DE2523838A1 - Verfahren zur herstellung von gemischen aus butandiol-(1,4) und 2-methylpropandiol-(1,3) - Google Patents
Verfahren zur herstellung von gemischen aus butandiol-(1,4) und 2-methylpropandiol-(1,3)Info
- Publication number
- DE2523838A1 DE2523838A1 DE19752523838 DE2523838A DE2523838A1 DE 2523838 A1 DE2523838 A1 DE 2523838A1 DE 19752523838 DE19752523838 DE 19752523838 DE 2523838 A DE2523838 A DE 2523838A DE 2523838 A1 DE2523838 A1 DE 2523838A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- dioxane
- butanediol
- mpd
- vinyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 23
- 239000000203 mixture Substances 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 4
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 25
- IMBQFRVNELCSTF-UHFFFAOYSA-N 2-ethenyl-5-methyl-1,3-dioxane Chemical compound CC1COC(C=C)OC1 IMBQFRVNELCSTF-UHFFFAOYSA-N 0.000 claims description 19
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 claims description 15
- 150000001299 aldehydes Chemical class 0.000 claims description 13
- 238000005984 hydrogenation reaction Methods 0.000 claims description 12
- 238000007037 hydroformylation reaction Methods 0.000 claims description 11
- 230000007062 hydrolysis Effects 0.000 claims description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims description 8
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 7
- -1 cyclic acetal Chemical class 0.000 claims description 7
- 150000002009 diols Chemical class 0.000 claims description 7
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 6
- 150000001336 alkenes Chemical class 0.000 claims 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 11
- 239000010948 rhodium Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000003446 ligand Substances 0.000 description 9
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 9
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 9
- 229910052703 rhodium Inorganic materials 0.000 description 9
- 229910002091 carbon monoxide Inorganic materials 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052797 bismuth Inorganic materials 0.000 description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001030 gas--liquid chromatography Methods 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 235000013847 iso-butane Nutrition 0.000 description 2
- CRSOQBOWXPBRES-UHFFFAOYSA-N neopentane Chemical compound CC(C)(C)C CRSOQBOWXPBRES-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- KHJXCZWBTDKALG-UHFFFAOYSA-N (2,3-dimethylphenyl) dihydrogen phosphite Chemical compound CC1=CC=CC(OP(O)O)=C1C KHJXCZWBTDKALG-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- VHBVURHYXATORH-UHFFFAOYSA-N 2-ethenyl-4-methyl-1,3-dioxane Chemical compound CC1CCOC(C=C)O1 VHBVURHYXATORH-UHFFFAOYSA-N 0.000 description 1
- BGIDUFCVXOXJNO-UHFFFAOYSA-N 2-ethenyl-4-methyl-1,3-dioxolane Chemical compound CC1COC(C=C)O1 BGIDUFCVXOXJNO-UHFFFAOYSA-N 0.000 description 1
- QOFLTGDAZLWRMJ-UHFFFAOYSA-N 2-methylpropane-1,1-diol Chemical compound CC(C)C(O)O QOFLTGDAZLWRMJ-UHFFFAOYSA-N 0.000 description 1
- WCBCTCOZTVWARV-UHFFFAOYSA-N 2-methyltridecan-2-yl dihydrogen phosphite Chemical compound CCCCCCCCCCCC(C)(C)OP(O)O WCBCTCOZTVWARV-UHFFFAOYSA-N 0.000 description 1
- UJAMLSXZNQLCDQ-UHFFFAOYSA-N 3-methylpentan-3-yl dihydrogen phosphate Chemical compound CCC(C)(CC)OP(O)(O)=O UJAMLSXZNQLCDQ-UHFFFAOYSA-N 0.000 description 1
- OZRVAPPAMUBHOH-UHFFFAOYSA-N CCCC(C(C)=CC=C1)=C1OP(O)O Chemical compound CCCC(C(C)=CC=C1)=C1OP(O)O OZRVAPPAMUBHOH-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- XIJLBSWGPVLQBE-UHFFFAOYSA-N [Sr].[Mo] Chemical compound [Sr].[Mo] XIJLBSWGPVLQBE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- SZQABOJVTZVBHE-UHFFFAOYSA-N carbon monoxide;rhodium Chemical group [Rh].[Rh].[Rh].[Rh].[Rh].[Rh].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] SZQABOJVTZVBHE-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DKUYEPUUXLQPPX-UHFFFAOYSA-N dibismuth;molybdenum;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Mo].[Mo].[Bi+3].[Bi+3] DKUYEPUUXLQPPX-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910003450 rhodium oxide Inorganic materials 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- XTTGYFREQJCEML-UHFFFAOYSA-N tributyl phosphite Chemical compound CCCCOP(OCCCC)OCCCC XTTGYFREQJCEML-UHFFFAOYSA-N 0.000 description 1
- BWPNIANVWARHPR-UHFFFAOYSA-N tridecyl dihydrogen phosphite Chemical compound CCCCCCCCCCCCCOP(O)O BWPNIANVWARHPR-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- SJHCUXCOGGKFAI-UHFFFAOYSA-N tripropan-2-yl phosphite Chemical compound CC(C)OP(OC(C)C)OC(C)C SJHCUXCOGGKFAI-UHFFFAOYSA-N 0.000 description 1
- QOPBTFMUVTXWFF-UHFFFAOYSA-N tripropyl phosphite Chemical compound CCCOP(OCCC)OCCC QOPBTFMUVTXWFF-UHFFFAOYSA-N 0.000 description 1
- DECPGQLXYYCNEZ-UHFFFAOYSA-N tris(6-methylheptyl) phosphite Chemical compound CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C DECPGQLXYYCNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
- C07C29/141—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group with hydrogen or hydrogen-containing gases
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/32—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen
- C07C45/33—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties
- C07C45/34—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds
- C07C45/35—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds in propene or isobutene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US493740A US3929915A (en) | 1974-07-31 | 1974-07-31 | Process for the production of butanediol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2523838A1 true DE2523838A1 (de) | 1976-02-19 |
Family
ID=23961498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752523838 Withdrawn DE2523838A1 (de) | 1974-07-31 | 1975-05-30 | Verfahren zur herstellung von gemischen aus butandiol-(1,4) und 2-methylpropandiol-(1,3) |
Country Status (8)
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2401553C2 (de) * | 1974-01-14 | 1984-05-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Butandiol-1,4 |
| US4024197A (en) * | 1974-07-31 | 1977-05-17 | E. I. Du Pont De Nemours And Company | Production of butanediol |
| US4079064A (en) * | 1975-10-14 | 1978-03-14 | Celanese Corporation | Production of (1,3-dioxane)propionaldehyde derivatives |
| US4105678A (en) * | 1975-11-17 | 1978-08-08 | Celanese Corporation | Synthesis of tetrahydrofuran |
| US4052401A (en) * | 1975-12-15 | 1977-10-04 | Celanese Corporation | Production of 3-(1',3'-dioxane)-propionaldehyde compounds |
| US4003918A (en) * | 1975-12-15 | 1977-01-18 | Celanese Corporation | Production of 2-vinyl-1,3-dioxane compounds |
| US4137240A (en) * | 1976-01-31 | 1979-01-30 | E. I. Du Pont De Nemours And Company | Hydroformylation process for preparation of predominantly linear aldehydes |
| US4096192A (en) * | 1976-03-30 | 1978-06-20 | E. I. Du Pont De Nemours And Company | Process for the preparation of 2-methyl-1,3-propanediol |
| US4105677A (en) * | 1976-04-29 | 1978-08-08 | Celanese Corporation | Production of tetrahydrofuran |
| GB1581379A (en) * | 1976-12-28 | 1980-12-10 | Du Pont | Preparation of diols by hydrogenation and hyrdrolysis of cyclic acetals |
| US4091041A (en) * | 1977-06-13 | 1978-05-23 | General Electric Company | Preparation of 1,4-diols by hydrolysis-hydrogenation of 2-alkoxytetrahydrofurans |
| US4161616A (en) * | 1978-04-24 | 1979-07-17 | Celanese Corporation | Acrolein conversion to butanediol |
| US4221726A (en) * | 1978-04-24 | 1980-09-09 | Celanese Corporation | Process of making tetrahydrofuran |
| DE3068494D1 (en) * | 1979-04-11 | 1984-08-16 | Davy Mckee London | Production of tetrahydrofuran |
| US4374999A (en) * | 1981-01-02 | 1983-02-22 | The Dow Chemical Company | Internal hydroformylation of acrolein acetals |
| US4400550A (en) * | 1982-02-12 | 1983-08-23 | Albany International Corp. | Synthesis of the navel orange worm pheromone (Z,Z)-11,13-hexadecadienal |
| DE3361212D1 (en) * | 1982-06-11 | 1985-12-19 | Davy Mckee London | Hydroformylation process |
| EP0096986B1 (en) * | 1982-06-11 | 1987-04-22 | DAVY McKEE (LONDON) LIMITED | Hydroformylation process |
| US4678857A (en) * | 1986-03-31 | 1987-07-07 | Texaco Inc. | Process for separation of product resulting from hydroformylation |
| JPH07324083A (ja) * | 1994-05-30 | 1995-12-12 | Mitsubishi Chem Corp | １，４−ブタンジアールモノアセタールの製造方法 |
| US6555720B1 (en) | 2000-04-28 | 2003-04-29 | Mitsubishi Chemical Corporation | Method and system for producing 1,4-butanediol |
| JP4096511B2 (ja) * | 2000-12-18 | 2008-06-04 | 三菱化学株式会社 | 多価アルコール類の製造方法 |
| CN105541555B (zh) * | 2016-02-04 | 2020-11-17 | 天津大学 | 用于分离乙二醇、丙二醇和丁二醇的反应精馏方法及装置 |
| CN105541551B (zh) * | 2016-02-04 | 2020-11-17 | 天津大学 | 乙二醇和1,2-丁二醇的反应精馏分离精制新方法、工艺及装置 |
| CN105622338B (zh) * | 2016-02-04 | 2020-11-17 | 天津大学 | 乙二醇和1,2-丁二醇的分离方法、工艺及装置 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2987524A (en) * | 1961-06-06 | Process for preparing cyclic | ||
| US2888492A (en) * | 1955-08-08 | 1959-05-26 | Shell Dev | Production of polyols |
| US3448157A (en) * | 1965-09-27 | 1969-06-03 | Shell Oil Co | Hydroformylation of olefins |
| FR1559112A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-01-25 | 1969-03-07 | ||
| DE2401553C2 (de) * | 1974-01-14 | 1984-05-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Butandiol-1,4 |
-
1974
- 1974-07-31 US US493740A patent/US3929915A/en not_active Expired - Lifetime
-
1975
- 1975-05-30 DE DE19752523838 patent/DE2523838A1/de not_active Withdrawn
- 1975-07-28 NL NL7508978A patent/NL7508978A/xx not_active Application Discontinuation
- 1975-07-29 CA CA232,499A patent/CA1051039A/en not_active Expired
- 1975-07-30 IT IT25941/75A patent/IT1040204B/it active
- 1975-07-31 GB GB3211975A patent/GB1462342A/en not_active Expired
- 1975-07-31 BE BE158831A patent/BE831988A/xx not_active IP Right Cessation
- 1975-07-31 JP JP50092650A patent/JPS5139612A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA1051039A (en) | 1979-03-20 |
| BE831988A (fr) | 1976-02-02 |
| GB1462342A (en) | 1977-01-26 |
| US3929915A (en) | 1975-12-30 |
| NL7508978A (nl) | 1976-02-03 |
| IT1040204B (it) | 1979-12-20 |
| JPS5139612A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1976-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2523838A1 (de) | Verfahren zur herstellung von gemischen aus butandiol-(1,4) und 2-methylpropandiol-(1,3) | |
| DE69710092T2 (de) | Verfahren zur ununterbrochenen herstellung von neopentylglykol | |
| DE1957591C3 (de) | Verfahren zur Herstellung von 2,2- Dimethylpropandiol-(1,3) | |
| DE2431242C3 (de) | 2,7,10,15,18,23-Hexamethyltetracosan und Verfahren zu seiner Herstellung | |
| DE2523889A1 (de) | 2-vinyl-5-methyl-1,3-dioxan und dessen verwendung zur herstellung von diolen | |
| DE3875281T2 (de) | Herstellung von pseudoiononen. | |
| EP0009797B1 (de) | Verfahren zur gleichzeitigen Herstellung von Trioxan und cyclischen Formalen | |
| DE2513910A1 (de) | Verfahren zur herstellung von carbonsaeureestern des perillylalkohols | |
| DE2714237A1 (de) | Verfahren zur herstellung von 2- methyl-1,3-propandiol | |
| EP0322660A1 (de) | Verfahren zur Gewinnung von 2-Methylbutanal | |
| DE1804984A1 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-1,3-propandiol | |
| DE2523839A1 (de) | Cyclische acetalaldehyde und deren verwendung zur herstellung von diolen | |
| EP1216979A1 (de) | Verfahren zur Herstellung von Trimethylolverbindungen und Ameisensäure | |
| EP0193801B1 (de) | Verfahren zur kontinuierlichen Homologisierung von Methanol | |
| DE2504230A1 (de) | Verfahren zur herstellung von allylestern aus carbonsaeuren und allylalkoholen | |
| DE1173454B (de) | Verfahren zur Herstellung von N-Vinyl-carbaminsaeureestern | |
| US4024197A (en) | Production of butanediol | |
| CH624374A5 (en) | Process for preparing liquid acetals of reduced solubility in water | |
| DE2416584A1 (de) | Hexamethyltetracosan-diol derivate und verfahren zu deren herstellung | |
| DE1958463C3 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-1,3-propandiol-hy droxypivalinsäuremonoester | |
| EP0602573B1 (de) | Verfahren zur Herstellung von Acetalen | |
| DE852991C (de) | Verfahren zur Herstellung organischer sauerstoffhaltiger Verbindungen | |
| DE950850C (de) | Verfahren zur Herstellung von hydroxylgruppenhaltigen Trimethylenoxydverbindungen | |
| DE749150C (de) | Verfahren zur Herstellung von ringfoermigen Acetalen des Formaldehyds | |
| EP0229884B1 (de) | Verfahren zur Herstellung von 2,5-Dimethoxy-und 2,5-Diethoxytetrahydrofuran |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ABITZ, W., DIPL.-ING.DR.-ING. MORF, D., DR., PAT.- |
|
| 8176 | Proceedings suspended because of application no: |
Ref document number: 2401553 Country of ref document: DE Format of ref document f/p: P |
|
| 8178 | Suspension cancelled | ||
| 8139 | Disposal/non-payment of the annual fee |