DE2527066A1 - 6-hydrazinopyridazine, verfahren zu ihrer herstellung und arzneimittel - Google Patents
6-hydrazinopyridazine, verfahren zu ihrer herstellung und arzneimittelInfo
- Publication number
- DE2527066A1 DE2527066A1 DE19752527066 DE2527066A DE2527066A1 DE 2527066 A1 DE2527066 A1 DE 2527066A1 DE 19752527066 DE19752527066 DE 19752527066 DE 2527066 A DE2527066 A DE 2527066A DE 2527066 A1 DE2527066 A1 DE 2527066A1
- Authority
- DE
- Germany
- Prior art keywords
- tert
- hydroxypropoxy
- butylamino
- radical
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 10
- YTRGNBTVTHPFJM-UHFFFAOYSA-N pyridazin-3-ylhydrazine Chemical compound NNC1=CC=CN=N1 YTRGNBTVTHPFJM-UHFFFAOYSA-N 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 8
- 229940126601 medicinal product Drugs 0.000 title description 2
- -1 2- (3-tert-Butylamino-2-hydroxypropoxy) -phenyl Chemical group 0.000 claims description 124
- 150000001875 compounds Chemical class 0.000 claims description 70
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 31
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 17
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 10
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 9
- 101150065749 Churc1 gene Proteins 0.000 claims description 9
- 102100038239 Protein Churchill Human genes 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 150000002429 hydrazines Chemical class 0.000 claims description 2
- 150000007857 hydrazones Chemical class 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 150000001299 aldehydes Chemical class 0.000 claims 1
- 125000005236 alkanoylamino group Chemical group 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 150000007524 organic acids Chemical class 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 125000003396 thiol group Chemical group [H]S* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- 239000000203 mixture Substances 0.000 description 92
- 239000000243 solution Substances 0.000 description 82
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 57
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 239000002904 solvent Substances 0.000 description 42
- 238000006243 chemical reaction Methods 0.000 description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 27
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 26
- 150000003254 radicals Chemical class 0.000 description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
- 239000003921 oil Substances 0.000 description 20
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 17
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 17
- 238000004440 column chromatography Methods 0.000 description 16
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 15
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 15
- 239000000377 silicon dioxide Substances 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000003480 eluent Substances 0.000 description 14
- 235000012239 silicon dioxide Nutrition 0.000 description 14
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- 229910000027 potassium carbonate Inorganic materials 0.000 description 13
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- 238000009835 boiling Methods 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- YQQSRZSUGBETRS-UHFFFAOYSA-N 1h-pyridazine-6-thione Chemical group SC1=CC=CN=N1 YQQSRZSUGBETRS-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 241001061127 Thione Species 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229940014800 succinic anhydride Drugs 0.000 description 5
- KYEACNNYFNZCST-UHFFFAOYSA-N 1-methylpyrrolidine-2,5-dione Chemical compound CN1C(=O)CCC1=O KYEACNNYFNZCST-UHFFFAOYSA-N 0.000 description 4
- SSDAKJLEKSSAMH-UHFFFAOYSA-N 2,4-dihydro-1h-pyridazin-3-one Chemical compound O=C1CC=CNN1 SSDAKJLEKSSAMH-UHFFFAOYSA-N 0.000 description 4
- JTEVRTFFPRBPHQ-UHFFFAOYSA-N 2-(6-chloropyridazin-3-yl)-5-methoxyphenol Chemical compound OC1=CC(OC)=CC=C1C1=CC=C(Cl)N=N1 JTEVRTFFPRBPHQ-UHFFFAOYSA-N 0.000 description 4
- UXNQKCOMUCSBSS-UHFFFAOYSA-N 2-phenyl-1,5-dihydropyridazin-6-one Chemical class N1C(=O)CC=CN1C1=CC=CC=C1 UXNQKCOMUCSBSS-UHFFFAOYSA-N 0.000 description 4
- ACTLOQLEUUYVRQ-UHFFFAOYSA-N 3-chloro-4-phenylpyridazine Chemical class ClC1=NN=CC=C1C1=CC=CC=C1 ACTLOQLEUUYVRQ-UHFFFAOYSA-N 0.000 description 4
- QBQVEOIVSWQRDU-UHFFFAOYSA-N 4-(2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC=C1O QBQVEOIVSWQRDU-UHFFFAOYSA-N 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 4
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000006356 dehydrogenation reaction Methods 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- DKACXUFSLUYRFU-UHFFFAOYSA-N tert-butyl n-aminocarbamate Chemical compound CC(C)(C)OC(=O)NN DKACXUFSLUYRFU-UHFFFAOYSA-N 0.000 description 4
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 4
- 229940124549 vasodilator Drugs 0.000 description 4
- 239000003071 vasodilator agent Substances 0.000 description 4
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 3
- KFVDVTYLBHWHHJ-UHFFFAOYSA-N 4-(2-hydroxy-5-nitrophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC([N+]([O-])=O)=CC=C1O KFVDVTYLBHWHHJ-UHFFFAOYSA-N 0.000 description 3
- DDHVIKQPVLQZHU-UHFFFAOYSA-N 4-(6-chloropyridazin-3-yl)benzene-1,3-diol Chemical compound OC1=CC(O)=CC=C1C1=CC=C(Cl)N=N1 DDHVIKQPVLQZHU-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- AYKYOOPFBCOXSL-UHFFFAOYSA-N (4-hydroxyphenyl)acetonitrile Chemical compound OC1=CC=C(CC#N)C=C1 AYKYOOPFBCOXSL-UHFFFAOYSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- DPZNOMCNRMUKPS-UHFFFAOYSA-N 1,3-Dimethoxybenzene Chemical compound COC1=CC=CC(OC)=C1 DPZNOMCNRMUKPS-UHFFFAOYSA-N 0.000 description 2
- YBPAYPRLUDCSEY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)acetamide Chemical compound NC(=O)CC1=CC=C(O)C=C1 YBPAYPRLUDCSEY-UHFFFAOYSA-N 0.000 description 2
- IRJXUMOUDQWBMA-UHFFFAOYSA-N 3-(3-carboxypropanoyl)-4-hydroxybenzoic acid Chemical compound OC(=O)CCC(=O)C1=CC(C(O)=O)=CC=C1O IRJXUMOUDQWBMA-UHFFFAOYSA-N 0.000 description 2
- UQAKTDJTFRZJBE-UHFFFAOYSA-N 4-(2-fluoro-6-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=C(O)C=CC=C1F UQAKTDJTFRZJBE-UHFFFAOYSA-N 0.000 description 2
- JVHVQJFNBQIPEJ-UHFFFAOYSA-N 4-(2-hydroxyphenyl)-3-methyl-4-oxobutanoic acid Chemical compound OC(=O)CC(C)C(=O)C1=CC=CC=C1O JVHVQJFNBQIPEJ-UHFFFAOYSA-N 0.000 description 2
- PFGWKMQUMPPXDZ-UHFFFAOYSA-N 4-(5-acetamido-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound CC(=O)NC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 PFGWKMQUMPPXDZ-UHFFFAOYSA-N 0.000 description 2
- RYZPSWSXZLSRHS-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound NC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 RYZPSWSXZLSRHS-UHFFFAOYSA-N 0.000 description 2
- WEPFHOZDZFINGL-UHFFFAOYSA-N 4-(5-cyano-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(C#N)=CC=C1O WEPFHOZDZFINGL-UHFFFAOYSA-N 0.000 description 2
- NJBUYHVDUHIVET-UHFFFAOYSA-N 4-[2-methoxy-5-(trifluoromethyl)phenyl]-n-methyl-4-oxobutanamide Chemical compound CNC(=O)CCC(=O)C1=CC(C(F)(F)F)=CC=C1OC NJBUYHVDUHIVET-UHFFFAOYSA-N 0.000 description 2
- HIAWXKGEKRDCRJ-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-sulfanylidene-1h-pyridazin-3-yl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C1=NNC(=S)C=C1 HIAWXKGEKRDCRJ-UHFFFAOYSA-N 0.000 description 2
- VBZSVQQFVRASJZ-UHFFFAOYSA-N 4-[5-(cyanomethyl)-2-hydroxyphenyl]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(CC#N)=CC=C1O VBZSVQQFVRASJZ-UHFFFAOYSA-N 0.000 description 2
- TVKFDBOFBKXOQT-UHFFFAOYSA-N 5-phenyl-1h-pyridazin-6-one Chemical compound O=C1NN=CC=C1C1=CC=CC=C1 TVKFDBOFBKXOQT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 208000001871 Tachycardia Diseases 0.000 description 2
- RYLHBWPTXXAGHJ-UHFFFAOYSA-N [4-(6-chloropyridazin-3-yl)-3-hydroxyphenyl] ethyl carbonate Chemical compound OC1=CC(OC(=O)OCC)=CC=C1C1=CC=C(Cl)N=N1 RYLHBWPTXXAGHJ-UHFFFAOYSA-N 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- VOBJDVORMSMFSD-UHFFFAOYSA-N ethyl 4-(4-chloro-2-hydroxyphenyl)-4-oxobutanoate Chemical compound CCOC(=O)CCC(=O)C1=CC=C(Cl)C=C1O VOBJDVORMSMFSD-UHFFFAOYSA-N 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- WRVFBHYACVUZDM-UHFFFAOYSA-N methyl 4-(2-hydroxy-4-methylphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(C)C=C1O WRVFBHYACVUZDM-UHFFFAOYSA-N 0.000 description 2
- FEBVPWGYFJSPIF-UHFFFAOYSA-N methyl 4-(2-hydroxyphenyl)-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=CC=C1O FEBVPWGYFJSPIF-UHFFFAOYSA-N 0.000 description 2
- ZLAQXXCKJJLVIH-UHFFFAOYSA-N methyl 4-hydroxy-3-(4-methoxy-4-oxobutanoyl)benzoate Chemical compound COC(=O)CCC(=O)C1=CC(C(=O)OC)=CC=C1O ZLAQXXCKJJLVIH-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 230000006794 tachycardia Effects 0.000 description 2
- WSGZJPHKMJNWEI-UHFFFAOYSA-N tert-butyl N-[[6-(2-hydroxy-4-methoxyphenyl)pyridazin-3-yl]amino]carbamate Chemical compound OC1=CC(OC)=CC=C1C1=CC=C(NNC(=O)OC(C)(C)C)N=N1 WSGZJPHKMJNWEI-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- BKWQKVJYXODDAC-UHFFFAOYSA-N 1,2-dihydropyridazine Chemical compound N1NC=CC=C1 BKWQKVJYXODDAC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YLJDSYYCRXITBF-UHFFFAOYSA-N 1-phenyl-2-phenylmethoxypropan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C)OCC1=CC=CC=C1 YLJDSYYCRXITBF-UHFFFAOYSA-N 0.000 description 1
- 125000003816 2-hydroxybenzoyl group Chemical group OC1=C(C(=O)*)C=CC=C1 0.000 description 1
- ADOOGIDAYYNDJQ-UHFFFAOYSA-N 2-methyl-1-(2-phenylmethoxyphenyl)prop-2-en-1-one Chemical compound CC(=C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 ADOOGIDAYYNDJQ-UHFFFAOYSA-N 0.000 description 1
- YIVWQNVQRXFZJB-UHFFFAOYSA-N 2-succinylbenzoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC=C1C(O)=O YIVWQNVQRXFZJB-UHFFFAOYSA-N 0.000 description 1
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 1
- GJHOYMMCLLSYLU-UHFFFAOYSA-N 3-(dimethylamino)-2-methyl-1-(2-phenylmethoxyphenyl)propan-1-one Chemical compound CN(C)CC(C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 GJHOYMMCLLSYLU-UHFFFAOYSA-N 0.000 description 1
- IBWYHNOFSKJKKY-UHFFFAOYSA-N 3-chloropyridazine Chemical compound ClC1=CC=CN=N1 IBWYHNOFSKJKKY-UHFFFAOYSA-N 0.000 description 1
- ASFHDLDAWYTMJS-UHFFFAOYSA-N 3-methoxypyridazine Chemical compound COC1=CC=CN=N1 ASFHDLDAWYTMJS-UHFFFAOYSA-N 0.000 description 1
- PLUHHWJZORAODT-UHFFFAOYSA-N 3-methyl-4-oxo-4-(2-phenylmethoxyphenyl)butanenitrile Chemical compound N#CCC(C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 PLUHHWJZORAODT-UHFFFAOYSA-N 0.000 description 1
- VERPGLCXXBNYLG-UHFFFAOYSA-N 4-(2,6-dimethoxyphenyl)-n-methyl-4-oxobutanamide Chemical compound CNC(=O)CCC(=O)C1=C(OC)C=CC=C1OC VERPGLCXXBNYLG-UHFFFAOYSA-N 0.000 description 1
- MRXKHNRFMSVSPY-UHFFFAOYSA-N 4-(2-hydroxy-3-nitrophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC([N+]([O-])=O)=C1O MRXKHNRFMSVSPY-UHFFFAOYSA-N 0.000 description 1
- VEMILKYHFUPAJA-UHFFFAOYSA-N 4-(2-hydroxy-4-methylphenyl)-4-oxobutanoic acid Chemical compound CC1=CC=C(C(=O)CCC(O)=O)C(O)=C1 VEMILKYHFUPAJA-UHFFFAOYSA-N 0.000 description 1
- AYYMJKSDHKNXRP-UHFFFAOYSA-N 4-(2-hydroxy-6-methoxyphenyl)-n-methyl-4-oxobutanamide Chemical compound CNC(=O)CCC(=O)C1=C(O)C=CC=C1OC AYYMJKSDHKNXRP-UHFFFAOYSA-N 0.000 description 1
- XMKSYNSQMKQFSE-UHFFFAOYSA-N 4-(4-chloro-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(Cl)C=C1O XMKSYNSQMKQFSE-UHFFFAOYSA-N 0.000 description 1
- RGSZHMFKJIMTLQ-UHFFFAOYSA-N 4-[2-hydroxy-5-(trifluoromethyl)phenyl]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(C(F)(F)F)=CC=C1O RGSZHMFKJIMTLQ-UHFFFAOYSA-N 0.000 description 1
- LFPCYWXFROOMSO-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(3-carboxypropanoyl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C(=O)CCC(O)=O LFPCYWXFROOMSO-UHFFFAOYSA-N 0.000 description 1
- ICLOBPMMKINOSZ-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-1h-pyridazin-3-yl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C1=NNC(=O)C=C1 ICLOBPMMKINOSZ-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- ZSLAKQOAQXNAKA-UHFFFAOYSA-N 5-methoxy-2-(6-methoxypyridazin-3-yl)phenol Chemical compound OC1=CC(OC)=CC=C1C1=CC=C(OC)N=N1 ZSLAKQOAQXNAKA-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 241001631457 Cannula Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- VVHSJNHOLDIYEF-UHFFFAOYSA-N [Na].CCCC(C)C1C(=O)NC(=O)NC1=O Chemical compound [Na].CCCC(C)C1C(=O)NC(=O)NC1=O VVHSJNHOLDIYEF-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000008366 buffered solution Substances 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- QNYBHRXLWXGNIZ-UHFFFAOYSA-N methyl 4-(2-fluoro-6-methoxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=C(F)C=CC=C1OC QNYBHRXLWXGNIZ-UHFFFAOYSA-N 0.000 description 1
- ZOOTXGXHWQPRGE-UHFFFAOYSA-N methyl 4-(2-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC=C1O ZOOTXGXHWQPRGE-UHFFFAOYSA-N 0.000 description 1
- LVHWYFLZVALMGD-UHFFFAOYSA-N methyl 4-(5-acetamido-2-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC(NC(C)=O)=CC=C1O LVHWYFLZVALMGD-UHFFFAOYSA-N 0.000 description 1
- SRXOJMOGPYFZKC-UHFFFAOYSA-N methyl 4-chloro-4-oxobutanoate Chemical compound COC(=O)CCC(Cl)=O SRXOJMOGPYFZKC-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- RPILSQRRFFWGQN-UHFFFAOYSA-N n-methylmethanamine;naphthalene Chemical compound CNC.C1=CC=CC2=CC=CC=C21 RPILSQRRFFWGQN-UHFFFAOYSA-N 0.000 description 1
- 229940105631 nembutal Drugs 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000011935 selective methylation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ISHLCKAQWKBMAU-UHFFFAOYSA-N tert-butyl n-diazocarbamate Chemical compound CC(C)(C)OC(=O)N=[N+]=[N-] ISHLCKAQWKBMAU-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/32—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups
- C07C65/40—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/12—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/18—Sulfur atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26864/74A GB1527712A (en) | 1974-06-18 | 1974-06-18 | Hydrazinopyridazines |
| GB2075 | 1975-01-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2527066A1 true DE2527066A1 (de) | 1976-01-08 |
Family
ID=26235616
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752527066 Ceased DE2527066A1 (de) | 1974-06-18 | 1975-06-18 | 6-hydrazinopyridazine, verfahren zu ihrer herstellung und arzneimittel |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4053601A (en, 2012) |
| JP (1) | JPS5113782A (en, 2012) |
| CA (1) | CA1067078A (en, 2012) |
| CH (1) | CH617429A5 (en, 2012) |
| DE (1) | DE2527066A1 (en, 2012) |
| DK (1) | DK145099C (en, 2012) |
| ES (1) | ES438685A1 (en, 2012) |
| FI (1) | FI62532C (en, 2012) |
| FR (1) | FR2275213A1 (en, 2012) |
| IE (1) | IE42214B1 (en, 2012) |
| IL (1) | IL47351A (en, 2012) |
| LU (1) | LU72739A1 (en, 2012) |
| NL (1) | NL7507267A (en, 2012) |
| SE (1) | SE416650B (en, 2012) |
| SU (1) | SU862824A3 (en, 2012) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0259835A3 (en) * | 1986-09-08 | 1989-03-15 | Teikoku Hormone Mfg. Co., Ltd. | Pyridazinone derivatives |
| US6858602B2 (en) | 2001-06-12 | 2005-02-22 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4314943A (en) * | 1977-07-13 | 1982-02-09 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| US4272440A (en) * | 1978-02-24 | 1981-06-09 | Smithkline Corporation | Intermediates for preparing hydroxyphenylpyridazinones |
| IN148775B (en, 2012) * | 1978-08-04 | 1981-06-13 | Smithkline & French Lab Ltd Uk | |
| US4495352A (en) * | 1979-02-13 | 1985-01-22 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| DE3028453A1 (de) * | 1980-07-26 | 1982-03-18 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Spinnmaschine |
| US4340733A (en) * | 1980-09-02 | 1982-07-20 | Smithkline Corporation | Process for preparing 3-chloro-6-(2-hydroxyphenyl)-pyridazines |
| EP0101156A3 (en) * | 1982-06-24 | 1984-08-22 | Smith Kline & French Laboratories Limited | Process for preparing 6-(2-hydroxyphenyl)-3-pyridazinone |
| DE3302442A1 (de) * | 1983-01-26 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Neue pyridazinone, verfahren zu ihrer herstellung, diese verbindungen enthaltende therapeutische mittel und deren verwendung |
| GB8323553D0 (en) * | 1983-09-02 | 1983-10-05 | Smith Kline French Lab | Pharmaceutical compositions |
| WO2008013838A2 (en) * | 2006-07-25 | 2008-01-31 | Cephalon, Inc. | Pyridizinone derivatives |
| US20150119399A1 (en) | 2012-01-10 | 2015-04-30 | President And Fellows Of Harvard College | Beta-cell replication promoting compounds and methods of their use |
| TW202216671A (zh) * | 2020-06-25 | 2022-05-01 | 瑞士商諾華公司 | １，４—二取代的嗒𠯤化合物之製造方法 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2154245A1 (de) * | 1970-12-15 | 1972-07-13 | I.S.F. S.P.A., Mailand (Italien) | Gegen Bluthochdruck wirksame Pyridazinderivate |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758146A (fr) * | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Derives de l'amidine |
| US3818097A (en) * | 1969-10-29 | 1974-06-18 | Smith Kline French Lab | Method of inhibiting histamine activity with isothioureas |
| US3975530A (en) * | 1972-09-05 | 1976-08-17 | Smith Kline & French Laboratories Limited | N-cyano-N'-heterocyclic-alkyl quanidine inhibitors of H2 histamine receptors |
-
1975
- 1975-05-19 IE IE1124/75A patent/IE42214B1/en unknown
- 1975-05-26 IL IL47351A patent/IL47351A/xx unknown
- 1975-05-30 DK DK245275A patent/DK145099C/da not_active IP Right Cessation
- 1975-06-03 US US05/583,379 patent/US4053601A/en not_active Expired - Lifetime
- 1975-06-12 CA CA229,160A patent/CA1067078A/en not_active Expired
- 1975-06-16 FI FI751790A patent/FI62532C/fi not_active IP Right Cessation
- 1975-06-16 LU LU72739A patent/LU72739A1/xx unknown
- 1975-06-17 CH CH787175A patent/CH617429A5/de not_active IP Right Cessation
- 1975-06-17 SE SE7506947A patent/SE416650B/xx unknown
- 1975-06-17 JP JP50074260A patent/JPS5113782A/ja active Pending
- 1975-06-18 FR FR7519034A patent/FR2275213A1/fr active Granted
- 1975-06-18 ES ES438685A patent/ES438685A1/es not_active Expired
- 1975-06-18 NL NL7507267A patent/NL7507267A/xx not_active Application Discontinuation
- 1975-06-18 DE DE19752527066 patent/DE2527066A1/de not_active Ceased
-
1978
- 1978-12-22 SU SU782145553D patent/SU862824A3/ru active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2154245A1 (de) * | 1970-12-15 | 1972-07-13 | I.S.F. S.P.A., Mailand (Italien) | Gegen Bluthochdruck wirksame Pyridazinderivate |
Non-Patent Citations (1)
| Title |
|---|
| Ehrhart, G., Ruschig, H.: Arzneimittel, 2. Aufl., Bd. 2, Weinheim/Bergstr., 1972 * |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0259835A3 (en) * | 1986-09-08 | 1989-03-15 | Teikoku Hormone Mfg. Co., Ltd. | Pyridazinone derivatives |
| US6858602B2 (en) | 2001-06-12 | 2005-02-22 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US6916848B2 (en) | 2001-06-12 | 2005-07-12 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US6924314B2 (en) | 2001-06-12 | 2005-08-02 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US6946491B2 (en) | 2001-06-12 | 2005-09-20 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7012071B2 (en) | 2001-06-12 | 2006-03-14 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7041659B2 (en) | 2001-06-12 | 2006-05-09 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7045541B2 (en) | 2001-06-12 | 2006-05-16 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7101910B2 (en) | 2001-06-12 | 2006-09-05 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7329782B2 (en) | 2001-06-12 | 2008-02-12 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7547802B2 (en) | 2001-06-12 | 2009-06-16 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US7863475B2 (en) | 2001-06-12 | 2011-01-04 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
| US8487000B2 (en) | 2001-06-12 | 2013-07-16 | Wellstat Therapertics Corporation | Compound for the treatment of metabolic disorders |
| US8552062B2 (en) | 2001-06-12 | 2013-10-08 | Wellstat Therapeutics Corporation | Methods for the treatment of metabolic disorders such as diabetes |
| US8604083B2 (en) | 2001-06-12 | 2013-12-10 | Wellstat Therapeutics Corporation | Method for the treatment of metabolic disorders |
Also Published As
| Publication number | Publication date |
|---|---|
| CH617429A5 (en, 2012) | 1980-05-30 |
| FR2275213B1 (en, 2012) | 1979-08-10 |
| JPS5113782A (en, 2012) | 1976-02-03 |
| IE42214L (en) | 1975-12-18 |
| FI62532C (fi) | 1983-01-10 |
| DK245275A (da) | 1975-12-19 |
| DK145099B (da) | 1982-08-30 |
| IE42214B1 (en) | 1980-07-02 |
| AU8158175A (en) | 1976-12-02 |
| SE416650B (sv) | 1981-01-26 |
| LU72739A1 (en, 2012) | 1975-10-08 |
| SU862824A3 (ru) | 1981-09-07 |
| FI62532B (fi) | 1982-09-30 |
| US4053601A (en) | 1977-10-11 |
| SE7506947L (sv) | 1975-12-19 |
| DK145099C (da) | 1983-01-31 |
| IL47351A0 (en) | 1975-07-28 |
| ES438685A1 (es) | 1977-05-16 |
| NL7507267A (nl) | 1975-12-22 |
| IL47351A (en) | 1980-02-29 |
| FI751790A7 (en, 2012) | 1975-12-19 |
| CA1067078A (en) | 1979-11-27 |
| FR2275213A1 (fr) | 1976-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2527066A1 (de) | 6-hydrazinopyridazine, verfahren zu ihrer herstellung und arzneimittel | |
| DE2459468A1 (de) | Substituierte aryldihydropyridazinone, ihre salze, verfahren zu ihrer herstellung und arzneimittel | |
| DD204698A5 (de) | Verfahren zur herstellung von 3,4-dihydro-5h-2,3-benzodiazepin derivaten | |
| EP0365915B1 (de) | Substituierte 2-Aminothiazole | |
| DE2118261A1 (de) | Neue N-haltige Bicyclen, deren Säureadditionssalze sowie Verfahren zu deren Herstellung | |
| EP2243768A1 (de) | Phenolisches Diazoniumsalz, Verfahren zu dessen Herstellung und dessen Verwendung | |
| EP0171645B1 (de) | Neue 2H-1-Benzopyran-2-on-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE69314649T2 (de) | Chinuclidine derivate als squalen synthase inhibitoren | |
| DE2726393C2 (de) | Verfahren zur Herstellung von 5-(quartär-Alkyl)resorcinen | |
| DD201792A5 (de) | Verfahren zur herstellung der 2,3,4,5-tetrahydro-1-benzoxepin-3,5-dion-derivate | |
| DE2943286C2 (en, 2012) | ||
| EP0533056A2 (de) | Substituierte Aminopropane, Verfahren zu ihrer Herstellung und ihre Verwendung als Antimykutiku | |
| DE2121996C3 (de) | Dibasische Äther des 2,6- und 2,7-Dihydroxyanthrachinons der Herstellung und pharmazeutische Zubereitung | |
| DE2849107A1 (de) | 2,6-diphenyl-3,7-dioxabicyclo 3.3.0 octan-4,8-dion-derivate verfahren zu ihrer herstellung und sie enthaltende mittel | |
| EP0004322A1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln | |
| AT371445B (de) | Verfahren zur herstellung von neuen cis-4a-phenyl-isochinolinderivaten und ihren saeureadditionssalzen | |
| DE2143646A1 (de) | 2-Amino-l,5-benzodiazocinderivate und Verfahren zu ihrer Herstellung | |
| EP0167945B1 (de) | Phenylethylaminopropiophenon-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DD220302A1 (de) | Verfahren zur ortho-bromierung von 2-substituierten phenolen | |
| DE1955006A1 (de) | Alkanolaminderivate und Verfahren zu deren Herstellung | |
| CH644602A5 (de) | Benzothiazocin- und benzothiazoninderivate, ihre herstellung und diese derivate enthaltende pharmazeutische praeparate. | |
| EP0182271B1 (de) | Neue Nb-quartäre Dibromderivate von Ajmalin, Isoajmalin, Sandwicin und Isosandwicin sowie diese Derivate enthaltende pharmazeutische Zubereitungen und Zwischenprodukte und Verfahren zu ihrer Herstellung | |
| DE2556918A1 (de) | 3-phenyl-6-hydrazinopyridazine | |
| AT239219B (de) | Verfahren zur Herstellung von neuen Pyridinderivaten | |
| DE2163908C3 (de) | 2-Aminomethylphenolderivate deren nichtgiftige, pharmazeutisch verwertbare Säureadditionssalze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Mittel Merck & Co., Inc., Rahway, N.J. (V.St.A.) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8131 | Rejection |