DE2525295C3 - Verfahren zur Herstellung von Azomethinen - Google Patents
Verfahren zur Herstellung von AzomethinenInfo
- Publication number
- DE2525295C3 DE2525295C3 DE2525295A DE2525295A DE2525295C3 DE 2525295 C3 DE2525295 C3 DE 2525295C3 DE 2525295 A DE2525295 A DE 2525295A DE 2525295 A DE2525295 A DE 2525295A DE 2525295 C3 DE2525295 C3 DE 2525295C3
- Authority
- DE
- Germany
- Prior art keywords
- cyclohexanone
- reaction
- water
- exchanger
- aniline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title description 3
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 70
- 230000002378 acidificating effect Effects 0.000 claims description 18
- 238000009833 condensation Methods 0.000 claims description 9
- 230000005494 condensation Effects 0.000 claims description 9
- -1 alkoxy radicals Chemical group 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000003142 primary aromatic amines Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 25
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 16
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- HSJKGGMUJITCBW-UHFFFAOYSA-N 3-hydroxybutanal Chemical compound CC(O)CC=O HSJKGGMUJITCBW-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000010533 azeotropic distillation Methods 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- RPFGCUFAJAQNLJ-UHFFFAOYSA-N n-phenylcyclohexanimine Chemical compound C1CCCCC1=NC1=CC=CC=C1 RPFGCUFAJAQNLJ-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 230000007306 turnover Effects 0.000 description 3
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000005882 aldol condensation reaction Methods 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- FRPHFZCDPYBUAU-UHFFFAOYSA-N Bromocresolgreen Chemical compound CC1=C(Br)C(O)=C(Br)C=C1C1(C=2C(=C(Br)C(O)=C(Br)C=2)C)C2=CC=CC=C2S(=O)(=O)O1 FRPHFZCDPYBUAU-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ZXYNGLRGFYLTQZ-UHFFFAOYSA-M [Zn]Cl Chemical compound [Zn]Cl ZXYNGLRGFYLTQZ-UHFFFAOYSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- GPEZLRMLDUYSIO-UHFFFAOYSA-L zinc;aniline;dichloride Chemical compound [Cl-].[Cl-].[Zn+2].NC1=CC=CC=C1 GPEZLRMLDUYSIO-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/02—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of compounds containing imino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2525295A DE2525295C3 (de) | 1975-06-06 | 1975-06-06 | Verfahren zur Herstellung von Azomethinen |
| IN765/CAL/76A IN145450B (https=) | 1975-06-06 | 1976-05-01 | |
| US05/685,557 US4045486A (en) | 1975-06-06 | 1976-05-12 | Process for preparing azomethines |
| GB22973/76A GB1490948A (en) | 1975-06-06 | 1976-06-03 | Process for the preparation of azomethines |
| JP51064705A JPS51149243A (en) | 1975-06-06 | 1976-06-04 | Process for manufacture of azomethine |
| FR7617117A FR2313354A1 (fr) | 1975-06-06 | 1976-06-04 | Procede de preparation d'azomethines |
| BE2055091A BE842583A (fr) | 1975-06-06 | 1976-06-04 | Procede de preparation d'azomethines |
| ES448549A ES448549A1 (es) | 1975-06-06 | 1976-06-04 | Procedimiento para la obtencion de azometinas. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2525295A DE2525295C3 (de) | 1975-06-06 | 1975-06-06 | Verfahren zur Herstellung von Azomethinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2525295A1 DE2525295A1 (de) | 1976-12-09 |
| DE2525295B2 DE2525295B2 (de) | 1979-06-13 |
| DE2525295C3 true DE2525295C3 (de) | 1980-02-14 |
Family
ID=5948469
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2525295A Expired DE2525295C3 (de) | 1975-06-06 | 1975-06-06 | Verfahren zur Herstellung von Azomethinen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4045486A (https=) |
| JP (1) | JPS51149243A (https=) |
| BE (1) | BE842583A (https=) |
| DE (1) | DE2525295C3 (https=) |
| ES (1) | ES448549A1 (https=) |
| FR (1) | FR2313354A1 (https=) |
| GB (1) | GB1490948A (https=) |
| IN (1) | IN145450B (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2901863A1 (de) * | 1979-01-18 | 1980-07-31 | Bayer Ag | Verfahren zur herstellung von schiff'schen basen durch umsetzung von aromatischen aminen mit ketonen |
| US4908479A (en) * | 1987-10-30 | 1990-03-13 | Osaka Yuki Kagaku Kogyo Kabushiki Kaisha | N-phenyl-2,2,6,6-tetrahalocyclohexaneimine |
| US5292953A (en) * | 1990-08-09 | 1994-03-08 | Bayer Aktiengesellschaft | Process for the preparation of azomethines |
| DE4025185A1 (de) * | 1990-08-09 | 1992-02-13 | Bayer Ag | Verfahren zur herstellung von azomethinen |
| DE4201605A1 (de) * | 1992-01-22 | 1993-07-29 | Bayer Ag | Verfahren zur herstellung von azomethinen |
| US6586612B2 (en) | 2001-11-16 | 2003-07-01 | Crompton Corporation | Process for the preparation of secondary and tertiary amino-functional silanes, iminoorganosilanes and/or imidoorganosilanes |
| US8076518B2 (en) | 2005-03-28 | 2011-12-13 | Albemarle Corporation | Chain extenders |
| US7964695B2 (en) * | 2005-03-28 | 2011-06-21 | Albemarle Corporation | Chain extenders |
| SG156644A1 (en) * | 2005-03-28 | 2009-11-26 | Albemarle Corp | Diimines and secondary diamines |
| US8143365B2 (en) * | 2007-01-10 | 2012-03-27 | Albemarle Corporation | Formulations for reaction injection molding and for spray systems |
| WO2015134401A1 (en) * | 2014-03-04 | 2015-09-11 | Kellogg Brown & Root Llc | Promotion of imine formation via cationic resin catalyst |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3219702A (en) * | 1961-02-02 | 1965-11-23 | Monsanto Co | Manufacture of aromatic amines by aromatization |
| BE788421A (fr) * | 1971-09-10 | 1973-01-02 | Snam Progetti | Procede de fabrication d'imines |
| US3904625A (en) * | 1974-04-08 | 1975-09-09 | Petrolite Corp | Use of ion exchange resins in preparing tetrahydropyrimidines |
-
1975
- 1975-06-06 DE DE2525295A patent/DE2525295C3/de not_active Expired
-
1976
- 1976-05-01 IN IN765/CAL/76A patent/IN145450B/en unknown
- 1976-05-12 US US05/685,557 patent/US4045486A/en not_active Expired - Lifetime
- 1976-06-03 GB GB22973/76A patent/GB1490948A/en not_active Expired
- 1976-06-04 BE BE2055091A patent/BE842583A/xx not_active IP Right Cessation
- 1976-06-04 JP JP51064705A patent/JPS51149243A/ja active Granted
- 1976-06-04 FR FR7617117A patent/FR2313354A1/fr active Granted
- 1976-06-04 ES ES448549A patent/ES448549A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES448549A1 (es) | 1977-07-01 |
| JPS51149243A (en) | 1976-12-22 |
| BE842583A (fr) | 1976-12-06 |
| IN145450B (https=) | 1978-10-14 |
| FR2313354B1 (https=) | 1980-05-16 |
| FR2313354A1 (fr) | 1976-12-31 |
| GB1490948A (en) | 1977-11-02 |
| JPS5729027B2 (https=) | 1982-06-19 |
| DE2525295A1 (de) | 1976-12-09 |
| US4045486A (en) | 1977-08-30 |
| DE2525295B2 (de) | 1979-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0242505B1 (de) | Verfahren zur Herstellung von Caprolactam | |
| DE2525295C3 (de) | Verfahren zur Herstellung von Azomethinen | |
| EP0099516A1 (de) | Verfahren zur Herstellung von Bis(aminocyclohexyl)dialkylmethanen | |
| DE2612843B2 (de) | Bis-acrylester und Bis-methacrylester, Verfahren zur Herstellung dieser Verbindungen und deren Verwendung | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| DE69317818T2 (de) | Verfahren zur Herstellung von tertiären Alkoholen | |
| DE2452912C3 (de) | Verfahren zur Herstellung von ungesättigten Dimeren von a -Methylstyrolen | |
| DE102014112363A1 (de) | Verfahren zur herstellung eines strukturdirigierenden mittels | |
| DE1210872C2 (de) | Verfahren zur Herstellung von 4, 4'-Diaminodiphenylmethanen | |
| DE1179945B (de) | Verfahren zur Herstellung von 4, 4'-Diaminodiphenylmethanen | |
| EP3016925A1 (de) | Verfahren zur herstellung von 3-heptanol aus einer mischung enthaltend 2-ehthylhexanala und 3-heptylformiat | |
| DE3026554A1 (de) | Verfahren zur herstellung von polyamingemischen mit einem hohen anteil an 4,4'-diaminodiphenylmethan | |
| DE1026524B (de) | Verfahren zur Herstellung von Polymerisaten aus Olefinen | |
| EP0128489B1 (de) | Verfahren zur Herstellung von Succinylobernsteinsäuredialkylestern | |
| EP0105143B1 (de) | Verfahren zur Herstellung von N-substituierten Carbamaten | |
| DE1927528C3 (de) | Verfahren zur herstellung von alpha- aethinylaminen | |
| DE3202687A1 (de) | Verfahren zur herstellung von methylen-bis-phenylcarbaminsaeureestern und polymethylenpolyphenylcarbaminsaeureestern | |
| DE3506473C2 (https=) | ||
| DE3883276T2 (de) | Verfahren zur Herstellung von fluorsubstituierten alicyclischen Diolen. | |
| DE69813388T2 (de) | Verfahren zur Herstellung von 2,4-Oxazolidindion | |
| DE2925176A1 (de) | Verfahren zur herstellung von beta -damascon und beta -damascenon | |
| AT225706B (de) | Verfahren zur Herstellung von Dimethallylphthalaten | |
| DE1090225B (de) | Verfahren zur Herstellung von p-Nitrodiphenylaminen | |
| DE1767621A1 (de) | Ionenaustausch-Katalysator fuer die Herstellung von Bisphenolen | |
| DE881340C (de) | Verfahren zur Herstellung von Adipinsaeuredinitril |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |