DE2529295A1 - Diester von dihydroxybenzolen sowie verwendung derselben als u.v.-stabilisatoren - Google Patents
Diester von dihydroxybenzolen sowie verwendung derselben als u.v.-stabilisatorenInfo
- Publication number
- DE2529295A1 DE2529295A1 DE19752529295 DE2529295A DE2529295A1 DE 2529295 A1 DE2529295 A1 DE 2529295A1 DE 19752529295 DE19752529295 DE 19752529295 DE 2529295 A DE2529295 A DE 2529295A DE 2529295 A1 DE2529295 A1 DE 2529295A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- alkyl
- atom
- radicals
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003381 stabilizer Substances 0.000 title description 25
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 title description 3
- -1 alkyl radical Chemical class 0.000 claims description 215
- 150000005690 diesters Chemical class 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 41
- 150000003254 radicals Chemical class 0.000 claims description 34
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 26
- 150000005840 aryl radicals Chemical class 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 229910052799 carbon Inorganic materials 0.000 claims description 19
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 12
- 239000012963 UV stabilizer Substances 0.000 claims description 10
- 125000004429 atom Chemical group 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 10
- 150000005205 dihydroxybenzenes Chemical class 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000002837 carbocyclic group Chemical group 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 229920000874 polytetramethylene terephthalate Polymers 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- CINULRJBVUJUSF-UHFFFAOYSA-N [3-[4-(1,3-benzoxazol-2-yl)benzoyl]oxyphenyl] 4-(1,3-benzoxazol-2-yl)benzoate Chemical compound C1=CC=C2OC(C3=CC=C(C=C3)C(OC=3C=C(OC(=O)C=4C=CC(=CC=4)C=4OC5=CC=CC=C5N=4)C=CC=3)=O)=NC2=C1 CINULRJBVUJUSF-UHFFFAOYSA-N 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims 5
- 150000002825 nitriles Chemical class 0.000 claims 5
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 125000002560 nitrile group Chemical group 0.000 claims 1
- 229920000620 organic polymer Polymers 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000002894 organic compounds Chemical class 0.000 description 9
- 230000000087 stabilizing effect Effects 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- DTNVIGCWOGUZON-UHFFFAOYSA-N 4-(1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=NC2=CC=CC=C2O1 DTNVIGCWOGUZON-UHFFFAOYSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 4
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 2
- JJXADRWORNIOEW-UHFFFAOYSA-N 4-(5,6-diethyl-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound O1C=2C=C(CC)C(CC)=CC=2N=C1C1=CC=C(C(Cl)=O)C=C1 JJXADRWORNIOEW-UHFFFAOYSA-N 0.000 description 2
- LBFZEOHBKQPVMT-UHFFFAOYSA-N 4-(5,6-dimethyl-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound O1C=2C=C(C)C(C)=CC=2N=C1C1=CC=C(C(Cl)=O)C=C1 LBFZEOHBKQPVMT-UHFFFAOYSA-N 0.000 description 2
- VKSPNTZLTIJOEK-UHFFFAOYSA-N 4-(5-cyano-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=NC2=CC(C#N)=CC=C2O1 VKSPNTZLTIJOEK-UHFFFAOYSA-N 0.000 description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 2
- JXZABYGWFNGNLB-UHFFFAOYSA-N 4-methoxybenzene-1,2-diol Chemical compound COC1=CC=C(O)C(O)=C1 JXZABYGWFNGNLB-UHFFFAOYSA-N 0.000 description 2
- ZBCATMYQYDCTIZ-UHFFFAOYSA-N 4-methylcatechol Chemical compound CC1=CC=C(O)C(O)=C1 ZBCATMYQYDCTIZ-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000012964 benzotriazole Chemical class 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- GDESWOTWNNGOMW-UHFFFAOYSA-N resorcinol monobenzoate Chemical compound OC1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1 GDESWOTWNNGOMW-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- HXCCOAUMJBFQCC-UHFFFAOYSA-N 1-(4-methoxyphenyl)-1,2,4-triazole Chemical compound C1=CC(OC)=CC=C1N1N=CN=C1 HXCCOAUMJBFQCC-UHFFFAOYSA-N 0.000 description 1
- GPASWZHHWPVSRG-UHFFFAOYSA-N 2,5-dimethylbenzene-1,4-diol Chemical compound CC1=CC(O)=C(C)C=C1O GPASWZHHWPVSRG-UHFFFAOYSA-N 0.000 description 1
- XABODFXPSOQXTP-UHFFFAOYSA-N 2-(1,3-benzoxazol-2-yl)benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1C1=NC2=CC=CC=C2O1 XABODFXPSOQXTP-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MWGATWIBSKHFMR-UHFFFAOYSA-N 2-anilinoethanol Chemical compound OCCNC1=CC=CC=C1 MWGATWIBSKHFMR-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- FIOYEQTZWHZGES-UHFFFAOYSA-N 3-(5-chloro-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC(C=2OC3=CC=C(Cl)C=C3N=2)=C1 FIOYEQTZWHZGES-UHFFFAOYSA-N 0.000 description 1
- ACCHWUWBKYGKNM-UHFFFAOYSA-N 4,5-dichlorobenzene-1,2-diol Chemical compound OC1=CC(Cl)=C(Cl)C=C1O ACCHWUWBKYGKNM-UHFFFAOYSA-N 0.000 description 1
- ASYWQJACGNQHIF-UHFFFAOYSA-N 4,5-dimethoxybenzene-1,2-diol Chemical compound COC1=CC(O)=C(O)C=C1OC ASYWQJACGNQHIF-UHFFFAOYSA-N 0.000 description 1
- VKQJFKLRXDLRNP-UHFFFAOYSA-N 4,5-dimethylbenzene-1,2-diol Chemical compound CC1=CC(O)=C(O)C=C1C VKQJFKLRXDLRNP-UHFFFAOYSA-N 0.000 description 1
- RCNRUBNQUNPIHK-UHFFFAOYSA-N 4-(1,3-benzoxazol-2-yl)-2-chlorobenzoyl chloride Chemical compound C1=C(Cl)C(C(=O)Cl)=CC=C1C1=NC2=CC=CC=C2O1 RCNRUBNQUNPIHK-UHFFFAOYSA-N 0.000 description 1
- NUEZYYBQCMBQOY-UHFFFAOYSA-N 4-(1,3-benzoxazol-2-yl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=NC2=CC=CC=C2O1 NUEZYYBQCMBQOY-UHFFFAOYSA-N 0.000 description 1
- FVUNLZUXUIJXMC-UHFFFAOYSA-N 4-(5,6-dichloro-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=NC2=CC(Cl)=C(Cl)C=C2O1 FVUNLZUXUIJXMC-UHFFFAOYSA-N 0.000 description 1
- LFIQHQAQPIENRG-UHFFFAOYSA-N 4-(5-methoxy-6-methyl-1,3-benzoxazol-2-yl)benzoyl chloride Chemical compound O1C=2C=C(C)C(OC)=CC=2N=C1C1=CC=C(C(Cl)=O)C=C1 LFIQHQAQPIENRG-UHFFFAOYSA-N 0.000 description 1
- WWOBYPKUYODHDG-UHFFFAOYSA-N 4-chlorocatechol Chemical compound OC1=CC=C(Cl)C=C1O WWOBYPKUYODHDG-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- NYMLZIFRPNYAHS-UHFFFAOYSA-N 5-phenyl-1h-1,2,4-triazole Chemical compound C1=NNC(C=2C=CC=CC=2)=N1 NYMLZIFRPNYAHS-UHFFFAOYSA-N 0.000 description 1
- FMMWHPNWAFZXNH-UHFFFAOYSA-N Benz[a]pyrene Chemical compound C1=C2C3=CC=CC=C3C=C(C=C3)C2=C2C3=CC=CC2=C1 FMMWHPNWAFZXNH-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical class COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- YJWQBPZKLWCVEV-UHFFFAOYSA-N [2-[4-(1,3-benzoxazol-2-yl)benzoyl]oxyphenyl] 4-(1,3-benzoxazol-2-yl)benzoate Chemical compound C1=CC=C2OC(C3=CC=C(C=C3)C(OC=3C(=CC=CC=3)OC(=O)C=3C=CC(=CC=3)C=3OC4=CC=CC=C4N=3)=O)=NC2=C1 YJWQBPZKLWCVEV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- PLOYJEGLPVCRAJ-UHFFFAOYSA-N buta-1,3-diene;prop-2-enoic acid;styrene Chemical compound C=CC=C.OC(=O)C=C.C=CC1=CC=CC=C1 PLOYJEGLPVCRAJ-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- MMFBQHXDINNBMW-UHFFFAOYSA-N n,n-dipropylaniline Chemical group CCCN(CCC)C1=CC=CC=C1 MMFBQHXDINNBMW-UHFFFAOYSA-N 0.000 description 1
- ITMSSZATZARZCA-UHFFFAOYSA-N n-ethyl-n-phenylaniline Chemical group C=1C=CC=CC=1N(CC)C1=CC=CC=C1 ITMSSZATZARZCA-UHFFFAOYSA-N 0.000 description 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 238000012667 polymer degradation Methods 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D263/57—Aryl or substituted aryl radicals
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/005—Stabilisers against oxidation, heat, light, ozone
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/35—Heterocyclic compounds having nitrogen in the ring having also oxygen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/484,849 US4017508A (en) | 1974-07-01 | 1974-07-01 | Benzoxazole ultraviolet stabilizers and their use in organic compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2529295A1 true DE2529295A1 (de) | 1976-01-22 |
Family
ID=23925880
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752529295 Withdrawn DE2529295A1 (de) | 1974-07-01 | 1975-07-01 | Diester von dihydroxybenzolen sowie verwendung derselben als u.v.-stabilisatoren |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US4017508A (forum.php) |
| JP (1) | JPS5136240A (forum.php) |
| CA (1) | CA1120037A (forum.php) |
| CH (1) | CH614726A5 (forum.php) |
| DE (1) | DE2529295A1 (forum.php) |
| GB (1) | GB1519624A (forum.php) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4017508A (en) * | 1974-07-01 | 1977-04-12 | Eastman Kodak Company | Benzoxazole ultraviolet stabilizers and their use in organic compositions |
| US4172081A (en) * | 1974-07-01 | 1979-10-23 | Eastman Kodak Company | Benzotriazole ultraviolet stabilizers |
| US4105631A (en) * | 1975-10-28 | 1978-08-08 | Eastman Kodak Company | Multichromophoric ultraviolet stabilizers and their use in organic compositions |
| US4062800A (en) * | 1976-08-16 | 1977-12-13 | Eastman Kodak Company | Bichromophoric benzoxazole-styrene ester and amide ultraviolet stabilizers and their use in organic compositions |
| US4251433A (en) * | 1978-07-12 | 1981-02-17 | Eastman Kodak Company | Heterocyclic ester, ultraviolet stabilizers and their use in organic compositions |
| US4265804A (en) * | 1979-01-05 | 1981-05-05 | Eastman Kodak Company | Oriented polyester articles having improved ultraviolet stability (III) |
| US4543360A (en) * | 1981-09-10 | 1985-09-24 | Degussa Aktiengesellschaft | 2-(Hydroxy-phenyl)-indoles and process for their production |
| US4544691A (en) * | 1981-11-05 | 1985-10-01 | Ciba-Geigy Corporation | Compositions containing ultraviolet-absorbing stabilizing substituted by an aliphatic hydroxyl group |
| US4616052A (en) * | 1985-07-05 | 1986-10-07 | Becton, Dickinson And Company | High temperature creep resistant thermoplastic elastomer compositions |
| DE3708292A1 (de) * | 1987-03-14 | 1988-09-29 | Basf Ag | Gegen einwirkung von licht stabilisierte polymere sowie neue imidazol-2-carbonsaeureanilide |
| CN113264927B (zh) * | 2021-06-06 | 2022-05-24 | 湖南第一师范学院 | 一种双苯并噁唑类荧光增白剂及其衍生物的合成方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3113907A (en) * | 1963-12-10 | Polymeric compositions and preparation | ||
| US3213058A (en) * | 1960-12-19 | 1965-10-19 | American Cyanamid Co | Polymers reacted with benzotriazole uv absorbers |
| US3594408A (en) * | 1966-04-28 | 1971-07-20 | American Cyanamid Co | Resorcinol dialkyl benzoates |
| NL6911367A (forum.php) * | 1969-07-24 | 1971-01-26 | ||
| US3864354A (en) * | 1972-10-16 | 1975-02-04 | Eastman Kodak Co | Benzoxazole and oxadiazole ultraviolet stabilizers |
| US3957813A (en) * | 1974-07-01 | 1976-05-18 | Eastman Kodak Company | Benzoxazolyl phenyl aromatic ester compounds and their use as ultraviolet stabilizers in organic compositions |
| US4017508A (en) * | 1974-07-01 | 1977-04-12 | Eastman Kodak Company | Benzoxazole ultraviolet stabilizers and their use in organic compositions |
| US4020080A (en) * | 1974-07-01 | 1977-04-26 | Eastman Kodak Company | Oxadiazolylphenyl aromatic ester compounds and their use as ultraviolet stabilizer in organic compositions |
| US4020041A (en) * | 1974-07-01 | 1977-04-26 | Eastman Kodak Company | Polymers stabilized with bis-heterocyclic benzoates |
-
1974
- 1974-07-01 US US05/484,849 patent/US4017508A/en not_active Expired - Lifetime
-
1975
- 1975-06-05 CA CA000228630A patent/CA1120037A/en not_active Expired
- 1975-06-24 JP JP50078494A patent/JPS5136240A/ja active Pending
- 1975-06-30 CH CH820075A patent/CH614726A5/xx not_active IP Right Cessation
- 1975-07-01 GB GB27743/75A patent/GB1519624A/en not_active Expired
- 1975-07-01 DE DE19752529295 patent/DE2529295A1/de not_active Withdrawn
-
1977
- 1977-01-12 US US05/758,729 patent/US4116929A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4116929A (en) | 1978-09-26 |
| JPS5136240A (forum.php) | 1976-03-27 |
| US4017508A (en) | 1977-04-12 |
| GB1519624A (en) | 1978-08-02 |
| CH614726A5 (forum.php) | 1979-12-14 |
| CA1120037A (en) | 1982-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1217383B (de) | Verwendung von substituierten 2-(2'-Hydroxyphenyl)-benztriazolverbindungen zum Schützen von organischen Stoffen gegen ultraviolette Strahlung | |
| EP0361069B1 (de) | Benzimidazol-2-carbonsäureanilide, ihre Verwendung als Lichtschutzmittel für organisches Material und mit diesen Aniliden stabilisiertes organisches Material | |
| DE2353538A1 (de) | Neue piperidinderivate und ihre verwendung | |
| DE1227907B (de) | Verwendung von substituierten Benztriazol-verbindungen zum Schuetzen organischer Stoffe gegen den schaedlichen Einfluss von Ultraviolettstrahlung | |
| DE3236070C2 (forum.php) | ||
| DE2529363A1 (de) | Arylester von heterocyclischen aromatischen saeuren sowie verwendung derselben als u.v.-stabilisatoren | |
| DE2529295A1 (de) | Diester von dihydroxybenzolen sowie verwendung derselben als u.v.-stabilisatoren | |
| DE2351728A1 (de) | U.v.-stabilisatoren | |
| CH522432A (de) | Verwendung von v-Triazolen als Schutzmittel für nichttextile organische Substrate gegen UV-Strahlen | |
| DE3708292A1 (de) | Gegen einwirkung von licht stabilisierte polymere sowie neue imidazol-2-carbonsaeureanilide | |
| US3546270A (en) | Bis-methylene malonic acid nitriles | |
| DE1213409B (de) | Verwendung von substituierten 2-(2'-Hydroxyphenyl)-benztriazolverbindungen zum Schuetzen von organischen Stoffen gegen ultraviolette Strahlung | |
| DE2543856A1 (de) | Benzotriazol-ortho-ester sowie verwendung derselben als uv-stabilisatoren | |
| DE1670951A1 (de) | Alkylen-bis-(benztriazolyl-phenole) | |
| DE2543859A1 (de) | Polychromophore u.v.-stabilisatoren | |
| DE2550876A1 (de) | Polychromophore heterocyclische ester | |
| EP0019578B1 (de) | Piperidinverbindungen, Verfahren zu deren Herstellung und diese enthaltende polymere Zusammensetzungen | |
| DE1568693A1 (de) | UV-absorbierende,lichtstabile Verbindungen | |
| DE2821579C2 (forum.php) | ||
| DE1544723C3 (de) | Verfahren zum Herstellen von mit Oxazolverbindungen optisch aufgehellten Formkorpern | |
| EP0006564B1 (de) | 2-(2-Hydroxy-3.5-disubstituiertes-phenyl)-2H-benzotriazol und damit stabilisierte Mischungen | |
| DE1768364A1 (de) | 7-Cyan-cumarine | |
| DE1185610B (de) | Verwendung von 2-Phenylbenzotriazol-verbindungen zum Schuetzen von organischen Stoffen gegen ultraviolette Strahlung | |
| DE3828537A1 (de) | Neue n-substituierte benzimidazol-2-carbonsaeureanilide, deren verwendung als lichtschutzmittel, insbesondere polymere und diese anilide enthaltendes organisches material | |
| DE2543855A1 (de) | Polychrome benzotriazolderivate sowie verwendung derselben als uv-stabilisatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |