DE2542847A1 - Aus schichten zusammengesetzter fotorezeptor - Google Patents
Aus schichten zusammengesetzter fotorezeptorInfo
- Publication number
- DE2542847A1 DE2542847A1 DE19752542847 DE2542847A DE2542847A1 DE 2542847 A1 DE2542847 A1 DE 2542847A1 DE 19752542847 DE19752542847 DE 19752542847 DE 2542847 A DE2542847 A DE 2542847A DE 2542847 A1 DE2542847 A1 DE 2542847A1
- Authority
- DE
- Germany
- Prior art keywords
- layer
- active
- photoconductive
- layers
- electrically
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 108091008695 photoreceptors Proteins 0.000 title claims description 17
- 239000000463 material Substances 0.000 claims description 84
- 239000000758 substrate Substances 0.000 claims description 28
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 claims description 15
- 238000002347 injection Methods 0.000 claims description 9
- 239000007924 injection Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 238000003384 imaging method Methods 0.000 claims description 7
- 238000012546 transfer Methods 0.000 claims description 7
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 claims description 6
- 239000002800 charge carrier Substances 0.000 claims description 6
- 230000007547 defect Effects 0.000 claims description 5
- 230000003213 activating effect Effects 0.000 claims description 2
- 230000005525 hole transport Effects 0.000 claims 1
- 239000002861 polymer material Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 155
- 230000032258 transport Effects 0.000 description 45
- 230000009056 active transport Effects 0.000 description 24
- 229920000642 polymer Polymers 0.000 description 24
- 239000011230 binding agent Substances 0.000 description 21
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 17
- 239000011149 active material Substances 0.000 description 17
- 229910052711 selenium Inorganic materials 0.000 description 16
- 239000011669 selenium Substances 0.000 description 16
- 239000002245 particle Substances 0.000 description 13
- 239000011159 matrix material Substances 0.000 description 10
- 229920000915 polyvinyl chloride Polymers 0.000 description 10
- 239000004800 polyvinyl chloride Substances 0.000 description 10
- -1 Polymethylene pyrene Polymers 0.000 description 9
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 8
- 239000002131 composite material Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000370 acceptor Substances 0.000 description 7
- 229920000728 polyester Polymers 0.000 description 7
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 5
- 239000011368 organic material Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 230000002745 absorbent Effects 0.000 description 4
- 239000002250 absorbent Substances 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- 238000005299 abrasion Methods 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000004020 conductor Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 229920001225 polyester resin Polymers 0.000 description 3
- 239000004645 polyester resin Substances 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- DXBHBZVCASKNBY-UHFFFAOYSA-N 1,2-Benz(a)anthracene Chemical compound C1=CC=C2C3=CC4=CC=CC=C4C=C3C=CC2=C1 DXBHBZVCASKNBY-UHFFFAOYSA-N 0.000 description 2
- KBSPJIWZDWBDGM-UHFFFAOYSA-N 1-Methylpyrene Chemical compound C1=C2C(C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 KBSPJIWZDWBDGM-UHFFFAOYSA-N 0.000 description 2
- WPMHMYHJGDAHKX-UHFFFAOYSA-N 1-ethenylpyrene Chemical compound C1=C2C(C=C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 WPMHMYHJGDAHKX-UHFFFAOYSA-N 0.000 description 2
- IYDMICQAKLQHLA-UHFFFAOYSA-N 1-phenylnaphthalene Chemical compound C1=CC=CC=C1C1=CC=CC2=CC=CC=C12 IYDMICQAKLQHLA-UHFFFAOYSA-N 0.000 description 2
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 2
- VIJYEGDOKCKUOL-UHFFFAOYSA-N 9-phenylcarbazole Chemical compound C1=CC=CC=C1N1C2=CC=CC=C2C2=CC=CC=C21 VIJYEGDOKCKUOL-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229920001342 Bakelite® Polymers 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- RAASUWZPTOJQAY-UHFFFAOYSA-N Dibenz[a,c]anthracene Chemical compound C1=CC=C2C3=CC4=CC=CC=C4C=C3C3=CC=CC=C3C2=C1 RAASUWZPTOJQAY-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229910001370 Se alloy Inorganic materials 0.000 description 2
- 229920006387 Vinylite Polymers 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000004637 bakelite Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- PGWFQHBXMJMAPN-UHFFFAOYSA-N ctk4b5078 Chemical compound [Cd].OS(=O)(=O)[Se]S(O)(=O)=O PGWFQHBXMJMAPN-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 239000012212 insulator Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 238000003909 pattern recognition Methods 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- GBROPGWFBFCKAG-UHFFFAOYSA-N picene Chemical compound C1=CC2=C3C=CC=CC3=CC=C2C2=C1C1=CC=CC=C1C=C2 GBROPGWFBFCKAG-UHFFFAOYSA-N 0.000 description 2
- 229920005668 polycarbonate resin Polymers 0.000 description 2
- 239000004431 polycarbonate resin Substances 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- LQYCEPZHJMYYQE-UHFFFAOYSA-N 1,2,3-trichloro-4,5,6-trinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C([N+]([O-])=O)=C1[N+]([O-])=O LQYCEPZHJMYYQE-UHFFFAOYSA-N 0.000 description 1
- QIUGUNHEXAZYIY-UHFFFAOYSA-N 1,2-dinitroacridine Chemical compound C1=CC=CC2=CC3=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C3N=C21 QIUGUNHEXAZYIY-UHFFFAOYSA-N 0.000 description 1
- NMNSBFYYVHREEE-UHFFFAOYSA-N 1,2-dinitroanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C3C(=O)C2=C1 NMNSBFYYVHREEE-UHFFFAOYSA-N 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- HYQUWYMJSAPGDY-UHFFFAOYSA-N 1,5-dibromo-2,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Br)C=C1Br HYQUWYMJSAPGDY-UHFFFAOYSA-N 0.000 description 1
- ZPXDNSYFDIHPOJ-UHFFFAOYSA-N 1,5-dichloro-2,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl ZPXDNSYFDIHPOJ-UHFFFAOYSA-N 0.000 description 1
- HYGLETVERPVXOS-UHFFFAOYSA-N 1-bromopyrene Chemical compound C1=C2C(Br)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 HYGLETVERPVXOS-UHFFFAOYSA-N 0.000 description 1
- NQUNFJPWTMNGSY-UHFFFAOYSA-N 1-buta-1,3-dienylpyrene Chemical compound C1=C2C(C=CC=C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 NQUNFJPWTMNGSY-UHFFFAOYSA-N 0.000 description 1
- HJRJRUMKQCMYDL-UHFFFAOYSA-N 1-chloro-2,4,6-trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1 HJRJRUMKQCMYDL-UHFFFAOYSA-N 0.000 description 1
- ZWAMZDRREBOHIO-UHFFFAOYSA-N 1-ethylpyrene Chemical compound C1=C2C(CC)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 ZWAMZDRREBOHIO-UHFFFAOYSA-N 0.000 description 1
- BDLNCFCZHNKBGI-UHFFFAOYSA-N 1-nitro-4-(4-nitrophenyl)benzene Chemical group C1=CC([N+](=O)[O-])=CC=C1C1=CC=C([N+]([O-])=O)C=C1 BDLNCFCZHNKBGI-UHFFFAOYSA-N 0.000 description 1
- KCIJNJVCFPSUBQ-UHFFFAOYSA-N 1-pyren-1-ylethanone Chemical compound C1=C2C(C(=O)C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 KCIJNJVCFPSUBQ-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- PBOPJYORIDJAFE-UHFFFAOYSA-N 2,4-dinitrobromobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 PBOPJYORIDJAFE-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- JJEJACZBVVTDIH-UHFFFAOYSA-N 2-ethenyl-9h-carbazole Chemical compound C1=CC=C2C3=CC=C(C=C)C=C3NC2=C1 JJEJACZBVVTDIH-UHFFFAOYSA-N 0.000 description 1
- FMXDVBRYDYFVGS-UHFFFAOYSA-N 2-methoxy-1,3,5-trinitrobenzene Chemical compound COC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O FMXDVBRYDYFVGS-UHFFFAOYSA-N 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- VIRDQWZTIAVLSE-UHFFFAOYSA-N 3-ethenyl-9h-carbazole Chemical compound C1=CC=C2C3=CC(C=C)=CC=C3NC2=C1 VIRDQWZTIAVLSE-UHFFFAOYSA-N 0.000 description 1
- BAJQRLZAPXASRD-UHFFFAOYSA-N 4-Nitrobiphenyl Chemical group C1=CC([N+](=O)[O-])=CC=C1C1=CC=CC=C1 BAJQRLZAPXASRD-UHFFFAOYSA-N 0.000 description 1
- IXAFAYIIDHDJHN-UHFFFAOYSA-N 4-methylpyrene Natural products C1=CC=C2C(C)=CC3=CC=CC4=CC=C1C2=C34 IXAFAYIIDHDJHN-UHFFFAOYSA-N 0.000 description 1
- OGOYZCQQQFAGRI-UHFFFAOYSA-N 9-ethenylanthracene Chemical compound C1=CC=C2C(C=C)=C(C=CC=C3)C3=CC2=C1 OGOYZCQQQFAGRI-UHFFFAOYSA-N 0.000 description 1
- PLAZXGNBGZYJSA-UHFFFAOYSA-N 9-ethylcarbazole Chemical compound C1=CC=C2N(CC)C3=CC=CC=C3C2=C1 PLAZXGNBGZYJSA-UHFFFAOYSA-N 0.000 description 1
- LRSYZHFYNDZXMU-UHFFFAOYSA-N 9h-carbazol-3-amine Chemical compound C1=CC=C2C3=CC(N)=CC=C3NC2=C1 LRSYZHFYNDZXMU-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical class NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229910000967 As alloy Inorganic materials 0.000 description 1
- FMMWHPNWAFZXNH-UHFFFAOYSA-N Benz[a]pyrene Chemical compound C1=C2C3=CC=CC=C3C=C(C=C3)C2=C2C3=CC=CC2=C1 FMMWHPNWAFZXNH-UHFFFAOYSA-N 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- 229920000134 Metallised film Polymers 0.000 description 1
- 239000005041 Mylar™ Substances 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- 229910001215 Te alloy Inorganic materials 0.000 description 1
- XBDYBAVJXHJMNQ-UHFFFAOYSA-N Tetrahydroanthracene Natural products C1=CC=C2C=C(CCCC3)C3=CC2=C1 XBDYBAVJXHJMNQ-UHFFFAOYSA-N 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- QLNFINLXAKOTJB-UHFFFAOYSA-N [As].[Se] Chemical compound [As].[Se] QLNFINLXAKOTJB-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- LHRCREOYAASXPZ-UHFFFAOYSA-N dibenz[a,h]anthracene Chemical compound C1=CC=C2C(C=C3C=CC=4C(C3=C3)=CC=CC=4)=C3C=CC2=C1 LHRCREOYAASXPZ-UHFFFAOYSA-N 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 150000002605 large molecules Chemical group 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- IFLREYGFSNHWGE-UHFFFAOYSA-N tetracene Chemical compound C1=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C21 IFLREYGFSNHWGE-UHFFFAOYSA-N 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 230000007723 transport mechanism Effects 0.000 description 1
- 125000005580 triphenylene group Chemical group 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 229920006163 vinyl copolymer Polymers 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/043—Photoconductive layers characterised by having two or more layers or characterised by their composite structure
- G03G5/047—Photoconductive layers characterised by having two or more layers or characterised by their composite structure characterised by the charge-generation layers or charge transport layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/043—Photoconductive layers characterised by having two or more layers or characterised by their composite structure
- G03G5/0436—Photoconductive layers characterised by having two or more layers or characterised by their composite structure combining organic and inorganic layers
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/517,978 US3953207A (en) | 1974-10-25 | 1974-10-25 | Composite layered photoreceptor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2542847A1 true DE2542847A1 (de) | 1976-04-29 |
Family
ID=24062023
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752542847 Pending DE2542847A1 (de) | 1974-10-25 | 1975-09-25 | Aus schichten zusammengesetzter fotorezeptor |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3953207A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5165943A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2542847A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1515396A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7512447A (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0029703A1 (en) * | 1979-11-23 | 1981-06-03 | Xerox Corporation | Electrophotographic imaging member |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2404921A1 (de) * | 1974-02-01 | 1975-08-14 | Turlabor Ag | Verfahren zur verbesserung der photoelektrischen eigenschaften eines geschichteten ladungsbildtraegers |
| FR2279137A1 (fr) * | 1974-07-19 | 1976-02-13 | Xonics Inc | Feuille sensible pour radiographie electronique |
| DE2452623C2 (de) * | 1974-11-06 | 1983-12-01 | Hoechst Ag, 6230 Frankfurt | Elektrophotographisches Aufzeichnungsmaterial |
| US4047945A (en) * | 1975-02-18 | 1977-09-13 | Xerox Corporation | Xeroprinting master and process |
| US4190445A (en) * | 1975-03-20 | 1980-02-26 | Canon Kabushiki Kaisha | Electrophotographic photosensitive media and process for manufacturing thereof |
| US4066455A (en) * | 1975-11-05 | 1978-01-03 | Eastman Kodak Company | Selenium containing multi-active photoconductive element |
| US4131462A (en) * | 1976-02-17 | 1978-12-26 | Honeywell Inc. | Element for thermoplastic recording |
| US4192677A (en) * | 1976-05-18 | 1980-03-11 | Ricoh Co., Ltd. | 1,3,4-Oxadiazole derivatives and use thereof |
| US4076527A (en) * | 1976-10-26 | 1978-02-28 | Xerox Corporation | Photosensitive composition useful in photoelectrophoretic imaging |
| US4047949A (en) * | 1976-11-01 | 1977-09-13 | Xerox Corporation | Composite layered imaging member for electrophotography |
| US4081274A (en) * | 1976-11-01 | 1978-03-28 | Xerox Corporation | Composite layered photoreceptor |
| US4078925A (en) * | 1976-11-01 | 1978-03-14 | Xerox Corporation | Composite layered photoreceptor |
| US4047948A (en) * | 1976-11-01 | 1977-09-13 | Xerox Corporation | Composite layered imaging member for electrophotography |
| JPS6057588B2 (ja) * | 1977-10-20 | 1985-12-16 | 株式会社リコー | 電子写真用感光体 |
| US4358519A (en) * | 1977-12-05 | 1982-11-09 | Honeywell Inc. | Technique of introducing an interface layer in a thermoplastic photoconductor medium |
| US4214907A (en) * | 1978-01-05 | 1980-07-29 | Mita Industrial Company, Ltd. | Photosensitive material for electrophotography having a polyvinyl carbazole derivative, phthalocyanine, and an electron-acceptor |
| JPS54110837A (en) * | 1978-02-17 | 1979-08-30 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| US4299897A (en) * | 1978-12-15 | 1981-11-10 | Xerox Corporation | Aromatic amino charge transport layer in electrophotography |
| JPS55127561A (en) * | 1979-03-26 | 1980-10-02 | Canon Inc | Image forming member for electrophotography |
| US4291110A (en) * | 1979-06-11 | 1981-09-22 | Xerox Corporation | Siloxane hole trapping layer for overcoated photoreceptors |
| JPS55166647A (en) * | 1979-06-15 | 1980-12-25 | Fuji Photo Film Co Ltd | Photoconductive composition and electrophotographic receptor using this |
| US4378418A (en) * | 1979-09-04 | 1983-03-29 | Xerox Corporation | Hole injecting contact for overcoated photoreceptors |
| DE3040972A1 (de) * | 1979-10-30 | 1981-05-14 | Fuji Photo Film Co. Ltd., Minami-Ashigara, Kanagawa | Elektrophotographisches lichtempfindliches material und verfahren zu dessen herstellung |
| US4254199A (en) * | 1980-03-10 | 1981-03-03 | Xerox Corporation | Electrophotographic imaging method having a double charging sequence |
| JPS56143438A (en) * | 1980-04-10 | 1981-11-09 | Mita Ind Co Ltd | Improvement of electrophotographic sensitive layer |
| JPS56143439A (en) * | 1980-04-11 | 1981-11-09 | Mita Ind Co Ltd | Electrophotographic laminated sensitive plate |
| US4282294A (en) * | 1980-10-06 | 1981-08-04 | Honeywell Inc. | Polyvinyl blocking layer for preventing charge injection in a thermoplastic photoconductive device for holography |
| JPS6097360A (ja) * | 1983-11-01 | 1985-05-31 | Canon Inc | 電子写真感光体 |
| US4543314A (en) * | 1983-12-01 | 1985-09-24 | Xerox Corporation | Process for preparing electrostatographic photosensitive device comprising sodium additives and trigonal selenium particles |
| JPS6169081A (ja) * | 1984-08-22 | 1986-04-09 | Ricoh Co Ltd | 画像形成方法 |
| US4546059A (en) * | 1984-11-08 | 1985-10-08 | Xerox Corporation | Layered photoresponsive imaging members with sulfur incorporated dicyanomethylenefluorene carboxylate compositions |
| US8790853B2 (en) * | 2006-03-01 | 2014-07-29 | Xerox Corporation | Charge generating composition |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3394001A (en) * | 1964-03-03 | 1968-07-23 | Xerox Corp | Electrophotographic sensitive material containing electron-donor dye layers |
| US3723110A (en) * | 1966-12-19 | 1973-03-27 | Xerox Corp | Electrophotographic process |
| US3573906A (en) * | 1967-01-11 | 1971-04-06 | Xerox Corp | Electrophotographic plate and process |
| US3725058A (en) * | 1969-12-30 | 1973-04-03 | Matsushita Electric Industrial Co Ltd | Dual layered photoreceptor employing selenium sensitizer |
| US3713820A (en) * | 1971-09-07 | 1973-01-30 | Ibm | Electrophotographic charge transport layer |
| US3791826A (en) * | 1972-01-24 | 1974-02-12 | Ibm | Electrophotographic plate |
-
1974
- 1974-10-25 US US05/517,978 patent/US3953207A/en not_active Expired - Lifetime
-
1975
- 1975-09-25 DE DE19752542847 patent/DE2542847A1/de active Pending
- 1975-10-03 GB GB40591/75A patent/GB1515396A/en not_active Expired
- 1975-10-20 JP JP50126240A patent/JPS5165943A/ja active Pending
- 1975-10-23 NL NL7512447A patent/NL7512447A/xx not_active Application Discontinuation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0029703A1 (en) * | 1979-11-23 | 1981-06-03 | Xerox Corporation | Electrophotographic imaging member |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5165943A (cg-RX-API-DMAC10.html) | 1976-06-08 |
| GB1515396A (en) | 1978-06-21 |
| NL7512447A (nl) | 1976-04-27 |
| US3953207A (en) | 1976-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2542847A1 (de) | Aus schichten zusammengesetzter fotorezeptor | |
| DE2929518C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2712556A1 (de) | Aufzeichnungsverfahren und -vorrichtung | |
| DE2712557C2 (de) | Verwendung von N,N'-Diphenyl-N,N'-bis (phenylmethyl)-(1,1'-biphenyl)-4,4'-diamin in einem elektrofotografischen Aufzeichnungsmaterial | |
| DE3004339C2 (cg-RX-API-DMAC10.html) | ||
| DE2944949A1 (de) | Lichtempfindliches abbildeelement | |
| DE2734990A1 (de) | Elektrophotographisches aufzeichnungsmaterial und aufzeichnungsverfahren | |
| EP0001599A1 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung in einem Kopierverfahren | |
| DE2108939B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3235887C2 (de) | Elektrophotographisches Verfahren und elektrophotographisches Aufzeichnungsmaterial | |
| DE1932457A1 (de) | Induktionsabbildungsverfahren | |
| DE2552886A1 (de) | Verfahren zur herstellung elektrostatografischer fotorezeptoren | |
| DE69333311T2 (de) | Photoleiter beinhaltend sensibilisierte, extrinsische lichterzeugende Pigmente | |
| DE2108984C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2108968A1 (de) | Elektrophotographische Platte | |
| DE2108992A1 (de) | Elektrophotographische Platte | |
| DE2108938C2 (de) | Elektrofotografisches Aufzeichnungsmaterial und elektrofotografisches Verfahren zur Herstellung eines Ladungsbildes | |
| DE2415323A1 (de) | Photoaktive polymerisate mit induziertem exocyclischem quartett-konzept | |
| DE3033505A1 (de) | Abbildungselement | |
| DE2108935A1 (de) | Elektrophotographische Platte | |
| DE69511125T2 (de) | Bildherstellungsverfahren | |
| DE2108963C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2249028B2 (de) | Elektrophotographisches aufzeichnungsmaterial und elektrophotographisches verfahren zur herstellung eines ladungsbildes | |
| AT335285B (de) | Aufzeichnungstrager mit einer photorezeptorschicht und verfahren zur bilderzeugung | |
| DE3148967C2 (de) | Elektrophotographisches Aufzeichnungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |