DE2607487A1 - Ungesaettigte polyesteramide, verfahren zu ihrer herstellung und aus diesen polyesteramiden hergestellte haertbare harze - Google Patents
Ungesaettigte polyesteramide, verfahren zu ihrer herstellung und aus diesen polyesteramiden hergestellte haertbare harzeInfo
- Publication number
- DE2607487A1 DE2607487A1 DE19762607487 DE2607487A DE2607487A1 DE 2607487 A1 DE2607487 A1 DE 2607487A1 DE 19762607487 DE19762607487 DE 19762607487 DE 2607487 A DE2607487 A DE 2607487A DE 2607487 A1 DE2607487 A1 DE 2607487A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- unsaturated
- mixture
- glycols
- aliphatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920005989 resin Polymers 0.000 title claims description 32
- 239000011347 resin Substances 0.000 title claims description 32
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 239000000203 mixture Substances 0.000 claims description 61
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 42
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 42
- 229920006149 polyester-amide block copolymer Polymers 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 38
- 150000001412 amines Chemical class 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 35
- 239000012298 atmosphere Substances 0.000 claims description 33
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 32
- 238000003756 stirring Methods 0.000 claims description 28
- 239000000178 monomer Substances 0.000 claims description 23
- 125000001931 aliphatic group Chemical group 0.000 claims description 21
- -1 aliphatic radical Chemical class 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 20
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical class CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 claims description 18
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 17
- 229920006305 unsaturated polyester Polymers 0.000 claims description 17
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 16
- 150000004985 diamines Chemical class 0.000 claims description 16
- 150000003254 radicals Chemical class 0.000 claims description 16
- 150000001408 amides Chemical class 0.000 claims description 15
- 150000002334 glycols Chemical class 0.000 claims description 15
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 14
- 230000015572 biosynthetic process Effects 0.000 claims description 14
- 239000001530 fumaric acid Substances 0.000 claims description 14
- 150000008064 anhydrides Chemical class 0.000 claims description 13
- 238000003786 synthesis reaction Methods 0.000 claims description 13
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 13
- 229920002554 vinyl polymer Polymers 0.000 claims description 13
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 10
- 239000004952 Polyamide Substances 0.000 claims description 10
- 229920002647 polyamide Polymers 0.000 claims description 10
- 229920000642 polymer Polymers 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 8
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 7
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 claims description 7
- 238000006068 polycondensation reaction Methods 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 6
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 5
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 5
- 239000000194 fatty acid Substances 0.000 claims description 5
- 229930195729 fatty acid Natural products 0.000 claims description 5
- 150000004665 fatty acids Chemical class 0.000 claims description 5
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 claims description 4
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 4
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 claims description 4
