DE2546674C2 - Feuerhemmende thermoplastische Polyestermassen - Google Patents
Feuerhemmende thermoplastische PolyestermassenInfo
- Publication number
- DE2546674C2 DE2546674C2 DE2546674A DE2546674A DE2546674C2 DE 2546674 C2 DE2546674 C2 DE 2546674C2 DE 2546674 A DE2546674 A DE 2546674A DE 2546674 A DE2546674 A DE 2546674A DE 2546674 C2 DE2546674 C2 DE 2546674C2
- Authority
- DE
- Germany
- Prior art keywords
- fire retardant
- parts
- weight
- compounds
- fire
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003063 flame retardant Substances 0.000 title claims description 81
- 229920000728 polyester Polymers 0.000 title claims description 53
- 239000000203 mixture Substances 0.000 title claims description 27
- 229920001169 thermoplastic Polymers 0.000 title claims description 16
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 15
- -1 polyethylene terephthalate Polymers 0.000 claims description 42
- 125000003118 aryl group Chemical group 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 27
- 239000003365 glass fiber Substances 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000002667 nucleating agent Substances 0.000 claims description 8
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 8
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 8
- 239000003381 stabilizer Substances 0.000 claims description 7
- 239000006082 mold release agent Substances 0.000 claims description 5
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 5
- 239000000314 lubricant Substances 0.000 claims description 4
- 239000003607 modifier Substances 0.000 claims description 4
- 239000006103 coloring component Substances 0.000 claims description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 48
- 230000015572 biosynthetic process Effects 0.000 description 24
- 229910000019 calcium carbonate Inorganic materials 0.000 description 24
- 239000000654 additive Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 238000000034 method Methods 0.000 description 13
- 230000000052 comparative effect Effects 0.000 description 10
- 229910052736 halogen Inorganic materials 0.000 description 10
- 150000002367 halogens Chemical class 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 239000004593 Epoxy Substances 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical group OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 229910019142 PO4 Inorganic materials 0.000 description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 7
- 235000021317 phosphate Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 6
- 150000001491 aromatic compounds Chemical class 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 229910052748 manganese Inorganic materials 0.000 description 5
- 239000011572 manganese Substances 0.000 description 5
- 239000004417 polycarbonate Substances 0.000 description 5
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- 239000010425 asbestos Substances 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 150000002896 organic halogen compounds Chemical class 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229910052895 riebeckite Inorganic materials 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N terephthalic acid group Chemical group C(C1=CC=C(C(=O)O)C=C1)(=O)O KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229920000578 graft copolymer Polymers 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000001746 injection moulding Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 150000002903 organophosphorus compounds Chemical class 0.000 description 3
- ZQBAKBUEJOMQEX-UHFFFAOYSA-N phenyl salicylate Chemical class OC1=CC=CC=C1C(=O)OC1=CC=CC=C1 ZQBAKBUEJOMQEX-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 229920000515 polycarbonate Polymers 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- 239000004604 Blowing Agent Substances 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 150000001260 acyclic compounds Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 229910000410 antimony oxide Inorganic materials 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- CAYGQBVSOZLICD-UHFFFAOYSA-N hexabromobenzene Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1Br CAYGQBVSOZLICD-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000011256 inorganic filler Substances 0.000 description 2
- 229910003475 inorganic filler Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 150000002739 metals Chemical group 0.000 description 2
- 239000012778 molding material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 229960003742 phenol Drugs 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 238000010298 pulverizing process Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 229920005992 thermoplastic resin Polymers 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- AQPHBYQUCKHJLT-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2,3,4,5,6-pentabromophenyl)benzene Chemical group BrC1=C(Br)C(Br)=C(Br)C(Br)=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br AQPHBYQUCKHJLT-UHFFFAOYSA-N 0.000 description 1
- LJDGJCNHVGGOFW-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenoxy)benzene Chemical compound BrC1=CC=CC=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br LJDGJCNHVGGOFW-UHFFFAOYSA-N 0.000 description 1
- OYSVBCSOQFXYHK-UHFFFAOYSA-N 1,3-dibromo-2,2-bis(bromomethyl)propane Chemical compound BrCC(CBr)(CBr)CBr OYSVBCSOQFXYHK-UHFFFAOYSA-N 0.000 description 1
- FYEICUJLVWWATQ-UHFFFAOYSA-N 1,3-dibromo-2-[(2,6-dibromophenyl)methyl]benzene Chemical compound BrC1=CC=CC(Br)=C1CC1=C(Br)C=CC=C1Br FYEICUJLVWWATQ-UHFFFAOYSA-N 0.000 description 1
- SKLOHZRZUDVZDA-UHFFFAOYSA-N 1,3-dichloro-2-[2-(2,6-dichlorophenyl)ethyl]benzene Chemical compound ClC1=CC=CC(Cl)=C1CCC1=C(Cl)C=CC=C1Cl SKLOHZRZUDVZDA-UHFFFAOYSA-N 0.000 description 1
- AEYSBXOAQUTNNK-UHFFFAOYSA-N 1,3-dichloro-5-[1-(3,5-dichlorophenyl)ethyl]benzene Chemical compound C=1C(Cl)=CC(Cl)=CC=1C(C)C1=CC(Cl)=CC(Cl)=C1 AEYSBXOAQUTNNK-UHFFFAOYSA-N 0.000 description 1
- NVGMYJQFGHPBJO-UHFFFAOYSA-N 1-iodo-4-[1-(4-iodophenyl)ethyl]benzene Chemical compound C=1C=C(I)C=CC=1C(C)C1=CC=C(I)C=C1 NVGMYJQFGHPBJO-UHFFFAOYSA-N 0.000 description 1
- CHUGKEQJSLOLHL-UHFFFAOYSA-N 2,2-Bis(bromomethyl)propane-1,3-diol Chemical compound OCC(CO)(CBr)CBr CHUGKEQJSLOLHL-UHFFFAOYSA-N 0.000 description 1
- PNXPXUDJXYVOFM-UHFFFAOYSA-N 2,3,5,6-tetrabromoterephthalic acid Chemical compound OC(=O)C1=C(Br)C(Br)=C(C(O)=O)C(Br)=C1Br PNXPXUDJXYVOFM-UHFFFAOYSA-N 0.000 description 1
- ZXDDPOHVAMWLBH-UHFFFAOYSA-N 2,4-Dihydroxybenzophenone Chemical compound OC1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 ZXDDPOHVAMWLBH-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- LTHWCPFHYXQELH-UHFFFAOYSA-N 2-bromo-1-[1-(2-bromo-3-phenylphenyl)ethyl]-3-phenylbenzene Chemical compound C=1C=CC(C=2C=CC=CC=2)=C(Br)C=1C(C)C(C=1Br)=CC=CC=1C1=CC=CC=C1 LTHWCPFHYXQELH-UHFFFAOYSA-N 0.000 description 1
- WKOZPNLVEMGPKZ-UHFFFAOYSA-N 2-chloro-1-[1-(2-chloro-4-iodophenyl)ethyl]-4-iodobenzene Chemical compound C=1C=C(I)C=C(Cl)C=1C(C)C1=CC=C(I)C=C1Cl WKOZPNLVEMGPKZ-UHFFFAOYSA-N 0.000 description 1
- QDLYDXLYPXBEKO-UHFFFAOYSA-N 2-ethylhexyl bis(4-methylphenyl) phosphate Chemical compound C=1C=C(C)C=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=C(C)C=C1 QDLYDXLYPXBEKO-UHFFFAOYSA-N 0.000 description 1
- GQPZHNGYFYMRTD-UHFFFAOYSA-N 2-hydroxy-4-phenyl-1,3,2$l^{5}-dioxaphospholane 2-oxide Chemical compound O1P(O)(=O)OCC1C1=CC=CC=C1 GQPZHNGYFYMRTD-UHFFFAOYSA-N 0.000 description 1
- ISUMUAKOGDLTCO-UHFFFAOYSA-N 2-hydroxy-5-methylbenzotriazole Chemical compound C1=C(C)C=CC2=NN(O)N=C21 ISUMUAKOGDLTCO-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- PJIIWWVHGXJKGG-UHFFFAOYSA-N 4,6-dichloro-1-[2-(4,6-dichloronaphthalen-1-yl)propan-2-yl]naphthalene Chemical compound ClC1=CC=C2C(C(C)(C=3C4=CC=C(Cl)C=C4C(Cl)=CC=3)C)=CC=C(Cl)C2=C1 PJIIWWVHGXJKGG-UHFFFAOYSA-N 0.000 description 1
- CNGYZEMWVAWWOB-VAWYXSNFSA-N 5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(e)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound N=1C(NC=2C=C(C(\C=C\C=3C(=CC(NC=4N=C(N=C(NC=5C=CC=CC=5)N=4)N(CCO)CCO)=CC=3)S(O)(=O)=O)=CC=2)S(O)(=O)=O)=NC(N(CCO)CCO)=NC=1NC1=CC=CC=C1 CNGYZEMWVAWWOB-VAWYXSNFSA-N 0.000 description 1
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- QORUGOXNWQUALA-UHFFFAOYSA-N N=C=O.N=C=O.N=C=O.C1=CC=C(C(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 Chemical compound N=C=O.N=C=O.N=C=O.C1=CC=C(C(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 QORUGOXNWQUALA-UHFFFAOYSA-N 0.000 description 1
- CGSLYBDCEGBZCG-UHFFFAOYSA-N Octicizer Chemical compound C=1C=CC=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 CGSLYBDCEGBZCG-UHFFFAOYSA-N 0.000 description 1
- 241000238633 Odonata Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- FYAMXEPQQLNQDM-UHFFFAOYSA-N Tris(1-aziridinyl)phosphine oxide Chemical compound C1CN1P(N1CC1)(=O)N1CC1 FYAMXEPQQLNQDM-UHFFFAOYSA-N 0.000 description 1
- JETSKDPKURDVNI-UHFFFAOYSA-N [C].[Ca] Chemical compound [C].[Ca] JETSKDPKURDVNI-UHFFFAOYSA-N 0.000 description 1
- PEQYWQJRQVAUAZ-UHFFFAOYSA-L [Cr](=O)(=O)(Cl)Cl.C(C(=C)C)(=O)O Chemical compound [Cr](=O)(=O)(Cl)Cl.C(C(=C)C)(=O)O PEQYWQJRQVAUAZ-UHFFFAOYSA-L 0.000 description 1
- CDOMXXVCZQOOMT-UHFFFAOYSA-N [phenoxy(phenyl)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CDOMXXVCZQOOMT-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001334 alicyclic compounds Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- YTFJQDNGSQJFNA-UHFFFAOYSA-N benzyl dihydrogen phosphate Chemical compound OP(O)(=O)OCC1=CC=CC=C1 YTFJQDNGSQJFNA-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- OFOXPUGNNSFGPE-UHFFFAOYSA-N bis(2,2-dimethylpropyl) phenyl phosphate Chemical compound CC(C)(C)COP(=O)(OCC(C)(C)C)OC1=CC=CC=C1 OFOXPUGNNSFGPE-UHFFFAOYSA-N 0.000 description 1
- XIMUORXKUCOUFY-UHFFFAOYSA-N bis(2-ethylhexyl) (4-methylphenyl) phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OC1=CC=C(C)C=C1 XIMUORXKUCOUFY-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- DJKGDNKYTKCJKD-UHFFFAOYSA-N chlorendic acid Chemical compound ClC1=C(Cl)C2(Cl)C(C(=O)O)C(C(O)=O)C1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- NLCKLZIHJQEMCU-UHFFFAOYSA-N cyano prop-2-enoate Chemical class C=CC(=O)OC#N NLCKLZIHJQEMCU-UHFFFAOYSA-N 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical class C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- YICSVBJRVMLQNS-UHFFFAOYSA-N dibutyl phenyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OC1=CC=CC=C1 YICSVBJRVMLQNS-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- OHZIKCOBQFCTDM-UHFFFAOYSA-N didodecyl phenyl phosphate Chemical compound CCCCCCCCCCCCOP(=O)(OCCCCCCCCCCCC)OC1=CC=CC=C1 OHZIKCOBQFCTDM-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- CIJWIJSYZZLMGD-UHFFFAOYSA-N diphenylphosphoryloxybenzene Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CIJWIJSYZZLMGD-UHFFFAOYSA-N 0.000 description 1
- VIQSRHWJEKERKR-UHFFFAOYSA-L disodium;terephthalate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=C(C([O-])=O)C=C1 VIQSRHWJEKERKR-UHFFFAOYSA-L 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- UBIJTWDKTYCPMQ-UHFFFAOYSA-N hexachlorophosphazene Chemical compound ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 UBIJTWDKTYCPMQ-UHFFFAOYSA-N 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- BCDIWLCKOCHCIH-UHFFFAOYSA-N methylphosphinic acid Chemical compound CP(O)=O BCDIWLCKOCHCIH-UHFFFAOYSA-N 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960000969 phenyl salicylate Drugs 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 125000005538 phosphinite group Chemical group 0.000 description 1
- 125000005541 phosphonamide group Chemical group 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical class OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920006380 polyphenylene oxide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920000874 polytetramethylene terephthalate Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- WSANLGASBHUYGD-UHFFFAOYSA-N sulfidophosphanium Chemical class S=[PH3] WSANLGASBHUYGD-UHFFFAOYSA-N 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- AKXUUJCMWZFYMV-UHFFFAOYSA-M tetrakis(hydroxymethyl)phosphanium;chloride Chemical compound [Cl-].OC[P+](CO)(CO)CO AKXUUJCMWZFYMV-UHFFFAOYSA-M 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- 238000001721 transfer moulding Methods 0.000 description 1
- GQIUQDDJKHLHTB-UHFFFAOYSA-N trichloro(ethenyl)silane Chemical compound Cl[Si](Cl)(Cl)C=C GQIUQDDJKHLHTB-UHFFFAOYSA-N 0.000 description 1
- BPSIOYPQMFLKFR-UHFFFAOYSA-N trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CO[Si](OC)(OC)CCCOCC1CO1 BPSIOYPQMFLKFR-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- VYNGFCUGSYEOOZ-UHFFFAOYSA-N triphenylphosphine sulfide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=S)C1=CC=CC=C1 VYNGFCUGSYEOOZ-UHFFFAOYSA-N 0.000 description 1
- OOZBTDPWFHJVEK-UHFFFAOYSA-N tris(2-nonylphenyl) phosphate Chemical compound CCCCCCCCCC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC OOZBTDPWFHJVEK-UHFFFAOYSA-N 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 239000005050 vinyl trichlorosilane Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/24—Acids; Salts thereof
- C08K3/26—Carbonates; Bicarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/32—Phosphorus-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/02—Halogenated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11870674A JPS536016B2 (enExample) | 1974-10-17 | 1974-10-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2546674A1 DE2546674A1 (de) | 1976-04-29 |
| DE2546674C2 true DE2546674C2 (de) | 1982-07-22 |
Family
ID=14743102
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2546674A Expired DE2546674C2 (de) | 1974-10-17 | 1975-10-17 | Feuerhemmende thermoplastische Polyestermassen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4102853A (enExample) |
| JP (1) | JPS536016B2 (enExample) |
| CA (1) | CA1061026A (enExample) |
| DE (1) | DE2546674C2 (enExample) |
| FR (1) | FR2288122A1 (enExample) |
| GB (1) | GB1511279A (enExample) |
| NL (1) | NL7512217A (enExample) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS592466B2 (ja) * | 1977-05-18 | 1984-01-18 | 帝人株式会社 | 難燃性樹脂組成物 |
| JPS541361A (en) * | 1977-06-07 | 1979-01-08 | Teijin Ltd | Polyester composition |
| US4168259A (en) * | 1977-07-11 | 1979-09-18 | Gaf Corporation | Glass reinforced PBT resins |
| DE2943535A1 (de) * | 1979-10-27 | 1981-05-07 | Dynamit Nobel Ag, 5210 Troisdorf | Flammgeschuetztes polybutylenterephthalat mit verbesserter viskositaet |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| CA1174780A (en) * | 1980-08-06 | 1984-09-18 | John Christiansen | High gloss polyethylene terephthalate reinforced resin compositions |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| JPS5755957A (en) * | 1980-09-22 | 1982-04-03 | Toray Ind Inc | Flame-retardant polyester composition |
| US4401784A (en) * | 1981-01-27 | 1983-08-30 | Ciba-Geigy Corporation | Thermoplastic moulding composition and use thereof |
| JPS5871944A (ja) * | 1981-10-26 | 1983-04-28 | Polyplastics Co | 耐熱安定性ポリエステル組成物 |
| IL80021A (en) * | 1985-11-13 | 1993-04-04 | Bromine Compounds Ltd | Granular flame retardant agents, process for their preparation and articles obtained thereby |
| JP2848865B2 (ja) * | 1989-10-04 | 1999-01-20 | 帝人株式会社 | 難燃性樹脂組成物及び電気部品用成形品 |
| GB9013881D0 (en) * | 1990-06-21 | 1990-08-15 | Bip Chem Ltd | Improvements in or relating to polyamide compositions |
| US5593619A (en) * | 1992-10-22 | 1997-01-14 | Albemarle Corporation | Granulated flame retardant products |
| US6177488B1 (en) * | 1995-08-25 | 2001-01-23 | Kansai Paint Company, Limited | Aqueous colored base coating composition |
| US5965639A (en) * | 1996-10-16 | 1999-10-12 | Toray Industries, Inc. | Flame retardant resin composition |
| US6239197B1 (en) | 1999-04-23 | 2001-05-29 | Great Lakes Chemical Corporation | Vacuum de-aerated powdered polymer additives |
| DE10002160A1 (de) * | 2000-01-20 | 2001-07-26 | Mitsubishi Polyester Film Gmbh | Matte, UV-stabile, schwerentflammbare koextrudierte Polyesterfolie, Verfahren zu ihrer Herstellung und ihre Verwendung |
| KR20020069366A (ko) * | 2000-01-20 | 2002-08-30 | 미쓰비시 폴리에스테르 필름 지엠비에치 | 결정성 열가소성 수지로 제조된 백색 방염성 내uv성열성형성 필름, 그 제조방법 및 그 용도 |
| DE10002161A1 (de) * | 2000-01-20 | 2001-07-26 | Mitsubishi Polyester Film Gmbh | Matte, flammhemmend ausgerüstete koextrudierte Polyesterfolie, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10002163A1 (de) * | 2000-01-20 | 2001-07-26 | Mitsubishi Polyester Film Gmbh | Weiße, schwerentflammbare, UV-stabile Folie aus einem kristallisierbaren Thermoplasten, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10002169A1 (de) * | 2000-01-20 | 2001-07-26 | Mitsubishi Polyester Film Gmbh | Matte, UV-stabile, thermoformbare, koextrudierte Polyesterfolie, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10007730A1 (de) * | 2000-02-19 | 2001-08-23 | Mitsubishi Polyester Film Gmbh | Transparente, siegelfähige, flammhemmend ausgerüstete Polyesterfolie, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10007725A1 (de) * | 2000-02-19 | 2001-08-23 | Mitsubishi Polyester Film Gmbh | Einseitig matte, siegelfähige, UV stabilisierte und flammhemmend ausgerüstete, koextrudierte, biaxial orientierte Polyesterfolie, Verfahren zu ihrer Herstellung ihre Verwendung |
| KR100401326B1 (ko) * | 2001-06-08 | 2003-10-10 | 제일모직주식회사 | 난연성 열가소성 수지조성물 |
| KR100406593B1 (ko) * | 2001-06-08 | 2003-11-20 | 제일모직주식회사 | 난연성 열가소성 수지조성물 |
| JP2002265777A (ja) * | 2001-03-12 | 2002-09-18 | Matsushita Electric Works Ltd | ポリフェニレンオキサイド樹脂組成物、プリプレグ、積層板、プリント配線板、多層プリント配線板 |
| CN1216939C (zh) * | 2001-05-02 | 2005-08-31 | 旭化成株式会社 | 增强的聚对苯二甲酸丙二醇酯树脂组合物 |
| US20040171722A1 (en) * | 2003-02-28 | 2004-09-02 | Brown William R. | Flame retardant polyurethanes and additive compositions for use in producing them |
| KR100650910B1 (ko) * | 2004-10-13 | 2006-11-27 | 제일모직주식회사 | 난연성 열가소성 수지 조성물 |
| US20090156714A1 (en) * | 2007-12-17 | 2009-06-18 | Subramaniam Narayan | Flame retardant compositions |
| KR100885819B1 (ko) * | 2007-12-18 | 2009-02-26 | 제일모직주식회사 | 굴절률이 우수한 분지형 아크릴계 공중합체 및 그 제조방법 |
| KR101004040B1 (ko) * | 2007-12-18 | 2010-12-31 | 제일모직주식회사 | 상용성이 향상된 난연 내스크래치 열가소성 수지 조성물 |
| KR100902352B1 (ko) * | 2008-03-13 | 2009-06-12 | 제일모직주식회사 | 상용성이 향상된 열가소성 수지 조성물 |
| KR100886348B1 (ko) * | 2008-04-14 | 2009-03-03 | 제일모직주식회사 | 상용성이 개선된 난연 내스크래치 열가소성 수지 조성물 |
| KR101188349B1 (ko) * | 2008-12-17 | 2012-10-05 | 제일모직주식회사 | 투명성 및 내스크래치성이 향상된 폴리카보네이트계 수지 조성물 |
| US8735490B2 (en) * | 2009-12-30 | 2014-05-27 | Cheil Industries Inc. | Thermoplastic resin composition having improved impact strength and melt flow properties |
| JP5654300B2 (ja) * | 2010-09-17 | 2015-01-14 | ポリプラスチックス株式会社 | 一体成形体 |
| JP5650496B2 (ja) * | 2010-10-28 | 2015-01-07 | ウィンテックポリマー株式会社 | 一体成形体 |
| JP5724104B2 (ja) | 2010-11-30 | 2015-05-27 | 株式会社白石中央研究所 | 樹脂組成物 |
| US20140371366A1 (en) * | 2013-06-14 | 2014-12-18 | Sabic Innovative Plastics Ip B.V. | Flame Retardant Polyester Composition |
| CN105683286B (zh) * | 2013-10-28 | 2017-07-21 | 帝人杜邦薄膜日本有限公司 | 阻燃性双轴取向聚酯膜、由其形成的阻燃性聚酯膜层合体和柔性电路基板 |
| EP2881408B1 (en) | 2013-12-04 | 2017-09-20 | Lotte Advanced Materials Co., Ltd. | Styrene-based copolymer and thermoplastic resin composition including the same |
| US9902850B2 (en) | 2014-06-26 | 2018-02-27 | Lotte Advanced Materials Co., Ltd. | Thermoplastic resin composition |
| US9790362B2 (en) | 2014-06-27 | 2017-10-17 | Lotte Advanced Materials Co., Ltd. | Thermoplastic resin composition and molded article made using the same |
| US9850333B2 (en) | 2014-06-27 | 2017-12-26 | Lotte Advanced Materials Co., Ltd. | Copolymers and thermoplastic resin composition including the same |
| US9856371B2 (en) | 2014-06-27 | 2018-01-02 | Lotte Advanced Materials Co., Ltd. | Thermoplastic resin composition and low-gloss molded article made therefrom |
| KR101822697B1 (ko) | 2014-11-18 | 2018-01-30 | 롯데첨단소재(주) | 외관 특성이 우수한 열가소성 수지 조성물 및 이를 이용한 성형품 |
| US9670338B2 (en) | 2014-11-18 | 2017-06-06 | International Business Machines Corporation | Polymer comprising mesoporous flame retardant |
| EP3227377A4 (en) * | 2014-12-03 | 2018-06-27 | FRX Polymers, Inc. | Flame retardant thermoplastic and thermoset compositions |
| KR102776201B1 (ko) * | 2018-09-20 | 2025-03-07 | 도레이 카부시키가이샤 | 열가소성 폴리에스테르 수지 조성물 및 성형품 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1090598A (en) * | 1964-08-17 | 1967-11-08 | Hooker Chemical Corp | Polymers and coatings rendered flame retardant by the addition of halogenated cyclopentadiene diels-alder adducts |
| US3516957A (en) * | 1968-04-29 | 1970-06-23 | Eastman Kodak Co | Thermoplastic polyester composition containing organic ester mold release agent |
| NO133760C (enExample) * | 1970-01-02 | 1976-06-23 | Baychem Corp | |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3647747A (en) * | 1970-04-15 | 1972-03-07 | Gen Electric | High temperature molding flame retardant polycarbonate composition |
| BE755318A (fr) * | 1970-06-16 | 1971-02-26 | Celanese Corp | Composition peu ou pas combustible de poly (terephtalate d'alkylene) a mouler |
| US3688001A (en) * | 1970-08-03 | 1972-08-29 | Dow Chemical Co | Carbonates containing halogenated neopentyl groups |
| US3663502A (en) * | 1970-10-29 | 1972-05-16 | American Cyanamid Co | Tertiary phosphine oxide-ammonium polyphosphate combinations as flame-retardants for propylene polymers |
| US3751396A (en) * | 1970-11-27 | 1973-08-07 | Celanese Corp | Reinforced polyalkylene terephthalate molding resin having reduced burning properties in thin sections |
| US3875108A (en) * | 1970-12-18 | 1975-04-01 | Allied Chem | Deep dyeable, lusterous, and fire-retardant linear polyester composition |
| US3671487A (en) * | 1971-05-05 | 1972-06-20 | Gen Electric | Glass reinforced polyester resins containing polytetrafluoroethylene and flame retardant additives |
| US3833535A (en) * | 1971-08-30 | 1974-09-03 | Gen Electric | Non-dripping flame retardant glass reinforced polyester resins |
| US3847861A (en) * | 1971-09-14 | 1974-11-12 | Allied Chem | Polyethylene terephthalate |
| BE790385A (fr) * | 1971-11-01 | 1973-02-15 | Gen Electric | Perfectionnements aux compositions thermoplastiques a inflammation retardee, et aux procedes pour leur |
| JPS52503B2 (enExample) * | 1971-12-29 | 1977-01-08 | ||
| DE2226931A1 (de) * | 1972-06-02 | 1973-12-13 | Basf Ag | Flammwidrige glasfaserverstaerkte formmassen auf basis gesaettigter linearer polyester, insbesondere polybutylenterephthalat |
| DE2246861A1 (de) * | 1972-09-23 | 1974-03-28 | Hoechst Ag | Schwerentflammbare thermoplastische polyester |
| DE2247652A1 (de) * | 1972-09-28 | 1974-04-04 | Basf Ag | Schwer entflammbare und selbstverloeschende formmassen |
| DE2252258A1 (de) * | 1972-10-25 | 1974-05-09 | Hoechst Ag | Schwerentflammbare thermoplastische polyester |
| US4010219A (en) * | 1972-12-28 | 1977-03-01 | Toray Industries, Inc. | Flame retardant polyester composition |
| DE2302583A1 (de) * | 1973-01-19 | 1974-07-25 | Basf Ag | Selbstverloeschende polyester-formmassen |
| US3867336A (en) * | 1973-04-13 | 1975-02-18 | Gen Electric | Flame retardant thermoplastic compositions |
| US3909485A (en) * | 1973-07-11 | 1975-09-30 | Mitsubishi Rayon Co | Flame-resistant glass-fiber reinforced polytetramethylene terephthalate resin composition |
| JPS5720974B2 (enExample) * | 1973-09-14 | 1982-05-04 | ||
| DE2512504A1 (de) * | 1975-03-21 | 1976-10-07 | Basf Ag | Polyesterformmassen mit verminderter brennbarkeit |
-
1974
- 1974-10-17 JP JP11870674A patent/JPS536016B2/ja not_active Expired
-
1975
- 1975-10-15 GB GB42320/75A patent/GB1511279A/en not_active Expired
- 1975-10-15 US US05/622,498 patent/US4102853A/en not_active Expired - Lifetime
- 1975-10-16 CA CA237,811A patent/CA1061026A/en not_active Expired
- 1975-10-17 NL NL7512217A patent/NL7512217A/xx unknown
- 1975-10-17 DE DE2546674A patent/DE2546674C2/de not_active Expired
- 1975-10-17 FR FR7531864A patent/FR2288122A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS536016B2 (enExample) | 1978-03-03 |
| DE2546674A1 (de) | 1976-04-29 |
| CA1061026A (en) | 1979-08-21 |
| FR2288122A1 (fr) | 1976-05-14 |
| GB1511279A (en) | 1978-05-17 |
| US4102853A (en) | 1978-07-25 |
| NL7512217A (nl) | 1976-04-21 |
| FR2288122B1 (enExample) | 1978-04-07 |
| JPS5146344A (enExample) | 1976-04-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2546674C2 (de) | Feuerhemmende thermoplastische Polyestermassen | |
| DE2921325C2 (de) | Flammabweisende aromatische Polycarbonatmassen | |
| DE69220532T2 (de) | Kristalline Pulver von aromatischen Diphosphaten, ihre Herstellung und Verwendung | |
| DE2523010C2 (de) | Feuerfeste thermoplastische Polyesterformmasse und deren Verwendung | |
| DE2242509C2 (de) | Nicht-tropfende, flammhemmende, mit Glas verstärkte Polyesterharze und Verfahren zu ihrer Herstellung | |
| US4222926A (en) | Flame-retardant thermoplastic polyester resin compositions | |
| DE2331826A1 (de) | Thermoplastische massen | |
| DE2255654C2 (de) | Polyester-Formmasse | |
| EP0030618B1 (de) | Flammwidrige Formmassen auf Basis von Polyethylenterephthalat, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Formkörpern | |
| DE2228072C3 (de) | Selbstauslöschende und nicht-tropfende thermoplastische Formmasse | |
| DE60103938T2 (de) | Flammgeschützte und flammhemmende Harzzusammensetzung | |
| DE2221772A1 (de) | Entflammungshemmende,glasverstaerkte Polyester-Harze | |
| DE19708726A1 (de) | Flammgeschützte Polymerformmassen | |
| EP0482451B1 (de) | Lichtalterungsbeständige, flammwidrige Polycarbonat-, Polyestercarbonat- oder Polyarylat-Formmassen | |
| EP0362623B1 (de) | Flammgeschütze, gut kristallisierende Polyethylenterephthalatformmassen | |
| DE4133124A1 (de) | Anorganische nebengruppenmetallsalze enthaltende thermoplastische formmassen | |
| JPH0292961A (ja) | 抗着火性改質熱可塑性組成物及び製造方法 | |
| DE69800960T2 (de) | Flammgeschützte Polyesterzusammensetzung | |
| DE68928701T2 (de) | Flammfester Formkörper und Verfahren zu dessen Herstellung | |
| WO2011039301A1 (de) | Funktionalisierte expandierbare graphiteinlagerungsverbindungen | |
| DE2045079A1 (de) | Flammhemmende Mittel und sie ent haltende Kunstharzmassen | |
| EP1817174A1 (de) | Formmasse für die herstellung schwer entflammbarer gegenstände, pigment hierfür und dessen verwendung | |
| DE2835653A1 (de) | Thermoplastische polyestermasse | |
| EP0469354B1 (en) | Flame-resistant polyolefinic fibres and films | |
| DE3713747A1 (de) | Flammgeschuetzte thermoplastische polyesterformmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR.RER.NAT. KLINGSEISEN, F., DIPL.-ING. ZUMSTEIN JUN., F., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8331 | Complete revocation |