7708009A (OSRAM) |
| ZA (1) | ZA774159B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4275038A (en) * | 1979-03-01 | 1981-06-23 | Occidental Research Corporation | Process for treating loaded extractant from purification of phosphoric acid by extraction and recovering nutrients |
| JPS56105797A (en) * | 1980-01-28 | 1981-08-22 | Kubota Ltd | Microorganism filtration equipment |
| US4311681A (en) * | 1980-05-19 | 1982-01-19 | Fmc Corporation | Method of regenerating phosphoric acid extraction solvent |
| DE3413020A1 (de) * | 1984-04-06 | 1985-10-17 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung einer alkaliphosphatloesung |
| JPS6221034A (ja) * | 1985-07-19 | 1987-01-29 | Junkosha Co Ltd | 漏液検知センサ |
| US4751066A (en) * | 1986-05-08 | 1988-06-14 | Fmc Corporation | Process for preparing alkali metal phosphate |
| US4676963A (en) * | 1986-05-09 | 1987-06-30 | Fmc Corporation | Manufacture of sodium tripolyphosphate from wet acid |
| US4780295A (en) * | 1987-07-06 | 1988-10-25 | Fmc Corporation | Process for purifying phosphoric acid |
| SE536607C2 (sv) * | 2012-06-21 | 2014-03-25 | Easymining Sweden Ab | Framställning av ammoniumfosfater |
| EP4165001A4 (en) * | 2020-06-12 | 2025-11-05 | Easymining Sweden Ab | PRODUCTION OF POTASSIUM PHOSPHATES |
| CN115403018B (zh) * | 2022-08-01 | 2024-01-30 | 深圳市德方纳米科技股份有限公司 | 利用高杂磷酸制备磷酸铁的方法和正极材料的制备方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA672008A (en) * | 1963-10-08 | C. Gattiker David | Method of producing phosphoric acid | |
| US3019099A (en) * | 1959-06-10 | 1962-01-30 | Tennessee Valley Authority | Manufacture of fluid fertilizer from wet-process phosphoric acid |
| GB974610A (en) * | 1962-05-24 | 1964-11-04 | Canadian Ind | Purification of phosphoric acid |
| US3367738A (en) * | 1963-09-23 | 1968-02-06 | Tennessee Corp | Process for purifying wet process phosphoric acid with ethyl ether |
| GB1142719A (en) * | 1968-10-24 | 1969-02-12 | Israel Mining Ind Inst For Res | Phosphoric acid recovery |
| US3956465A (en) * | 1970-06-12 | 1976-05-11 | Azote Et Produits Chimiques S.A. | Solvent purification of wet process phosphoric acid |
| DE2029564C3 (de) * | 1970-06-16 | 1978-06-22 | Giulini Chemie Gmbh, 6700 Ludwigshafen | Verfahren zur Herstellung von reinen Alkaliphosphaten aus Rohphosphorsäure |
| US3707357A (en) * | 1971-03-23 | 1972-12-26 | United States Steel Corp | Wet-process phosphoric acid extraction including separating solvent from extract by freezing solvent |
| IL42065A (en) * | 1972-04-26 | 1977-07-31 | Albright & Wilson | Purification of phosphoric acid |
| SU424849A1 (ru) * | 1972-05-12 | 1974-04-25 | Б. Н. Ласкорин, Ш. Голынко , Г. К. Целпщев | СПОСОБ ПОЛУЧЕНИЯ ФОСФАТОВ АММОПИЯ1 ,*f :'й г- '••^'•, • ,. Г^-:'' • |Ф1>&1Д ;. .'.Mi.; i•:^J |
| US3813233A (en) * | 1972-08-28 | 1974-05-28 | Tennessee Valley Authority | Production of suspension fertilizers from wet-process orthophosphoric acids |
| IL42774A (en) * | 1973-07-18 | 1976-07-30 | Imi Inst For Res & Dev | Purification of phosphoric acid |
| US3975178A (en) * | 1973-10-12 | 1976-08-17 | Tennessee Valley Authority | Purification of wet-process phosphoric acid with methanol and ammonia |
| US4024225A (en) * | 1973-11-02 | 1977-05-17 | United States Steel Corporation | Method of making high purity alkali metal phosphates from wet-process phosphoric acid |
| US3937783A (en) * | 1974-02-21 | 1976-02-10 | Allied Chemical Corporation | Recovery of fluorine, uranium and rare earth metal values from phosphoric acid by-product brine raffinate |
| US3926610A (en) * | 1974-06-10 | 1975-12-16 | Phillips Petroleum Co | Removal of fertilizer precipitate |
| US3985538A (en) * | 1974-10-24 | 1976-10-12 | Tennessee Valley Authority | Pipe reactor-continuous ammoniator process for production of granular phosphates |
| US3988140A (en) * | 1975-01-30 | 1976-10-26 | Burns Tom V | Process for making stable sludge-free ammonium polyphosphate fertilizer solutions |
| GB1483853A (en) * | 1975-01-30 | 1977-08-24 | Scottish Agricultural Ind Ltd | Manufacture of solid ammonium phosphate |
| US3993733A (en) * | 1975-08-14 | 1976-11-23 | Stauffer Chemical Company | Food grade alkali metal phosphates from wet process H3 PO4 |
-
1977
- 1977-07-11 ZA ZA00774159A patent/ZA774159B/xx unknown
- 1977-07-18 IL IL7752552A patent/IL52552A/xx unknown
- 1977-07-18 US US05/816,891 patent/US4132540A/en not_active Expired - Lifetime
- 1977-07-18 CA CA282,912A patent/CA1105672A/en not_active Expired
- 1977-07-19 NL NL7708009A patent/NL7708009A/xx not_active Application Discontinuation
- 1977-07-20 DE DE19772732782 patent/DE2732782A1/de not_active Withdrawn
- 1977-07-26 BE BE179628A patent/BE857146A/xx unknown
- 1977-07-26 IT IT6873977A patent/IT1082793B/it active
- 1977-07-26 FR FR7722989A patent/FR2359790A1/fr active Granted
- 1977-07-26 JP JP8891677A patent/JPS5315298A/ja active Pending
- 1977-07-26 AU AU27321/77A patent/AU512538B2/en not_active Expired
- 1977-10-27 GB GB31257/76A patent/GB1593970A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5315298A (en) | 1978-02-10 |
| GB1593970A (en) | 1981-07-22 |
| BE857146A (fr) | 1978-01-26 |
| IL52552A (en) | 1980-10-26 |
| ZA774159B (en) | 1978-07-26 |
| IL52552A0 (en) | 1977-10-31 |
| US4132540A (en) | 1979-01-02 |
| AU2732177A (en) | 1979-02-01 |
| NL7708009A (nl) | 1978-01-31 |
| AU512538B2 (en) | 1980-10-16 |
| FR2359790B1 (OSRAM) | 1981-01-09 |
| CA1105672A (en) | 1981-07-28 |
| IT1082793B (it) | 1985-05-21 |
| FR2359790A1 (fr) | 1978-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE884358C (de) | Verfahren zur Reinigung von technischer Phosphorsaeure | |
| DE2732782A1 (de) | Verfahren zur gewinnung von phosphatsalzen aus waessrigen phosphorsaeureloesungen | |
| DE2635839A1 (de) | Alkaliphosphate mit einem reinheitsgrad fuer nahrungsmittel aus nach dem nassen aufschlussverfahren hergestellter phosphorsaeure | |
| EP0896567B1 (de) | Verfahren zur reinigung von nassverfahrensphosphorsäure | |
| DE1283205B (de) | Verfahren zur Herstellung von Calciumnitrat und Phosphaten oder Phosphaten, die als Duenge- und Futtermittel verwendet werden, aus Reaktionsgemischen, die durch Aufschluss von Rohphosphaten mit Salpetersaeure gewonnen werden | |
| DE2433307C3 (de) | Verfahren zur Abtrennung eines Phosphorsäure-organisches Lösungsmittel-Wasser-Gemisches | |
| DE1952104B2 (de) | Verfahren zur Herstellung von reinen Alkaliphosphaten aus Naßverfahrensphosphorsäure | |
| DE2320877A1 (de) | Verfahren zur reinigung von durch nassaufschluss gewonnener phosphorsaeure | |
| DE2365881C3 (de) | Verfahren zur Reinigung von Naßphosphorsäure | |
| DE2307039C2 (de) | Verfahren zur Reinigung von Naßverfahrensphosphorsäure | |
| DE2952475C2 (de) | Verfahren zur Gewinnung von Uranverbindungen aus wäßriger Uran enthaltender Phosphorsäure | |
| DE2404434A1 (de) | Verfahren zur herstellung einer festen phosphorsaeureverbindung | |
| DE1567590B1 (de) | Verfahren zur Reinigung und Konzentrierung von Phosphorsaeure | |
| DE2229602B1 (de) | Verfahren zur Reinigung von technischer Phosphorsaure | |
| DE2365882A1 (de) | Verfahren zur reinigung von durch nassaufschluss gewonnener phosphorsaeure durch loesungsmittelextraktion | |
| DE1963359A1 (de) | Verfahren zur Herstellung von konzentrierter Phosphorsaeure bzw. deren Verbindungen aus Phosphatgestein | |
| DE2047261B2 (de) | Verfahren zur Entfernung von Eisen aus Phosphorsäure | |
| DE2952476C2 (de) | Verfahren zur Gewinnung von Uranverbindungen aus wäßriger Uran enthaltender Phosphorsäure | |
| DE1567830A1 (de) | Verfahren zu der Herstellung wasserloeslicher Phosphate | |
| EP0133490B1 (de) | Verfahren zur Verminderung des Fluorgehaltes einer Nassverfahrensphosphorsäure | |
| DE1467131A1 (de) | Verfahren zum Aufschliessen von Phosphatmineralen mit Salpetersaeure | |
| DE1767797B2 (de) | Verfahren zur herstellung von natriumorthophosphatgemischen | |
| DE1261840B (de) | Verfahren zur Herstellung hochkonzentrierter Phosphorsaeuren | |
| DE1767797C (de) | Verfahren zur Herstellung von Natrium orthophosphatgemischen | |
| DE2433307C2 (de) | Verfahren zur Abtrennung eines Phosphorsäure-organisches Lösungsmittel-Wasser-Gemisches |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAM | Search report available | ||
| OC | Search report available | ||
| 8128 | New person/name/address of the agent |
Representative=s name: BERENDT, T., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUEN |
|
| 8139 | Disposal/non-payment of the annual fee |