- 229940018557 citraconic acid Drugs 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000003827 glycol group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 4
- 239000011976 maleic acid Substances 0.000 claims description 4
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 claims description 4
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims description 4
- 239000003784 tall oil Substances 0.000 claims description 4
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004641 Diallyl-phthalate Substances 0.000 claims description 3
- SSRHZSLSLDOUJB-UHFFFAOYSA-N benzene-1,4-diol;toluene Chemical compound CC1=CC=CC=C1.OC1=CC=C(O)C=C1 SSRHZSLSLDOUJB-UHFFFAOYSA-N 0.000 claims description 3
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 238000004132 cross linking Methods 0.000 claims description 3
- 239000000835 fiber Substances 0.000 claims description 3
- 239000003112 inhibitor Substances 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 claims description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 2
- JCTXKRPTIMZBJT-UHFFFAOYSA-N 2,2,4-trimethylpentane-1,3-diol Chemical compound CC(C)C(O)C(C)(C)CO JCTXKRPTIMZBJT-UHFFFAOYSA-N 0.000 claims description 2
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 claims description 2
- ASLIRPJDOQNQLI-UHFFFAOYSA-N 2-phenylpentane-1,5-diamine Chemical compound NCCCC(CN)C1=CC=CC=C1 ASLIRPJDOQNQLI-UHFFFAOYSA-N 0.000 claims description 2
- VQDJODAWOFNASI-UHFFFAOYSA-N 2-propylpropanedioic acid Chemical compound CCCC(C(O)=O)C(O)=O VQDJODAWOFNASI-UHFFFAOYSA-N 0.000 claims description 2
- GLBHAWAMATUOBB-UHFFFAOYSA-N 6,6-dimethylheptane-1,1-diamine Chemical class CC(C)(C)CCCCC(N)N GLBHAWAMATUOBB-UHFFFAOYSA-N 0.000 claims description 2
- CKPKHTKLLYPGFM-UHFFFAOYSA-N 6,6-dimethylheptane-1,1-diol Chemical class CC(CCCCC(O)O)(C)C CKPKHTKLLYPGFM-UHFFFAOYSA-N 0.000 claims description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 2
- 229930192627 Naphthoquinone Natural products 0.000 claims description 2
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical class OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 claims description 2
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 claims description 2
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 claims description 2
- 239000001361 adipic acid Substances 0.000 claims description 2
- 235000011037 adipic acid Nutrition 0.000 claims description 2
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 claims description 2
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 claims description 2
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical class CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- OMNKZBIFPJNNIO-UHFFFAOYSA-N n-(2-methyl-4-oxopentan-2-yl)prop-2-enamide Chemical compound CC(=O)CC(C)(C)NC(=O)C=C OMNKZBIFPJNNIO-UHFFFAOYSA-N 0.000 claims description 2
- 150000002791 naphthoquinones Chemical class 0.000 claims description 2
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 claims description 2
- 150000004885 piperazines Chemical class 0.000 claims description 2
- 229920001748 polybutylene Polymers 0.000 claims description 2
- 229920001223 polyethylene glycol Polymers 0.000 claims description 2
- 229920001451 polypropylene glycol Polymers 0.000 claims description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 2
- 239000004250 tert-Butylhydroquinone Substances 0.000 claims description 2
- 235000019281 tert-butylhydroquinone Nutrition 0.000 claims description 2
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 claims description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical class CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims 1
- CDBAMNGURPMUTG-UHFFFAOYSA-N 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol Chemical compound C1CC(O)CCC1C(C)(C)C1CCC(O)CC1 CDBAMNGURPMUTG-UHFFFAOYSA-N 0.000 claims 1
- SWVKFORRAJEMKK-UHFFFAOYSA-N 4-methylcyclohexane-1,1-diamine Chemical compound CC1CCC(N)(N)CC1 SWVKFORRAJEMKK-UHFFFAOYSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- DUFKCOQISQKSAV-UHFFFAOYSA-N Polypropylene glycol (m w 1,200-3,000) Chemical class CC(O)COC(C)CO DUFKCOQISQKSAV-UHFFFAOYSA-N 0.000 claims 1
- 239000000945 filler Substances 0.000 claims 1
- 239000003365 glass fiber Substances 0.000 claims 1
- 125000005395 methacrylic acid group Chemical group 0.000 claims 1
- KMBPCQSCMCEPMU-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-methylpropane-1,3-diamine Chemical compound NCCCN(C)CCCN KMBPCQSCMCEPMU-UHFFFAOYSA-N 0.000 claims 1
- ITZPOSYADVYECJ-UHFFFAOYSA-N n'-cyclohexylpropane-1,3-diamine Chemical compound NCCCNC1CCCCC1 ITZPOSYADVYECJ-UHFFFAOYSA-N 0.000 claims 1
- OYFWLCJAPSAGCG-UHFFFAOYSA-N n'-methylhexane-1,6-diamine Chemical compound CNCCCCCCN OYFWLCJAPSAGCG-UHFFFAOYSA-N 0.000 claims 1
- 239000011261 inert gas Substances 0.000 description 25
- 239000003054 catalyst Substances 0.000 description 23
- DPQHRXRAZHNGRU-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,6-diamine Chemical compound NCC(C)CC(C)(C)CCN DPQHRXRAZHNGRU-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 229920001225 polyester resin Polymers 0.000 description 5
- 239000004645 polyester resin Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 125000003368 amide group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 3
- XIRDTMSOGDWMOX-UHFFFAOYSA-N 3,4,5,6-tetrabromophthalic acid Chemical compound OC(=O)C1=C(Br)C(Br)=C(Br)C(Br)=C1C(O)=O XIRDTMSOGDWMOX-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- PVLVQTYSRICFCB-TYYBGVCCSA-N (e)-but-2-enedioic acid;2-(2-hydroxyethoxy)ethanol Chemical compound OCCOCCO.OC(=O)\C=C\C(O)=O PVLVQTYSRICFCB-TYYBGVCCSA-N 0.000 description 1
- MSXNYYYUCCRXTB-WLHGVMLRSA-N (e)-but-2-enedioic acid;2-(2-hydroxypropoxy)propan-1-ol Chemical compound OC(=O)\C=C\C(O)=O.CC(O)COC(C)CO MSXNYYYUCCRXTB-WLHGVMLRSA-N 0.000 description 1
- NAHSJIQXYWGMJN-UHFFFAOYSA-N 1-cyclohexylpropane-1,3-diamine Chemical compound NCCC(N)C1CCCCC1 NAHSJIQXYWGMJN-UHFFFAOYSA-N 0.000 description 1
- WAEBPJQJWCRUJJ-UHFFFAOYSA-N 1-n-methylhexane-1,5-diamine Chemical compound CNCCCCC(C)N WAEBPJQJWCRUJJ-UHFFFAOYSA-N 0.000 description 1
- VPRCINUSGGYBRP-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,1-diamine Chemical compound CCC(C)(C)CC(C)C(N)N VPRCINUSGGYBRP-UHFFFAOYSA-N 0.000 description 1
- XACKQJURAZIUES-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,6-diol Chemical compound OCC(C)CC(C)(C)CCO XACKQJURAZIUES-UHFFFAOYSA-N 0.000 description 1
- JWTVQZQPKHXGFM-UHFFFAOYSA-N 2,5-dimethylhexane-2,5-diamine Chemical class CC(C)(N)CCC(C)(C)N JWTVQZQPKHXGFM-UHFFFAOYSA-N 0.000 description 1
- XRCRJFOGPCJKPF-UHFFFAOYSA-N 2-butylbenzene-1,4-diol Chemical compound CCCCC1=CC(O)=CC=C1O XRCRJFOGPCJKPF-UHFFFAOYSA-N 0.000 description 1
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 description 1
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical class C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/44—Polyester-amides
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05K—PRINTED CIRCUITS; CASINGS OR CONSTRUCTIONAL DETAILS OF ELECTRIC APPARATUS; MANUFACTURE OF ASSEMBLAGES OF ELECTRICAL COMPONENTS
- H05K1/00—Printed circuits
- H05K1/02—Details
- H05K1/03—Use of materials for the substrate
- H05K1/0313—Organic insulating material
- H05K1/032—Organic insulating material consisting of one material
- H05K1/0346—Organic insulating material consisting of one material containing N
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT20489/75A IT1031921B (it) | 1975-02-21 | 1975-02-21 | Poliesterammidi insature metodo per la loro produzione e resine induribili prodotte con le dette poliesterammidi |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2607487A1 true DE2607487A1 (de) | 1976-09-02 |
Family
ID=11167704
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762607487 Withdrawn DE2607487A1 (de) | 1975-02-21 | 1976-02-20 | Ungesaettigte polyesteramide, verfahren zu ihrer herstellung und aus diesen polyesteramiden hergestellte haertbare harze |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4115370A (OSRAM) |
| JP (1) | JPS51107398A (OSRAM) |
| BE (1) | BE838799A (OSRAM) |
| DE (1) | DE2607487A1 (OSRAM) |
| DK (1) | DK71476A (OSRAM) |
| FR (1) | FR2301549A1 (OSRAM) |
| GB (1) | GB1534346A (OSRAM) |
| IE (1) | IE42495B1 (OSRAM) |
| IT (1) | IT1031921B (OSRAM) |
| NL (1) | NL7601378A (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4410686A (en) * | 1981-12-21 | 1983-10-18 | The Dow Chemical Company | Norbornyl modified polyesteramides and process for preparing same |
| US4409371A (en) * | 1982-04-08 | 1983-10-11 | The Dow Chemical Company | Dicyclopentadiene modified polyesteramides containing endomethylenetetrahydrophthalyl functionality and process for preparing same |
| KR890003441B1 (ko) * | 1983-10-24 | 1989-09-21 | 더 다우 케미칼 캄파니 | 폴리에스테르아미드 콘크리이트 |
| US4587293A (en) * | 1984-02-24 | 1986-05-06 | The Dow Chemical Company | Reactive flexibilizing monomer and thermosettable compositions containing same |
| US4975522A (en) * | 1988-06-07 | 1990-12-04 | Adademie der Wissenschaften der DDR | Crosslinkable compounds and method for making |
| US6169160B1 (en) | 1996-09-26 | 2001-01-02 | Union Camp Corporation | Cable protectant compositions |
| US5783657A (en) * | 1996-10-18 | 1998-07-21 | Union Camp Corporation | Ester-terminated polyamides of polymerized fatty acids useful in formulating transparent gels in low polarity liquids |
| BR9712342A (pt) * | 1996-10-18 | 2000-10-31 | Union Camp Corp | Géis de poliamida terminados em éster |
| US6517343B2 (en) | 1997-09-26 | 2003-02-11 | Arizona Chemical Company | Coated candles and coating compositions |
| US6503077B2 (en) | 1999-01-04 | 2003-01-07 | Arizona Chemical Company | Gelled articles containing tertiary amide-terminated polyamide |
| US6544302B2 (en) * | 1999-06-01 | 2003-04-08 | Bush Boake Allen | Composite candle compositions |
| US6439880B1 (en) | 2000-02-11 | 2002-08-27 | Robert Ray | Clear candle construction |
| US6552160B2 (en) * | 2001-05-14 | 2003-04-22 | Arizona Chemical Company | Ester-terminated poly(ester-amides) useful for formulating transparent gels in low polarity fluids |
| US7863406B2 (en) * | 2004-06-03 | 2011-01-04 | Cornell Research Foundation, Inc. | Unsaturated poly(ester-amide) biomaterials |
| EP3626759A1 (en) * | 2018-09-21 | 2020-03-25 | Erfindergemeinschaft Lorenz + Grahneis GbR | High-temperature-up-resins (ht-up resin) based on cyclic and non-cyclic raw materials (ht-up) |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB621977A (en) * | 1946-12-16 | 1949-04-25 | James Gordon Napier Drewitt | Improvements in the production of poly-ester-amides |
| GB927786A (en) * | 1958-07-14 | 1963-06-06 | Howards Ilford Ltd | Unsaturated polyesters and polyester compositions |
| NL259504A (OSRAM) * | 1960-12-28 | |||
| NL297039A (OSRAM) * | 1962-08-25 | |||
| GB1113264A (en) * | 1965-07-16 | 1968-05-08 | Universal Oil Prod Co | Production and use of polyhalopolyhydropolycyclicdi-carboxylic acid-alkanolamine-phosphorus compound reaction product |
| DE1694951A1 (de) * | 1966-07-09 | 1971-07-22 | Schering Ag | Ungesaettigte Polyesterharzmassen |
| DE1645440B2 (de) * | 1966-12-13 | 1976-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue haertbare ungesaettigte polyesteramidharzmassen |
| GB1278655A (en) * | 1968-03-20 | 1972-06-21 | Mobil Oil Corp | Novel carboxy-substituted lactones |
| DE1935484A1 (de) * | 1969-07-12 | 1971-01-14 | Bayer Ag | Verfahren zur Herstellung von Polyamiden |
| DE1935485A1 (de) * | 1969-07-12 | 1971-01-21 | Bayer Ag | Verfahren zur Herstellung von Polyamiden mit Urethan- und/oder Harnstoffgruppierungen |
| CA964269A (en) * | 1970-08-31 | 1975-03-11 | Vulcan Materials Company | Production of polyesteramides from aziridine salts |
| BE790331A (fr) * | 1971-10-20 | 1973-02-15 | Vulcan Materials Co | Polyesteramides ameliores et procede pour les preparer |
-
1975
- 1975-02-21 IT IT20489/75A patent/IT1031921B/it active
-
1976
- 1976-02-11 NL NL7601378A patent/NL7601378A/xx not_active Application Discontinuation
- 1976-02-11 US US05/657,268 patent/US4115370A/en not_active Expired - Lifetime
- 1976-02-17 GB GB6169/76A patent/GB1534346A/en not_active Expired
- 1976-02-18 JP JP51016085A patent/JPS51107398A/ja active Pending
- 1976-02-19 IE IE330/76A patent/IE42495B1/en unknown
- 1976-02-20 DE DE19762607487 patent/DE2607487A1/de not_active Withdrawn
- 1976-02-20 FR FR7604768A patent/FR2301549A1/fr not_active Withdrawn
- 1976-02-20 DK DK71476*#A patent/DK71476A/da unknown
- 1976-02-20 BE BE164517A patent/BE838799A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE42495L (en) | 1976-08-21 |
| DK71476A (da) | 1976-08-22 |
| FR2301549A1 (fr) | 1976-09-17 |
| GB1534346A (en) | 1978-12-06 |
| US4115370A (en) | 1978-09-19 |
| JPS51107398A (OSRAM) | 1976-09-22 |
| BE838799A (fr) | 1976-06-16 |
| IT1031921B (it) | 1979-05-10 |
| IE42495B1 (en) | 1980-08-27 |
| NL7601378A (nl) | 1976-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2607487A1 (de) | Ungesaettigte polyesteramide, verfahren zu ihrer herstellung und aus diesen polyesteramiden hergestellte haertbare harze | |
| DE2523991C2 (OSRAM) | ||
| EP0023956B1 (de) | Verfahren zur Herstellung von Polyether(ester)amiden | |
| DE2740116A1 (de) | Polyamidgemische mit verbesserten verarbeitungseigenschaften | |
| DE2265320A1 (de) | Verfahren zum herstellen eines segmentierten thermoplastischen mischpolyesterelastomeren | |
| DE2313874B2 (de) | Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesters | |
| CH620937A5 (OSRAM) | ||
| DE1645440A1 (de) | Neue,loesliche,ungesaettigte Polyesteramid-Harze | |
| EP1778763B1 (de) | Verfahren zur herstellung von hochverzweigten polyamiden | |
| EP0905192B1 (de) | Synthese von Copolymeren aus einem Polyarylensulfid und einem aromatischen Polyester sowie deren Verwendung zur Kompatilisierung von Blends | |
| DE60000939T2 (de) | Wasserdispergierbare polyamide mit ethylenisch ungesättigten endgruppen | |
| EP0431124A1 (de) | Neuartige kunststoffe auf fettsäurebasis. | |
| DE2945370C3 (de) | p-Oxybenzoylcopolyester und deren Verwendung | |
| EP0101838A1 (de) | Verfahren zur Herstellung von Phosphorsäuregruppen enthaltenden Polyesterharzen und deren Verwendung als Lackbindemittel | |
| DE1745460B2 (de) | Neue, haertbare ungesaettigte polyamidharzmassen | |
| EP0023248A1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| DE1770336A1 (de) | Polyamide und Verfahren zu ihrer Herstellung | |
| DE2016023A1 (de) | Polykondensationskatalysator und dessen Verwendung zur Herstellung von Polyestern | |
| DE1959189A1 (de) | Verfahren zur Herstellung von Polymeren der Polyesterreihe | |
| DE2732928A1 (de) | Transparente polyamide | |
| DE60303021T2 (de) | Verfahren zur Herstellung von ungesättigten Polyesterpolyolen | |
| DE1945594A1 (de) | Verfahren zur Herstellung von aromatischen Polyestern | |
| DE1908468B2 (de) | Homogene spritzfaehige mischungen von polyamiden und polyolefinen | |
| DE4342705C2 (de) | Verfahren zur Herstellung von Polyamidblockcopolymeren insbesondere Polyamidseitenketten-gepfropften steif- und halbsteifkettigen Polymeren | |
| DE2809769A1 (de) | Polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |