DE2558022A1 - Tetrazol-5-yl-thiomethylcephalosporine - Google Patents
Tetrazol-5-yl-thiomethylcephalosporineInfo
- Publication number
- DE2558022A1 DE2558022A1 DE19752558022 DE2558022A DE2558022A1 DE 2558022 A1 DE2558022 A1 DE 2558022A1 DE 19752558022 DE19752558022 DE 19752558022 DE 2558022 A DE2558022 A DE 2558022A DE 2558022 A1 DE2558022 A1 DE 2558022A1
- Authority
- DE
- Germany
- Prior art keywords
- carboxylic acid
- cephem
- tetrazol
- ylthiomethyl
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 claims description 82
- -1 formamido, ureido Chemical group 0.000 claims description 80
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical class SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 claims description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 9
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- BKZLVXLDRQUFHT-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propanoic acid Chemical compound OC(=O)CCN1N=NN=C1S BKZLVXLDRQUFHT-UHFFFAOYSA-N 0.000 claims description 4
- BQIWJFVLKNPOGK-UHFFFAOYSA-N 6-(5-sulfanylidene-2h-tetrazol-1-yl)hexanoic acid Chemical compound OC(=O)CCCCCN1N=NN=C1S BQIWJFVLKNPOGK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 4
- XSHRIGOGVGDZIX-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propanamide Chemical compound NC(=O)CCN1N=NN=C1S XSHRIGOGVGDZIX-UHFFFAOYSA-N 0.000 claims description 3
- OBRSDUSGVHJKAR-UHFFFAOYSA-N 3-cyanooxadiazol-3-ium-5-olate Chemical compound O=C1C=[N+](C#N)[N-]O1 OBRSDUSGVHJKAR-UHFFFAOYSA-N 0.000 claims description 3
- MORHPNKHDKWZHZ-UHFFFAOYSA-N 4-(5-sulfanylidene-2h-tetrazol-1-yl)butanoic acid Chemical compound OC(=O)CCCN1N=NN=C1S MORHPNKHDKWZHZ-UHFFFAOYSA-N 0.000 claims description 3
- CDAOOUIBHCVUSV-UHFFFAOYSA-N 6-(5-sulfanylidene-2h-tetrazol-1-yl)hexanamide Chemical compound NC(=O)CCCCCN1N=NN=C1S CDAOOUIBHCVUSV-UHFFFAOYSA-N 0.000 claims description 3
- 230000000844 anti-bacterial effect Effects 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 230000020477 pH reduction Effects 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- IYIAIRFTGCOABW-SSDOTTSWSA-N (6R)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O IYIAIRFTGCOABW-SSDOTTSWSA-N 0.000 claims description 2
- KWWQYVGEBIIDFO-IOJJLOCKSA-N (6r)-7-amino-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=NN1CC(O)=O KWWQYVGEBIIDFO-IOJJLOCKSA-N 0.000 claims description 2
- WHNOEVOISMYRDZ-UHFFFAOYSA-N 4-(5-sulfanylidene-2h-tetrazol-1-yl)butanamide Chemical compound NC(=O)CCCN1N=NN=C1S WHNOEVOISMYRDZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 101150068479 chrb gene Proteins 0.000 claims description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 2
- 229940126601 medicinal product Drugs 0.000 claims description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 2
- BBYWQESEHJPWDP-MKTAYPAQSA-N C(C(O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(=O)O)C(=O)O)C1=O Chemical compound C(C(O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(=O)O)C(=O)O)C1=O BBYWQESEHJPWDP-MKTAYPAQSA-N 0.000 claims 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 150
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 72
- 239000000203 mixture Substances 0.000 description 68
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 239000000243 solution Substances 0.000 description 51
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 32
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 31
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- 239000002253 acid Substances 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000008346 aqueous phase Substances 0.000 description 17
- 159000000000 sodium salts Chemical class 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 description 16
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 16
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 15
- 235000019341 magnesium sulphate Nutrition 0.000 description 15
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 14
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000002024 ethyl acetate extract Substances 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- QOCVPCKWMZJXQD-HQKHBYFDSA-N (6R)-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-3-[[1-[2-(methylamino)-2-oxoethyl]tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(NC)=O)C(=O)O)C1=O QOCVPCKWMZJXQD-HQKHBYFDSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- OBETXYAYXDNJHR-UHFFFAOYSA-N 2-Ethylhexanoic acid Chemical compound CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 4
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229940000635 beta-alanine Drugs 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- 239000003456 ion exchange resin Substances 0.000 description 4
- 229920003303 ion-exchange polymer Polymers 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- SRRXEPQZIJXWPK-QHDYGNBISA-N (6R)-3-[[1-(2-amino-2-oxoethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[[2-(trifluoromethylsulfanyl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound FC(F)(F)SCC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(N)=O)C(=O)O)C1=O SRRXEPQZIJXWPK-QHDYGNBISA-N 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- DPZNOMCNRMUKPS-UHFFFAOYSA-N 1,3-Dimethoxybenzene Chemical compound COC1=CC=CC(OC)=C1 DPZNOMCNRMUKPS-UHFFFAOYSA-N 0.000 description 3
- CDXSCTQQQWTJNJ-UHFFFAOYSA-N 2-(trifluoromethylsulfanyl)acetic acid Chemical compound OC(=O)CSC(F)(F)F CDXSCTQQQWTJNJ-UHFFFAOYSA-N 0.000 description 3
- 229930186147 Cephalosporin Natural products 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 229940124587 cephalosporin Drugs 0.000 description 3
- 150000001780 cephalosporins Chemical class 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- UOTQEHLQKASWQO-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1N=NN=C1S UOTQEHLQKASWQO-UHFFFAOYSA-N 0.000 description 2
- CVYLWKKBVGCWBQ-UHFFFAOYSA-N 2-(methylsulfanylcarbothioylamino)acetic acid Chemical compound CSC(=S)NCC(O)=O CVYLWKKBVGCWBQ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- OQEBBZSWEGYTPG-UHFFFAOYSA-N 3-aminobutanoic acid Chemical compound CC(N)CC(O)=O OQEBBZSWEGYTPG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- WDOKHRWVRAZJQN-MRXJRLSOSA-N C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(N)=O)C(=O)O)C1=O Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CC(N)=O)C(=O)O)C1=O WDOKHRWVRAZJQN-MRXJRLSOSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001782 cephems Chemical group 0.000 description 2
- 150000003946 cyclohexylamines Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- IYPSSPPKMLXXRN-UHFFFAOYSA-N ethyl 2-isothiocyanatoacetate Chemical compound CCOC(=O)CN=C=S IYPSSPPKMLXXRN-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- GSOFXOBOZHKTHS-UHFFFAOYSA-N methyl 3-(5-sulfanylidene-2h-tetrazol-1-yl)propanoate Chemical compound COC(=O)CCN1NN=NC1=S GSOFXOBOZHKTHS-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- IPANJGPZFZVMKN-QHDYGNBISA-N (6r)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[[2-(trifluoromethylsulfanyl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CSC(F)(F)F)[C@H]2SC1 IPANJGPZFZVMKN-QHDYGNBISA-N 0.000 description 1
- OLVCFLKTBJRLHI-IJGSQOGDSA-N (6r)-7-[(2-hydroxy-2-phenylacetyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(O)C=3C=CC=CC=3)[C@H]2SC1 OLVCFLKTBJRLHI-IJGSQOGDSA-N 0.000 description 1
- MWJYRAUQODYNLH-UHFFFAOYSA-N 11-(5-sulfanylidene-2h-tetrazol-1-yl)undecanoic acid Chemical compound OC(=O)CCCCCCCCCCN1NN=NC1=S MWJYRAUQODYNLH-UHFFFAOYSA-N 0.000 description 1
- HNRQWFXWCSGIQR-UHFFFAOYSA-N 11-(methylsulfanylcarbothioylamino)undecanoic acid Chemical compound CSC(=S)NCCCCCCCCCCC(O)=O HNRQWFXWCSGIQR-UHFFFAOYSA-N 0.000 description 1
- GUOSQNAUYHMCRU-UHFFFAOYSA-N 11-Aminoundecanoic acid Chemical compound NCCCCCCCCCCC(O)=O GUOSQNAUYHMCRU-UHFFFAOYSA-N 0.000 description 1
- JXBKZAYVMSNKHA-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-olate Chemical class OC=1N=NNN=1 JXBKZAYVMSNKHA-UHFFFAOYSA-N 0.000 description 1
- RWVPFRSKYWPNIT-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)acetamide Chemical compound NC(=O)CN1N=NN=C1S RWVPFRSKYWPNIT-UHFFFAOYSA-N 0.000 description 1
- GRWAIJBHBCCLGS-UHFFFAOYSA-N 2-(tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1C=NN=N1 GRWAIJBHBCCLGS-UHFFFAOYSA-N 0.000 description 1
- HDCRPLDQSLGQQA-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)butanoic acid Chemical compound OC(=O)CC(C)N1N=NN=C1S HDCRPLDQSLGQQA-UHFFFAOYSA-N 0.000 description 1
- PBBKFUOGKZPENI-UHFFFAOYSA-N 3-(methylsulfanylcarbothioylamino)propanoic acid Chemical compound CSC(=S)NCCC(O)=O PBBKFUOGKZPENI-UHFFFAOYSA-N 0.000 description 1
- QITUNFACYILIHB-UHFFFAOYSA-N 3-[dithiocarboxy(methyl)amino]propanoic acid Chemical compound SC(=S)N(C)CCC(O)=O QITUNFACYILIHB-UHFFFAOYSA-N 0.000 description 1
- JQATYBMVAFRQNM-UHFFFAOYSA-N 4-(methylsulfanylcarbothioylamino)butanoic acid Chemical compound CSC(=S)NCCCC(O)=O JQATYBMVAFRQNM-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OJIOPDXKHZOIIZ-UHFFFAOYSA-N 6-(methylsulfanylcarbothioylamino)hexanoic acid Chemical compound CSC(=S)NCCCCCC(O)=O OJIOPDXKHZOIIZ-UHFFFAOYSA-N 0.000 description 1
- SJVGFKBLUYAEOK-SFHVURJKSA-N 6-[4-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]pyrimidine-4-carbonitrile Chemical compound FC=1C=C(C=C(C=1)F)[C@@H]1CC=NN1C(=O)C1CCN(CC1)C1=CC(=NC=N1)C#N SJVGFKBLUYAEOK-SFHVURJKSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- HDSIOIFPNSBGBB-OMNKOJBGSA-N C1C(=C(N2[C@H](S1)C(C2=O)N)C(=O)O)CC3=NN=NN3CC(=O)O Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)N)C(=O)O)CC3=NN=NN3CC(=O)O HDSIOIFPNSBGBB-OMNKOJBGSA-N 0.000 description 1
- MIALMLGBHCZGSD-QKFMDRJYSA-N C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)C(C3=CC=CS3)C(=O)O)C(=O)O)CSC4=NN=NN4CC(=O)O Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)C(C3=CC=CS3)C(=O)O)C(=O)O)CSC4=NN=NN4CC(=O)O MIALMLGBHCZGSD-QKFMDRJYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- ICZOIXFFVKYXOM-YCLOEFEOSA-M cefamandole nafate Chemical compound [Na+].CN1N=NN=C1SCC1=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)[C@H](OC=O)C=3C=CC=CC=3)[C@H]2SC1 ICZOIXFFVKYXOM-YCLOEFEOSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- IWPOUGUWYUOKJD-UHFFFAOYSA-N n,n-dimethyl-2-(5-sulfanylidene-2h-tetrazol-1-yl)acetamide Chemical compound CN(C)C(=O)CN1N=NN=C1S IWPOUGUWYUOKJD-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/536,760 US4286089A (en) | 1974-12-27 | 1974-12-27 | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2558022A1 true DE2558022A1 (de) | 1976-07-08 |
Family
ID=24139832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752558022 Withdrawn DE2558022A1 (de) | 1974-12-27 | 1975-12-22 | Tetrazol-5-yl-thiomethylcephalosporine |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4286089A (enExample) |
| JP (1) | JPS5188990A (enExample) |
| AU (1) | AU507050B2 (enExample) |
| BE (1) | BE837030A (enExample) |
| CA (1) | CA1108602A (enExample) |
| CH (1) | CH622523A5 (enExample) |
| DD (1) | DD122545A5 (enExample) |
| DE (1) | DE2558022A1 (enExample) |
| DK (1) | DK576075A (enExample) |
| ES (1) | ES443620A1 (enExample) |
| FR (3) | FR2295751A1 (enExample) |
| GB (1) | GB1537844A (enExample) |
| HU (1) | HU171833B (enExample) |
| IE (1) | IE42493B1 (enExample) |
| IL (1) | IL48691A0 (enExample) |
| IT (1) | IT1051940B (enExample) |
| LU (1) | LU74055A1 (enExample) |
| NL (1) | NL7515093A (enExample) |
| SE (1) | SE7514240L (enExample) |
| YU (1) | YU323775A (enExample) |
| ZA (1) | ZA756532B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2730377A1 (de) * | 1976-07-12 | 1978-01-19 | Smithkline Corp | 7-beta-(2-oxyimino-2-arylacetamido)- cephalosporine |
| DE2730376A1 (de) * | 1976-07-12 | 1978-01-19 | Smithkline Corp | 7-beta-(2-oxyimino-2-arylacetamido)- cephalosporine |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| AU510280B2 (en) * | 1976-08-30 | 1980-06-19 | Bristol-Myers Company | Antibacterial cephalosporin agents |
| EP0095029B1 (en) * | 1979-11-30 | 1986-11-05 | Fujisawa Pharmaceutical Co., Ltd. | 5-thio-tetrazol compounds and their preparation |
| US4420477A (en) * | 1979-11-30 | 1983-12-13 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| US4346076A (en) * | 1980-09-17 | 1982-08-24 | Eli Lilly And Company | Bis-tetrazoylmethyl substituted cephalosporin antibiotics |
| JPS58198473A (ja) * | 1982-05-13 | 1983-11-18 | Shionogi & Co Ltd | ヒドロキサム酸誘導体 |
| JPS59152385A (ja) * | 1983-02-17 | 1984-08-31 | Shionogi & Co Ltd | ヒドロキサム酸系セフアロスポリン誘導体 |
| PT87616B (pt) | 1987-06-24 | 1992-09-30 | Smithkline Beecham Corp | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticas |
| CH682878A5 (fr) * | 1991-11-01 | 1993-12-15 | Nestle Sa | Procédé permettant d'éviter le brunissement d'un produit alimentaire. |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH527215A (de) * | 1967-04-15 | 1972-08-31 | Fujisawa Pharmaceutical Co | Verfahren zur Herstellung von 3,7-disubstituierten Cephalosporinderivaten |
| US3819623A (en) * | 1968-04-12 | 1974-06-25 | Fujisawa Pharmaceutical Co | 3,7-disubstituted cephalosporin compounds |
| NL173169C (nl) | 1969-10-27 | 1983-12-16 | Fujisawa Pharmaceutical Co | Werkwijze voor het bereiden van een farmaceutisch preparaat met antibacteriele werking en werkwijze voor het bereiden van het daarvoor benodigde cephalosporinederivaat. |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US4007173A (en) | 1973-05-07 | 1977-02-08 | Smithkline Corporation | α-amino-α-(ureidophenyl)acetamidocephalosporins |
| US3884915A (en) * | 1973-06-04 | 1975-05-20 | Smithkline Corp | 7-Alkylmercaptoacetamido cephalosporins |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| GB1478055A (en) | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| US3883520A (en) * | 1973-08-17 | 1975-05-13 | Smithkline Corp | Substituted mercaptoacetamidocephalosporins |
| JPS5653557B2 (enExample) * | 1973-10-15 | 1981-12-19 | ||
| US4110338A (en) * | 1973-10-31 | 1978-08-29 | Fujisawa Pharmaceutical Co., Ltd. | Product and preparation of 1H-tetrazole-5-thiol derivatives |
| JPS57873B2 (enExample) | 1973-12-25 | 1982-01-08 | ||
| US4205166A (en) * | 1974-02-20 | 1980-05-27 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted-3-aminoalkyl-, acylaminoalkyl-, or hydroxyalkyl-substituted heterocyclic thiomethyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| GB1509074A (en) | 1974-04-05 | 1978-04-26 | Yamanouchi Pharma Co Ltd | Cephalosporin derivatives |
| GB1486272A (en) | 1974-04-27 | 1977-09-21 | Beecham Group Ltd | Cephalosporins |
| GB1476981A (en) * | 1974-06-05 | 1977-06-16 | Bristol Myers Co | Substituted penicillanic acids |
| US4172196A (en) * | 1974-09-03 | 1979-10-23 | Bristol-Myers Company | Certain 7-α-substituted-α-hydroxyacetamido-3-(1-carboxymethyltetrazol-5-yl-thiomethyl)-3-cephem-4-carboxylic acids |
| US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4182863A (en) * | 1974-09-03 | 1980-01-08 | Bristol-Myers Company | 7-Amino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid |
| DE2455071A1 (de) | 1974-11-21 | 1976-05-26 | Volkswagenwerk Ag | Mit ladungsschichtung betriebene, fremdgezuendete brennkraftmaschine |
| JPS525787A (en) * | 1975-06-27 | 1977-01-17 | Bristol Myers Co | Antiibacterial agent |
| US4198406A (en) * | 1975-11-27 | 1980-04-15 | Beecham Group Limited | Carbamoyl heterocyclicthio cephalosporins and pharmaceutical compositions formulated therewith |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
-
1974
- 1974-12-27 US US05/536,760 patent/US4286089A/en not_active Expired - Lifetime
-
1975
- 1975-10-15 ZA ZA00756532A patent/ZA756532B/xx unknown
- 1975-12-16 CH CH1631075A patent/CH622523A5/de not_active IP Right Cessation
- 1975-12-17 SE SE7514240A patent/SE7514240L/xx unknown
- 1975-12-17 GB GB51601/75A patent/GB1537844A/en not_active Expired
- 1975-12-17 AU AU87647/75A patent/AU507050B2/en not_active Ceased
- 1975-12-18 ES ES443620A patent/ES443620A1/es not_active Expired
- 1975-12-18 YU YU03237/75A patent/YU323775A/xx unknown
- 1975-12-18 IL IL48691A patent/IL48691A0/xx unknown
- 1975-12-18 LU LU74055A patent/LU74055A1/xx unknown
- 1975-12-18 DK DK576075A patent/DK576075A/da not_active Application Discontinuation
- 1975-12-19 FR FR7539205A patent/FR2295751A1/fr active Granted
- 1975-12-19 IE IE2784/74A patent/IE42493B1/en unknown
- 1975-12-19 JP JP50152718A patent/JPS5188990A/ja active Pending
- 1975-12-22 CA CA242,315A patent/CA1108602A/en not_active Expired
- 1975-12-22 DE DE19752558022 patent/DE2558022A1/de not_active Withdrawn
- 1975-12-23 IT IT30743/75A patent/IT1051940B/it active
- 1975-12-23 DD DD190519A patent/DD122545A5/xx unknown
- 1975-12-23 BE BE163075A patent/BE837030A/xx not_active IP Right Cessation
- 1975-12-23 HU HU75SI00001505A patent/HU171833B/hu unknown
- 1975-12-24 NL NL7515093A patent/NL7515093A/xx not_active Application Discontinuation
-
1976
- 1976-07-02 FR FR7620277A patent/FR2306983A1/fr active Granted
- 1976-07-02 FR FR7620274A patent/FR2306992A1/fr active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2730377A1 (de) * | 1976-07-12 | 1978-01-19 | Smithkline Corp | 7-beta-(2-oxyimino-2-arylacetamido)- cephalosporine |
| DE2730376A1 (de) * | 1976-07-12 | 1978-01-19 | Smithkline Corp | 7-beta-(2-oxyimino-2-arylacetamido)- cephalosporine |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2306983B1 (enExample) | 1979-08-24 |
| IE42493L (en) | 1976-06-27 |
| YU323775A (en) | 1982-05-31 |
| HU171833B (hu) | 1978-03-28 |
| BE837030A (fr) | 1976-06-23 |
| DD122545A5 (enExample) | 1976-10-12 |
| AU507050B2 (en) | 1980-01-31 |
| FR2306983A1 (fr) | 1976-11-05 |
| JPS5188990A (enExample) | 1976-08-04 |
| IT1051940B (it) | 1981-05-20 |
| FR2295751A1 (fr) | 1976-07-23 |
| US4286089A (en) | 1981-08-25 |
| FR2306992B1 (enExample) | 1978-09-01 |
| AU8764775A (en) | 1977-06-23 |
| SE7514240L (sv) | 1976-06-28 |
| CH622523A5 (enExample) | 1981-04-15 |
| NL7515093A (nl) | 1976-06-29 |
| IE42493B1 (en) | 1980-08-27 |
| DK576075A (da) | 1976-06-28 |
| ES443620A1 (es) | 1977-05-01 |
| CA1108602A (en) | 1981-09-08 |
| FR2306992A1 (fr) | 1976-11-05 |
| FR2295751B1 (enExample) | 1980-05-23 |
| IL48691A0 (en) | 1976-02-29 |
| LU74055A1 (enExample) | 1976-07-20 |
| ZA756532B (en) | 1976-09-29 |
| GB1537844A (en) | 1979-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH629499A5 (de) | Verfahren zur herstellung neuer cephalosporinderivate. | |
| CH639666A5 (de) | Cephalosporansaeurederivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung. | |
| CH622262A5 (enExample) | ||
| DE2558022A1 (de) | Tetrazol-5-yl-thiomethylcephalosporine | |
| DE2801644A1 (de) | Heteromonocyclische und heterobicyclische derivate der ungesaettigten 7-acylamido-3-cephem-4-carbonsaeure, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische oder veterinaer- zubereitung | |
| SU1151213A3 (ru) | Способ получени цефалоспоринов или их солей | |
| US4025626A (en) | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins | |
| DE2512284A1 (de) | Cephalosporansaeurederivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel | |
| DE2538801A1 (de) | Cephalosporinderivate und verfahren zu ihrer herstellung | |
| DE2831568C2 (de) | 7&alpha;-Methoxycephalosporine und Verfahren zur Herstellung derselben | |
| US4220644A (en) | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins | |
| US4350692A (en) | 3,7-Disubstituted-3-cephem-4-carboxylic acids | |
| FR2496666A1 (fr) | Nouveaux derives de cephalosporine et composition pharmaceutique les contenant | |
| DE2521063A1 (de) | Phenylacetamidocephalosporin- derivate | |
| CH642663A5 (de) | 3,7-disubstituierte 3-cephem-4-carbonsaeure-verbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel. | |
| DE2611270C2 (de) | Cephalosporin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2710490A1 (de) | 7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittel | |
| DE2702552C2 (de) | 7&alpha;-Methoxy-cephalosporine und Verfahren zur Herstellung derselben | |
| US4101656A (en) | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| DE2714419C2 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und Arzneimittel | |
| DE2627126A1 (de) | 7beta-acyloxycephalosporin- derivate | |
| DE2552861A1 (de) | Verfahren zur herstellung von 7-methoxycephalosporinverbindungen | |
| AT368164B (de) | Verfahren zur herstellung von neuen 7alphamethoxycephalosporinen | |
| DE2730376A1 (de) | 7-beta-(2-oxyimino-2-arylacetamido)- cephalosporine | |
| NO742465L (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |