DE2702598C2 - Cyclohexylcyclohexane und diese enthaltende Dielektrika - Google Patents
Cyclohexylcyclohexane und diese enthaltende DielektrikaInfo
- Publication number
- DE2702598C2 DE2702598C2 DE2702598A DE2702598A DE2702598C2 DE 2702598 C2 DE2702598 C2 DE 2702598C2 DE 2702598 A DE2702598 A DE 2702598A DE 2702598 A DE2702598 A DE 2702598A DE 2702598 C2 DE2702598 C2 DE 2702598C2
- Authority
- DE
- Germany
- Prior art keywords
- trans
- cyclohexane
- carbonitrile
- general formula
- liquid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical class C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 title claims abstract description 15
- 239000003989 dielectric material Substances 0.000 title abstract description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000000126 substance Substances 0.000 abstract description 11
- 239000004973 liquid crystal related substance Substances 0.000 abstract description 7
- 230000005292 diamagnetic effect Effects 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 4
- 239000000463 material Substances 0.000 abstract description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 230000007704 transition Effects 0.000 abstract description 3
- 230000002349 favourable effect Effects 0.000 abstract description 2
- 238000000034 method Methods 0.000 abstract description 2
- 238000006467 substitution reaction Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 31
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 29
- -1 η-butyl Chemical group 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- JTGCXYYDAVPSFD-UHFFFAOYSA-N 4-(4-hydroxyphenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(O)C=C1 JTGCXYYDAVPSFD-UHFFFAOYSA-N 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000003098 cholesteric effect Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- 125000005916 2-methylpentyl group Chemical group 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical class C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000006219 1-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000005924 2-methylpentyloxy group Chemical group 0.000 description 1
- GPGGNNIMKOVSAG-UHFFFAOYSA-N 4-(4-octoxyphenyl)benzonitrile Chemical group C1=CC(OCCCCCCCC)=CC=C1C1=CC=C(C#N)C=C1 GPGGNNIMKOVSAG-UHFFFAOYSA-N 0.000 description 1
- YXKKMVGGPRVHIL-UHFFFAOYSA-N 4-(4-pentylcyclohexyl)benzoic acid Chemical compound C1CC(CCCCC)CCC1C1=CC=C(C(O)=O)C=C1 YXKKMVGGPRVHIL-UHFFFAOYSA-N 0.000 description 1
- UKLNPJDLSPMJMQ-UHFFFAOYSA-N 4-pentylcyclohexan-1-one Chemical compound CCCCCC1CCC(=O)CC1 UKLNPJDLSPMJMQ-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical group C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 150000001840 cholesterol esters Chemical class 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid group Chemical class C(C=CC1=CC=CC=C1)(=O)O WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 210000002858 crystal cell Anatomy 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IGARGHRYKHJQSM-UHFFFAOYSA-N cyclohexylbenzene Chemical class C1CCCCC1C1=CC=CC=C1 IGARGHRYKHJQSM-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000001564 phenyl benzoates Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000002310 reflectometry Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- VFWRGKJLLYDFBY-UHFFFAOYSA-N silver;hydrate Chemical compound O.[Ag].[Ag] VFWRGKJLLYDFBY-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000001629 stilbenes Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/30—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing saturated or unsaturated non-aromatic rings, e.g. cyclohexane rings
- C09K19/3001—Cyclohexane rings
- C09K19/3003—Compounds containing at least two rings in which the different rings are directly linked (covalent bond)
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2702598A DE2702598C2 (de) | 1977-01-22 | 1977-01-22 | Cyclohexylcyclohexane und diese enthaltende Dielektrika |
| US05/868,580 US4181625A (en) | 1977-01-22 | 1978-01-11 | Liquid crystalline cyclohexylcyclohexanes |
| GB1800/78A GB1554131A (en) | 1977-01-22 | 1978-01-17 | Liquid crystal cyclohexylcyclohexanes and dielectric materials containing them |
| NL7800698A NL7800698A (nl) | 1977-01-22 | 1978-01-19 | Cyclohexylcyclohexanen. |
| DD78203333A DD134114A5 (de) | 1977-01-22 | 1978-01-20 | Fluessigkristallines dielektrikum |
| SU782569100A SU938745A3 (ru) | 1977-01-22 | 1978-01-20 | Жидкокристаллический диэлектрик |
| AT44278A AT353856B (de) | 1977-01-22 | 1978-01-20 | Fluessigkristallines dielektrikum |
| FR7801648A FR2378001A1 (fr) | 1977-01-22 | 1978-01-20 | Nouveaux cyclohexylcyclohexanes utiles comme derives cristallins liquides |
| CH64878A CH633527A5 (de) | 1977-01-22 | 1978-01-20 | Cyclohexylcyclohexane. |
| JP53006634A JPS594420B2 (ja) | 1977-01-22 | 1978-01-23 | シクロヘキシルシクロヘキサン類 |
| HK450/80A HK45080A (en) | 1977-01-22 | 1980-08-21 | Liquid crystal cyclohexylcyclohexanes and dielectric materials containing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2702598A DE2702598C2 (de) | 1977-01-22 | 1977-01-22 | Cyclohexylcyclohexane und diese enthaltende Dielektrika |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2702598A1 DE2702598A1 (de) | 1978-07-27 |
| DE2702598C2 true DE2702598C2 (de) | 1984-10-25 |
Family
ID=5999298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2702598A Expired DE2702598C2 (de) | 1977-01-22 | 1977-01-22 | Cyclohexylcyclohexane und diese enthaltende Dielektrika |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4181625A (enExample) |
| JP (1) | JPS594420B2 (enExample) |
| AT (1) | AT353856B (enExample) |
| CH (1) | CH633527A5 (enExample) |
| DD (1) | DD134114A5 (enExample) |
| DE (1) | DE2702598C2 (enExample) |
| FR (1) | FR2378001A1 (enExample) |
| GB (1) | GB1554131A (enExample) |
| HK (1) | HK45080A (enExample) |
| NL (1) | NL7800698A (enExample) |
| SU (1) | SU938745A3 (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4337999A (en) * | 1977-08-29 | 1982-07-06 | Sharp Corporation | Fluorescent liquid crystal display compositions and devices |
| DE2832112C2 (de) * | 1978-07-21 | 1985-06-05 | Merck Patent Gmbh, 6100 Darmstadt | Flüssigkristallines Dielektrikum |
| CA1120478A (en) * | 1979-02-05 | 1982-03-23 | Arthur Boller | Cyclohexyl pyrimidines |
| DE2927277A1 (de) * | 1979-07-06 | 1981-01-08 | Merck Patent Gmbh | Cyclohexylbiphenyle, verfahren zu ihrer herstellung, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| DE2933611A1 (de) * | 1979-07-18 | 1981-02-12 | Bbc Brown Boveri & Cie | Cyclohexylcyclohexanoate |
| US4293193A (en) * | 1979-08-15 | 1981-10-06 | Temple University | Amine-substituted liquid crystal compositions |
| DE3034222A1 (de) * | 1979-09-24 | 1981-04-02 | VEB Werk für Fernsehelektronik im VEB Kombinat Mikroelektronik, DDR 1160 Berlin | Kristallin-fluessige subst.-trans-n-alkylcyclohexane bzw. subst.-3-subst.-benzoyloxy-(trans-4-n-alkylcyclohexane) |
| DE2948836A1 (de) * | 1979-12-05 | 1981-06-11 | Merck Patent Gmbh, 6100 Darmstadt | Partiell hydrierte oligo-1,4-phenylene, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| DE2951099A1 (de) * | 1979-12-19 | 1981-06-25 | Merck Patent Gmbh, 6100 Darmstadt | Tetrahydrochinazoline, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeigeelement |
| US4323504A (en) * | 1980-03-28 | 1982-04-06 | Timex Corporation | Cyclohexyl cyclohexyl dioxane liquid crystalline compounds and admixture containing same |
| US4323473A (en) * | 1980-03-28 | 1982-04-06 | Timex Corporation | Cyclohexyl cyclohexyl dioxane liquid crystalline compounds and admixture containing same |
| US4366080A (en) * | 1980-04-07 | 1982-12-28 | Tokyo Shibaura Denki Kabushiki Kaisha | Liquid crystal display element |
| DE3022818C2 (de) * | 1980-06-19 | 1986-11-27 | Merck Patent Gmbh, 6100 Darmstadt | Flüssigkristall-Anzeigeelement |
| DE3023989A1 (de) * | 1980-06-26 | 1982-01-21 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristallines dielektrikum |
| JPS57171936A (en) * | 1981-04-16 | 1982-10-22 | Chisso Corp | Trans-4-(trans-4'-alkylcyclohexyl)cyclohexanole derivative |
| US4405488A (en) * | 1980-10-09 | 1983-09-20 | Chisso Corporation | Liquid-crystalline halogenobenzene derivatives |
| DE3042391A1 (de) * | 1980-11-10 | 1982-06-16 | Merck Patent Gmbh, 6100 Darmstadt | Fluorhaltige cyclohexylbiphenylderivate, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| US4325830A (en) * | 1980-12-24 | 1982-04-20 | Timex Corporation | Three ring dioxane liquid crystalline compounds |
| DE3100142A1 (de) * | 1981-01-07 | 1982-08-12 | Merck Patent Gmbh, 6100 Darmstadt | Cyclohexylcarbonitrilderivate, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| GB2093057B (en) * | 1981-02-13 | 1985-10-16 | Secr Defence | Liquid crystal composition comprising a component of low dielectric anisotropy one of high clearing point and a low melting nematic component |
| DE3268611D1 (en) * | 1981-02-25 | 1986-03-06 | Hitachi Ltd | Colorless liquid crystalline compounds |
| US4422951A (en) * | 1981-04-02 | 1983-12-27 | Chisso Corporation | Liquid crystal benzene derivatives |
| CH652118A5 (de) * | 1981-07-17 | 1985-10-31 | Hoffmann La Roche | Fluessigkristall-verbindungen. |
| US4528114A (en) * | 1981-12-18 | 1985-07-09 | Hoffmann-La Roche Inc. | Acetylenes |
| DE3151367A1 (de) * | 1981-12-24 | 1983-07-07 | Merck Patent Gmbh, 6100 Darmstadt | Acetonitrile, verfahren zu ihrer herstellung, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
| DE3206269A1 (de) * | 1982-02-20 | 1983-09-01 | Merck Patent Gmbh, 6100 Darmstadt | Bicyclohexylderivate |
| EP0090548B1 (en) * | 1982-03-26 | 1987-11-11 | Chisso Corporation | Liquid-crystalline compounds |
| DE3220155A1 (de) * | 1982-05-28 | 1983-12-01 | Merck Patent Gmbh, 6100 Darmstadt | Piperidinderivate |
| JPS58225179A (ja) * | 1982-06-21 | 1983-12-27 | Sharp Corp | 液晶組成物 |
| US4985583A (en) * | 1982-08-26 | 1991-01-15 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Cyclohexane derivatives |
| DE3407013A1 (de) | 1984-02-27 | 1985-09-05 | Merck Patent Gmbh, 6100 Darmstadt | Cyclohexanderivate |
| DE3382646D1 (de) * | 1982-08-26 | 1993-01-28 | Merck Patent Gmbh | Cyclohexanderivate und ihre verwendung als komponenten fluessigkristalliner-dielektrika. |
| JPS59161348A (ja) * | 1983-03-02 | 1984-09-12 | Chisso Corp | シアノテルシクロヘキサン誘導体 |
| DE3465192D1 (en) * | 1983-03-16 | 1987-09-10 | Hoffmann La Roche | Liquid crystal components having an alkenyl chain |
| GB2155465B (en) * | 1984-01-23 | 1987-12-31 | Dainippon Ink & Chemicals | Tolan-type nematic liquid crystalline compounds |
| DE3566901D1 (en) * | 1984-04-07 | 1989-01-26 | Merck Patent Gmbh | Liquid crystal phase |
| JPS6160782A (ja) * | 1984-08-31 | 1986-03-28 | Fujitsu Ltd | 蓄積型液晶組成物 |
| JPH072927U (ja) * | 1991-09-03 | 1995-01-17 | 鹿島石油株式会社 | 計器目盛指示マ−ク |
| JP2605249B2 (ja) * | 1993-07-23 | 1997-04-30 | 大日本インキ化学工業株式会社 | 液晶組成物及び液晶表示装置 |
| US5769028A (en) * | 1996-06-06 | 1998-06-23 | Deckys; Jonas E. | Pet carrier |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1433130A (en) * | 1972-11-09 | 1976-04-22 | Secr Defence | Substituted biphenyl and polyphenyl compounds and liquid crystal materials and devices containing them |
| NL7414352A (nl) * | 1973-11-19 | 1975-05-21 | Hoffmann La Roche | Vloeibaarkristallijne bifenylen. |
| SE7509022L (sv) * | 1974-09-09 | 1976-03-10 | Du Pont | Foreningar med analgetisk verkan |
| US4029594A (en) * | 1976-06-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
| US4013582A (en) * | 1976-06-17 | 1977-03-22 | Rca Corporation | Liquid crystal compounds and electro-optic devices incorporating them |
| US4029595A (en) * | 1976-09-17 | 1977-06-14 | Rca Corporation | Novel liquid crystal compounds and electro-optic devices incorporating them |
-
1977
- 1977-01-22 DE DE2702598A patent/DE2702598C2/de not_active Expired
-
1978
- 1978-01-11 US US05/868,580 patent/US4181625A/en not_active Expired - Lifetime
- 1978-01-17 GB GB1800/78A patent/GB1554131A/en not_active Expired
- 1978-01-19 NL NL7800698A patent/NL7800698A/xx not_active Application Discontinuation
- 1978-01-20 DD DD78203333A patent/DD134114A5/xx unknown
- 1978-01-20 SU SU782569100A patent/SU938745A3/ru active
- 1978-01-20 AT AT44278A patent/AT353856B/de not_active IP Right Cessation
- 1978-01-20 CH CH64878A patent/CH633527A5/de not_active IP Right Cessation
- 1978-01-20 FR FR7801648A patent/FR2378001A1/fr active Granted
- 1978-01-23 JP JP53006634A patent/JPS594420B2/ja not_active Expired
-
1980
- 1980-08-21 HK HK450/80A patent/HK45080A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2702598A1 (de) | 1978-07-27 |
| FR2378001B1 (enExample) | 1983-08-19 |
| FR2378001A1 (fr) | 1978-08-18 |
| NL7800698A (nl) | 1978-07-25 |
| AT353856B (de) | 1979-12-10 |
| GB1554131A (en) | 1979-10-17 |
| SU938745A3 (ru) | 1982-06-23 |
| JPS5392745A (en) | 1978-08-15 |
| US4181625A (en) | 1980-01-01 |
| CH633527A5 (de) | 1982-12-15 |
| DD134114A5 (de) | 1979-02-07 |
| HK45080A (en) | 1980-08-29 |
| ATA44278A (de) | 1979-05-15 |
| JPS594420B2 (ja) | 1984-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2702598C2 (de) | Cyclohexylcyclohexane und diese enthaltende Dielektrika | |
| DE2701591C3 (de) | Hexahydroterphenylderivate und deren Verwendung in flüssigkristallinen Dielektrika | |
| EP0051738B1 (de) | Fluorhaltige Cyclohexylbiphenylderivate, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| EP0022183B1 (de) | Cyclohexylbiphenyle, Verfahren zu ihrer Herstellung, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| DE3040632C2 (enExample) | ||
| EP0056113B1 (de) | Cyclohexylcarbonitrilderivate, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| EP0003215B1 (de) | Cyclohexanderivate, diese enthaltende flüssigkristalline Dielektrika und ihre Verwendung als Komponenten flüssigkristalliner Dielektrika | |
| EP0064193B1 (de) | Fluorhaltige 4,4'-Bis-(cyclohexyl)-biphenylderivate, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| EP0085335B1 (de) | Flüssigkristallines Dielektrikum, neue Farbstoffe, Verfahren zu ihrer Herstellung und elektrooptisches Anzeigeelement | |
| DE2949080A1 (de) | Naphthalinderivate, diese enthaltende dielektrika und elektrooptisches anzeigeelement | |
| CH631737A5 (de) | Verwendung von cyclohexanderivaten in fluessigkristallinen dielektrika. | |
| EP0074608A2 (de) | Flüssigkristalline Halogenverbindungen, Verfahren zu ihrer Herstellung, diese enthaltende Dielektrika und elektrooptisches Anzeigeelement | |
| DE2450088A1 (de) | Biphenylester | |
| DE3315295A1 (de) | Fluorhaltige pyrimidinderivate | |
| DE3006666A1 (de) | Phenylcyclohexenderivate, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeieelement | |
| DE2907332A1 (de) | Fluorphenylcyclohexane, verfahren zu ihrer herstellung und ihre verwendung als komponenten fluessigkristalliner dielektrika | |
| DE2548360C2 (de) | Flüssigkristalline Materialien mit verminderter Viskosität | |
| EP0019060B1 (de) | Diketone, Verfahren zu ihrer Herstellung und ihre Verwendung als Komponenten flüssigkristalliner Dielektrika | |
| DE3148448A1 (de) | "perhydrophenanthrenderivate, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeigeelement" | |
| EP0226592B1 (de) | Flüssigkristall-phase | |
| EP0031021B1 (de) | Tetrahydrochinazoline, Verfahren zu ihrer Herstellung, diese enthaltende flüssigkristalline Dielektrika und elektrooptisches Anzeigeelement | |
| DE2747113A1 (de) | Cyclohexylcyclohexane | |
| DE3530126A1 (de) | Bicyclooctanderivate | |
| DE2835662C2 (de) | Flüssige Kristalle vom Typ disubstituierter Diester sowie diese Kristalle enthaltende Gemische | |
| DE3015388A1 (de) | Schiff'sche basen, diese enthaltende dielektrika und elektrooptisches anzeigeelement |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAM | Search report available | ||
| OC | Search report available | ||
| 8110 | Request for examination paragraph 44 | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2747113 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |