DE2533985C2 - Verfahren zur Herstellung von 3'-Desoxyneamin, kanamycin B, ribostamycin, -6'-N-methylkanamycin B und paromamin - Google Patents
Verfahren zur Herstellung von 3'-Desoxyneamin, kanamycin B, ribostamycin, -6'-N-methylkanamycin B und paromaminInfo
- Publication number
- DE2533985C2 DE2533985C2 DE2533985A DE2533985A DE2533985C2 DE 2533985 C2 DE2533985 C2 DE 2533985C2 DE 2533985 A DE2533985 A DE 2533985A DE 2533985 A DE2533985 A DE 2533985A DE 2533985 C2 DE2533985 C2 DE 2533985C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- epoxy
- hydrogen
- kanamycin
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 29
- 229960001192 bekanamycin Drugs 0.000 title claims description 13
- QBWLTQZEVUXXSR-RROBTUQGSA-N Nebramine Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N QBWLTQZEVUXXSR-RROBTUQGSA-N 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 3
- SKKLOUVUUNMCJE-FQSMHNGLSA-N kanamycin B Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SKKLOUVUUNMCJE-FQSMHNGLSA-N 0.000 title description 10
- 229930182824 kanamycin B Natural products 0.000 title description 8
- 229930190553 ribostamycin Natural products 0.000 title description 7
- NSKGQURZWSPSBC-NLZFXWNVSA-N ribostamycin Chemical compound N[C@H]1[C@H](O)[C@@H](O)[C@H](CN)O[C@@H]1O[C@@H]1[C@@H](O[C@H]2[C@@H]([C@@H](O)[C@H](CO)O2)O)[C@H](O)[C@@H](N)C[C@H]1N NSKGQURZWSPSBC-NLZFXWNVSA-N 0.000 title description 7
- 229960003485 ribostamycin Drugs 0.000 title description 5
- NSKGQURZWSPSBC-UHFFFAOYSA-N ribostamycin A Natural products NC1C(O)C(O)C(CN)OC1OC1C(OC2C(C(O)C(CO)O2)O)C(O)C(N)CC1N NSKGQURZWSPSBC-UHFFFAOYSA-N 0.000 title description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000006239 protecting group Chemical group 0.000 claims description 16
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 14
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 14
- 239000007868 Raney catalyst Substances 0.000 claims description 9
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 7
- 150000004703 alkoxides Chemical class 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 claims description 7
- 239000012429 reaction media Substances 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims 2
- 239000010941 cobalt Substances 0.000 claims 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims 2
- 229940126575 aminoglycoside Drugs 0.000 claims 1
- 239000000243 solution Substances 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 28
- 239000004593 Epoxy Substances 0.000 description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 25
- 239000001257 hydrogen Substances 0.000 description 25
- 229910052739 hydrogen Inorganic materials 0.000 description 25
- 239000000203 mixture Substances 0.000 description 21
- 230000002829 reductive effect Effects 0.000 description 21
- 239000012043 crude product Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 16
- -1 Alkylsulfonyl chloride Chemical compound 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 13
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 12
- 239000000908 ammonium hydroxide Substances 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 12
- SYJXFKPQNSDJLI-HKEUSBCWSA-N neamine Chemical class N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N SYJXFKPQNSDJLI-HKEUSBCWSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 229920001429 chelating resin Polymers 0.000 description 11
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 8
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 8
- 239000003729 cation exchange resin Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 125000002252 acyl group Chemical group 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- 238000006735 epoxidation reaction Methods 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 241001646716 Escherichia coli K-12 Species 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 4
- 238000013019 agitation Methods 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000002647 aminoglycoside antibiotic agent Substances 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 229940088710 antibiotic agent Drugs 0.000 description 4
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 4
- 229910001863 barium hydroxide Inorganic materials 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000005002 aryl methyl group Chemical group 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 229930027917 kanamycin Natural products 0.000 description 3
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical class O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- JGSMDVGTXBPWIM-HKEUSBCWSA-N paromamine Chemical compound O[C@@H]1[C@@H](O)[C@H](N)C[C@H](N)[C@H]1O[C@@H]1[C@H](N)[C@@H](O)[C@H](O)[C@@H](CO)O1 JGSMDVGTXBPWIM-HKEUSBCWSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000006277 sulfonation reaction Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- JGSMDVGTXBPWIM-UHFFFAOYSA-N Paromamine Natural products OC1C(O)C(N)CC(N)C1OC1C(N)C(O)C(O)C(CO)O1 JGSMDVGTXBPWIM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000020176 deacylation Effects 0.000 description 2
- 238000005947 deacylation reaction Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 229920001184 polypeptide Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- YMXPJJNRCZYMFQ-UHFFFAOYSA-N (2-phenylacetyl) 2-phenylacetate;pyridine Chemical compound C1=CC=NC=C1.C=1C=CC=CC=1CC(=O)OC(=O)CC1=CC=CC=C1 YMXPJJNRCZYMFQ-UHFFFAOYSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PPUSZMZQPGFMIJ-HURQSWDASA-N 1-[(e)-11-(3,5,7,9,19,23,25,27,31,33,34,35-dodecahydroxy-8,14,18,22,26,30-hexamethyl-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,20-trien-15-yl)-9-methyldodec-4-enyl]-2-methylguanidine Chemical compound C1C(O)CC(O)CC(O)C(C)C(O)C=CC=CC(C)C(C(C)CC(C)CCC/C=C/CCCNC(N)=NC)OC(=O)C(C)C(O)C=CC(C)C(O)CC(O)C(C)C(O)CCC(C)C(O)CC2(O)C(O)C(O)CC1O2 PPUSZMZQPGFMIJ-HURQSWDASA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- PPUSZMZQPGFMIJ-UHFFFAOYSA-N Amycin B Natural products C1C(O)CC(O)CC(O)C(C)C(O)C=CC=CC(C)C(C(C)CC(C)CCCC=CCCCNC(N)=NC)OC(=O)C(C)C(O)C=CC(C)C(O)CC(O)C(C)C(O)CCC(C)C(O)CC2(O)C(O)C(O)CC1O2 PPUSZMZQPGFMIJ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JYOQAMIUHGMNKV-UHFFFAOYSA-N COCOC.[Na] Chemical compound COCOC.[Na] JYOQAMIUHGMNKV-UHFFFAOYSA-N 0.000 description 1
- 125000003535 D-glucopyranosyl group Chemical group [H]OC([H])([H])[C@@]1([H])OC([H])(*)[C@]([H])(O[H])[C@@]([H])(O[H])[C@]1([H])O[H] 0.000 description 1
- 125000000824 D-ribofuranosyl group Chemical group [H]OC([H])([H])[C@@]1([H])OC([H])(*)[C@]([H])(O[H])[C@]1([H])O[H] 0.000 description 1
- 201000008225 Klebsiella pneumonia Diseases 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 206010035717 Pneumonia klebsiella Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- LUTSRLYCMSCGCS-BWOMAWGNSA-N [(3s,8r,9s,10r,13s)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(=O)CC=C3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 LUTSRLYCMSCGCS-BWOMAWGNSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HFNQLYDPNAZRCH-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O.OC(O)=O HFNQLYDPNAZRCH-UHFFFAOYSA-N 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical group [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000006916 nutrient agar Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000012608 weak cation exchange resin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49087499A JPS5116642A (en) | 1974-08-01 | 1974-08-01 | 3** deokishineamin oyobi sonokanrenkoseibutsushitsuno seizoho |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2533985A1 DE2533985A1 (de) | 1976-02-19 |
| DE2533985C2 true DE2533985C2 (de) | 1981-09-24 |
Family
ID=13916655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2533985A Expired DE2533985C2 (de) | 1974-08-01 | 1975-07-30 | Verfahren zur Herstellung von 3'-Desoxyneamin, kanamycin B, ribostamycin, -6'-N-methylkanamycin B und paromamin |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4060682A (enExample) |
| JP (1) | JPS5116642A (enExample) |
| DE (1) | DE2533985C2 (enExample) |
| FR (1) | FR2280642A1 (enExample) |
| GB (1) | GB1505355A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4195170A (en) * | 1975-12-09 | 1980-03-25 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | 3',4'-Episulfido kanamycin B compounds |
| GB1537905A (en) * | 1975-12-09 | 1979-01-10 | Microbial Chem Res Found | Processes for the preparation of 3',4'-dideoxykanamycin b |
| DE2861947D1 (en) * | 1977-06-10 | 1982-09-02 | Bayer Ag | Selectively protected 4,6-di-o-(aminoglycosyl)-1,3-diamino-cyclitols |
| US4196197A (en) * | 1977-12-21 | 1980-04-01 | Abbott Laboratories | 2'N-Acyl and alkyl-6'-N-alkyl- and 6',6'-di-N-alkyl derivatives of fortimicins A and B |
| US4187296A (en) * | 1977-12-21 | 1980-02-05 | Abbott Laboratories | 2-N-acyl and alkyl 6-epi-fortimicin B and derivatives |
| US4232148A (en) * | 1979-03-05 | 1980-11-04 | The Upjohn Company | 6-Deoxyneamines |
| JPS56118097A (en) * | 1980-02-25 | 1981-09-16 | Microbial Chem Res Found | Kanamycin a derivative and its preparation |
| JPS56152497A (en) * | 1980-04-25 | 1981-11-26 | Microbial Chem Res Found | Novel synthetic method of 3'-deoxykanamycin a |
| JPH01157976A (ja) * | 1987-12-16 | 1989-06-21 | Towa Kasei Kogyo Kk | （４ｓ，５ｓ）−４，５−シクロヘキシリデンジオキシ−２−シクロペンテン−１−オンとその鏡像体及びそれらの合成中間体並びにそれらの製造方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57876B2 (enExample) * | 1972-12-08 | 1982-01-08 | ||
| US3868360A (en) * | 1972-10-24 | 1975-02-25 | Schering Corp | Process for preparing 2-deroxy-3-desamino-2,3-epimino-aminoglycosides and intermediates useful therein |
-
1974
- 1974-08-01 JP JP49087499A patent/JPS5116642A/ja active Granted
-
1975
- 1975-07-22 GB GB30659/75A patent/GB1505355A/en not_active Expired
- 1975-07-23 US US05/598,379 patent/US4060682A/en not_active Expired - Lifetime
- 1975-07-30 DE DE2533985A patent/DE2533985C2/de not_active Expired
- 1975-07-30 FR FR7524592A patent/FR2280642A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1505355A (en) | 1978-03-30 |
| FR2280642A1 (fr) | 1976-02-27 |
| US4060682A (en) | 1977-11-29 |
| JPS5116642A (en) | 1976-02-10 |
| JPS5421325B2 (enExample) | 1979-07-30 |
| DE2533985A1 (de) | 1976-02-19 |
| FR2280642B1 (enExample) | 1977-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2945010C2 (de) | Verfahren zur Herstellung von durch Schutzgruppen N-acylierten Aminoglycosiden | |
| DE2350169C3 (de) | 19.10.72 Japan 103988-72 11.12.72 Japan 123482-72 23.01.73 Japan 9146-73 1-N- [(S)-2-Hydroxy-4-amino-butyryl] -neamin-Derivate, Verfahren zu ihrer Herstellung und solche Derivate enthaltende Arzneimittel | |
| DE2555479A1 (de) | Verfahren zur herstellung von 3', 4'-alpha-epoxyneamin und verwandten aminoglykosidischen antibiotika sowie die so hergestellten verbindungen | |
| DE2533985C2 (de) | Verfahren zur Herstellung von 3'-Desoxyneamin, kanamycin B, ribostamycin, -6'-N-methylkanamycin B und paromamin | |
| DE2411504B2 (de) | 6'-Substituierte 6'-Desoxylividomycine B, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2515629C3 (de) | 2"-N-substituierte Paromomycine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69322750T2 (de) | Dibekacin und Arbekacin Derivate wirksam gegen resistente Bakterien, und ihre Herstellung | |
| CH648854A5 (de) | Antibiotisch wirksame aminoglykoside. | |
| DE2724597C3 (de) | 3'-Desoxykanamycin C und 3\4'-Didesoxykanamycin C, deren Salze, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE2618009A1 (de) | 1-n-(alpha-hydroxy-omega-aminoacyl)-derivate des 3'-deoxykanamycins a und verfahren zur herstellung derselben | |
| DE2617597C3 (de) | Verfahren zur Herstellung von 1-N- ( a -Hydroxyw -aminoacyl)-3'- desoxy-ribostamycinen | |
| DE2361159C3 (de) | 3'-Desoxy-neamin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2825289C3 (de) | Kanamycinen und Ribostamycinen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE1543203A1 (de) | Neue Furanoside und Verfahren zu ihrer Herstellung | |
| DE3227178C2 (de) | 2'-Modifizierte Kanamycine, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE3035057C2 (de) | 6"-Desoxy- und 4",6"-Didesoxy-dibekacin sowie deren 1-N(L-4-Amino-2-hydroxybutyryl)-Derivate. Verfahren zu Ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2436694A1 (de) | Verfahren zur herstellung von 1-n(s)-alpha-hydroxy-omega-aminoacyl)-derivaten von 3',4'-dideoxyneamin oder 3', 4'-dideoxyribostamycin | |
| DE2720199C3 (de) | 5,6-Didesoxy-neamin und Verfahren zu dessen Herstellung | |
| DE2756057A1 (de) | Verfahren zur herstellung von 3',4'-dideoxykanamycin b | |
| DE3106463C2 (de) | Verfahren zur Herstellung von Derivaten des Kanamycin A | |
| DE3116127C2 (de) | Verfahren zur Herstellung von 3'-Desoxykanamycin A | |
| DE2726113A1 (de) | Synthetische aminoglycoside und verfahren zu ihrer herstellung | |
| DE3004178A1 (de) | 3',4'-didesoxykanamycin a und dessen 1-n-((s)- alpha -hydroxy- omega -aminoalkanoyl)-derivate sowie salze dieser verbindungen mit saeuren, verfahren zu ihrer herstellung und ihre verwendung als antibakterielle wirkstoffe | |
| DE3041130A1 (de) | Antibiotisch wirksames macrolid | |
| DE3050399C2 (de) | Verfahren zur Herstellung von 3'-Desoxykanamycin A und hierbei eingesetzte Zwischenprodukte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |