SE7514240L - Nya cefalosporinforeningar - Google Patents
Nya cefalosporinforeningarInfo
- Publication number
- SE7514240L SE7514240L SE7514240A SE7514240A SE7514240L SE 7514240 L SE7514240 L SE 7514240L SE 7514240 A SE7514240 A SE 7514240A SE 7514240 A SE7514240 A SE 7514240A SE 7514240 L SE7514240 L SE 7514240L
- Authority
- SE
- Sweden
- Prior art keywords
- associations
- cephalosporine
- new
- new cephalosporine
- cephalosporine associations
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/536,760 US4286089A (en) | 1974-12-27 | 1974-12-27 | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE7514240L true SE7514240L (sv) | 1976-06-28 |
Family
ID=24139832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7514240A SE7514240L (sv) | 1974-12-27 | 1975-12-17 | Nya cefalosporinforeningar |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4286089A (enExample) |
| JP (1) | JPS5188990A (enExample) |
| AU (1) | AU507050B2 (enExample) |
| BE (1) | BE837030A (enExample) |
| CA (1) | CA1108602A (enExample) |
| CH (1) | CH622523A5 (enExample) |
| DD (1) | DD122545A5 (enExample) |
| DE (1) | DE2558022A1 (enExample) |
| DK (1) | DK576075A (enExample) |
| ES (1) | ES443620A1 (enExample) |
| FR (3) | FR2295751A1 (enExample) |
| GB (1) | GB1537844A (enExample) |
| HU (1) | HU171833B (enExample) |
| IE (1) | IE42493B1 (enExample) |
| IL (1) | IL48691A0 (enExample) |
| IT (1) | IT1051940B (enExample) |
| LU (1) | LU74055A1 (enExample) |
| NL (1) | NL7515093A (enExample) |
| SE (1) | SE7514240L (enExample) |
| YU (1) | YU323775A (enExample) |
| ZA (1) | ZA756532B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4066762A (en) * | 1976-07-12 | 1978-01-03 | Smithkline Corporation | Derivatives of 7-(2-substituted-2-hydroxyiminoacetamido)-3-(1-substituted tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid |
| US4278670A (en) * | 1976-07-12 | 1981-07-14 | Smithkline Corporation | 7-Alpha-oxyiminoacylcephalosporins |
| AU510280B2 (en) * | 1976-08-30 | 1980-06-19 | Bristol-Myers Company | Antibacterial cephalosporin agents |
| EP0095029B1 (en) * | 1979-11-30 | 1986-11-05 | Fujisawa Pharmaceutical Co., Ltd. | 5-thio-tetrazol compounds and their preparation |
| US4420477A (en) * | 1979-11-30 | 1983-12-13 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| US4346076A (en) * | 1980-09-17 | 1982-08-24 | Eli Lilly And Company | Bis-tetrazoylmethyl substituted cephalosporin antibiotics |
| JPS58198473A (ja) * | 1982-05-13 | 1983-11-18 | Shionogi & Co Ltd | ヒドロキサム酸誘導体 |
| JPS59152385A (ja) * | 1983-02-17 | 1984-08-31 | Shionogi & Co Ltd | ヒドロキサム酸系セフアロスポリン誘導体 |
| PT87616B (pt) | 1987-06-24 | 1992-09-30 | Smithkline Beecham Corp | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticas |
| CH682878A5 (fr) * | 1991-11-01 | 1993-12-15 | Nestle Sa | Procédé permettant d'éviter le brunissement d'un produit alimentaire. |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH527215A (de) * | 1967-04-15 | 1972-08-31 | Fujisawa Pharmaceutical Co | Verfahren zur Herstellung von 3,7-disubstituierten Cephalosporinderivaten |
| US3819623A (en) * | 1968-04-12 | 1974-06-25 | Fujisawa Pharmaceutical Co | 3,7-disubstituted cephalosporin compounds |
| NL173169C (nl) | 1969-10-27 | 1983-12-16 | Fujisawa Pharmaceutical Co | Werkwijze voor het bereiden van een farmaceutisch preparaat met antibacteriele werking en werkwijze voor het bereiden van het daarvoor benodigde cephalosporinederivaat. |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US4007173A (en) | 1973-05-07 | 1977-02-08 | Smithkline Corporation | α-amino-α-(ureidophenyl)acetamidocephalosporins |
| US3884915A (en) * | 1973-06-04 | 1975-05-20 | Smithkline Corp | 7-Alkylmercaptoacetamido cephalosporins |
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| GB1478055A (en) | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| US3883520A (en) * | 1973-08-17 | 1975-05-13 | Smithkline Corp | Substituted mercaptoacetamidocephalosporins |
| JPS5653557B2 (enExample) * | 1973-10-15 | 1981-12-19 | ||
| US4110338A (en) * | 1973-10-31 | 1978-08-29 | Fujisawa Pharmaceutical Co., Ltd. | Product and preparation of 1H-tetrazole-5-thiol derivatives |
| JPS57873B2 (enExample) | 1973-12-25 | 1982-01-08 | ||
| US4205166A (en) * | 1974-02-20 | 1980-05-27 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted-3-aminoalkyl-, acylaminoalkyl-, or hydroxyalkyl-substituted heterocyclic thiomethyl-3-cephem-4-carboxylic acid derivatives and preparation thereof |
| GB1509074A (en) | 1974-04-05 | 1978-04-26 | Yamanouchi Pharma Co Ltd | Cephalosporin derivatives |
| GB1486272A (en) | 1974-04-27 | 1977-09-21 | Beecham Group Ltd | Cephalosporins |
| GB1476981A (en) * | 1974-06-05 | 1977-06-16 | Bristol Myers Co | Substituted penicillanic acids |
| US4172196A (en) * | 1974-09-03 | 1979-10-23 | Bristol-Myers Company | Certain 7-α-substituted-α-hydroxyacetamido-3-(1-carboxymethyltetrazol-5-yl-thiomethyl)-3-cephem-4-carboxylic acids |
| US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4182863A (en) * | 1974-09-03 | 1980-01-08 | Bristol-Myers Company | 7-Amino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid |
| DE2455071A1 (de) | 1974-11-21 | 1976-05-26 | Volkswagenwerk Ag | Mit ladungsschichtung betriebene, fremdgezuendete brennkraftmaschine |
| JPS525787A (en) * | 1975-06-27 | 1977-01-17 | Bristol Myers Co | Antiibacterial agent |
| US4198406A (en) * | 1975-11-27 | 1980-04-15 | Beecham Group Limited | Carbamoyl heterocyclicthio cephalosporins and pharmaceutical compositions formulated therewith |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
-
1974
- 1974-12-27 US US05/536,760 patent/US4286089A/en not_active Expired - Lifetime
-
1975
- 1975-10-15 ZA ZA00756532A patent/ZA756532B/xx unknown
- 1975-12-16 CH CH1631075A patent/CH622523A5/de not_active IP Right Cessation
- 1975-12-17 SE SE7514240A patent/SE7514240L/xx unknown
- 1975-12-17 GB GB51601/75A patent/GB1537844A/en not_active Expired
- 1975-12-17 AU AU87647/75A patent/AU507050B2/en not_active Ceased
- 1975-12-18 ES ES443620A patent/ES443620A1/es not_active Expired
- 1975-12-18 YU YU03237/75A patent/YU323775A/xx unknown
- 1975-12-18 IL IL48691A patent/IL48691A0/xx unknown
- 1975-12-18 LU LU74055A patent/LU74055A1/xx unknown
- 1975-12-18 DK DK576075A patent/DK576075A/da not_active Application Discontinuation
- 1975-12-19 FR FR7539205A patent/FR2295751A1/fr active Granted
- 1975-12-19 IE IE2784/74A patent/IE42493B1/en unknown
- 1975-12-19 JP JP50152718A patent/JPS5188990A/ja active Pending
- 1975-12-22 CA CA242,315A patent/CA1108602A/en not_active Expired
- 1975-12-22 DE DE19752558022 patent/DE2558022A1/de not_active Withdrawn
- 1975-12-23 IT IT30743/75A patent/IT1051940B/it active
- 1975-12-23 DD DD190519A patent/DD122545A5/xx unknown
- 1975-12-23 BE BE163075A patent/BE837030A/xx not_active IP Right Cessation
- 1975-12-23 HU HU75SI00001505A patent/HU171833B/hu unknown
- 1975-12-24 NL NL7515093A patent/NL7515093A/xx not_active Application Discontinuation
-
1976
- 1976-07-02 FR FR7620277A patent/FR2306983A1/fr active Granted
- 1976-07-02 FR FR7620274A patent/FR2306992A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2306983B1 (enExample) | 1979-08-24 |
| IE42493L (en) | 1976-06-27 |
| YU323775A (en) | 1982-05-31 |
| HU171833B (hu) | 1978-03-28 |
| BE837030A (fr) | 1976-06-23 |
| DD122545A5 (enExample) | 1976-10-12 |
| AU507050B2 (en) | 1980-01-31 |
| FR2306983A1 (fr) | 1976-11-05 |
| JPS5188990A (enExample) | 1976-08-04 |
| IT1051940B (it) | 1981-05-20 |
| FR2295751A1 (fr) | 1976-07-23 |
| DE2558022A1 (de) | 1976-07-08 |
| US4286089A (en) | 1981-08-25 |
| FR2306992B1 (enExample) | 1978-09-01 |
| AU8764775A (en) | 1977-06-23 |
| CH622523A5 (enExample) | 1981-04-15 |
| NL7515093A (nl) | 1976-06-29 |
| IE42493B1 (en) | 1980-08-27 |
| DK576075A (da) | 1976-06-28 |
| ES443620A1 (es) | 1977-05-01 |
| CA1108602A (en) | 1981-09-08 |
| FR2306992A1 (fr) | 1976-11-05 |
| FR2295751B1 (enExample) | 1980-05-23 |
| IL48691A0 (en) | 1976-02-29 |
| LU74055A1 (enExample) | 1976-07-20 |
| ZA756532B (en) | 1976-09-29 |
| GB1537844A (en) | 1979-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7510767L (sv) | Nya uretanoxazolidiner | |
| FI56489B (fi) | Inhalationsapparat foer inandning av pulverformiga aemnen | |
| FI55391B (fi) | Anordning foer sortering av minst tvao skilda godsslag | |
| IT1030434B (it) | Treppiede | |
| FI55610C (fi) | Foerfarande foer foervaring av lyofiliserad blodplasma | |
| IT1051939B (it) | Composti cefalosporinici | |
| SE7514240L (sv) | Nya cefalosporinforeningar | |
| SE7513331L (sv) | Substituerade ureidoforeningar | |
| FI55431C (fi) | Foer vattning av djur avsett drickesmunstycke | |
| FI55487C (fi) | Anordning foer dragning av borrningsroer | |
| SE7514033L (sv) | Nytt antibiotiskt komplex | |
| FI53576C (fi) | Foerfarande foer framstaellning av steroid- -isomeras | |
| SE7510966L (sv) | Kiselorganiska foreningar | |
| SE7507046L (sv) | Nya n-vinyloxietyl-alfa-metyl-beta-fenetylaminer. | |
| SE7514642L (sv) | Nya bensylpyrimidiner | |
| FI54142B (fi) | Foerfarande foer kultivering av aeroba mikroorganismer | |
| SE7513577L (sv) | Nya tricykliska foreningar | |
| SE7605818L (sv) | Nya diureidforeningar | |
| SE7510967L (sv) | Polyeteniskt omettade kiselforeningar | |
| HU173603B (hu) | Sposob poluchenija antibiotika a-28086 | |
| BE827408A (fr) | Ureidocephalosporines antibiotiques | |
| BE833237A (fr) | Penicillines | |
| SE7511732L (sv) | Nya, heterocykliska foreningar | |
| FR2275208A1 (fr) | Nouvelles penicillines | |
| SE7509337L (sv) | Smertstillande foreningar |